Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Trifluoromethanesulfonic Acid 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 1493-13-6 Molecular Formula: CHF3O3S Molecular Weight (g/mol): 150.07 MDL Number: MFCD00007514 InChI Key: ITMCEJHCFYSIIV-UHFFFAOYSA-N Synonym: triflic acid,perfluoromethanesulfonic acid,trifluoromethanesulphonic acid,tfmsa,trifluoromethane sulfonic acid,tfoh,methanesulfonic acid, trifluoro,hotf,trifluoromethylsulfonic acid,trimsylate PubChem CID: 62406 ChEBI: CHEBI:48511 IUPAC Name: trifluoromethanesulfonic acid SMILES: OS(=O)(=O)C(F)(F)F
| PubChem CID | 62406 |
|---|---|
| CAS | 1493-13-6 |
| Molecular Weight (g/mol) | 150.07 |
| ChEBI | CHEBI:48511 |
| MDL Number | MFCD00007514 |
| SMILES | OS(=O)(=O)C(F)(F)F |
| Synonym | triflic acid,perfluoromethanesulfonic acid,trifluoromethanesulphonic acid,tfmsa,trifluoromethane sulfonic acid,tfoh,methanesulfonic acid, trifluoro,hotf,trifluoromethylsulfonic acid,trimsylate |
| IUPAC Name | trifluoromethanesulfonic acid |
| InChI Key | ITMCEJHCFYSIIV-UHFFFAOYSA-N |
| Molecular Formula | CHF3O3S |
2-Ethyl-2-(hydroxymethyl)-1,3-propanediol, 98%
CAS: 77-99-6 Molecular Formula: C6H14O3 Molecular Weight (g/mol): 134.18 MDL Number: MFCD00004694 InChI Key: ZJCCRDAZUWHFQH-UHFFFAOYSA-N Synonym: trimethylolpropane,2-ethyl-2-hydroxymethyl propane-1,3-diol,ethriol,2-ethyl-2-hydroxymethyl-1,3-propanediol,hexaglycerine,ettriol,etriol,trimethylol propane,tmp alcohol,1,1,1-tris hydroxymethyl propane PubChem CID: 6510 IUPAC Name: 2-ethyl-2-(hydroxymethyl)propane-1,3-diol SMILES: CCC(CO)(CO)CO
| PubChem CID | 6510 |
|---|---|
| CAS | 77-99-6 |
| Molecular Weight (g/mol) | 134.18 |
| MDL Number | MFCD00004694 |
| SMILES | CCC(CO)(CO)CO |
| Synonym | trimethylolpropane,2-ethyl-2-hydroxymethyl propane-1,3-diol,ethriol,2-ethyl-2-hydroxymethyl-1,3-propanediol,hexaglycerine,ettriol,etriol,trimethylol propane,tmp alcohol,1,1,1-tris hydroxymethyl propane |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | ZJCCRDAZUWHFQH-UHFFFAOYSA-N |
| Molecular Formula | C6H14O3 |
4-Hydroxy-3-methoxycinnamic acid, 99%
CAS: 1135-24-6 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00004400 InChI Key: KSEBMYQBYZTDHS-HWKANZROSA-N Synonym: ferulic acid,trans-ferulic acid,4-hydroxy-3-methoxycinnamic acid,trans-4-hydroxy-3-methoxycinnamic acid,3-4-hydroxy-3-methoxyphenyl acrylic acid,e-ferulic acid,coniferic acid,ferulate,ferulic acid, trans,2-propenoic acid, 3-4-hydroxy-3-methoxyphenyl PubChem CID: 445858 ChEBI: CHEBI:17620 IUPAC Name: (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid SMILES: COC1=C(C=CC(=C1)C=CC(=O)O)O
| PubChem CID | 445858 |
|---|---|
| CAS | 1135-24-6 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:17620 |
| MDL Number | MFCD00004400 |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)O)O |
| Synonym | ferulic acid,trans-ferulic acid,4-hydroxy-3-methoxycinnamic acid,trans-4-hydroxy-3-methoxycinnamic acid,3-4-hydroxy-3-methoxyphenyl acrylic acid,e-ferulic acid,coniferic acid,ferulate,ferulic acid, trans,2-propenoic acid, 3-4-hydroxy-3-methoxyphenyl |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| InChI Key | KSEBMYQBYZTDHS-HWKANZROSA-N |
| Molecular Formula | C10H10O4 |
Trimethyl 1,3,5-benzenetricarboxylate, 99%
CAS: 2672-58-4 Molecular Formula: C12H12O6 Molecular Weight (g/mol): 252.22 MDL Number: MFCD00008434 InChI Key: RGCHNYAILFZUPL-UHFFFAOYSA-N Synonym: trimethyl 1,3,5-benzenetricarboxylate,trimethyl trimesate,trimesic acid trimethyl ester,1,3,5-benzenetricarboxylic acid, trimethyl ester,1,3,5-benzenetricarboxylic acid trimethyl ester,trimethylbenzene-1,3,5-tricarboxylate,1,3,5-trimethyl benzene-1,3,5-tricarboxylate,methyl 3,5-bis methoxycarbonyl benzoate,benzene-1,3,5-tricarboxylic acid trimethyl ester,timtec-bb sbb007766 PubChem CID: 75881 IUPAC Name: trimethyl benzene-1,3,5-tricarboxylate SMILES: COC(=O)C1=CC(=CC(=C1)C(=O)OC)C(=O)OC
| PubChem CID | 75881 |
|---|---|
| CAS | 2672-58-4 |
| Molecular Weight (g/mol) | 252.22 |
| MDL Number | MFCD00008434 |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)OC)C(=O)OC |
| Synonym | trimethyl 1,3,5-benzenetricarboxylate,trimethyl trimesate,trimesic acid trimethyl ester,1,3,5-benzenetricarboxylic acid, trimethyl ester,1,3,5-benzenetricarboxylic acid trimethyl ester,trimethylbenzene-1,3,5-tricarboxylate,1,3,5-trimethyl benzene-1,3,5-tricarboxylate,methyl 3,5-bis methoxycarbonyl benzoate,benzene-1,3,5-tricarboxylic acid trimethyl ester,timtec-bb sbb007766 |
| IUPAC Name | trimethyl benzene-1,3,5-tricarboxylate |
| InChI Key | RGCHNYAILFZUPL-UHFFFAOYSA-N |
| Molecular Formula | C12H12O6 |
4-Methylbenzyl alcohol, 98%
CAS: 589-18-4 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.17 MDL Number: MFCD00004664 InChI Key: KMTDMTZBNYGUNX-UHFFFAOYSA-N Synonym: 4-methylbenzyl alcohol,p-tolylmethanol,p-tolylcarbinol,4-methylphenyl methanol,4-tolylcarbinol,p-methylbenzyl alcohol,benzenemethanol, 4-methyl,4-hydroxymethyl toluene,benzyl alcohol, p-methyl,4-methylbenzenemethanol PubChem CID: 11505 ChEBI: CHEBI:1895 IUPAC Name: (4-methylphenyl)methanol SMILES: CC1=CC=C(C=C1)CO
| PubChem CID | 11505 |
|---|---|
| CAS | 589-18-4 |
| Molecular Weight (g/mol) | 122.17 |
| ChEBI | CHEBI:1895 |
| MDL Number | MFCD00004664 |
| SMILES | CC1=CC=C(C=C1)CO |
| Synonym | 4-methylbenzyl alcohol,p-tolylmethanol,p-tolylcarbinol,4-methylphenyl methanol,4-tolylcarbinol,p-methylbenzyl alcohol,benzenemethanol, 4-methyl,4-hydroxymethyl toluene,benzyl alcohol, p-methyl,4-methylbenzenemethanol |
| IUPAC Name | (4-methylphenyl)methanol |
| InChI Key | KMTDMTZBNYGUNX-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
2-Methyl-1,3-cyclohexanedione, 98+%
CAS: 1193-55-1 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00001587 InChI Key: VSGJHHIAMHUZKF-UHFFFAOYSA-N Synonym: 2-methyl-1,3-cyclohexanedione,1,3-cyclohexanedione, 2-methyl,1,3-dimethylcycloadipic ketone,2-methyl-1,3-cyclohexandione,1-methyl-2,6-cyclohexanedione,ghl.pd_mitscher_leg0.98,2-methylcyclohexan-1,3-dion,2-methyl-cyclohexane-1,3-dione,pubchem15384,acmc-209a2g PubChem CID: 70945 IUPAC Name: 2-methylcyclohexane-1,3-dione SMILES: CC1C(=O)CCCC1=O
| PubChem CID | 70945 |
|---|---|
| CAS | 1193-55-1 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD00001587 |
| SMILES | CC1C(=O)CCCC1=O |
| Synonym | 2-methyl-1,3-cyclohexanedione,1,3-cyclohexanedione, 2-methyl,1,3-dimethylcycloadipic ketone,2-methyl-1,3-cyclohexandione,1-methyl-2,6-cyclohexanedione,ghl.pd_mitscher_leg0.98,2-methylcyclohexan-1,3-dion,2-methyl-cyclohexane-1,3-dione,pubchem15384,acmc-209a2g |
| IUPAC Name | 2-methylcyclohexane-1,3-dione |
| InChI Key | VSGJHHIAMHUZKF-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
4-Nitrophenylacetic acid, 99%
CAS: 104-03-0 Molecular Formula: C8H7NO4 Molecular Weight (g/mol): 181.15 MDL Number: MFCD00007383 InChI Key: YBADLXQNJCMBKR-UHFFFAOYSA-N Synonym: 4-nitrophenylacetic acid,2-4-nitrophenyl acetic acid,p-nitrophenylacetic acid,4-nitrophenyl acetic acid,4-nitrobenzeneacetic acid,benzeneacetic acid, 4-nitro,2-p-nitrophenyl acetic acid,4-nitrophenylacetate,4-nitrophenylaceticacid,acetic acid, p-nitrophenyl PubChem CID: 4661 ChEBI: CHEBI:40443 SMILES: C1=CC(=CC=C1CC(=O)O)[N+](=O)[O-]
| PubChem CID | 4661 |
|---|---|
| CAS | 104-03-0 |
| Molecular Weight (g/mol) | 181.15 |
| ChEBI | CHEBI:40443 |
| MDL Number | MFCD00007383 |
| SMILES | C1=CC(=CC=C1CC(=O)O)[N+](=O)[O-] |
| Synonym | 4-nitrophenylacetic acid,2-4-nitrophenyl acetic acid,p-nitrophenylacetic acid,4-nitrophenyl acetic acid,4-nitrobenzeneacetic acid,benzeneacetic acid, 4-nitro,2-p-nitrophenyl acetic acid,4-nitrophenylacetate,4-nitrophenylaceticacid,acetic acid, p-nitrophenyl |
| InChI Key | YBADLXQNJCMBKR-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO4 |
Thermo Scientific Chemicals Roxithromycin, 96%
CAS: 80214-83-1 Molecular Formula: C41H76N2O15 Molecular Weight (g/mol): 837.06 MDL Number: MFCD00214389 InChI Key: RXZBMPWDPOLZGW-KMAKEOJNSA-N Synonym: roxithromycin PubChem CID: 133687104 IUPAC Name: (3S,5R,6S,7S,9S,10E,11R,12S,13R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-(5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl)oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one SMILES: CC[C@H]1OC(=O)[C@H](C)[C@@H](OC2CC(C)(OC)C(O)C(C)O2)[C@H](C)[C@@H](OC2OC(C)CC(C2O)N(C)C)[C@](C)(O)C[C@@H](C)\C(=N/OCOCCOC)[C@H](C)[C@@H](O)[C@]1(C)O
| PubChem CID | 133687104 |
|---|---|
| CAS | 80214-83-1 |
| Molecular Weight (g/mol) | 837.06 |
| MDL Number | MFCD00214389 |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](OC2CC(C)(OC)C(O)C(C)O2)[C@H](C)[C@@H](OC2OC(C)CC(C2O)N(C)C)[C@](C)(O)C[C@@H](C)\C(=N/OCOCCOC)[C@H](C)[C@@H](O)[C@]1(C)O |
| Synonym | roxithromycin |
| IUPAC Name | (3S,5R,6S,7S,9S,10E,11R,12S,13R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-(5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl)oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
| InChI Key | RXZBMPWDPOLZGW-KMAKEOJNSA-N |
| Molecular Formula | C41H76N2O15 |
Thermo Scientific Chemicals Cellulose triacetate
CAS: 9012-09-3 Molecular Formula: (C24H32O16)n MDL Number: MFCD00132680
| CAS | 9012-09-3 |
|---|---|
| MDL Number | MFCD00132680 |
| Molecular Formula | (C24H32O16)n |
Thermo Scientific Chemicals D(-)-Isoascorbic acid, 98%
CAS: 89-65-6 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 MDL Number: MFCD00005378 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: erythorbic acid,isoascorbic acid,d-araboascorbic acid,d-isoascorbic acid,araboascorbic acid,d-erythorbic acid,isovitamin c,neo-cebicure,saccharosonic acid,mercate 5 PubChem CID: 54675810 ChEBI: CHEBI:51438 IUPAC Name: (2R)-2-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| PubChem CID | 54675810 |
|---|---|
| CAS | 89-65-6 |
| Molecular Weight (g/mol) | 198.11 |
| ChEBI | CHEBI:51438 |
| MDL Number | MFCD00005378 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | erythorbic acid,isoascorbic acid,d-araboascorbic acid,d-isoascorbic acid,araboascorbic acid,d-erythorbic acid,isovitamin c,neo-cebicure,saccharosonic acid,mercate 5 |
| IUPAC Name | (2R)-2-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
5-Bromo-6-chloro-2-picoline, 98+%, Thermo Scientific Chemicals
CAS: 185017-72-5 Molecular Formula: C6H5BrClN Molecular Weight (g/mol): 206.47 MDL Number: MFCD03095218 InChI Key: JVDQYSIJBRTRMS-UHFFFAOYSA-N Synonym: 3-bromo-2-chloro-6-picoline,5-bromo-6-chloro-2-picoline,2-chloro-3-bromo-6-methylpyridine,5-bromo-6-chloro-2-methylpyridine,pyridine, 3-bromo-2-chloro-6-methyl,3-bromo-2-chloro-6-methyl-pyridine,pubchem1286,acmc-209emg,ksc538q8t,3-bromo-2-chloro-6 picoline PubChem CID: 2734418 IUPAC Name: 3-bromo-2-chloro-6-methylpyridine SMILES: CC1=CC=C(Br)C(Cl)=N1
| PubChem CID | 2734418 |
|---|---|
| CAS | 185017-72-5 |
| Molecular Weight (g/mol) | 206.47 |
| MDL Number | MFCD03095218 |
| SMILES | CC1=CC=C(Br)C(Cl)=N1 |
| Synonym | 3-bromo-2-chloro-6-picoline,5-bromo-6-chloro-2-picoline,2-chloro-3-bromo-6-methylpyridine,5-bromo-6-chloro-2-methylpyridine,pyridine, 3-bromo-2-chloro-6-methyl,3-bromo-2-chloro-6-methyl-pyridine,pubchem1286,acmc-209emg,ksc538q8t,3-bromo-2-chloro-6 picoline |
| IUPAC Name | 3-bromo-2-chloro-6-methylpyridine |
| InChI Key | JVDQYSIJBRTRMS-UHFFFAOYSA-N |
| Molecular Formula | C6H5BrClN |
4-tert-Butylbenzoyl chloride, 98%
CAS: 1710-98-1 Molecular Formula: C11H13ClO Molecular Weight (g/mol): 196.67 MDL Number: MFCD00000695 InChI Key: WNLMYNASWOULQY-UHFFFAOYSA-N PubChem CID: 74372 IUPAC Name: 4-tert-butylbenzoyl chloride SMILES: CC(C)(C)C1=CC=C(C=C1)C(Cl)=O
| PubChem CID | 74372 |
|---|---|
| CAS | 1710-98-1 |
| Molecular Weight (g/mol) | 196.67 |
| MDL Number | MFCD00000695 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(Cl)=O |
| IUPAC Name | 4-tert-butylbenzoyl chloride |
| InChI Key | WNLMYNASWOULQY-UHFFFAOYSA-N |
| Molecular Formula | C11H13ClO |
Polyethylene glycol 6,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Diphenylmethane, 99%
CAS: 101-81-5 Molecular Formula: C13H12 Molecular Weight (g/mol): 168.24 MDL Number: MFCD00004781 InChI Key: CZZYITDELCSZES-UHFFFAOYSA-N Synonym: diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene PubChem CID: 7580 ChEBI: CHEBI:38884 IUPAC Name: benzylbenzene SMILES: C(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 7580 |
|---|---|
| CAS | 101-81-5 |
| Molecular Weight (g/mol) | 168.24 |
| ChEBI | CHEBI:38884 |
| MDL Number | MFCD00004781 |
| SMILES | C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene |
| IUPAC Name | benzylbenzene |
| InChI Key | CZZYITDELCSZES-UHFFFAOYSA-N |
| Molecular Formula | C13H12 |
2-Bromobenzyl alcohol, 98%
CAS: 18982-54-2 Molecular Formula: C7H7BrO Molecular Weight (g/mol): 187.04 MDL Number: MFCD00004600 InChI Key: IOWGHQGLUMEZKG-UHFFFAOYSA-N Synonym: 2-bromobenzyl alcohol,2-bromophenyl methanol,o-bromobenzyl alcohol,benzenemethanol, 2-bromo,o-bromo-benzyl alcohol,2-bromobenzylalcohol,2-bromophenyl methan-1-ol,o-bromobenzylalcohol,2-bromo-benzylalcohol,pubchem3746 PubChem CID: 72850 IUPAC Name: (2-bromophenyl)methanol SMILES: OCC1=CC=CC=C1Br
| PubChem CID | 72850 |
|---|---|
| CAS | 18982-54-2 |
| Molecular Weight (g/mol) | 187.04 |
| MDL Number | MFCD00004600 |
| SMILES | OCC1=CC=CC=C1Br |
| Synonym | 2-bromobenzyl alcohol,2-bromophenyl methanol,o-bromobenzyl alcohol,benzenemethanol, 2-bromo,o-bromo-benzyl alcohol,2-bromobenzylalcohol,2-bromophenyl methan-1-ol,o-bromobenzylalcohol,2-bromo-benzylalcohol,pubchem3746 |
| IUPAC Name | (2-bromophenyl)methanol |
| InChI Key | IOWGHQGLUMEZKG-UHFFFAOYSA-N |
| Molecular Formula | C7H7BrO |