Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Allyl methyl carbonate, 98%
CAS: 35466-83-2 Molecular Formula: C5H8O3 Molecular Weight (g/mol): 116.12 MDL Number: MFCD00134545 InChI Key: YHLVIDQQTOMBGN-UHFFFAOYSA-N Synonym: allyl methyl carbonate,methyl prop-2-en-1-yl carbonate,carbonic acid allyl methyl ester,isobutylene carbonate,methyl allyl carbonate,acmc-1agon,allyl methyl carbonate #,prop-2-enyl methoxyformate,yhlvidqqtombgn-uhfffaoysa PubChem CID: 534788 IUPAC Name: methyl prop-2-enyl carbonate SMILES: COC(=O)OCC=C
| PubChem CID | 534788 |
|---|---|
| CAS | 35466-83-2 |
| Molecular Weight (g/mol) | 116.12 |
| MDL Number | MFCD00134545 |
| SMILES | COC(=O)OCC=C |
| Synonym | allyl methyl carbonate,methyl prop-2-en-1-yl carbonate,carbonic acid allyl methyl ester,isobutylene carbonate,methyl allyl carbonate,acmc-1agon,allyl methyl carbonate #,prop-2-enyl methoxyformate,yhlvidqqtombgn-uhfffaoysa |
| IUPAC Name | methyl prop-2-enyl carbonate |
| InChI Key | YHLVIDQQTOMBGN-UHFFFAOYSA-N |
| Molecular Formula | C5H8O3 |
tert-Butyldimethylsilyl trifluoromethanesulfonate, 98%
CAS: 69739-34-0 Molecular Formula: C7H15F3O3SSi Molecular Weight (g/mol): 264.33 MDL Number: MFCD00000405 InChI Key: WLLIXJBWWFGEHT-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate PubChem CID: 123564 IUPAC Name: [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate SMILES: CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F
| PubChem CID | 123564 |
|---|---|
| CAS | 69739-34-0 |
| Molecular Weight (g/mol) | 264.33 |
| MDL Number | MFCD00000405 |
| SMILES | CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| Synonym | tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate |
| IUPAC Name | [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate |
| InChI Key | WLLIXJBWWFGEHT-UHFFFAOYSA-N |
| Molecular Formula | C7H15F3O3SSi |
Divinyl sulfone, 97%, stab. with 0.05% hydroquinone
CAS: 77-77-0 Molecular Formula: C4H6O2S Molecular Weight (g/mol): 118.15 MDL Number: MFCD00008623 InChI Key: AFOSIXZFDONLBT-UHFFFAOYSA-N Synonym: divinyl sulfone,vinyl sulfone,divinyl sulphone,bis ethenyl sulfone,vinyl sulphone,sulfone, divinyl,ethenesulfonyl-ethene,ethene, 1,1'-sulfonylbis,1,1'-sulphonylbisethene,ethenesulfonyl ethene PubChem CID: 6496 ChEBI: CHEBI:53729 IUPAC Name: 1-ethenylsulfonylethene SMILES: C=CS(=O)(=O)C=C
| PubChem CID | 6496 |
|---|---|
| CAS | 77-77-0 |
| Molecular Weight (g/mol) | 118.15 |
| ChEBI | CHEBI:53729 |
| MDL Number | MFCD00008623 |
| SMILES | C=CS(=O)(=O)C=C |
| Synonym | divinyl sulfone,vinyl sulfone,divinyl sulphone,bis ethenyl sulfone,vinyl sulphone,sulfone, divinyl,ethenesulfonyl-ethene,ethene, 1,1'-sulfonylbis,1,1'-sulphonylbisethene,ethenesulfonyl ethene |
| IUPAC Name | 1-ethenylsulfonylethene |
| InChI Key | AFOSIXZFDONLBT-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2S |
Lidocaine Hydrochloride, MP Biomedicals
CAS: 6108-05-0 Molecular Formula: C14H25ClN2O2 Molecular Weight (g/mol): 288.82 MDL Number: MFCD00150329 InChI Key: YECIFGHRMFEPJK-UHFFFAOYSA-N Synonym: lidocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride hydrate,dolicaine,linocaine hydrochloride,lidocaine hydrochloride hydrate,xylocaine hydrochloride monohydrate,lignocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride monohydrate,zingo tm,lidocaine hcl hydrate PubChem CID: 16219577 ChEBI: CHEBI:60791 SMILES: O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C
| PubChem CID | 16219577 |
|---|---|
| CAS | 6108-05-0 |
| Molecular Weight (g/mol) | 288.82 |
| ChEBI | CHEBI:60791 |
| MDL Number | MFCD00150329 |
| SMILES | O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C |
| Synonym | lidocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride hydrate,dolicaine,linocaine hydrochloride,lidocaine hydrochloride hydrate,xylocaine hydrochloride monohydrate,lignocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride monohydrate,zingo tm,lidocaine hcl hydrate |
| InChI Key | YECIFGHRMFEPJK-UHFFFAOYSA-N |
| Molecular Formula | C14H25ClN2O2 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, Cell Culture Reagent
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
3-Fluorobenzoic acid, 99%
CAS: 455-38-9 Molecular Formula: C7H5FO2 Molecular Weight (g/mol): 140.11 MDL Number: MFCD00002489 InChI Key: MXNBDFWNYRNIBH-UHFFFAOYSA-N Synonym: m-fluorobenzoic acid,benzoic acid, 3-fluoro,meta-fluorobenzoic acid,benzoic acid, m-fluoro,3-fluoro-benzoic acid,3-fluorobenzoicacid,pubchem3480,3-fluorobenzoic acid,ksc235q1b,paragos 390192 PubChem CID: 9968 ChEBI: CHEBI:20021 IUPAC Name: 3-fluorobenzoic acid SMILES: OC(=O)C1=CC=CC(F)=C1
| PubChem CID | 9968 |
|---|---|
| CAS | 455-38-9 |
| Molecular Weight (g/mol) | 140.11 |
| ChEBI | CHEBI:20021 |
| MDL Number | MFCD00002489 |
| SMILES | OC(=O)C1=CC=CC(F)=C1 |
| Synonym | m-fluorobenzoic acid,benzoic acid, 3-fluoro,meta-fluorobenzoic acid,benzoic acid, m-fluoro,3-fluoro-benzoic acid,3-fluorobenzoicacid,pubchem3480,3-fluorobenzoic acid,ksc235q1b,paragos 390192 |
| IUPAC Name | 3-fluorobenzoic acid |
| InChI Key | MXNBDFWNYRNIBH-UHFFFAOYSA-N |
| Molecular Formula | C7H5FO2 |
Poly(dimethylsiloxane), 100 cSt
CAS: 9016-00-6 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): 74.15 MDL Number: MFCD00084411 InChI Key: SEUDSDUUJXTXSV-UHFFFAOYSA-N Synonym: Simethicone,Dimethicone,PDMS IUPAC Name: dimethylsilanone SMILES: C[Si](C)(-*)O-*
| CAS | 9016-00-6 |
|---|---|
| Molecular Weight (g/mol) | 74.15 |
| MDL Number | MFCD00084411 |
| SMILES | C[Si](C)(-*)O-* |
| Synonym | Simethicone,Dimethicone,PDMS |
| IUPAC Name | dimethylsilanone |
| InChI Key | SEUDSDUUJXTXSV-UHFFFAOYSA-N |
| Molecular Formula | (C2H6OSi)n |
Tetrabutylammonium hydroxide, 0.1N sol. in toluene/methanol for non-aq.titr.
Tetrabutylammonium hydroxide, 0.1N sol. in toluene/methanol for non-aq.titr., Quantity: 500mL, Packaging: Glass bottle, Colorless to Yellow, Molecular Weight: 259.47, Beilstein: 04,II,634, CAS: 2052-49-5, 108-88-3, 67-56-1, Density: 0.8500g/mL, EINECS Number: 218-147-6 | CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.8500g/mL |
| PubChem CID | 2723671 |
| Fieser | 05,645; 11,500; 07,332 |
| Formula Weight | 259.47 |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF SWALLOWED: rinse mouth. Do NOT induce vomi |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Harmful if swallowed. Harmful in contact with skin. Harmful if inhaled. Causes damage to organs. Suspected of damaging the unborn child. May be fatal if swallow |
| Solubility Information | Solubility in water: insoluble |
| Packaging | Glass bottle |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.3775 |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04,II,634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.85 |
Iodomethane, 99+%, stab. with copper
CAS: 74-88-4 Molecular Formula: CH3I Molecular Weight (g/mol): 141.94 MDL Number: MFCD00001073 InChI Key: INQOMBQAUSQDDS-UHFFFAOYSA-N Synonym: methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek PubChem CID: 6328 ChEBI: CHEBI:39282 IUPAC Name: iodomethane SMILES: CI
| PubChem CID | 6328 |
|---|---|
| CAS | 74-88-4 |
| Molecular Weight (g/mol) | 141.94 |
| ChEBI | CHEBI:39282 |
| MDL Number | MFCD00001073 |
| SMILES | CI |
| Synonym | methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek |
| IUPAC Name | iodomethane |
| InChI Key | INQOMBQAUSQDDS-UHFFFAOYSA-N |
| Molecular Formula | CH3I |
5-Aminonaphthalene-1-sulfonic acid, tech. 85%
CAS: 84-89-9 Molecular Formula: C10H9NO3S Molecular Weight (g/mol): 223.25 MDL Number: MFCD00014315 InChI Key: DQNAQOYOSRJXFZ-UHFFFAOYSA-N Synonym: 5-amino-1-naphthalenesulfonic acid,1-naphthylamine-5-sulfonic acid,laurent acid,1-naphthalenesulfonic acid, 5-amino,1-amino-5-sulfonaphthalene,laurent's acid,5-naphthylamine-1-sulfonic acid,1-amino-5-naphthalenesufonic acid,1-aminonaphthalene-5-sulfonic acid,unii-w70wc365od PubChem CID: 6793 IUPAC Name: 5-aminonaphthalene-1-sulfonic acid SMILES: NC1=C2C=CC=C(C2=CC=C1)S(O)(=O)=O
| PubChem CID | 6793 |
|---|---|
| CAS | 84-89-9 |
| Molecular Weight (g/mol) | 223.25 |
| MDL Number | MFCD00014315 |
| SMILES | NC1=C2C=CC=C(C2=CC=C1)S(O)(=O)=O |
| Synonym | 5-amino-1-naphthalenesulfonic acid,1-naphthylamine-5-sulfonic acid,laurent acid,1-naphthalenesulfonic acid, 5-amino,1-amino-5-sulfonaphthalene,laurent's acid,5-naphthylamine-1-sulfonic acid,1-amino-5-naphthalenesufonic acid,1-aminonaphthalene-5-sulfonic acid,unii-w70wc365od |
| IUPAC Name | 5-aminonaphthalene-1-sulfonic acid |
| InChI Key | DQNAQOYOSRJXFZ-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO3S |
4'-Hydroxyacetophenone, 98%
CAS: 99-93-4 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002359 InChI Key: TXFPEBPIARQUIG-UHFFFAOYSA-N Synonym: 4'-hydroxyacetophenone,4-hydroxyacetophenone,1-4-hydroxyphenyl ethanone,4-acetylphenol,p-hydroxyacetophenone,piceol,ethanone, 1-4-hydroxyphenyl,p-acetylphenol,para-hydroxyacetophenone,p-oxyacetophenone PubChem CID: 7469 ChEBI: CHEBI:28032 IUPAC Name: 1-(4-hydroxyphenyl)ethanone SMILES: CC(=O)C1=CC=C(O)C=C1
| PubChem CID | 7469 |
|---|---|
| CAS | 99-93-4 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:28032 |
| MDL Number | MFCD00002359 |
| SMILES | CC(=O)C1=CC=C(O)C=C1 |
| Synonym | 4'-hydroxyacetophenone,4-hydroxyacetophenone,1-4-hydroxyphenyl ethanone,4-acetylphenol,p-hydroxyacetophenone,piceol,ethanone, 1-4-hydroxyphenyl,p-acetylphenol,para-hydroxyacetophenone,p-oxyacetophenone |
| IUPAC Name | 1-(4-hydroxyphenyl)ethanone |
| InChI Key | TXFPEBPIARQUIG-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
Ethyl benzoate, 99%
CAS: 93-89-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00009109 InChI Key: MTZQAGJQAFMTAQ-UHFFFAOYSA-N Synonym: benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 PubChem CID: 7165 IUPAC Name: ethyl benzoate SMILES: CCOC(=O)C1=CC=CC=C1
| PubChem CID | 7165 |
|---|---|
| CAS | 93-89-0 |
| Molecular Weight (g/mol) | 150.177 |
| MDL Number | MFCD00009109 |
| SMILES | CCOC(=O)C1=CC=CC=C1 |
| Synonym | benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 |
| IUPAC Name | ethyl benzoate |
| InChI Key | MTZQAGJQAFMTAQ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Pentafluorobenzenesulfonyl chloride, 99%
CAS: 832-53-1 Molecular Formula: C6ClF5O2S Molecular Weight (g/mol): 266.57 MDL Number: MFCD00007427 InChI Key: UOJCTEGNHXRPKO-UHFFFAOYSA-N Synonym: pentafluorobenzenesulfonyl chloride,2,3,4,5,6-pentafluorobenzene-1-sulfonyl chloride,pentafluorobenzenesulphonyl chloride,benzenesulfonyl chloride, pentafluoro,pentafluorophenylsulfonyl chloride,2,3,4,5,6-pentafluorobenzenesulfonyl choride,2,3,4,5,6-pentafluoro-benzenesulfonyl chloride,chloro 2,3,4,5,6-pentafluorophenyl sulfone,pubchem5683,pentafluorobenzenesulfonylchloride PubChem CID: 70026 IUPAC Name: 2,3,4,5,6-pentafluorobenzenesulfonyl chloride SMILES: C1(=C(C(=C(C(=C1F)F)S(=O)(=O)Cl)F)F)F
| PubChem CID | 70026 |
|---|---|
| CAS | 832-53-1 |
| Molecular Weight (g/mol) | 266.57 |
| MDL Number | MFCD00007427 |
| SMILES | C1(=C(C(=C(C(=C1F)F)S(=O)(=O)Cl)F)F)F |
| Synonym | pentafluorobenzenesulfonyl chloride,2,3,4,5,6-pentafluorobenzene-1-sulfonyl chloride,pentafluorobenzenesulphonyl chloride,benzenesulfonyl chloride, pentafluoro,pentafluorophenylsulfonyl chloride,2,3,4,5,6-pentafluorobenzenesulfonyl choride,2,3,4,5,6-pentafluoro-benzenesulfonyl chloride,chloro 2,3,4,5,6-pentafluorophenyl sulfone,pubchem5683,pentafluorobenzenesulfonylchloride |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzenesulfonyl chloride |
| InChI Key | UOJCTEGNHXRPKO-UHFFFAOYSA-N |
| Molecular Formula | C6ClF5O2S |
Triethylamine, 99+%
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.193 MDL Number: MFCD00009051 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N Synonym: triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane PubChem CID: 8471 ChEBI: CHEBI:35026 IUPAC Name: N,N-diethylethanamine SMILES: CCN(CC)CC
| PubChem CID | 8471 |
|---|---|
| CAS | 121-44-8 |
| Molecular Weight (g/mol) | 101.193 |
| ChEBI | CHEBI:35026 |
| MDL Number | MFCD00009051 |
| SMILES | CCN(CC)CC |
| Synonym | triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane |
| IUPAC Name | N,N-diethylethanamine |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
1,2,4-Benzenetricarboxylic anhydride, 97%
CAS: 552-30-7 MDL Number: MFCD00005925 InChI Key: SRPWOOOHEPICQU-UHFFFAOYSA-N Synonym: trimellitic anhydride,1,2,4-benzenetricarboxylic anhydride,anhydrotrimellic acid,trimellitic acid anhydride,4-carboxyphthalic anhydride,tman,anhydrotrimellitic acid,trimellic acid anhydride,1,3-dioxo-1,3-dihydroisobenzofuran-5-carboxylic acid,trimellitic acid 1,2-anhydride PubChem CID: 11089 ChEBI: CHEBI:53050 IUPAC Name: 1,3-dioxo-2-benzofuran-5-carboxylic acid SMILES: C1=CC2=C(C=C1C(=O)O)C(=O)OC2=O
| PubChem CID | 11089 |
|---|---|
| CAS | 552-30-7 |
| ChEBI | CHEBI:53050 |
| MDL Number | MFCD00005925 |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)OC2=O |
| Synonym | trimellitic anhydride,1,2,4-benzenetricarboxylic anhydride,anhydrotrimellic acid,trimellitic acid anhydride,4-carboxyphthalic anhydride,tman,anhydrotrimellitic acid,trimellic acid anhydride,1,3-dioxo-1,3-dihydroisobenzofuran-5-carboxylic acid,trimellitic acid 1,2-anhydride |
| IUPAC Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid |
| InChI Key | SRPWOOOHEPICQU-UHFFFAOYSA-N |