Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1,2-Propanediol, 99%, extra pure
CAS: 57-55-6 Molecular Formula: C3H8O2 Molecular Weight (g/mol): 76.09 MDL Number: MFCD00064272 InChI Key: DNIAPMSPPWPWGF-UHFFFAOYSA-N Synonym: 1,2-propanediol,propylene glycol,1,2-dihydroxypropane,2-hydroxypropanol,1,2-propylene glycol,methylethyl glycol,methylethylene glycol,monopropylene glycol,isopropylene glycol,dowfrost PubChem CID: 1030 ChEBI: CHEBI:16997 IUPAC Name: propane-1,2-diol SMILES: CC(CO)O
| PubChem CID | 1030 |
|---|---|
| CAS | 57-55-6 |
| Molecular Weight (g/mol) | 76.09 |
| ChEBI | CHEBI:16997 |
| MDL Number | MFCD00064272 |
| SMILES | CC(CO)O |
| Synonym | 1,2-propanediol,propylene glycol,1,2-dihydroxypropane,2-hydroxypropanol,1,2-propylene glycol,methylethyl glycol,methylethylene glycol,monopropylene glycol,isopropylene glycol,dowfrost |
| IUPAC Name | propane-1,2-diol |
| InChI Key | DNIAPMSPPWPWGF-UHFFFAOYSA-N |
| Molecular Formula | C3H8O2 |
4-Methoxybenzylamine, 98%
CAS: 2393-23-9 Molecular Formula: C8H11NO Molecular Weight (g/mol): 137.18 InChI Key: IDPURXSQCKYKIJ-UHFFFAOYSA-N Synonym: 4-methoxybenzylamine,4-methoxyphenyl methanamine,benzenemethanamine, 4-methoxy,p-methoxybenzylamine,4-methoxy-benzylamine,anisylamine,benzylamine, p-methoxy,4-methoxybenzyl amine,1-4-methoxyphenyl methanamine,4-methoxyphenyl methylamine PubChem CID: 75452 ChEBI: CHEBI:49837 IUPAC Name: (4-methoxyphenyl)methanamine SMILES: COC1=CC=C(C=C1)CN
| PubChem CID | 75452 |
|---|---|
| CAS | 2393-23-9 |
| Molecular Weight (g/mol) | 137.18 |
| ChEBI | CHEBI:49837 |
| SMILES | COC1=CC=C(C=C1)CN |
| Synonym | 4-methoxybenzylamine,4-methoxyphenyl methanamine,benzenemethanamine, 4-methoxy,p-methoxybenzylamine,4-methoxy-benzylamine,anisylamine,benzylamine, p-methoxy,4-methoxybenzyl amine,1-4-methoxyphenyl methanamine,4-methoxyphenyl methylamine |
| IUPAC Name | (4-methoxyphenyl)methanamine |
| InChI Key | IDPURXSQCKYKIJ-UHFFFAOYSA-N |
| Molecular Formula | C8H11NO |
N,N-Diethyl-p-phenylenediamine, 98%
CAS: 93-05-0 MDL Number: MFCD00007861 InChI Key: QNGVNLMMEQUVQK-UHFFFAOYSA-N Synonym: n,n-diethyl-1,4-phenylenediamine,4-amino-n,n-diethylaniline,n,n-diethyl-p-phenylenediamine,n1,n1-diethylbenzene-1,4-diamine,p-aminodiethylaniline,4-diethylamino aniline,p-amino-n,n-diethylaniline,n,n-diethyl-1,4-benzenediamine,diethylaminoaniline,p-diethylamino aniline PubChem CID: 7120 IUPAC Name: 4-N,4-N-diethylbenzene-1,4-diamine SMILES: CCN(CC)C1=CC=C(C=C1)N
| PubChem CID | 7120 |
|---|---|
| CAS | 93-05-0 |
| MDL Number | MFCD00007861 |
| SMILES | CCN(CC)C1=CC=C(C=C1)N |
| Synonym | n,n-diethyl-1,4-phenylenediamine,4-amino-n,n-diethylaniline,n,n-diethyl-p-phenylenediamine,n1,n1-diethylbenzene-1,4-diamine,p-aminodiethylaniline,4-diethylamino aniline,p-amino-n,n-diethylaniline,n,n-diethyl-1,4-benzenediamine,diethylaminoaniline,p-diethylamino aniline |
| IUPAC Name | 4-N,4-N-diethylbenzene-1,4-diamine |
| InChI Key | QNGVNLMMEQUVQK-UHFFFAOYSA-N |
Thermo Scientific Chemicals CAPSO sodium salt, 98%
CAS: 102601-34-3 Molecular Formula: C9H12NO4S Molecular Weight (g/mol): 230.26 MDL Number: MFCD00070063 InChI Key: CLEVULOKVPBHCU-VIFPVBQESA-M Synonym: capso sodium salt,sodium 3-cyclohexylamino-2-hydroxypropane-1-sulfonate,3-cyclohexylamino-2-hydroxypropanesulfonic acid sodium salt,capso sodium,capso, 0.2m buffer solution, ph 8.5,capso, 0.2m buffer solution, ph 9.0,capso, 0.2m buffer solution, ph 9.5,sodium 3-cyclohexylamino-2-hydroxypropanesulfonate,sodium 3-cyclohexylamino-2-hydroxy-propane-1-sulfonate,potassium 3-cyclohexylamino-2-hydroxypropane-1-sulfonate PubChem CID: 25000353 IUPAC Name: sodium;3-(cyclohexylamino)-2-hydroxypropane-1-sulfonate SMILES: O[C@@H](CNC1=CC=CC=C1)CS([O-])(=O)=O
| PubChem CID | 25000353 |
|---|---|
| CAS | 102601-34-3 |
| Molecular Weight (g/mol) | 230.26 |
| MDL Number | MFCD00070063 |
| SMILES | O[C@@H](CNC1=CC=CC=C1)CS([O-])(=O)=O |
| Synonym | capso sodium salt,sodium 3-cyclohexylamino-2-hydroxypropane-1-sulfonate,3-cyclohexylamino-2-hydroxypropanesulfonic acid sodium salt,capso sodium,capso, 0.2m buffer solution, ph 8.5,capso, 0.2m buffer solution, ph 9.0,capso, 0.2m buffer solution, ph 9.5,sodium 3-cyclohexylamino-2-hydroxypropanesulfonate,sodium 3-cyclohexylamino-2-hydroxy-propane-1-sulfonate,potassium 3-cyclohexylamino-2-hydroxypropane-1-sulfonate |
| IUPAC Name | sodium;3-(cyclohexylamino)-2-hydroxypropane-1-sulfonate |
| InChI Key | CLEVULOKVPBHCU-VIFPVBQESA-M |
| Molecular Formula | C9H12NO4S |
(+)-Rutin trihydrate, 95%
CAS: 250249-75-3 Molecular Formula: C27H36O19 Molecular Weight (g/mol): 664.566 MDL Number: MFCD00149490 InChI Key: NLLBWFFSGHKUSY-JPRRWYCFSA-N Synonym: rutoside trihydrate,+-rutin trihydrate,rutin trihydrate,rutin hydrate,unii-rf4n03853g,2-3,4-dihydroxyphenyl-5,7-dihydroxy-3-2s,3r,4s,5s,6r-3,4,5-trihydroxy-6-2r,3r,4r,5r,6s-3,4,5-trihydroxy-6-methyltetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy-4h-chromen-4-one trihydrate,rutoside trihydrate ep,rutin hydrate jan,rutin trihydrate hplc,rutin trihydrate, analytical standard PubChem CID: 16218542 IUPAC Name: 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one;trihydrate SMILES: CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O.O.O.O
| PubChem CID | 16218542 |
|---|---|
| CAS | 250249-75-3 |
| Molecular Weight (g/mol) | 664.566 |
| MDL Number | MFCD00149490 |
| SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O.O.O.O |
| Synonym | rutoside trihydrate,+-rutin trihydrate,rutin trihydrate,rutin hydrate,unii-rf4n03853g,2-3,4-dihydroxyphenyl-5,7-dihydroxy-3-2s,3r,4s,5s,6r-3,4,5-trihydroxy-6-2r,3r,4r,5r,6s-3,4,5-trihydroxy-6-methyltetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy-4h-chromen-4-one trihydrate,rutoside trihydrate ep,rutin hydrate jan,rutin trihydrate hplc,rutin trihydrate, analytical standard |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one;trihydrate |
| InChI Key | NLLBWFFSGHKUSY-JPRRWYCFSA-N |
| Molecular Formula | C27H36O19 |
Methacrylic acid, 99%, stab. with 100-250ppm hydroquinone or 4-methoxyphenol
CAS: 79-41-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00002651 InChI Key: CERQOIWHTDAKMF-UHFFFAOYSA-N Synonym: methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl PubChem CID: 4093 ChEBI: CHEBI:25219 IUPAC Name: 2-methylprop-2-enoic acid
| PubChem CID | 4093 |
|---|---|
| CAS | 79-41-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:25219 |
| MDL Number | MFCD00002651 |
| Synonym | methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl |
| IUPAC Name | 2-methylprop-2-enoic acid |
| InChI Key | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
2-Ethylhexyl methacrylate, 99%, stabilized
CAS: 688-84-6 Molecular Formula: C12H22O2 Molecular Weight (g/mol): 198.31 MDL Number: MFCD00009494 InChI Key: WDQMWEYDKDCEHT-UHFFFAOYSA-N Synonym: 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 PubChem CID: 12713 IUPAC Name: 2-ethylhexyl 2-methylprop-2-enoate SMILES: CCCCC(CC)COC(=O)C(=C)C
| PubChem CID | 12713 |
|---|---|
| CAS | 688-84-6 |
| Molecular Weight (g/mol) | 198.31 |
| MDL Number | MFCD00009494 |
| SMILES | CCCCC(CC)COC(=O)C(=C)C |
| Synonym | 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 |
| IUPAC Name | 2-ethylhexyl 2-methylprop-2-enoate |
| InChI Key | WDQMWEYDKDCEHT-UHFFFAOYSA-N |
| Molecular Formula | C12H22O2 |
Methacrylic acid, 99+%, stab. with 250ppm 4-methoxyphenol
CAS: 79-41-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00002651 InChI Key: CERQOIWHTDAKMF-UHFFFAOYSA-N Synonym: methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl PubChem CID: 4093 ChEBI: CHEBI:25219 IUPAC Name: 2-methylprop-2-enoic acid SMILES: CC(=C)C(=O)O
| PubChem CID | 4093 |
|---|---|
| CAS | 79-41-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:25219 |
| MDL Number | MFCD00002651 |
| SMILES | CC(=C)C(=O)O |
| Synonym | methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl |
| IUPAC Name | 2-methylprop-2-enoic acid |
| InChI Key | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
4-Chlorophenol, 99%
CAS: 106-48-9 Molecular Formula: C6H5ClO Molecular Weight (g/mol): 128.555 MDL Number: MFCD00002318 InChI Key: WXNZTHHGJRFXKQ-UHFFFAOYSA-N Synonym: p-chlorophenol,parachlorophenol,phenol, 4-chloro,4-hydroxychlorobenzene,phenol, p-chloro,applied 3-78,4-monochlorophenol,p-chlorophenic acid,p-chlorfenol,4-chloro-1-hydroxybenzene PubChem CID: 4684 ChEBI: CHEBI:28078 IUPAC Name: 4-chlorophenol SMILES: C1=CC(=CC=C1O)Cl
| PubChem CID | 4684 |
|---|---|
| CAS | 106-48-9 |
| Molecular Weight (g/mol) | 128.555 |
| ChEBI | CHEBI:28078 |
| MDL Number | MFCD00002318 |
| SMILES | C1=CC(=CC=C1O)Cl |
| Synonym | p-chlorophenol,parachlorophenol,phenol, 4-chloro,4-hydroxychlorobenzene,phenol, p-chloro,applied 3-78,4-monochlorophenol,p-chlorophenic acid,p-chlorfenol,4-chloro-1-hydroxybenzene |
| IUPAC Name | 4-chlorophenol |
| InChI Key | WXNZTHHGJRFXKQ-UHFFFAOYSA-N |
| Molecular Formula | C6H5ClO |
Methyl formate, 98%, for spectroscopy
CAS: 107-31-3 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00003291 InChI Key: TZIHFWKZFHZASV-UHFFFAOYSA-N Synonym: formic acid, methyl ester,methyl methanoate,methylformiat,formic acid methyl ester,formiate de methyle,methylformiaat,mravencan methylnaty,methylformate,caswell no. 570,hcooch3 PubChem CID: 7865 ChEBI: CHEBI:77699 IUPAC Name: methyl formate SMILES: COC=O
| PubChem CID | 7865 |
|---|---|
| CAS | 107-31-3 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:77699 |
| MDL Number | MFCD00003291 |
| SMILES | COC=O |
| Synonym | formic acid, methyl ester,methyl methanoate,methylformiat,formic acid methyl ester,formiate de methyle,methylformiaat,mravencan methylnaty,methylformate,caswell no. 570,hcooch3 |
| IUPAC Name | methyl formate |
| InChI Key | TZIHFWKZFHZASV-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Mercaptoacetic acid sodium salt, 98%
CAS: 367-51-1 Molecular Formula: C2H3NaO2S Molecular Weight (g/mol): 114.094 MDL Number: MFCD00043386 InChI Key: GNBVPFITFYNRCN-UHFFFAOYSA-M Synonym: sodium thioglycolate,sodium mercaptoacetate,mercaptoacetic acid sodium salt,mollescal sf,sodium 2-sulfanylacetate,thioglycolate sodium,sodium thioglycollate,mercaptoacetic acid, sodium salt,erhavit d,sodium 2-mercatoethanoate PubChem CID: 23690444 ChEBI: CHEBI:86481 IUPAC Name: sodium;2-sulfanylacetate SMILES: C(C(=O)[O-])S.[Na+]
| PubChem CID | 23690444 |
|---|---|
| CAS | 367-51-1 |
| Molecular Weight (g/mol) | 114.094 |
| ChEBI | CHEBI:86481 |
| MDL Number | MFCD00043386 |
| SMILES | C(C(=O)[O-])S.[Na+] |
| Synonym | sodium thioglycolate,sodium mercaptoacetate,mercaptoacetic acid sodium salt,mollescal sf,sodium 2-sulfanylacetate,thioglycolate sodium,sodium thioglycollate,mercaptoacetic acid, sodium salt,erhavit d,sodium 2-mercatoethanoate |
| IUPAC Name | sodium;2-sulfanylacetate |
| InChI Key | GNBVPFITFYNRCN-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2S |
Sodium trifluoroacetate, 98%
CAS: 2923-18-4 Molecular Formula: C2F3NaO2 Molecular Weight (g/mol): 136.01 MDL Number: MFCD00013217 InChI Key: UYCAUPASBSROMS-UHFFFAOYSA-M Synonym: sodium trifluoroacetate,trifluoroacetic acid sodium salt,acetic acid, trifluoro-, sodium salt,sodium perfluoroacetate,trifluoroacetate sodium,sodium 2,2,2-trifluoroacetate,trifluoroacetic acid sodium,trifluoroacetic acid,sodium salt,acetic acid, 2,2,2-trifluoro-, sodium salt 1:1,trifluoroacetic acid, sodium salt PubChem CID: 517019 SMILES: [Na+].[O-]C(=O)C(F)(F)F
| PubChem CID | 517019 |
|---|---|
| CAS | 2923-18-4 |
| Molecular Weight (g/mol) | 136.01 |
| MDL Number | MFCD00013217 |
| SMILES | [Na+].[O-]C(=O)C(F)(F)F |
| Synonym | sodium trifluoroacetate,trifluoroacetic acid sodium salt,acetic acid, trifluoro-, sodium salt,sodium perfluoroacetate,trifluoroacetate sodium,sodium 2,2,2-trifluoroacetate,trifluoroacetic acid sodium,trifluoroacetic acid,sodium salt,acetic acid, 2,2,2-trifluoro-, sodium salt 1:1,trifluoroacetic acid, sodium salt |
| InChI Key | UYCAUPASBSROMS-UHFFFAOYSA-M |
| Molecular Formula | C2F3NaO2 |
p-Chloranil, 97%
CAS: 118-75-2 Molecular Formula: C6Cl4O2 Molecular Weight (g/mol): 245.86 MDL Number: MFCD00001594 InChI Key: UGNWTBMOAKPKBL-UHFFFAOYSA-N Synonym: chloranil,p-chloranil,tetrachloro-p-benzoquinone,tetrachloro-1,4-benzoquinone,tetrachlorobenzoquinone,spergon,coversan,reranil,vulklor,2,3,5,6-tetrachloro-1,4-benzoquinone PubChem CID: 8371 ChEBI: CHEBI:36703 IUPAC Name: 2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione SMILES: ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O
| PubChem CID | 8371 |
|---|---|
| CAS | 118-75-2 |
| Molecular Weight (g/mol) | 245.86 |
| ChEBI | CHEBI:36703 |
| MDL Number | MFCD00001594 |
| SMILES | ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O |
| Synonym | chloranil,p-chloranil,tetrachloro-p-benzoquinone,tetrachloro-1,4-benzoquinone,tetrachlorobenzoquinone,spergon,coversan,reranil,vulklor,2,3,5,6-tetrachloro-1,4-benzoquinone |
| IUPAC Name | 2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
| InChI Key | UGNWTBMOAKPKBL-UHFFFAOYSA-N |
| Molecular Formula | C6Cl4O2 |
trans-1,2-Dibenzoylethylene 98.0+%, TCI America™
CAS: 959-28-4 Molecular Formula: C16H12O2 Molecular Weight (g/mol): 236.27 MDL Number: MFCD00003083 InChI Key: WYCXGQSQHAXLPK-VAWYXSNFSA-N Synonym: trans-1,2-dibenzoylethylene,dibenzoylethylene,1,2-dibenzoylethylene,1,4-diphenyl-2-butene-1,4-dione,trans-1,4-diphenyl-2-butene-1,4-dione,1,2-dibenzoylethene,ethylene, 1,2-dibenzoyl,usaf nd-57,2-butene-1,4-dione, 1,4-diphenyl,trans-diphenacylidene PubChem CID: 735960 IUPAC Name: (E)-1,4-diphenylbut-2-ene-1,4-dione SMILES: C1=CC=C(C=C1)C(=O)C=CC(=O)C2=CC=CC=C2
| PubChem CID | 735960 |
|---|---|
| CAS | 959-28-4 |
| Molecular Weight (g/mol) | 236.27 |
| MDL Number | MFCD00003083 |
| SMILES | C1=CC=C(C=C1)C(=O)C=CC(=O)C2=CC=CC=C2 |
| Synonym | trans-1,2-dibenzoylethylene,dibenzoylethylene,1,2-dibenzoylethylene,1,4-diphenyl-2-butene-1,4-dione,trans-1,4-diphenyl-2-butene-1,4-dione,1,2-dibenzoylethene,ethylene, 1,2-dibenzoyl,usaf nd-57,2-butene-1,4-dione, 1,4-diphenyl,trans-diphenacylidene |
| IUPAC Name | (E)-1,4-diphenylbut-2-ene-1,4-dione |
| InChI Key | WYCXGQSQHAXLPK-VAWYXSNFSA-N |
| Molecular Formula | C16H12O2 |
Diethylene glycol monoethyl ether, 98%
CAS: 111-90-0 Molecular Formula: C6H14O3 Molecular Weight (g/mol): 134.175 MDL Number: MFCD00002872 InChI Key: XXJWXESWEXIICW-UHFFFAOYSA-N Synonym: diethylene glycol monoethyl ether,2-2-ethoxyethoxy ethanol,carbitol,transcutol,ethoxy diglycol,dioxitol,ethyl carbitol,ethyl digol,carbitol solvent,ethanol, 2-2-ethoxyethoxy PubChem CID: 8146 ChEBI: CHEBI:40572 IUPAC Name: 2-(2-ethoxyethoxy)ethanol SMILES: CCOCCOCCO
| PubChem CID | 8146 |
|---|---|
| CAS | 111-90-0 |
| Molecular Weight (g/mol) | 134.175 |
| ChEBI | CHEBI:40572 |
| MDL Number | MFCD00002872 |
| SMILES | CCOCCOCCO |
| Synonym | diethylene glycol monoethyl ether,2-2-ethoxyethoxy ethanol,carbitol,transcutol,ethoxy diglycol,dioxitol,ethyl carbitol,ethyl digol,carbitol solvent,ethanol, 2-2-ethoxyethoxy |
| IUPAC Name | 2-(2-ethoxyethoxy)ethanol |
| InChI Key | XXJWXESWEXIICW-UHFFFAOYSA-N |
| Molecular Formula | C6H14O3 |