Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Choline bitartrate, 97%
CAS: 87-67-2 Molecular Formula: C5H14NO·C4H5O6 Molecular Weight (g/mol): 253.25 InChI Key: QWJSAWXRUVVRLH-UHFFFAOYSA-M Synonym: choline bitartrate,cholini bitartras,choline 3-carboxy-2,3-dihydroxypropanoate,2-hydroxyethyl trimethylammonium bitartrate,choline tartrate 1:1,2-hydroxy-n,n,n-trimethylethanaminium 3-carboxy-2,3-dihydroxypropanoate,cholinibitatratis,choline hydrogen l-+-tartrate,ethanaminium, 2-hydroxy-n,n,n-trimethyl-, 2r,3r-2,3-dihydroxybutanedioate 1:1 PubChem CID: 10198924 IUPAC Name: 2-hydroxyethyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate SMILES: C[N+](C)(C)CCO.C(C(C(=O)[O-])O)(C(=O)O)O
| PubChem CID | 10198924 |
|---|---|
| CAS | 87-67-2 |
| Molecular Weight (g/mol) | 253.25 |
| SMILES | C[N+](C)(C)CCO.C(C(C(=O)[O-])O)(C(=O)O)O |
| Synonym | choline bitartrate,cholini bitartras,choline 3-carboxy-2,3-dihydroxypropanoate,2-hydroxyethyl trimethylammonium bitartrate,choline tartrate 1:1,2-hydroxy-n,n,n-trimethylethanaminium 3-carboxy-2,3-dihydroxypropanoate,cholinibitatratis,choline hydrogen l-+-tartrate,ethanaminium, 2-hydroxy-n,n,n-trimethyl-, 2r,3r-2,3-dihydroxybutanedioate 1:1 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate |
| InChI Key | QWJSAWXRUVVRLH-UHFFFAOYSA-M |
| Molecular Formula | C5H14NO·C4H5O6 |
2-Butoxyethyl acetate, 98%
CAS: 112-07-2 Molecular Formula: C8H16O3 Molecular Weight (g/mol): 160.21 MDL Number: MFCD00009457 InChI Key: NQBXSWAWVZHKBZ-UHFFFAOYSA-N Synonym: butoxyethyl acetate,butyl glycol acetate,butylglycol acetate,ethylene glycol monobutyl ether acetate,2-butoxyethanol acetate,butyl cellosolve acetate,ektasolve eb acetate,ethanol, 2-butoxy-, acetate,butylcelosolvacetat,1-acetoxy-2-butoxyethane PubChem CID: 8160 IUPAC Name: 2-butoxyethyl acetate SMILES: CCCCOCCOC(C)=O
| PubChem CID | 8160 |
|---|---|
| CAS | 112-07-2 |
| Molecular Weight (g/mol) | 160.21 |
| MDL Number | MFCD00009457 |
| SMILES | CCCCOCCOC(C)=O |
| Synonym | butoxyethyl acetate,butyl glycol acetate,butylglycol acetate,ethylene glycol monobutyl ether acetate,2-butoxyethanol acetate,butyl cellosolve acetate,ektasolve eb acetate,ethanol, 2-butoxy-, acetate,butylcelosolvacetat,1-acetoxy-2-butoxyethane |
| IUPAC Name | 2-butoxyethyl acetate |
| InChI Key | NQBXSWAWVZHKBZ-UHFFFAOYSA-N |
| Molecular Formula | C8H16O3 |
Chlorhexidine digluconate, 20% w/v aq. soln., non-sterile
CAS: 18472-51-0 Molecular Formula: C34H54Cl2N10O14 Molecular Weight (g/mol): 897.76 MDL Number: MFCD00083599 InChI Key: YZIYKJHYYHPJIB-UUPCJSQJSA-N Synonym: peridex,periogard,chlorhexidine gluconate,1,1'-hexamethylene bis 5-p-chlorophenyl biguanide di-d-gluconate PubChem CID: 60148207 IUPAC Name: (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;sulfane SMILES: OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O.NC(NC1=CC=C(Cl)C=C1)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1
| PubChem CID | 60148207 |
|---|---|
| CAS | 18472-51-0 |
| Molecular Weight (g/mol) | 897.76 |
| MDL Number | MFCD00083599 |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O.NC(NC1=CC=C(Cl)C=C1)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 |
| Synonym | peridex,periogard,chlorhexidine gluconate,1,1'-hexamethylene bis 5-p-chlorophenyl biguanide di-d-gluconate |
| IUPAC Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;sulfane |
| InChI Key | YZIYKJHYYHPJIB-UUPCJSQJSA-N |
| Molecular Formula | C34H54Cl2N10O14 |
URIDINE-5'-DIPHOSPHATE, MP Biomedicals
CAS: 58-98-0 Molecular Formula: C9H14N2O12P2 Molecular Weight (g/mol): 404.16 InChI Key: XCCTYIAWTASOJW-UHFFFAOYNA-N Synonym: uridine 5'-diphosphate,uridine diphosphate,uridine 5'-trihydrogen diphosphate,udp,uridine-5'-diphosphate,unii-5g0f599a1y,5'-udp,uridine 5'-pyrophosphate,uridine 5'-pyrophosphoric acid,uridine-diphosphate PubChem CID: 6031 ChEBI: CHEBI:17659
| PubChem CID | 6031 |
|---|---|
| CAS | 58-98-0 |
| Molecular Weight (g/mol) | 404.16 |
| ChEBI | CHEBI:17659 |
| Synonym | uridine 5'-diphosphate,uridine diphosphate,uridine 5'-trihydrogen diphosphate,udp,uridine-5'-diphosphate,unii-5g0f599a1y,5'-udp,uridine 5'-pyrophosphate,uridine 5'-pyrophosphoric acid,uridine-diphosphate |
| InChI Key | XCCTYIAWTASOJW-UHFFFAOYNA-N |
| Molecular Formula | C9H14N2O12P2 |
Diphenylamine, 98+%
CAS: 122-39-4 Molecular Formula: C12H11N Molecular Weight (g/mol): 169.227 MDL Number: MFCD00003014 InChI Key: DMBHHRLKUKUOEG-UHFFFAOYSA-N Synonym: diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald PubChem CID: 11487 ChEBI: CHEBI:4640 IUPAC Name: N-phenylaniline SMILES: C1=CC=C(C=C1)NC2=CC=CC=C2
| PubChem CID | 11487 |
|---|---|
| CAS | 122-39-4 |
| Molecular Weight (g/mol) | 169.227 |
| ChEBI | CHEBI:4640 |
| MDL Number | MFCD00003014 |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
| Synonym | diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald |
| IUPAC Name | N-phenylaniline |
| InChI Key | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Molecular Formula | C12H11N |
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Phenylsilane, 97+%
CAS: 694-53-1 Molecular Formula: C6H8Si Molecular Weight (g/mol): 108.22 InChI Key: XJWOWXZSFTXJEX-UHFFFAOYSA-N Synonym: phenylsilane,benzene, silyl,silylbenzene,silane, phenyl,fenylsilan,fenylsilan czech,phenylsilane, silyl,silane, phenyl-, PubChem CID: 6327628 IUPAC Name: phenylsilicon SMILES: C1=CC=C(C=C1)[Si]
| PubChem CID | 6327628 |
|---|---|
| CAS | 694-53-1 |
| Molecular Weight (g/mol) | 108.22 |
| SMILES | C1=CC=C(C=C1)[Si] |
| Synonym | phenylsilane,benzene, silyl,silylbenzene,silane, phenyl,fenylsilan,fenylsilan czech,phenylsilane, silyl,silane, phenyl-, |
| IUPAC Name | phenylsilicon |
| InChI Key | XJWOWXZSFTXJEX-UHFFFAOYSA-N |
| Molecular Formula | C6H8Si |
1H-Benzotriazole, 99%
CAS: 95-14-7 Molecular Formula: C6H5N3 Molecular Weight (g/mol): 119.127 MDL Number: MFCD00005699 InChI Key: QRUDEWIWKLJBPS-UHFFFAOYSA-N Synonym: 1h-benzotriazole,benzotriazole,1,2,3-benzotriazole,1h-benzo d 1,2,3 triazole,azimidobenzene,1h-1,2,3-benzotriazole,aziminobenzene,benztriazole,benzene azimide,benzisotriazole PubChem CID: 7220 ChEBI: CHEBI:75331 IUPAC Name: 2H-benzotriazole SMILES: C1=CC2=NNN=C2C=C1
| PubChem CID | 7220 |
|---|---|
| CAS | 95-14-7 |
| Molecular Weight (g/mol) | 119.127 |
| ChEBI | CHEBI:75331 |
| MDL Number | MFCD00005699 |
| SMILES | C1=CC2=NNN=C2C=C1 |
| Synonym | 1h-benzotriazole,benzotriazole,1,2,3-benzotriazole,1h-benzo d 1,2,3 triazole,azimidobenzene,1h-1,2,3-benzotriazole,aziminobenzene,benztriazole,benzene azimide,benzisotriazole |
| IUPAC Name | 2H-benzotriazole |
| InChI Key | QRUDEWIWKLJBPS-UHFFFAOYSA-N |
| Molecular Formula | C6H5N3 |
(1-Hexadecyl)trimethylammonium bromide, 98%
CAS: 57-09-0 Molecular Formula: C19H42BrN Molecular Weight (g/mol): 364.46 MDL Number: MFCD00011772 InChI Key: LZZYPRNAOMGNLH-UHFFFAOYSA-M Synonym: cetrimonium bromide,cetyltrimethylammonium bromide,hexadecyltrimethylammonium bromide,ctab,centimide,cetab,bromat,ctmab,cee dee,cetavlon PubChem CID: 5974 ChEBI: CHEBI:3567 SMILES: [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C
| PubChem CID | 5974 |
|---|---|
| CAS | 57-09-0 |
| Molecular Weight (g/mol) | 364.46 |
| ChEBI | CHEBI:3567 |
| MDL Number | MFCD00011772 |
| SMILES | [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C |
| Synonym | cetrimonium bromide,cetyltrimethylammonium bromide,hexadecyltrimethylammonium bromide,ctab,centimide,cetab,bromat,ctmab,cee dee,cetavlon |
| InChI Key | LZZYPRNAOMGNLH-UHFFFAOYSA-M |
| Molecular Formula | C19H42BrN |
Zinc acetate, anhydrous, 99.9+%
CAS: 557-34-6 Molecular Formula: C4H6O4Zn Molecular Weight (g/mol): 183.468 MDL Number: MFCD00012454 InChI Key: DJWUNCQRNNEAKC-UHFFFAOYSA-L Synonym: zinc acetate,zinc diacetate,zinc ii acetate,acetic acid, zinc salt,dicarbomethoxyzinc,acetic acid, zinc ii salt,zinc di acetate,galzin,zinc acetate anhydrous,siltex cl 4 PubChem CID: 11192 ChEBI: CHEBI:62984 IUPAC Name: zinc;diacetate SMILES: CC(=O)[O-].CC(=O)[O-].[Zn+2]
| PubChem CID | 11192 |
|---|---|
| CAS | 557-34-6 |
| Molecular Weight (g/mol) | 183.468 |
| ChEBI | CHEBI:62984 |
| MDL Number | MFCD00012454 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Zn+2] |
| Synonym | zinc acetate,zinc diacetate,zinc ii acetate,acetic acid, zinc salt,dicarbomethoxyzinc,acetic acid, zinc ii salt,zinc di acetate,galzin,zinc acetate anhydrous,siltex cl 4 |
| IUPAC Name | zinc;diacetate |
| InChI Key | DJWUNCQRNNEAKC-UHFFFAOYSA-L |
| Molecular Formula | C4H6O4Zn |
Propiophenone, 99%
CAS: 93-55-0 Molecular Formula: C9H10O Molecular Weight (g/mol): 134.178 MDL Number: MFCD00009309 InChI Key: KRIOVPPHQSLHCZ-UHFFFAOYSA-N Synonym: propiophenone,ethyl phenyl ketone,propionylbenzene,1-phenyl-1-propanone,1-propanone, 1-phenyl,phenyl ethyl ketone,ketone, ethyl phenyl,propionphenone,usaf ek-1235,1-phenyl-propan-1-one PubChem CID: 7148 ChEBI: CHEBI:425902 IUPAC Name: 1-phenylpropan-1-one SMILES: CCC(=O)C1=CC=CC=C1
| PubChem CID | 7148 |
|---|---|
| CAS | 93-55-0 |
| Molecular Weight (g/mol) | 134.178 |
| ChEBI | CHEBI:425902 |
| MDL Number | MFCD00009309 |
| SMILES | CCC(=O)C1=CC=CC=C1 |
| Synonym | propiophenone,ethyl phenyl ketone,propionylbenzene,1-phenyl-1-propanone,1-propanone, 1-phenyl,phenyl ethyl ketone,ketone, ethyl phenyl,propionphenone,usaf ek-1235,1-phenyl-propan-1-one |
| IUPAC Name | 1-phenylpropan-1-one |
| InChI Key | KRIOVPPHQSLHCZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O |
Thermo Scientific Chemicals Fluorescein diacetate, 97%, pure
CAS: 596-09-8 Molecular Formula: C24H16O7 Molecular Weight (g/mol): 416.39 MDL Number: MFCD00005062 InChI Key: CHADEQDQBURGHL-UHFFFAOYSA-N Synonym: fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate PubChem CID: 65047 IUPAC Name: (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate SMILES: CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3
| PubChem CID | 65047 |
|---|---|
| CAS | 596-09-8 |
| Molecular Weight (g/mol) | 416.39 |
| MDL Number | MFCD00005062 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
| Synonym | fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate |
| IUPAC Name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChI Key | CHADEQDQBURGHL-UHFFFAOYSA-N |
| Molecular Formula | C24H16O7 |
Dextran 40 (Mw.=ca. 40,000), TCI America™
CAS: 9004-54-0 Molecular Formula: (C6H9O5)n(C6H10O5)m Molecular Weight (g/mol): 504.44 MDL Number: MFCD00130935 InChI Key: FZWBNHMXJMCXLU-UHFFFAOYNA-N Synonym: dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal PubChem CID: 4125253 IUPAC Name: Dextran SMILES: O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O
| PubChem CID | 4125253 |
|---|---|
| CAS | 9004-54-0 |
| Molecular Weight (g/mol) | 504.44 |
| MDL Number | MFCD00130935 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O |
| Synonym | dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal |
| IUPAC Name | Dextran |
| InChI Key | FZWBNHMXJMCXLU-UHFFFAOYNA-N |
| Molecular Formula | (C6H9O5)n(C6H10O5)m |
Tetrafluoroboric acid-diethyl ether complex, 50-55% w/w HBF4
CAS: 67969-82-8 Molecular Formula: C4H11BF4O Molecular Weight (g/mol): 161.935 MDL Number: MFCD00011345 InChI Key: XFHGDBFMJCLEOW-UHFFFAOYSA-N Synonym: fluoroboric acid diethyl ether complex,tetrafluoroboric acid diethyl ether complex,hbf4.oet2,fluoroboric acid diethylether complex,boron trifluoride diethyl ether hydrofluoride PubChem CID: 11344169 IUPAC Name: ethoxyethane;trifluoroborane;hydrofluoride SMILES: B(F)(F)F.CCOCC.F
| PubChem CID | 11344169 |
|---|---|
| CAS | 67969-82-8 |
| Molecular Weight (g/mol) | 161.935 |
| MDL Number | MFCD00011345 |
| SMILES | B(F)(F)F.CCOCC.F |
| Synonym | fluoroboric acid diethyl ether complex,tetrafluoroboric acid diethyl ether complex,hbf4.oet2,fluoroboric acid diethylether complex,boron trifluoride diethyl ether hydrofluoride |
| IUPAC Name | ethoxyethane;trifluoroborane;hydrofluoride |
| InChI Key | XFHGDBFMJCLEOW-UHFFFAOYSA-N |
| Molecular Formula | C4H11BF4O |
Tetrasodium Ethylenediaminetetraacetate Tetrahydrate 98.0+%, TCI America™
CAS: 13235-36-4 Molecular Formula: C10H20N2Na4O12 Molecular Weight (g/mol): 452.23 MDL Number: MFCD00150027 InChI Key: XFLNVMPCPRLYBE-UHFFFAOYSA-J Synonym: tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 PubChem CID: 23287279 IUPAC Name: tetrasodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate tetrahydrate SMILES: O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 23287279 |
|---|---|
| CAS | 13235-36-4 |
| Molecular Weight (g/mol) | 452.23 |
| MDL Number | MFCD00150027 |
| SMILES | O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 |
| IUPAC Name | tetrasodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate tetrahydrate |
| InChI Key | XFLNVMPCPRLYBE-UHFFFAOYSA-J |
| Molecular Formula | C10H20N2Na4O12 |