Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2,2,3,3,4,4,4-Heptafluorobutyl acrylate, 97%, stab. with 100 ppm 4-methoxyphenol
CAS: 424-64-6 Molecular Formula: C7H5F7O2 Molecular Weight (g/mol): 254.104 MDL Number: MFCD00039252 InChI Key: PLXOUIVCSUBZIX-UHFFFAOYSA-N Synonym: 1h,1h-heptafluorobutyl acrylate,2,2,3,3,4,4,4-heptafluorobutyl acrylate,heptafluorobutyl acrylate,2-propenoic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,2,2,3,3,4,4,4-heptafluorobutyl acrylate, stab. with 100 ppm 4-methoxyphenol,1h, 1h-heptafluorobutylacrylate,1,1-dihydroheptafluorobutyl acrylate,1h,1h-heptafluorobut-1-yl acrylat,2,2,3,3,4,4,4-heptafluorobutyl=propenoate PubChem CID: 67923 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutyl prop-2-enoate SMILES: C=CC(=O)OCC(C(C(F)(F)F)(F)F)(F)F
| PubChem CID | 67923 |
|---|---|
| CAS | 424-64-6 |
| Molecular Weight (g/mol) | 254.104 |
| MDL Number | MFCD00039252 |
| SMILES | C=CC(=O)OCC(C(C(F)(F)F)(F)F)(F)F |
| Synonym | 1h,1h-heptafluorobutyl acrylate,2,2,3,3,4,4,4-heptafluorobutyl acrylate,heptafluorobutyl acrylate,2-propenoic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,2,2,3,3,4,4,4-heptafluorobutyl acrylate, stab. with 100 ppm 4-methoxyphenol,1h, 1h-heptafluorobutylacrylate,1,1-dihydroheptafluorobutyl acrylate,1h,1h-heptafluorobut-1-yl acrylat,2,2,3,3,4,4,4-heptafluorobutyl=propenoate |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl prop-2-enoate |
| InChI Key | PLXOUIVCSUBZIX-UHFFFAOYSA-N |
| Molecular Formula | C7H5F7O2 |
Methyl dichloroacetate, 99%
CAS: 116-54-1 Molecular Formula: C3H4Cl2O2 Molecular Weight (g/mol): 142.97 MDL Number: MFCD00000843 InChI Key: HKMLRUAPIDAGIE-UHFFFAOYSA-N Synonym: methyl dichloroacetate,dichloroacetic acid methyl ester,acetic acid, dichloro-, methyl ester,ccris 7740,acetic acid, 2,2-dichloro-, methyl ester,methyldichloroethanoate,acmc-1brpm,dichloroacetic acid methyl,methyl2,2-dichloroacetate,wln: gygvo1 PubChem CID: 8315 IUPAC Name: methyl 2,2-dichloroacetate SMILES: COC(=O)C(Cl)Cl
| PubChem CID | 8315 |
|---|---|
| CAS | 116-54-1 |
| Molecular Weight (g/mol) | 142.97 |
| MDL Number | MFCD00000843 |
| SMILES | COC(=O)C(Cl)Cl |
| Synonym | methyl dichloroacetate,dichloroacetic acid methyl ester,acetic acid, dichloro-, methyl ester,ccris 7740,acetic acid, 2,2-dichloro-, methyl ester,methyldichloroethanoate,acmc-1brpm,dichloroacetic acid methyl,methyl2,2-dichloroacetate,wln: gygvo1 |
| IUPAC Name | methyl 2,2-dichloroacetate |
| InChI Key | HKMLRUAPIDAGIE-UHFFFAOYSA-N |
| Molecular Formula | C3H4Cl2O2 |
Graphite powder, natural, high purity, -200 mesh, 99.9995% (metals basis), Thermo Scientific Chemicals
CAS: 7782-42-5 Molecular Formula: C Molecular Weight (g/mol): 12.01 MDL Number: MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7782-42-5 |
| Molecular Weight (g/mol) | 12.01 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
1,10-Phenanthroline monohydrochloride monohydrate, 99%
CAS: 18851-33-7 Molecular Formula: C12H11ClN2O Molecular Weight (g/mol): 234.683 MDL Number: MFCD00150061 InChI Key: NDLHUHRGAIHALB-UHFFFAOYSA-N Synonym: 1,10-phenanthroline hydrochloride monohydrate,1,10-phenanthroline hydrochloride hydrate,1,10-phenanthroline monohydrochloride monohydrate,1,10-phenanthroline hydrate hydrochloride,1,10-phenanthroline, monohydrochloride, monohydrate,phen hydrate hydrochloride,acmc-209iz9,dsstox_cid_24309,dsstox_rid_80145,dsstox_gsid_44309 PubChem CID: 2723715 IUPAC Name: 1,10-phenanthroline;hydrate;hydrochloride SMILES: C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.O.Cl
| PubChem CID | 2723715 |
|---|---|
| CAS | 18851-33-7 |
| Molecular Weight (g/mol) | 234.683 |
| MDL Number | MFCD00150061 |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.O.Cl |
| Synonym | 1,10-phenanthroline hydrochloride monohydrate,1,10-phenanthroline hydrochloride hydrate,1,10-phenanthroline monohydrochloride monohydrate,1,10-phenanthroline hydrate hydrochloride,1,10-phenanthroline, monohydrochloride, monohydrate,phen hydrate hydrochloride,acmc-209iz9,dsstox_cid_24309,dsstox_rid_80145,dsstox_gsid_44309 |
| IUPAC Name | 1,10-phenanthroline;hydrate;hydrochloride |
| InChI Key | NDLHUHRGAIHALB-UHFFFAOYSA-N |
| Molecular Formula | C12H11ClN2O |
Phenol, 99.5%, extra pure, loose crystals, unstabilized
CAS: 108-95-2 Molecular Formula: C6H6O Molecular Weight (g/mol): 94.11 MDL Number: MFCD00002143 InChI Key: ISWSIDIOOBJBQZ-UHFFFAOYSA-N Synonym: carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol PubChem CID: 996 ChEBI: CHEBI:15882 IUPAC Name: phenol SMILES: OC1=CC=CC=C1
| PubChem CID | 996 |
|---|---|
| CAS | 108-95-2 |
| Molecular Weight (g/mol) | 94.11 |
| ChEBI | CHEBI:15882 |
| MDL Number | MFCD00002143 |
| SMILES | OC1=CC=CC=C1 |
| Synonym | carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol |
| IUPAC Name | phenol |
| InChI Key | ISWSIDIOOBJBQZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O |
Diethyl sulfate, 99%
CAS: 64-67-5 Molecular Formula: C4H10O4S Molecular Weight (g/mol): 154.18 MDL Number: MFCD00009099 InChI Key: DENRZWYUOJLTMF-UHFFFAOYSA-N Synonym: sulfuric acid, diethyl ester,diethyl sulphate,diethylsulfate,diaethylsulfat,sulfuric acid diethyl ester,diethyl tetraoxosulfate,diaethylsulfat german,unii-k0fo4vfa7i,des van,diethylester kyseliny sirove PubChem CID: 6163 ChEBI: CHEBI:34699 IUPAC Name: diethyl sulfate SMILES: CCOS(=O)(=O)OCC
| PubChem CID | 6163 |
|---|---|
| CAS | 64-67-5 |
| Molecular Weight (g/mol) | 154.18 |
| ChEBI | CHEBI:34699 |
| MDL Number | MFCD00009099 |
| SMILES | CCOS(=O)(=O)OCC |
| Synonym | sulfuric acid, diethyl ester,diethyl sulphate,diethylsulfate,diaethylsulfat,sulfuric acid diethyl ester,diethyl tetraoxosulfate,diaethylsulfat german,unii-k0fo4vfa7i,des van,diethylester kyseliny sirove |
| IUPAC Name | diethyl sulfate |
| InChI Key | DENRZWYUOJLTMF-UHFFFAOYSA-N |
| Molecular Formula | C4H10O4S |
N,N-Dimethylformamide dimethyl acetal, 94%
CAS: 4637-24-5 Molecular Formula: C5H13NO2 Molecular Weight (g/mol): 119.16 MDL Number: MFCD00008482 InChI Key: ZSXGLVDWWRXATF-UHFFFAOYSA-N Synonym: n,n-dimethylformamide dimethyl acetal,1,1-dimethoxytrimethylamine,dimethoxymethyl dimethylamine,methanamine, 1,1-dimethoxy-n,n-dimethyl,dimethylformamide-dimethylacetal,dmf dimethyl acetal,dmfdma,dimethylformamide dimethyl acetal,1,1-dimethoxy-n,n-dimethylmethylamine,dimethoxy dimethylamino methane PubChem CID: 78373 ChEBI: CHEBI:85061 IUPAC Name: (dimethoxymethyl)dimethylamine SMILES: COC(OC)N(C)C
| PubChem CID | 78373 |
|---|---|
| CAS | 4637-24-5 |
| Molecular Weight (g/mol) | 119.16 |
| ChEBI | CHEBI:85061 |
| MDL Number | MFCD00008482 |
| SMILES | COC(OC)N(C)C |
| Synonym | n,n-dimethylformamide dimethyl acetal,1,1-dimethoxytrimethylamine,dimethoxymethyl dimethylamine,methanamine, 1,1-dimethoxy-n,n-dimethyl,dimethylformamide-dimethylacetal,dmf dimethyl acetal,dmfdma,dimethylformamide dimethyl acetal,1,1-dimethoxy-n,n-dimethylmethylamine,dimethoxy dimethylamino methane |
| IUPAC Name | (dimethoxymethyl)dimethylamine |
| InChI Key | ZSXGLVDWWRXATF-UHFFFAOYSA-N |
| Molecular Formula | C5H13NO2 |
Isoprene, 98%, stabilized
CAS: 78-79-5 Molecular Formula: C5H8 Molecular Weight (g/mol): 68.11 MDL Number: MFCD00008600 InChI Key: RRHGJUQNOFWUDK-UHFFFAOYSA-N Synonym: isoprene,2-methyl-1,3-butadiene,isopentadiene,2-methylbutadiene,1,3-butadiene, 2-methyl,2-methyldivinyl,beta-methylbivinyl,isopreno,isoterpene,isopren PubChem CID: 6557 ChEBI: CHEBI:35194 IUPAC Name: 2-methylbuta-1,3-diene SMILES: CC(=C)C=C
| PubChem CID | 6557 |
|---|---|
| CAS | 78-79-5 |
| Molecular Weight (g/mol) | 68.11 |
| ChEBI | CHEBI:35194 |
| MDL Number | MFCD00008600 |
| SMILES | CC(=C)C=C |
| Synonym | isoprene,2-methyl-1,3-butadiene,isopentadiene,2-methylbutadiene,1,3-butadiene, 2-methyl,2-methyldivinyl,beta-methylbivinyl,isopreno,isoterpene,isopren |
| IUPAC Name | 2-methylbuta-1,3-diene |
| InChI Key | RRHGJUQNOFWUDK-UHFFFAOYSA-N |
| Molecular Formula | C5H8 |
Thiourea, ACS, 99% min.
CAS: 62-56-6 Molecular Formula: CH4N2S Molecular Weight (g/mol): 76.12 MDL Number: MFCD00008067 InChI Key: UMGDCJDMYOKAJW-UHFFFAOYSA-N Synonym: thiocarbamide,2-thiourea,pseudothiourea,isothiourea,sulourea,2-thiopseudourea,sulfourea,thiuronium,thiocarbonic acid diamide,urea, thio PubChem CID: 2723790 ChEBI: CHEBI:36946 IUPAC Name: thiourea SMILES: NC(N)=S
| PubChem CID | 2723790 |
|---|---|
| CAS | 62-56-6 |
| Molecular Weight (g/mol) | 76.12 |
| ChEBI | CHEBI:36946 |
| MDL Number | MFCD00008067 |
| SMILES | NC(N)=S |
| Synonym | thiocarbamide,2-thiourea,pseudothiourea,isothiourea,sulourea,2-thiopseudourea,sulfourea,thiuronium,thiocarbonic acid diamide,urea, thio |
| IUPAC Name | thiourea |
| InChI Key | UMGDCJDMYOKAJW-UHFFFAOYSA-N |
| Molecular Formula | CH4N2S |
Sulfur trioxide pyridine complex, technical, 48-50% active SO3
CAS: 26412-87-3 Molecular Formula: C5H5NO3S Molecular Weight (g/mol): 159.16 MDL Number: MFCD00012437 InChI Key: UDYFLDICVHJSOY-UHFFFAOYSA-N Synonym: pyridine sulfur trioxide,sulfur trioxide pyridine complex,pyridine; sulfur trioxide,pyridine sulfotrioxide,pyridine compound with sulfur trioxide 1:1,sulfur trioxide, compd. with pyridine,pyridine-sulfur trioxide complex,active sulfure trioxide,sulfur trioxide-pyridine,pyridine-sulfur trioxide PubChem CID: 168533 SMILES: O=S(=O)=O.C1=CC=NC=C1
| PubChem CID | 168533 |
|---|---|
| CAS | 26412-87-3 |
| Molecular Weight (g/mol) | 159.16 |
| MDL Number | MFCD00012437 |
| SMILES | O=S(=O)=O.C1=CC=NC=C1 |
| Synonym | pyridine sulfur trioxide,sulfur trioxide pyridine complex,pyridine; sulfur trioxide,pyridine sulfotrioxide,pyridine compound with sulfur trioxide 1:1,sulfur trioxide, compd. with pyridine,pyridine-sulfur trioxide complex,active sulfure trioxide,sulfur trioxide-pyridine,pyridine-sulfur trioxide |
| InChI Key | UDYFLDICVHJSOY-UHFFFAOYSA-N |
| Molecular Formula | C5H5NO3S |
Isophorondiamine, 99+%, mixture of cis and trans
CAS: 2855-13-2 Molecular Formula: C10H22N2 Molecular Weight (g/mol): 170.30 MDL Number: MFCD00019397 InChI Key: RNLHGQLZWXBQNY-UHFFFAOYNA-N Synonym: isophorone diamine,isophoronediamine,3-aminomethyl-3,5,5-trimethylcyclohexylamine,3-aminomethyl-3,5,5-trimethylcyclohexanamine,cyclohexanemethanamine, 5-amino-1,3,3-trimethyl,ipda,ccris 6680,5-amino-1,3,3-trimethylcyclohexanemethylamine,cyclohexanemethylamine, 5-amino-1,3,3-trimethyl,1-amino-3-aminomethyl-3,5,5-trimethylcyclohexane PubChem CID: 17857 IUPAC Name: 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine SMILES: CC1(C)CC(N)CC(C)(CN)C1
| PubChem CID | 17857 |
|---|---|
| CAS | 2855-13-2 |
| Molecular Weight (g/mol) | 170.30 |
| MDL Number | MFCD00019397 |
| SMILES | CC1(C)CC(N)CC(C)(CN)C1 |
| Synonym | isophorone diamine,isophoronediamine,3-aminomethyl-3,5,5-trimethylcyclohexylamine,3-aminomethyl-3,5,5-trimethylcyclohexanamine,cyclohexanemethanamine, 5-amino-1,3,3-trimethyl,ipda,ccris 6680,5-amino-1,3,3-trimethylcyclohexanemethylamine,cyclohexanemethylamine, 5-amino-1,3,3-trimethyl,1-amino-3-aminomethyl-3,5,5-trimethylcyclohexane |
| IUPAC Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine |
| InChI Key | RNLHGQLZWXBQNY-UHFFFAOYNA-N |
| Molecular Formula | C10H22N2 |
Propargyl acrylate, 96%, stab. with ca 200ppm BHT
CAS: 10477-47-1 Molecular Formula: C6H6O2 Molecular Weight (g/mol): 110.11 MDL Number: MFCD00078451 InChI Key: WPBNLDNIZUGLJL-UHFFFAOYSA-N Synonym: propargyl acrylate,2-propenoic acid, 2-propynyl ester,acrylic acid propargyl ester,2-propenoic acid, 2-propyn-1-yl ester,2-propynyl acrylate,prop-2-yn-1-yl acrylate,acmc-1c257,prop-2-yn-1-yl prop-2-enoate,propargyl acrylate, PubChem CID: 82655 SMILES: C=CC(=O)OCC#C
| PubChem CID | 82655 |
|---|---|
| CAS | 10477-47-1 |
| Molecular Weight (g/mol) | 110.11 |
| MDL Number | MFCD00078451 |
| SMILES | C=CC(=O)OCC#C |
| Synonym | propargyl acrylate,2-propenoic acid, 2-propynyl ester,acrylic acid propargyl ester,2-propenoic acid, 2-propyn-1-yl ester,2-propynyl acrylate,prop-2-yn-1-yl acrylate,acmc-1c257,prop-2-yn-1-yl prop-2-enoate,propargyl acrylate, |
| InChI Key | WPBNLDNIZUGLJL-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2 |
5-Nitroindole, 99%
CAS: 6146-52-7 Molecular Formula: C8H6N2O2 Molecular Weight (g/mol): 162.148 MDL Number: MFCD00005673 InChI Key: OZFPSOBLQZPIAV-UHFFFAOYSA-N Synonym: 5-nitroindole,1h-indole, 5-nitro,indole, 5-nitro,unii-o2bhx6edbn,5-nitro indole,ccris 3255,o2bhx6edbn,pubchem1711,acmc-209msr PubChem CID: 22523 IUPAC Name: 5-nitro-1H-indole SMILES: C1=CC2=C(C=CN2)C=C1[N+](=O)[O-]
| PubChem CID | 22523 |
|---|---|
| CAS | 6146-52-7 |
| Molecular Weight (g/mol) | 162.148 |
| MDL Number | MFCD00005673 |
| SMILES | C1=CC2=C(C=CN2)C=C1[N+](=O)[O-] |
| Synonym | 5-nitroindole,1h-indole, 5-nitro,indole, 5-nitro,unii-o2bhx6edbn,5-nitro indole,ccris 3255,o2bhx6edbn,pubchem1711,acmc-209msr |
| IUPAC Name | 5-nitro-1H-indole |
| InChI Key | OZFPSOBLQZPIAV-UHFFFAOYSA-N |
| Molecular Formula | C8H6N2O2 |
Decane, 99%, anhydrous, AcroSeal™
CAS: 124-18-5 Molecular Formula: C10H22 Molecular Weight (g/mol): 142.28 InChI Key: DIOQZVSQGTUSAI-UHFFFAOYSA-N Synonym: n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 PubChem CID: 15600 ChEBI: CHEBI:41808 IUPAC Name: decane SMILES: CCCCCCCCCC
| PubChem CID | 15600 |
|---|---|
| CAS | 124-18-5 |
| Molecular Weight (g/mol) | 142.28 |
| ChEBI | CHEBI:41808 |
| SMILES | CCCCCCCCCC |
| Synonym | n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 |
| IUPAC Name | decane |
| InChI Key | DIOQZVSQGTUSAI-UHFFFAOYSA-N |
| Molecular Formula | C10H22 |
2,3-Dimethyl-2,3-diphenylbutane, 95%
CAS: 1889-67-4 Molecular Formula: C18H22 Molecular Weight (g/mol): 238.37 MDL Number: MFCD00053713 InChI Key: HGTUJZTUQFXBIH-UHFFFAOYSA-N Synonym: 2,3-dimethyl-2,3-diphenylbutane,dicumene,2,3-dimethylbutane-2,3-diyl dibenzene,dicumyl,butane, 2,3-dimethyl-2,3-diphenyl,benzene, 1,1'-1,1,2,2-tetramethyl-1,2-ethanediyl bis,.alpha.,.alpha.'-dicumyl,2,3-dimethyl-3-phenylbutan-2-yl benzene,bibenzyl, .alpha.,.alpha.,.alpha.',.alpha.'-tetramethyl,1,1,2-trimethyl-2-phenylpropyl benzene PubChem CID: 74681 IUPAC Name: (2,3-dimethyl-3-phenylbutan-2-yl)benzene SMILES: CC(C)(C1=CC=CC=C1)C(C)(C)C2=CC=CC=C2
| PubChem CID | 74681 |
|---|---|
| CAS | 1889-67-4 |
| Molecular Weight (g/mol) | 238.37 |
| MDL Number | MFCD00053713 |
| SMILES | CC(C)(C1=CC=CC=C1)C(C)(C)C2=CC=CC=C2 |
| Synonym | 2,3-dimethyl-2,3-diphenylbutane,dicumene,2,3-dimethylbutane-2,3-diyl dibenzene,dicumyl,butane, 2,3-dimethyl-2,3-diphenyl,benzene, 1,1'-1,1,2,2-tetramethyl-1,2-ethanediyl bis,.alpha.,.alpha.'-dicumyl,2,3-dimethyl-3-phenylbutan-2-yl benzene,bibenzyl, .alpha.,.alpha.,.alpha.',.alpha.'-tetramethyl,1,1,2-trimethyl-2-phenylpropyl benzene |
| IUPAC Name | (2,3-dimethyl-3-phenylbutan-2-yl)benzene |
| InChI Key | HGTUJZTUQFXBIH-UHFFFAOYSA-N |
| Molecular Formula | C18H22 |