Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
3-Sulfolene, 98%
CAS: 77-79-2 Molecular Formula: C4H6O2S Molecular Weight (g/mol): 118.15 MDL Number: MFCD00005481 InChI Key: MBDNRNMVTZADMQ-UHFFFAOYSA-N Synonym: 3-sulfolene,butadiene sulfone,sulfolene,thiophene, 2,5-dihydro-, 1,1-dioxide,beta-sulfolene,2,5-dihydrothiophene sulfone,2,5-dihydrothiophene dioxide,2,5-dihydrothiophene-1,1-dioxide,sulfol-3-ene,ccris 569 PubChem CID: 6498 IUPAC Name: 2,5-dihydrothiophene 1,1-dioxide SMILES: C1C=CCS1(=O)=O
| PubChem CID | 6498 |
|---|---|
| CAS | 77-79-2 |
| Molecular Weight (g/mol) | 118.15 |
| MDL Number | MFCD00005481 |
| SMILES | C1C=CCS1(=O)=O |
| Synonym | 3-sulfolene,butadiene sulfone,sulfolene,thiophene, 2,5-dihydro-, 1,1-dioxide,beta-sulfolene,2,5-dihydrothiophene sulfone,2,5-dihydrothiophene dioxide,2,5-dihydrothiophene-1,1-dioxide,sulfol-3-ene,ccris 569 |
| IUPAC Name | 2,5-dihydrothiophene 1,1-dioxide |
| InChI Key | MBDNRNMVTZADMQ-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2S |
1,10-Phenanthroline-5,6-dione, 98%
CAS: 27318-90-7 Molecular Formula: C12H6N2O2 Molecular Weight (g/mol): 210.19 MDL Number: MFCD00014473 InChI Key: KCALAFIVPCAXJI-UHFFFAOYSA-N Synonym: 1,10 phenanthroline-5,6-dione,1 10-phenanthroline-5 6-dione 97,pyridino 3,2-h quinoline-5,6-dione,phen-5,6-dione,pubchem16755,acmc-209gwd,d0jh7c,phox31,ksc204s8l,1,2-dione-based compound, 17 PubChem CID: 72810 IUPAC Name: 1,10-phenanthroline-5,6-dione SMILES: O=C1C(=O)C2=CC=CN=C2C2=NC=CC=C12
| PubChem CID | 72810 |
|---|---|
| CAS | 27318-90-7 |
| Molecular Weight (g/mol) | 210.19 |
| MDL Number | MFCD00014473 |
| SMILES | O=C1C(=O)C2=CC=CN=C2C2=NC=CC=C12 |
| Synonym | 1,10 phenanthroline-5,6-dione,1 10-phenanthroline-5 6-dione 97,pyridino 3,2-h quinoline-5,6-dione,phen-5,6-dione,pubchem16755,acmc-209gwd,d0jh7c,phox31,ksc204s8l,1,2-dione-based compound, 17 |
| IUPAC Name | 1,10-phenanthroline-5,6-dione |
| InChI Key | KCALAFIVPCAXJI-UHFFFAOYSA-N |
| Molecular Formula | C12H6N2O2 |
Diethanolamine, ACS reagent
CAS: 111-42-2 Molecular Formula: C4H11NO2 Molecular Weight (g/mol): 105.14 MDL Number: MFCD00002843 InChI Key: ZBCBWPMODOFKDW-UHFFFAOYSA-N Synonym: diethanolamine,2,2'-iminodiethanol,diolamine,iminodiethanol,bis 2-hydroxyethyl amine,diethylolamine,n,n-diethanolamine,diethanolamin,2,2'-dihydroxydiethylamine,ethanol, 2,2'-iminobis PubChem CID: 8113 ChEBI: CHEBI:28123 IUPAC Name: 2-(2-hydroxyethylamino)ethanol SMILES: OCCNCCO
| PubChem CID | 8113 |
|---|---|
| CAS | 111-42-2 |
| Molecular Weight (g/mol) | 105.14 |
| ChEBI | CHEBI:28123 |
| MDL Number | MFCD00002843 |
| SMILES | OCCNCCO |
| Synonym | diethanolamine,2,2'-iminodiethanol,diolamine,iminodiethanol,bis 2-hydroxyethyl amine,diethylolamine,n,n-diethanolamine,diethanolamin,2,2'-dihydroxydiethylamine,ethanol, 2,2'-iminobis |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol |
| InChI Key | ZBCBWPMODOFKDW-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO2 |
N-Ethylmaleimide, 99+%
CAS: 128-53-0 Molecular Formula: C6H7NO2 Molecular Weight (g/mol): 125.127 MDL Number: MFCD00005509 InChI Key: HDFGOPSGAURCEO-UHFFFAOYSA-N Synonym: n-ethylmaleimide,ethylmaleimide,1-ethyl-1h-pyrrole-2,5-dione,maleimide, n-ethyl,1h-pyrrole-2,5-dione, 1-ethyl,maleic acid n-ethylimide,nem,usaf b-121,unii-o3c74acm9v,maleic acid-n-ethylimide PubChem CID: 4362 ChEBI: CHEBI:44485 IUPAC Name: 1-ethylpyrrole-2,5-dione SMILES: CCN1C(=O)C=CC1=O
| PubChem CID | 4362 |
|---|---|
| CAS | 128-53-0 |
| Molecular Weight (g/mol) | 125.127 |
| ChEBI | CHEBI:44485 |
| MDL Number | MFCD00005509 |
| SMILES | CCN1C(=O)C=CC1=O |
| Synonym | n-ethylmaleimide,ethylmaleimide,1-ethyl-1h-pyrrole-2,5-dione,maleimide, n-ethyl,1h-pyrrole-2,5-dione, 1-ethyl,maleic acid n-ethylimide,nem,usaf b-121,unii-o3c74acm9v,maleic acid-n-ethylimide |
| IUPAC Name | 1-ethylpyrrole-2,5-dione |
| InChI Key | HDFGOPSGAURCEO-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO2 |
Guanidine hydrochloride, 99.5%, without anticaking agent
CAS: 50-01-1 Molecular Formula: CH5N3·HCl Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH5N3·HCl |
4-Hydroxy-4'-nitrostilbene, 98%
CAS: 19221-08-0 Molecular Formula: C14H11NO3 Molecular Weight (g/mol): 241.246 MDL Number: MFCD00017044 InChI Key: OETQWIHJPIESQB-OWOJBTEDSA-N Synonym: 4-hydroxy-4'-nitrostilbene,4-4-nitrostyryl phenol,4-e-2-4-nitrophenyl ethenyl phenol,4-hydroxy-4/'-nitrostilbene,4-1e-2-4-nitrophenyl vinyl phenol,4'-nitrostilben-4-ol,cambridge id 5309411,e-4'-nitrostilbene-4-ol,e-4-4-nitrostyryl phenol PubChem CID: 759250 IUPAC Name: 4-[(E)-2-(4-nitrophenyl)ethenyl]phenol SMILES: C1=CC(=CC=C1C=CC2=CC=C(C=C2)O)[N+](=O)[O-]
| PubChem CID | 759250 |
|---|---|
| CAS | 19221-08-0 |
| Molecular Weight (g/mol) | 241.246 |
| MDL Number | MFCD00017044 |
| SMILES | C1=CC(=CC=C1C=CC2=CC=C(C=C2)O)[N+](=O)[O-] |
| Synonym | 4-hydroxy-4'-nitrostilbene,4-4-nitrostyryl phenol,4-e-2-4-nitrophenyl ethenyl phenol,4-hydroxy-4/'-nitrostilbene,4-1e-2-4-nitrophenyl vinyl phenol,4'-nitrostilben-4-ol,cambridge id 5309411,e-4'-nitrostilbene-4-ol,e-4-4-nitrostyryl phenol |
| IUPAC Name | 4-[(E)-2-(4-nitrophenyl)ethenyl]phenol |
| InChI Key | OETQWIHJPIESQB-OWOJBTEDSA-N |
| Molecular Formula | C14H11NO3 |
Nitrilotriacetic acid, 99%
CAS: 139-13-9 Molecular Formula: C6H9NO6 Molecular Weight (g/mol): 191.14 MDL Number: MFCD00004287 InChI Key: MGFYIUFZLHCRTH-UHFFFAOYSA-N Synonym: nitrilotriacetic acid,2,2',2-nitrilotriacetic acid,triglycollamic acid,aminotriacetic acid,complexon i,trilon a,n,n-bis carboxymethyl glycine,nitrilotriacetate,komplexon i,titriplex i PubChem CID: 8758 ChEBI: CHEBI:44557 IUPAC Name: 2-[bis(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CC(O)=O)CC(O)=O
| PubChem CID | 8758 |
|---|---|
| CAS | 139-13-9 |
| Molecular Weight (g/mol) | 191.14 |
| ChEBI | CHEBI:44557 |
| MDL Number | MFCD00004287 |
| SMILES | OC(=O)CN(CC(O)=O)CC(O)=O |
| Synonym | nitrilotriacetic acid,2,2',2-nitrilotriacetic acid,triglycollamic acid,aminotriacetic acid,complexon i,trilon a,n,n-bis carboxymethyl glycine,nitrilotriacetate,komplexon i,titriplex i |
| IUPAC Name | 2-[bis(carboxymethyl)amino]acetic acid |
| InChI Key | MGFYIUFZLHCRTH-UHFFFAOYSA-N |
| Molecular Formula | C6H9NO6 |
2-(2-n-Butoxyethoxy)ethyl acetate, 98%
CAS: 124-17-4 Molecular Formula: C10H20O4 Molecular Weight (g/mol): 204.266 MDL Number: MFCD00009458 InChI Key: VXQBJTKSVGFQOL-UHFFFAOYSA-N Synonym: 2-2-butoxyethoxy ethyl acetate,butoxyethoxyethyl acetate,diethylene glycol monobutyl ether acetate,butyl diglycol acetate,butyl carbitol acetate,ektasolve db acetate,2-2-butoxyethoxy ethanol acetate,butyl diethylene glycol acetate,butylkarbitolacetat,diglycol monobutyl ether acetate PubChem CID: 31288 IUPAC Name: 2-(2-butoxyethoxy)ethyl acetate SMILES: CCCCOCCOCCOC(=O)C
| PubChem CID | 31288 |
|---|---|
| CAS | 124-17-4 |
| Molecular Weight (g/mol) | 204.266 |
| MDL Number | MFCD00009458 |
| SMILES | CCCCOCCOCCOC(=O)C |
| Synonym | 2-2-butoxyethoxy ethyl acetate,butoxyethoxyethyl acetate,diethylene glycol monobutyl ether acetate,butyl diglycol acetate,butyl carbitol acetate,ektasolve db acetate,2-2-butoxyethoxy ethanol acetate,butyl diethylene glycol acetate,butylkarbitolacetat,diglycol monobutyl ether acetate |
| IUPAC Name | 2-(2-butoxyethoxy)ethyl acetate |
| InChI Key | VXQBJTKSVGFQOL-UHFFFAOYSA-N |
| Molecular Formula | C10H20O4 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, tripotassium salt dihydrate, 99+%
CAS: 65501-24-8 Molecular Formula: C10H13K3N2O8·2H2O Molecular Weight (g/mol): 442.56 InChI Key: MAPFUJCWRWFQIY-UHFFFAOYSA-K Synonym: ethylenediaminetetraacetic acid tripotassium salt dihydrate,edta tripotassium salt,edta tripotassium salt dihydrate,tripotassium ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-carboxylatomethyl carboxymethyl amino ethyl azanediyl diacetate dihydrate,tripotassium 2-2-bis carboxylatomethyl amino ethyl carboxymethyl amino acetate dihydrate,edta tripotassium salt, dihydrate,ethylenediaminetetraacetic acid, tripotassium salt dihydrate,ethylenediaminetetraacetic acid tripotassium salt dihydrate titration PubChem CID: 2733162 IUPAC Name: tripotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate;dihydrate SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].O.O.[K+].[K+].[K+]
| PubChem CID | 2733162 |
|---|---|
| CAS | 65501-24-8 |
| Molecular Weight (g/mol) | 442.56 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].O.O.[K+].[K+].[K+] |
| Synonym | ethylenediaminetetraacetic acid tripotassium salt dihydrate,edta tripotassium salt,edta tripotassium salt dihydrate,tripotassium ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-carboxylatomethyl carboxymethyl amino ethyl azanediyl diacetate dihydrate,tripotassium 2-2-bis carboxylatomethyl amino ethyl carboxymethyl amino acetate dihydrate,edta tripotassium salt, dihydrate,ethylenediaminetetraacetic acid, tripotassium salt dihydrate,ethylenediaminetetraacetic acid tripotassium salt dihydrate titration |
| IUPAC Name | tripotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate;dihydrate |
| InChI Key | MAPFUJCWRWFQIY-UHFFFAOYSA-K |
| Molecular Formula | C10H13K3N2O8·2H2O |
Ethylenediaminetetraacetic acid disodium salt, 0.200N (0.1M) Standardized solution
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 IUPAC Name: disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Iron(III) oxalate hexahydrate
CAS: 166897-40-1 Molecular Formula: C6H12Fe2O18 Molecular Weight (g/mol): 483.834 MDL Number: MFCD00054430 InChI Key: FWXIZVVTJVNNRX-UHFFFAOYSA-H Synonym: ferric oxalate hexahydrate PubChem CID: 131849393 IUPAC Name: iron(3+);oxalate;hexahydrate SMILES: C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].O.O.O.O.O.O.[Fe+3].[Fe+3]
| PubChem CID | 131849393 |
|---|---|
| CAS | 166897-40-1 |
| Molecular Weight (g/mol) | 483.834 |
| MDL Number | MFCD00054430 |
| SMILES | C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].O.O.O.O.O.O.[Fe+3].[Fe+3] |
| Synonym | ferric oxalate hexahydrate |
| IUPAC Name | iron(3+);oxalate;hexahydrate |
| InChI Key | FWXIZVVTJVNNRX-UHFFFAOYSA-H |
| Molecular Formula | C6H12Fe2O18 |
Naringin
CAS: 10236-47-2 Molecular Formula: C27H32O14 Molecular Weight (g/mol): 580.54 MDL Number: MFCD00148888,MFCD00149445,MFCD01461988 InChI Key: DFPMSGMNTNDNHN-ZPHOTFPESA-N Synonym: 4',5,7-Trihydroxyflavanone 7-rhamnoglucoside PubChem CID: 74787988 IUPAC Name: 7-[(2S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one SMILES: C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2OC2=CC(O)=C3C(=O)C[C@H](OC3=C2)C2=CC=C(O)C=C2)[C@H](O)[C@H](O)[C@H]1O
| PubChem CID | 74787988 |
|---|---|
| CAS | 10236-47-2 |
| Molecular Weight (g/mol) | 580.54 |
| MDL Number | MFCD00148888,MFCD00149445,MFCD01461988 |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2OC2=CC(O)=C3C(=O)C[C@H](OC3=C2)C2=CC=C(O)C=C2)[C@H](O)[C@H](O)[C@H]1O |
| Synonym | 4',5,7-Trihydroxyflavanone 7-rhamnoglucoside |
| IUPAC Name | 7-[(2S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChI Key | DFPMSGMNTNDNHN-ZPHOTFPESA-N |
| Molecular Formula | C27H32O14 |
Morin hydrate
CAS: 654055-01-3 Molecular Formula: C15H10O7 Molecular Weight (g/mol): 302.24 MDL Number: MFCD00217054 InChI Key: YXOLAZRVSSWPPT-UHFFFAOYSA-N Synonym: morin hydrate,morinhydrate,bois d,arc hydrate,2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one hydrate,morin hydrate, powder,morin flavonol,morin hydrate aurantica,2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-chromen-4-one hydrate,2 inverted exclamation marka,3,4 inverted exclamation marka,5,7-pentahydroxyflavone PubChem CID: 16219651 IUPAC Name: 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;hydrate SMILES: OC1=CC(O)=C(C=C1)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1
| PubChem CID | 16219651 |
|---|---|
| CAS | 654055-01-3 |
| Molecular Weight (g/mol) | 302.24 |
| MDL Number | MFCD00217054 |
| SMILES | OC1=CC(O)=C(C=C1)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 |
| Synonym | morin hydrate,morinhydrate,bois d,arc hydrate,2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one hydrate,morin hydrate, powder,morin flavonol,morin hydrate aurantica,2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-chromen-4-one hydrate,2 inverted exclamation marka,3,4 inverted exclamation marka,5,7-pentahydroxyflavone |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;hydrate |
| InChI Key | YXOLAZRVSSWPPT-UHFFFAOYSA-N |
| Molecular Formula | C15H10O7 |
trans-Decahydronaphthalene 98.0+%, TCI America™
CAS: 493-02-7 Molecular Formula: C10H18 Molecular Weight (g/mol): 138.25 MDL Number: MFCD00004130,MFCD00064189,MFCD00064191 InChI Key: NNBZCPXTIHJBJL-UHFFFAOYSA-N Synonym: decalin,decahydronaphthalene,cis-decahydronaphthalene,trans-decahydronaphthalene,cis-decalin,dekalin,naphthalene, decahydro,perhydronaphthalene,trans-decalin,naphthalane PubChem CID: 7044 ChEBI: CHEBI:38853 IUPAC Name: decahydronaphthalene SMILES: C1CCC2CCCCC2C1
| PubChem CID | 7044 |
|---|---|
| CAS | 493-02-7 |
| Molecular Weight (g/mol) | 138.25 |
| ChEBI | CHEBI:38853 |
| MDL Number | MFCD00004130,MFCD00064189,MFCD00064191 |
| SMILES | C1CCC2CCCCC2C1 |
| Synonym | decalin,decahydronaphthalene,cis-decahydronaphthalene,trans-decahydronaphthalene,cis-decalin,dekalin,naphthalene, decahydro,perhydronaphthalene,trans-decalin,naphthalane |
| IUPAC Name | decahydronaphthalene |
| InChI Key | NNBZCPXTIHJBJL-UHFFFAOYSA-N |
| Molecular Formula | C10H18 |
Methyl 3-mercaptopropionate, 98%
CAS: 2935-90-2 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.17 MDL Number: MFCD00004895 InChI Key: LDTLDBDUBGAEDT-UHFFFAOYSA-N PubChem CID: 18050 IUPAC Name: methyl 3-sulfanylpropanoate SMILES: COC(=O)CCS
| PubChem CID | 18050 |
|---|---|
| CAS | 2935-90-2 |
| Molecular Weight (g/mol) | 120.17 |
| MDL Number | MFCD00004895 |
| SMILES | COC(=O)CCS |
| IUPAC Name | methyl 3-sulfanylpropanoate |
| InChI Key | LDTLDBDUBGAEDT-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |