Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
3-Mercapto-1,2-propanediol, 90%
CAS: 96-27-5 Molecular Formula: C3H8O2S Molecular Weight (g/mol): 108.16 MDL Number: MFCD00004879 InChI Key: PJUIMOJAAPLTRJ-UHFFFAOYNA-N Synonym: 3-mercapto-1,2-propanediol,monothioglycerol,1-thioglycerol,thioglycerol,thioglycerine,thioglycerin,thiovanol,3-mercaptopropane-1,2-diol,alpha-thioglycerol,glycerol-1-thiol PubChem CID: 7291 ChEBI: CHEBI:74537 IUPAC Name: 3-sulfanylpropane-1,2-diol SMILES: OCC(O)CS
| PubChem CID | 7291 |
|---|---|
| CAS | 96-27-5 |
| Molecular Weight (g/mol) | 108.16 |
| ChEBI | CHEBI:74537 |
| MDL Number | MFCD00004879 |
| SMILES | OCC(O)CS |
| Synonym | 3-mercapto-1,2-propanediol,monothioglycerol,1-thioglycerol,thioglycerol,thioglycerine,thioglycerin,thiovanol,3-mercaptopropane-1,2-diol,alpha-thioglycerol,glycerol-1-thiol |
| IUPAC Name | 3-sulfanylpropane-1,2-diol |
| InChI Key | PJUIMOJAAPLTRJ-UHFFFAOYNA-N |
| Molecular Formula | C3H8O2S |
Thermo Scientific Chemicals Phenolphthalein, 98%
CAS: 77-09-8 Molecular Formula: C20H14O4 Molecular Weight (g/mol): 318.33 MDL Number: MFCD00005913 InChI Key: KJFMBFZCATUALV-UHFFFAOYSA-N Synonym: phenolphthalein,phthalimetten,euchessina,phthalin,espotabs,phenolax,purgophen,koprol,laxogen,trilax PubChem CID: 4764 ChEBI: CHEBI:34914 SMILES: OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1
| PubChem CID | 4764 |
|---|---|
| CAS | 77-09-8 |
| Molecular Weight (g/mol) | 318.33 |
| ChEBI | CHEBI:34914 |
| MDL Number | MFCD00005913 |
| SMILES | OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| Synonym | phenolphthalein,phthalimetten,euchessina,phthalin,espotabs,phenolax,purgophen,koprol,laxogen,trilax |
| InChI Key | KJFMBFZCATUALV-UHFFFAOYSA-N |
| Molecular Formula | C20H14O4 |
Palmitoyl chloride, 98%
CAS: 112-67-4 Molecular Formula: C16H31ClO Molecular Weight (g/mol): 274.873 MDL Number: MFCD00000742 InChI Key: ARBOVOVUTSQWSS-UHFFFAOYSA-N Synonym: palmitoyl chloride,palmitic acid chloride,palmitoylchloride,unii-7642r2josb,hexadecanoyl-chloride,palm acetyl chlorine 14 acetyl chlorine,hexadecanoic acid, chloride,palmitic chloride,hexadecanoylchloride,n-hexadecanoyl chloride PubChem CID: 8206 IUPAC Name: hexadecanoyl chloride SMILES: CCCCCCCCCCCCCCCC(=O)Cl
| PubChem CID | 8206 |
|---|---|
| CAS | 112-67-4 |
| Molecular Weight (g/mol) | 274.873 |
| MDL Number | MFCD00000742 |
| SMILES | CCCCCCCCCCCCCCCC(=O)Cl |
| Synonym | palmitoyl chloride,palmitic acid chloride,palmitoylchloride,unii-7642r2josb,hexadecanoyl-chloride,palm acetyl chlorine 14 acetyl chlorine,hexadecanoic acid, chloride,palmitic chloride,hexadecanoylchloride,n-hexadecanoyl chloride |
| IUPAC Name | hexadecanoyl chloride |
| InChI Key | ARBOVOVUTSQWSS-UHFFFAOYSA-N |
| Molecular Formula | C16H31ClO |
Pentafluoropropionic anhydride, 98%
CAS: 356-42-3 Molecular Formula: C6F10O3 Molecular Weight (g/mol): 310.04 InChI Key: XETRHNFRKCNWAJ-UHFFFAOYSA-N Synonym: pentafluoropropionic anhydride,perfluoropropionic anhydride,pentafluoropropionic acid anhydride,pfpa,perfluoropropionic acid anhydride,propanoic acid, pentafluoro-, anhydride,unii-0lfe7u11o5,pentafluoropropanoic anhydride,decafluoropropionic anhydride,propionic acid, pentafluoro-, anhydride PubChem CID: 67742 IUPAC Name: 2,2,3,3,3-pentafluoropropanoyl 2,2,3,3,3-pentafluoropropanoate SMILES: C(=O)(C(C(F)(F)F)(F)F)OC(=O)C(C(F)(F)F)(F)F
| PubChem CID | 67742 |
|---|---|
| CAS | 356-42-3 |
| Molecular Weight (g/mol) | 310.04 |
| SMILES | C(=O)(C(C(F)(F)F)(F)F)OC(=O)C(C(F)(F)F)(F)F |
| Synonym | pentafluoropropionic anhydride,perfluoropropionic anhydride,pentafluoropropionic acid anhydride,pfpa,perfluoropropionic acid anhydride,propanoic acid, pentafluoro-, anhydride,unii-0lfe7u11o5,pentafluoropropanoic anhydride,decafluoropropionic anhydride,propionic acid, pentafluoro-, anhydride |
| IUPAC Name | 2,2,3,3,3-pentafluoropropanoyl 2,2,3,3,3-pentafluoropropanoate |
| InChI Key | XETRHNFRKCNWAJ-UHFFFAOYSA-N |
| Molecular Formula | C6F10O3 |
Bismuth(III) trifluoromethanesulfonate, 99%
CAS: 88189-03-1 Molecular Formula: C3BiF9O9S3 Molecular Weight (g/mol): 656.17 MDL Number: MFCD02093669 InChI Key: NYENCOMLZDQKNH-UHFFFAOYSA-K Synonym: bismuth iii trifluoromethanesulfonate,bismuth triflate,bismuth trifluoromethanesulfonate,bismuth 3+ triflate,bismuth triflate mi,bismuth 3+ trifluoromethanesulfonate,bismuth tris trifluoromethanesulfonate,bismuth iii triflate,bismuth 3+ ion tritriflate PubChem CID: 9917655 IUPAC Name: bismuth;trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Bi+3]
| PubChem CID | 9917655 |
|---|---|
| CAS | 88189-03-1 |
| Molecular Weight (g/mol) | 656.17 |
| MDL Number | MFCD02093669 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Bi+3] |
| Synonym | bismuth iii trifluoromethanesulfonate,bismuth triflate,bismuth trifluoromethanesulfonate,bismuth 3+ triflate,bismuth triflate mi,bismuth 3+ trifluoromethanesulfonate,bismuth tris trifluoromethanesulfonate,bismuth iii triflate,bismuth 3+ ion tritriflate |
| IUPAC Name | bismuth;trifluoromethanesulfonate |
| InChI Key | NYENCOMLZDQKNH-UHFFFAOYSA-K |
| Molecular Formula | C3BiF9O9S3 |
Ethyl 2-chlorobenzoate, 98%
CAS: 7335-25-3 Molecular Formula: C9H9ClO2 Molecular Weight (g/mol): 184.62 MDL Number: MFCD00016338 InChI Key: RETLCWPMLJPOTP-UHFFFAOYSA-N Synonym: 2-chlorobenzoic acid ethyl ester,ethyl o-chlorobenzoate,benzoic acid, 2-chloro-, ethyl ester,ethyl-2-chlorobenzoate,ethyl2-chlorobenzoate,pubchem3703,acmc-1bfxj,ethyl 2-chloranylbenzoate,chlorobenzoic acid ethyl ester,ksc498a5r PubChem CID: 81783 IUPAC Name: ethyl 2-chlorobenzoate SMILES: CCOC(=O)C1=CC=CC=C1Cl
| PubChem CID | 81783 |
|---|---|
| CAS | 7335-25-3 |
| Molecular Weight (g/mol) | 184.62 |
| MDL Number | MFCD00016338 |
| SMILES | CCOC(=O)C1=CC=CC=C1Cl |
| Synonym | 2-chlorobenzoic acid ethyl ester,ethyl o-chlorobenzoate,benzoic acid, 2-chloro-, ethyl ester,ethyl-2-chlorobenzoate,ethyl2-chlorobenzoate,pubchem3703,acmc-1bfxj,ethyl 2-chloranylbenzoate,chlorobenzoic acid ethyl ester,ksc498a5r |
| IUPAC Name | ethyl 2-chlorobenzoate |
| InChI Key | RETLCWPMLJPOTP-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO2 |
Methanesulfonic acid, pure, 70% solution in water
CAS: 75-75-2 Molecular Formula: CH4O3S Molecular Weight (g/mol): 96.1 MDL Number: MFCD00007518 InChI Key: AFVFQIVMOAPDHO-UHFFFAOYSA-N Synonym: methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane PubChem CID: 6395 ChEBI: CHEBI:27376 IUPAC Name: methanesulfonic acid SMILES: CS(=O)(=O)O
| PubChem CID | 6395 |
|---|---|
| CAS | 75-75-2 |
| Molecular Weight (g/mol) | 96.1 |
| ChEBI | CHEBI:27376 |
| MDL Number | MFCD00007518 |
| SMILES | CS(=O)(=O)O |
| Synonym | methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane |
| IUPAC Name | methanesulfonic acid |
| InChI Key | AFVFQIVMOAPDHO-UHFFFAOYSA-N |
| Molecular Formula | CH4O3S |
Dibutylboron trifluoromethanesulfonate, 1M sol. in dichloromethane
CAS: 60669-69-4 | C9H18BF3O3S | 274.11 g/mol
| Linear Formula | CF3SO3B[(CH2)3CH3]2 |
|---|---|
| Molecular Weight (g/mol) | 274.11 |
| Color | Orange to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Dibutylboron trifluoromethanesulfonate |
| SMILES | CCCCB(CCCC)OS(=O)(=O)C(F)(F)F |
| InChI Key | FAVAVMFXAKZTMV-UHFFFAOYSA-N |
| Density | 1.2710g/mL |
| Assay Percent Range | 98% |
| PubChem CID | 2724243 |
| Fieser | 07,91; 09,140; 16,109 |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse |
| MDL Number | MFCD00009669 |
| Health Hazard 2 | GHS H Statement Flammable liquid and vapour. Suspected of causing cancer. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. |
| Solubility Information | Solubility in water: reacts. |
| Packaging | Glass Bottle |
| Flash Point | 27°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | dibutylboron trifluoromethanesulfonate,dibutylboryl trifluoromethanesulfonate solution,nbu2botf,bu2botf,dibutylboron triflate,n-bu 2botf,dibutylboryl trifluoromethanesulfonate,dibutylboron triflate solution,trifluoromethylsulfonyloxy dibutylborane,dibutyl trifluoromethyl sulfonyl oxy borane |
| IUPAC Name | dibutylboranyl trifluoromethanesulfonate |
| Molecular Formula | C9H18BF3O3S |
| Formula Weight | 274.11 |
| Specific Gravity | 1.271 |
Myosmine, 98%, may contain up to 2% water
CAS: 532-12-7 Molecular Formula: C9H10N2 Molecular Weight (g/mol): 146.193 MDL Number: MFCD00052019 InChI Key: DPNGWXJMIILTBS-UHFFFAOYSA-N Synonym: myosmine,3-3,4-dihydro-2h-pyrrol-5-yl pyridine,3-1-pyrrolin-2-yl pyridine,miosmine,unii-9o0a545w4l,3-4,5-dihydro-3h-pyrrol-2-yl-pyridine,2-3-pyridyl-1-pyrroline,3-2-pyrrolin-2-yl pyridine,pyridine, 3-3,4-dihydro-2h-pyrrol-5-yl,pyridine, 3-1-pyrrolin-2-yl PubChem CID: 442649 ChEBI: CHEBI:7051 IUPAC Name: 3-(3,4-dihydro-2H-pyrrol-5-yl)pyridine SMILES: C1CC(=NC1)C2=CN=CC=C2
| PubChem CID | 442649 |
|---|---|
| CAS | 532-12-7 |
| Molecular Weight (g/mol) | 146.193 |
| ChEBI | CHEBI:7051 |
| MDL Number | MFCD00052019 |
| SMILES | C1CC(=NC1)C2=CN=CC=C2 |
| Synonym | myosmine,3-3,4-dihydro-2h-pyrrol-5-yl pyridine,3-1-pyrrolin-2-yl pyridine,miosmine,unii-9o0a545w4l,3-4,5-dihydro-3h-pyrrol-2-yl-pyridine,2-3-pyridyl-1-pyrroline,3-2-pyrrolin-2-yl pyridine,pyridine, 3-3,4-dihydro-2h-pyrrol-5-yl,pyridine, 3-1-pyrrolin-2-yl |
| IUPAC Name | 3-(3,4-dihydro-2H-pyrrol-5-yl)pyridine |
| InChI Key | DPNGWXJMIILTBS-UHFFFAOYSA-N |
| Molecular Formula | C9H10N2 |
Methylenediphosphonic acid, 98%, Thermo Scientific Chemicals
CAS: 1984-15-2 Molecular Formula: CH6O6P2 Molecular Weight (g/mol): 176.00 MDL Number: MFCD00002139 InChI Key: MBKDYNNUVRNNRF-UHFFFAOYSA-N Synonym: methylenediphosphonic acid,medronic acid,acido medronico,methylene diphosphonate,acide medronique,acidum medronicum,phosphonic acid, methylenebis,methylenebis phosphonic acid,mdp-bracco,methanediphosphonic acid PubChem CID: 16124 ChEBI: CHEBI:43945 SMILES: OP(O)(=O)CP(O)(O)=O
| PubChem CID | 16124 |
|---|---|
| CAS | 1984-15-2 |
| Molecular Weight (g/mol) | 176.00 |
| ChEBI | CHEBI:43945 |
| MDL Number | MFCD00002139 |
| SMILES | OP(O)(=O)CP(O)(O)=O |
| Synonym | methylenediphosphonic acid,medronic acid,acido medronico,methylene diphosphonate,acide medronique,acidum medronicum,phosphonic acid, methylenebis,methylenebis phosphonic acid,mdp-bracco,methanediphosphonic acid |
| InChI Key | MBKDYNNUVRNNRF-UHFFFAOYSA-N |
| Molecular Formula | CH6O6P2 |
Niclosamide, 97+%, Thermo Scientific Chemicals
CAS: 50-65-7 Molecular Formula: C13H8Cl2N2O4 Molecular Weight (g/mol): 327.12 MDL Number: MFCD00057597 InChI Key: RJMUSRYZPJIFPJ-UHFFFAOYSA-N Synonym: niclosamide,5-chloro-n-2-chloro-4-nitrophenyl-2-hydroxybenzamide,niclocide,bayluscid,phenasal,tredemine,fenasal,yomesan,dichlosale,helmiantin PubChem CID: 4477 IUPAC Name: 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide SMILES: OC1=CC=C(Cl)C=C1C(=O)NC1=CC=C(C=C1Cl)[N+]([O-])=O
| PubChem CID | 4477 |
|---|---|
| CAS | 50-65-7 |
| Molecular Weight (g/mol) | 327.12 |
| MDL Number | MFCD00057597 |
| SMILES | OC1=CC=C(Cl)C=C1C(=O)NC1=CC=C(C=C1Cl)[N+]([O-])=O |
| Synonym | niclosamide,5-chloro-n-2-chloro-4-nitrophenyl-2-hydroxybenzamide,niclocide,bayluscid,phenasal,tredemine,fenasal,yomesan,dichlosale,helmiantin |
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| InChI Key | RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
| Molecular Formula | C13H8Cl2N2O4 |
Poly(vinyl alcohol), 88% hydrolyzed, average M.W. 20000-30000
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Cyclohexylmagnesium chloride, 1.3M solution in THF/toluene, AcroSeal™
CAS: 931-51-1 Molecular Formula: C6H11ClMg Molecular Weight (g/mol): 142.91 MDL Number: MFCD00003816 InChI Key: WMJMABVHDMRMJA-UHFFFAOYSA-M Synonym: cyclohexylmagnesium chloride,magnesium, chlorocyclohexyl,magnesium,chlorocyclohexyl,cyclohexyl magnesium chloride,chloro cyclohexyl magnesium,chlorocyclohexylmagnesium,cyclohexylmagnesiumchloride,unii-oag686rdsu,cyclohexylmagnesium chloride solution, 2.0 m in diethyl ether,cyclohexylmagnesium cloride PubChem CID: 13605 IUPAC Name: magnesium;cyclohexane;chloride SMILES: Cl[Mg]C1CCCCC1
| PubChem CID | 13605 |
|---|---|
| CAS | 931-51-1 |
| Molecular Weight (g/mol) | 142.91 |
| MDL Number | MFCD00003816 |
| SMILES | Cl[Mg]C1CCCCC1 |
| Synonym | cyclohexylmagnesium chloride,magnesium, chlorocyclohexyl,magnesium,chlorocyclohexyl,cyclohexyl magnesium chloride,chloro cyclohexyl magnesium,chlorocyclohexylmagnesium,cyclohexylmagnesiumchloride,unii-oag686rdsu,cyclohexylmagnesium chloride solution, 2.0 m in diethyl ether,cyclohexylmagnesium cloride |
| IUPAC Name | magnesium;cyclohexane;chloride |
| InChI Key | WMJMABVHDMRMJA-UHFFFAOYSA-M |
| Molecular Formula | C6H11ClMg |
Ethyl chloroformate, 97%
CAS: 541-41-3 InChI Key: RIFGWPKJUGCATF-UHFFFAOYSA-N Synonym: ethyl chloroformate,ethyl chlorocarbonate,cathyl chloride,ethoxycarbonyl chloride,chloroformic acid ethyl ester,ethylchloroformate,carbonochloridic acid, ethyl ester,chloro ethoxy methanone,ethylchloorformiaat,etil cloroformiato PubChem CID: 10928 IUPAC Name: ethyl carbonochloridate SMILES: CCOC(=O)Cl
| PubChem CID | 10928 |
|---|---|
| CAS | 541-41-3 |
| SMILES | CCOC(=O)Cl |
| Synonym | ethyl chloroformate,ethyl chlorocarbonate,cathyl chloride,ethoxycarbonyl chloride,chloroformic acid ethyl ester,ethylchloroformate,carbonochloridic acid, ethyl ester,chloro ethoxy methanone,ethylchloorformiaat,etil cloroformiato |
| IUPAC Name | ethyl carbonochloridate |
| InChI Key | RIFGWPKJUGCATF-UHFFFAOYSA-N |
Taurine, 99%
CAS: 107-35-7 Molecular Formula: C2H7NO3S Molecular Weight (g/mol): 125.14 MDL Number: MFCD00008197 InChI Key: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC Name: 2-aminoethanesulfonic acid SMILES: NCCS(O)(=O)=O
| PubChem CID | 1123 |
|---|---|
| CAS | 107-35-7 |
| Molecular Weight (g/mol) | 125.14 |
| ChEBI | CHEBI:15891 |
| MDL Number | MFCD00008197 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| IUPAC Name | 2-aminoethanesulfonic acid |
| InChI Key | XOAAWQZATWQOTB-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO3S |