Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Tris(hydroxymethyl)phosphine, 95%
CAS: 2767-80-8 Molecular Formula: C3H9O3P Molecular Weight (g/mol): 124.08 MDL Number: MFCD00055382 InChI Key: JMXMXKRNIYCNRV-UHFFFAOYSA-N Synonym: tris hydroxymethyl phosphine,methanol, phosphinidynetris,trimethylolphosphine,phosphinidynetrimethanol,tris methanol phosphine,phosphinidynetrismethanol,unii-y6tg7wf7oq,y6tg7wf7oq,methanol, 1,1',1-phosphinidynetris,methanol, phosphinidynetri-7ci,8ci PubChem CID: 76001 IUPAC Name: bis(hydroxymethyl)phosphanylmethanol SMILES: C(O)P(CO)CO
| PubChem CID | 76001 |
|---|---|
| CAS | 2767-80-8 |
| Molecular Weight (g/mol) | 124.08 |
| MDL Number | MFCD00055382 |
| SMILES | C(O)P(CO)CO |
| Synonym | tris hydroxymethyl phosphine,methanol, phosphinidynetris,trimethylolphosphine,phosphinidynetrimethanol,tris methanol phosphine,phosphinidynetrismethanol,unii-y6tg7wf7oq,y6tg7wf7oq,methanol, 1,1',1-phosphinidynetris,methanol, phosphinidynetri-7ci,8ci |
| IUPAC Name | bis(hydroxymethyl)phosphanylmethanol |
| InChI Key | JMXMXKRNIYCNRV-UHFFFAOYSA-N |
| Molecular Formula | C3H9O3P |
tert-Butyl alcohol, anhydrous, 99.5%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 75-65-0 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00004464 InChI Key: DKGAVHZHDRPRBM-UHFFFAOYSA-N Synonym: tert-butanol,tert-butyl alcohol,2-methyl-2-propanol,t-butanol,t-butyl hydroxide,1,1-dimethylethanol,trimethylcarbinol,trimethyl methanol,2-propanol, 2-methyl,t-butyl alcohol PubChem CID: 6386 ChEBI: CHEBI:45895 IUPAC Name: 2-methylpropan-2-ol SMILES: CC(C)(C)O
| PubChem CID | 6386 |
|---|---|
| CAS | 75-65-0 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:45895 |
| MDL Number | MFCD00004464 |
| SMILES | CC(C)(C)O |
| Synonym | tert-butanol,tert-butyl alcohol,2-methyl-2-propanol,t-butanol,t-butyl hydroxide,1,1-dimethylethanol,trimethylcarbinol,trimethyl methanol,2-propanol, 2-methyl,t-butyl alcohol |
| IUPAC Name | 2-methylpropan-2-ol |
| InChI Key | DKGAVHZHDRPRBM-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
2,4-Dinitrophenylhydrazine Hydrochloride 98.0+%, TCI America™
CAS: 55907-61-4 Molecular Formula: C6H7ClN4O4 Molecular Weight (g/mol): 234.60 MDL Number: MFCD00050688 InChI Key: PUYFAZQODQZOFK-UHFFFAOYSA-N PubChem CID: 5463312 IUPAC Name: hydrogen (2,4-dinitrophenyl)hydrazine chloride SMILES: [H+].[Cl-].NNC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O
| PubChem CID | 5463312 |
|---|---|
| CAS | 55907-61-4 |
| Molecular Weight (g/mol) | 234.60 |
| MDL Number | MFCD00050688 |
| SMILES | [H+].[Cl-].NNC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O |
| IUPAC Name | hydrogen (2,4-dinitrophenyl)hydrazine chloride |
| InChI Key | PUYFAZQODQZOFK-UHFFFAOYSA-N |
| Molecular Formula | C6H7ClN4O4 |
Benzyl bromide, 98%
CAS: 100-39-0 MDL Number: MFCD00000172 InChI Key: AGEZXYOZHKGVCM-UHFFFAOYSA-N Synonym: benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite PubChem CID: 7498 ChEBI: CHEBI:59858 IUPAC Name: bromomethylbenzene SMILES: C1=CC=C(C=C1)CBr
| PubChem CID | 7498 |
|---|---|
| CAS | 100-39-0 |
| ChEBI | CHEBI:59858 |
| MDL Number | MFCD00000172 |
| SMILES | C1=CC=C(C=C1)CBr |
| Synonym | benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite |
| IUPAC Name | bromomethylbenzene |
| InChI Key | AGEZXYOZHKGVCM-UHFFFAOYSA-N |
Ethyl 3-dimethylaminopropionate, 97%
CAS: 20120-21-2 Molecular Formula: C7H15NO2 Molecular Weight (g/mol): 145.20 MDL Number: MFCD00015166 InChI Key: IZMJWGJGVGRWBW-UHFFFAOYSA-N Synonym: ethyl 3-dimethylamino propanoate,ethyl 3-dimethylaminopropionate,ethyl 3-dimethylamino propionate,n,n-dimethyl-beta-alanine ethyl ester,ethyl 3-n,n-dimethylamino propionate,ethyl n,n-dimethyl-beta-alaninate,ethyl beta-dimethylamino propionate,beta-alanine, n,n-dimethyl-, ethyl ester,ethyl 3-dimethyl-aminopropionate,ethyl-3-n,n-dimethylamino propionate PubChem CID: 88372 IUPAC Name: ethyl 3-(dimethylamino)propanoate SMILES: CCOC(=O)CCN(C)C
| PubChem CID | 88372 |
|---|---|
| CAS | 20120-21-2 |
| Molecular Weight (g/mol) | 145.20 |
| MDL Number | MFCD00015166 |
| SMILES | CCOC(=O)CCN(C)C |
| Synonym | ethyl 3-dimethylamino propanoate,ethyl 3-dimethylaminopropionate,ethyl 3-dimethylamino propionate,n,n-dimethyl-beta-alanine ethyl ester,ethyl 3-n,n-dimethylamino propionate,ethyl n,n-dimethyl-beta-alaninate,ethyl beta-dimethylamino propionate,beta-alanine, n,n-dimethyl-, ethyl ester,ethyl 3-dimethyl-aminopropionate,ethyl-3-n,n-dimethylamino propionate |
| IUPAC Name | ethyl 3-(dimethylamino)propanoate |
| InChI Key | IZMJWGJGVGRWBW-UHFFFAOYSA-N |
| Molecular Formula | C7H15NO2 |
Iron(III) acetylacetonate, 99+%
CAS: 14024-18-1 Molecular Formula: C15H21FeO6 Molecular Weight (g/mol): 353.17 MDL Number: MFCD00000020 InChI Key: AQBLLJNPHDIAPN-LNTINUHCSA-K Synonym: 2, 4-Pentanedione, iron(III) derivative,Ferric acetylacetonate IUPAC Name: iron(3+) tris((2Z)-4-oxopent-2-en-2-olate) SMILES: [Fe+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| CAS | 14024-18-1 |
|---|---|
| Molecular Weight (g/mol) | 353.17 |
| MDL Number | MFCD00000020 |
| SMILES | [Fe+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | 2, 4-Pentanedione, iron(III) derivative,Ferric acetylacetonate |
| IUPAC Name | iron(3+) tris((2Z)-4-oxopent-2-en-2-olate) |
| InChI Key | AQBLLJNPHDIAPN-LNTINUHCSA-K |
| Molecular Formula | C15H21FeO6 |
3-Fluoroaniline, 98+%
CAS: 372-19-0 Molecular Formula: C6H6FN Molecular Weight (g/mol): 111.119 MDL Number: MFCD00007758 InChI Key: QZVQQUVWFIZUBQ-UHFFFAOYSA-N Synonym: m-fluoroaniline,1-amino-3-fluorobenzene,3-fluoranilin,benzenamine, 3-fluoro,3-fluorobenzenamine,3-fluoro-phenylamine,aniline, 3-fluoro,3-fluorophenylamine,aniline, m-fluoro,3-fluoranilin czech PubChem CID: 9742 ChEBI: CHEBI:27873 IUPAC Name: 3-fluoroaniline SMILES: C1=CC(=CC(=C1)F)N
| PubChem CID | 9742 |
|---|---|
| CAS | 372-19-0 |
| Molecular Weight (g/mol) | 111.119 |
| ChEBI | CHEBI:27873 |
| MDL Number | MFCD00007758 |
| SMILES | C1=CC(=CC(=C1)F)N |
| Synonym | m-fluoroaniline,1-amino-3-fluorobenzene,3-fluoranilin,benzenamine, 3-fluoro,3-fluorobenzenamine,3-fluoro-phenylamine,aniline, 3-fluoro,3-fluorophenylamine,aniline, m-fluoro,3-fluoranilin czech |
| IUPAC Name | 3-fluoroaniline |
| InChI Key | QZVQQUVWFIZUBQ-UHFFFAOYSA-N |
| Molecular Formula | C6H6FN |
Isobutylene oxide, 98%
CAS: 558-30-5 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00066354 InChI Key: GELKGHVAFRCJNA-UHFFFAOYSA-N Synonym: isobutylene oxide,1,2-epoxy-2-methylpropane,isobutene oxide,isobutylene epoxide,isobutyleneoxide,oxirane, 2,2-dimethyl,1,2-epoxyisobutane,1,1-dimethylethylene oxide,1,2-isobutylene oxide,2-methyl-1-propene oxide PubChem CID: 11208 IUPAC Name: 2,2-dimethyloxirane SMILES: CC1(CO1)C
| PubChem CID | 11208 |
|---|---|
| CAS | 558-30-5 |
| Molecular Weight (g/mol) | 72.11 |
| MDL Number | MFCD00066354 |
| SMILES | CC1(CO1)C |
| Synonym | isobutylene oxide,1,2-epoxy-2-methylpropane,isobutene oxide,isobutylene epoxide,isobutyleneoxide,oxirane, 2,2-dimethyl,1,2-epoxyisobutane,1,1-dimethylethylene oxide,1,2-isobutylene oxide,2-methyl-1-propene oxide |
| IUPAC Name | 2,2-dimethyloxirane |
| InChI Key | GELKGHVAFRCJNA-UHFFFAOYSA-N |
| Molecular Formula | C4H8O |
Di-tert-butylchlorophosphine, 96%
CAS: 13716-10-4 Molecular Formula: C8H18ClP Molecular Weight (g/mol): 180.656 MDL Number: MFCD00008815 InChI Key: MCRSZLVSRGTMIH-UHFFFAOYSA-N Synonym: di-tert-butylchlorophosphine,di-tert-butylchlorophosphane,di-t-butylchlorophosphine,phosphinous chloride, bis 1,1-dimethylethyl,chlorodi-tert-butylphosphine,phosphinous chloride, di-tert-butyl,di-tert-butyl chloro phosphane,di-tert-butylphosphinous chloride,clptbu2,pubchem6477 PubChem CID: 139566 IUPAC Name: ditert-butyl(chloro)phosphane SMILES: CC(C)(C)P(C(C)(C)C)Cl
| PubChem CID | 139566 |
|---|---|
| CAS | 13716-10-4 |
| Molecular Weight (g/mol) | 180.656 |
| MDL Number | MFCD00008815 |
| SMILES | CC(C)(C)P(C(C)(C)C)Cl |
| Synonym | di-tert-butylchlorophosphine,di-tert-butylchlorophosphane,di-t-butylchlorophosphine,phosphinous chloride, bis 1,1-dimethylethyl,chlorodi-tert-butylphosphine,phosphinous chloride, di-tert-butyl,di-tert-butyl chloro phosphane,di-tert-butylphosphinous chloride,clptbu2,pubchem6477 |
| IUPAC Name | ditert-butyl(chloro)phosphane |
| InChI Key | MCRSZLVSRGTMIH-UHFFFAOYSA-N |
| Molecular Formula | C8H18ClP |
Propionamide, 97%
CAS: 79-05-0 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.09 MDL Number: MFCD00008039 InChI Key: QLNJFJADRCOGBJ-UHFFFAOYSA-N Synonym: propionamide,propylamide,propionic amide,propionimidic acid,propanimidic acid,propionic acid amide,amid kyseliny propionove,propanimidic acid van,propionimidic acid van,unii-qk07g0hp47 PubChem CID: 6578 ChEBI: CHEBI:45422 IUPAC Name: propanamide SMILES: CCC(=O)N
| PubChem CID | 6578 |
|---|---|
| CAS | 79-05-0 |
| Molecular Weight (g/mol) | 73.09 |
| ChEBI | CHEBI:45422 |
| MDL Number | MFCD00008039 |
| SMILES | CCC(=O)N |
| Synonym | propionamide,propylamide,propionic amide,propionimidic acid,propanimidic acid,propionic acid amide,amid kyseliny propionove,propanimidic acid van,propionimidic acid van,unii-qk07g0hp47 |
| IUPAC Name | propanamide |
| InChI Key | QLNJFJADRCOGBJ-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
| Physical Form | Liquid |
|---|---|
| Packaging | Plastic bottle |
| Chemical Name or Material | Tyrode's Solution |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
trans-Cinnamaldehyde 98.0+%, TCI America™
CAS: 14371-10-9 Molecular Formula: C9H8O Molecular Weight (g/mol): 132.16 MDL Number: MFCD00007000 InChI Key: KJPRLNWUNMBNBZ-QPJJXVBHSA-N Synonym: cinnamaldehyde,trans-cinnamaldehyde,cinnamic aldehyde,e-cinnamaldehyde,cinnamal,3-phenylacrylaldehyde,zimtaldehyde,cinnamylaldehyde,3-phenylpropenal,2e-3-phenylprop-2-enal PubChem CID: 637511 ChEBI: CHEBI:16731 IUPAC Name: (2E)-3-phenylprop-2-enal SMILES: O=C\C=C\C1=CC=CC=C1
| PubChem CID | 637511 |
|---|---|
| CAS | 14371-10-9 |
| Molecular Weight (g/mol) | 132.16 |
| ChEBI | CHEBI:16731 |
| MDL Number | MFCD00007000 |
| SMILES | O=C\C=C\C1=CC=CC=C1 |
| Synonym | cinnamaldehyde,trans-cinnamaldehyde,cinnamic aldehyde,e-cinnamaldehyde,cinnamal,3-phenylacrylaldehyde,zimtaldehyde,cinnamylaldehyde,3-phenylpropenal,2e-3-phenylprop-2-enal |
| IUPAC Name | (2E)-3-phenylprop-2-enal |
| InChI Key | KJPRLNWUNMBNBZ-QPJJXVBHSA-N |
| Molecular Formula | C9H8O |
Lithium Bis(trifluoromethanesulfonimide), 99%
CAS: 90076-65-6 Molecular Formula: C2F6LiNO4S2 Molecular Weight (g/mol): 287.09 MDL Number: MFCD00210017 InChI Key: QSZMZKBZAYQGRS-UHFFFAOYSA-N Synonym: lithium bis trifluoromethanesulfonyl imide,lithium bis trifluoromethyl sulfonyl amide,lithium bis trifluoromethanesulphonyl imide,litfsi,lithium bis trifluoromethylsulfonyl azanide,lithium bis trifluoromethylsulfonyl imide,bis trifluoromethane sulfonimide lithium salt,bistrifluoromethanesulfonimide lithium salt,lithium bis trifluoromethanesulfonyl amide,lithium triflimide PubChem CID: 3816071 IUPAC Name: lithium;bis(trifluoromethylsulfonyl)azanide SMILES: [Li+].C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
| PubChem CID | 3816071 |
|---|---|
| CAS | 90076-65-6 |
| Molecular Weight (g/mol) | 287.09 |
| MDL Number | MFCD00210017 |
| SMILES | [Li+].C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| Synonym | lithium bis trifluoromethanesulfonyl imide,lithium bis trifluoromethyl sulfonyl amide,lithium bis trifluoromethanesulphonyl imide,litfsi,lithium bis trifluoromethylsulfonyl azanide,lithium bis trifluoromethylsulfonyl imide,bis trifluoromethane sulfonimide lithium salt,bistrifluoromethanesulfonimide lithium salt,lithium bis trifluoromethanesulfonyl amide,lithium triflimide |
| IUPAC Name | lithium;bis(trifluoromethylsulfonyl)azanide |
| InChI Key | QSZMZKBZAYQGRS-UHFFFAOYSA-N |
| Molecular Formula | C2F6LiNO4S2 |
Magnesium bis(trifluoromethylsulfonyl)imide
CAS: 133395-16-1 Molecular Formula: C4F12MgN2O8S4 Molecular Weight (g/mol): 584.576 MDL Number: MFCD01321278 InChI Key: DMFBPGIDUUNBRU-UHFFFAOYSA-N Synonym: bis bis trifluoromethylsulfonyl amino magnesium,magnesium bis trifluoromethanesulfonimide,magnesium ii bis trifluoromethanesulfonyl imide,magnesium ii triflimide,magnesium bistrifluoromethanesulfonimide,magnesium bis trifluoromethylsulfonyl imide,magnesium 2+ bis bistriflylimide anion,bis trifluoromethanesulfonyl imide magnesium ii salt PubChem CID: 11851070 IUPAC Name: magnesium;bis(trifluoromethylsulfonyl)azanide SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Mg+2]
| PubChem CID | 11851070 |
|---|---|
| CAS | 133395-16-1 |
| Molecular Weight (g/mol) | 584.576 |
| MDL Number | MFCD01321278 |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Mg+2] |
| Synonym | bis bis trifluoromethylsulfonyl amino magnesium,magnesium bis trifluoromethanesulfonimide,magnesium ii bis trifluoromethanesulfonyl imide,magnesium ii triflimide,magnesium bistrifluoromethanesulfonimide,magnesium bis trifluoromethylsulfonyl imide,magnesium 2+ bis bistriflylimide anion,bis trifluoromethanesulfonyl imide magnesium ii salt |
| IUPAC Name | magnesium;bis(trifluoromethylsulfonyl)azanide |
| InChI Key | DMFBPGIDUUNBRU-UHFFFAOYSA-N |
| Molecular Formula | C4F12MgN2O8S4 |
Dehydroacetic acid sodium salt, 99%, Thermo Scientific Chemicals
CAS: 4418-26-2 Molecular Formula: C8H7O4Na MDL Number: MFCD00040583 Synonym: 3-Acetyl-6-methyl-2H-pyran-2, 4(3H)-dione sodium salt
| CAS | 4418-26-2 |
|---|---|
| MDL Number | MFCD00040583 |
| Synonym | 3-Acetyl-6-methyl-2H-pyran-2, 4(3H)-dione sodium salt |
| Molecular Formula | C8H7O4Na |