Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
tert-Butyldimethylsilane, 95%
CAS: 29681-57-0 Molecular Formula: C6H16Si Molecular Weight (g/mol): 116.28 InChI Key: ILMRJRBKQSSXGY-UHFFFAOYSA-N Synonym: tert-butyldimethylsilane,t-butyldimethylsilane,tert-butyldimethylsilyl,silane, 1,1-dimethylethyl dimethyl,t-butyldimethylsilyl,t-butyl-dimethylsilyl,t-butyl-dimethyl-silyl,tert-butyl dimethylsilane,tert-butyldimethylsilyl group PubChem CID: 9898815 IUPAC Name: tert-butyl(dimethyl)silicon SMILES: CC(C)(C)[Si](C)C
| PubChem CID | 9898815 |
|---|---|
| CAS | 29681-57-0 |
| Molecular Weight (g/mol) | 116.28 |
| SMILES | CC(C)(C)[Si](C)C |
| Synonym | tert-butyldimethylsilane,t-butyldimethylsilane,tert-butyldimethylsilyl,silane, 1,1-dimethylethyl dimethyl,t-butyldimethylsilyl,t-butyl-dimethylsilyl,t-butyl-dimethyl-silyl,tert-butyl dimethylsilane,tert-butyldimethylsilyl group |
| IUPAC Name | tert-butyl(dimethyl)silicon |
| InChI Key | ILMRJRBKQSSXGY-UHFFFAOYSA-N |
| Molecular Formula | C6H16Si |
Sulfolane, 99%
CAS: 126-33-0 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.17 MDL Number: MFCD00005484 InChI Key: HXJUTPCZVOIRIF-UHFFFAOYSA-N Synonym: sulfolane,tetramethylene sulfone,tetrahydrothiophene 1,1-dioxide,sulfolan,sulpholane,sulfalone,sulphoxaline,1,1-dioxothiolan,dioxothiolan,thiophan sulfone PubChem CID: 31347 ChEBI: CHEBI:74794 SMILES: O=S1(=O)CCCC1
| PubChem CID | 31347 |
|---|---|
| CAS | 126-33-0 |
| Molecular Weight (g/mol) | 120.17 |
| ChEBI | CHEBI:74794 |
| MDL Number | MFCD00005484 |
| SMILES | O=S1(=O)CCCC1 |
| Synonym | sulfolane,tetramethylene sulfone,tetrahydrothiophene 1,1-dioxide,sulfolan,sulpholane,sulfalone,sulphoxaline,1,1-dioxothiolan,dioxothiolan,thiophan sulfone |
| InChI Key | HXJUTPCZVOIRIF-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
(+)-Catechin hydrate
CAS: 225937-10-0 Molecular Formula: C15H14O6 Molecular Weight (g/mol): 290.27 MDL Number: MFCD00150865 InChI Key: PFTAWBLQPZVEMU-UYWMCZCJNA-N IUPAC Name: 2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol hydrate SMILES: O[C@H]1CC2=C(O)C=C(O)C=C2O[C@@H]1C1=CC=C(O)C(O)=C1
| CAS | 225937-10-0 |
|---|---|
| Molecular Weight (g/mol) | 290.27 |
| MDL Number | MFCD00150865 |
| SMILES | O[C@H]1CC2=C(O)C=C(O)C=C2O[C@@H]1C1=CC=C(O)C(O)=C1 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol hydrate |
| InChI Key | PFTAWBLQPZVEMU-UYWMCZCJNA-N |
| Molecular Formula | C15H14O6 |
p-Anisic Acid 99.0+%, TCI America™
CAS: 100-09-4 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002542 InChI Key: ZEYHEAKUIGZSGI-UHFFFAOYSA-N Synonym: p-anisic acid,anisic acid,p-methoxybenzoic acid,draconic acid,4-anisic acid,benzoic acid, 4-methoxy,anisic acid, para,4-methoxybenzoate,para-anisic acid,anisic acid, p-isomer PubChem CID: 7478 ChEBI: CHEBI:40813 IUPAC Name: 4-methoxybenzoic acid SMILES: COC1=CC=C(C=C1)C(O)=O
| PubChem CID | 7478 |
|---|---|
| CAS | 100-09-4 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:40813 |
| MDL Number | MFCD00002542 |
| SMILES | COC1=CC=C(C=C1)C(O)=O |
| Synonym | p-anisic acid,anisic acid,p-methoxybenzoic acid,draconic acid,4-anisic acid,benzoic acid, 4-methoxy,anisic acid, para,4-methoxybenzoate,para-anisic acid,anisic acid, p-isomer |
| IUPAC Name | 4-methoxybenzoic acid |
| InChI Key | ZEYHEAKUIGZSGI-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Sodium tert-Butoxide 98.0+%, TCI America™
CAS: 865-48-5 Molecular Formula: C4H9NaO Molecular Weight (g/mol): 96.105 MDL Number: MFCD00040575 InChI Key: MFRIHAYPQRLWNB-UHFFFAOYSA-N Synonym: sodium tert-butoxide,sodium 2-methylpropan-2-olate,sodium t-butoxide,sodium-t-butoxide,t-butoxy sodium,tert-butoxysodium,naotbu,tbuona,2-propanol, 2-methyl-, sodium salt,sodium-tert-butoxide PubChem CID: 23676156 IUPAC Name: sodium;2-methylpropan-2-olate SMILES: CC(C)(C)[O-].[Na+]
| PubChem CID | 23676156 |
|---|---|
| CAS | 865-48-5 |
| Molecular Weight (g/mol) | 96.105 |
| MDL Number | MFCD00040575 |
| SMILES | CC(C)(C)[O-].[Na+] |
| Synonym | sodium tert-butoxide,sodium 2-methylpropan-2-olate,sodium t-butoxide,sodium-t-butoxide,t-butoxy sodium,tert-butoxysodium,naotbu,tbuona,2-propanol, 2-methyl-, sodium salt,sodium-tert-butoxide |
| IUPAC Name | sodium;2-methylpropan-2-olate |
| InChI Key | MFRIHAYPQRLWNB-UHFFFAOYSA-N |
| Molecular Formula | C4H9NaO |
Benzyl mercaptan, 99%
CAS: 100-53-8 Molecular Formula: C7H8S Molecular Weight (g/mol): 124.20 MDL Number: MFCD00004867,MFCD00801588,MFCD01863867 InChI Key: UENWRTRMUIOCKN-UHFFFAOYSA-N Synonym: benzyl mercaptan,benzenemethanethiol,benzylthiol,alpha-toluenethiol,thiobenzyl alcohol,benzyl hydrosulfide,alpha-toluolthiol,benzylhydrosulfide,phenylmethyl mercaptan,benzylmercaptan PubChem CID: 7509 IUPAC Name: phenylmethanethiol SMILES: SCC1=CC=CC=C1
| PubChem CID | 7509 |
|---|---|
| CAS | 100-53-8 |
| Molecular Weight (g/mol) | 124.20 |
| MDL Number | MFCD00004867,MFCD00801588,MFCD01863867 |
| SMILES | SCC1=CC=CC=C1 |
| Synonym | benzyl mercaptan,benzenemethanethiol,benzylthiol,alpha-toluenethiol,thiobenzyl alcohol,benzyl hydrosulfide,alpha-toluolthiol,benzylhydrosulfide,phenylmethyl mercaptan,benzylmercaptan |
| IUPAC Name | phenylmethanethiol |
| InChI Key | UENWRTRMUIOCKN-UHFFFAOYSA-N |
| Molecular Formula | C7H8S |
1-Naphthaldehyde, 95%
CAS: 66-77-3 Molecular Formula: C11H8O Molecular Weight (g/mol): 156.18 MDL Number: MFCD00004003 InChI Key: SQAINHDHICKHLX-UHFFFAOYSA-N Synonym: 1-naphthaldehyde,1-formylnaphthalene,1-naphthalenecarboxaldehyde,1-naphthylaldehyde,alpha-naphthal,alpha-naphthaldehyde,naphthaldehyde,.alpha.-naphthal,alpha-naphthylcarboxaldehyde,alpha-naphthylaldehyde PubChem CID: 6195 ChEBI: CHEBI:52367 IUPAC Name: naphthalene-1-carbaldehyde SMILES: O=CC1=C2C=CC=CC2=CC=C1
| PubChem CID | 6195 |
|---|---|
| CAS | 66-77-3 |
| Molecular Weight (g/mol) | 156.18 |
| ChEBI | CHEBI:52367 |
| MDL Number | MFCD00004003 |
| SMILES | O=CC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthaldehyde,1-formylnaphthalene,1-naphthalenecarboxaldehyde,1-naphthylaldehyde,alpha-naphthal,alpha-naphthaldehyde,naphthaldehyde,.alpha.-naphthal,alpha-naphthylcarboxaldehyde,alpha-naphthylaldehyde |
| IUPAC Name | naphthalene-1-carbaldehyde |
| InChI Key | SQAINHDHICKHLX-UHFFFAOYSA-N |
| Molecular Formula | C11H8O |
4-tert-Butylcatechol, 98%
CAS: 98-29-3 Molecular Formula: C10H14O2 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00002201 InChI Key: XESZUVZBAMCAEJ-UHFFFAOYSA-N Synonym: 4-tert-butylcatechol,p-tert-butylcatechol,4-tert-butylpyrocatechol,p-tert-butyl catechol,4-tert-butyl benzene-1,2-diol,4-t-butylpyrocatechol,p-tert-butylpyrocatechol,4-t-butylcatechol,1,2-benzenediol, 4-1,1-dimethylethyl,4-tert-butylcatechin PubChem CID: 7381 IUPAC Name: 4-tert-butylbenzene-1,2-diol SMILES: CC(C)(C)C1=CC=C(O)C(O)=C1
| PubChem CID | 7381 |
|---|---|
| CAS | 98-29-3 |
| Molecular Weight (g/mol) | 166.22 |
| MDL Number | MFCD00002201 |
| SMILES | CC(C)(C)C1=CC=C(O)C(O)=C1 |
| Synonym | 4-tert-butylcatechol,p-tert-butylcatechol,4-tert-butylpyrocatechol,p-tert-butyl catechol,4-tert-butyl benzene-1,2-diol,4-t-butylpyrocatechol,p-tert-butylpyrocatechol,4-t-butylcatechol,1,2-benzenediol, 4-1,1-dimethylethyl,4-tert-butylcatechin |
| IUPAC Name | 4-tert-butylbenzene-1,2-diol |
| InChI Key | XESZUVZBAMCAEJ-UHFFFAOYSA-N |
| Molecular Formula | C10H14O2 |
Methyl p-toluenesulfonate, 98%
CAS: 80-48-8 Molecular Formula: C8H10O3S Molecular Weight (g/mol): 186.225 MDL Number: MFCD00008417 InChI Key: VUQUOGPMUUJORT-UHFFFAOYSA-N Synonym: methyl p-toluenesulfonate,methyl tosylate,methyl p-tosylate,methyl toluene-4-sulfonate,methyl-p-toluenesulfonate,p-toluenesulfonic acid, methyl ester,benzenesulfonic acid, 4-methyl-, methyl ester,methyl toluene-4-sulphonate,p-toluenesulfonic acid methyl ester,p-methylbenzenesulfonate methyl ester PubChem CID: 6645 IUPAC Name: methyl 4-methylbenzenesulfonate SMILES: CC1=CC=C(C=C1)S(=O)(=O)OC
| PubChem CID | 6645 |
|---|---|
| CAS | 80-48-8 |
| Molecular Weight (g/mol) | 186.225 |
| MDL Number | MFCD00008417 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC |
| Synonym | methyl p-toluenesulfonate,methyl tosylate,methyl p-tosylate,methyl toluene-4-sulfonate,methyl-p-toluenesulfonate,p-toluenesulfonic acid, methyl ester,benzenesulfonic acid, 4-methyl-, methyl ester,methyl toluene-4-sulphonate,p-toluenesulfonic acid methyl ester,p-methylbenzenesulfonate methyl ester |
| IUPAC Name | methyl 4-methylbenzenesulfonate |
| InChI Key | VUQUOGPMUUJORT-UHFFFAOYSA-N |
| Molecular Formula | C8H10O3S |
Methoxypolyethylene glycol amine, M.W. 1,000
CAS: 80506-64-5 Molecular Formula: H2NCH2CH2(OCH2CH2)nOCH3 Molecular Weight (g/mol): 559.69 MDL Number: MFCD00131599 InChI Key: QWCGXANSAOXRFE-UHFFFAOYSA-N Synonym: 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontan-37-amine,mpeg12-nh2,mpeg12-amine,m-dpeg12-amine,m-peg12-amine,ambotzpeg1655,m-dpeg r 12-amine,aminopolyethylene glycol 5'000 monomethyl ether,3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaheptatriacontane-1-amine IUPAC Name: 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontan-37-amine SMILES: COCCOCCN
| CAS | 80506-64-5 |
|---|---|
| Molecular Weight (g/mol) | 559.69 |
| MDL Number | MFCD00131599 |
| SMILES | COCCOCCN |
| Synonym | 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontan-37-amine,mpeg12-nh2,mpeg12-amine,m-dpeg12-amine,m-peg12-amine,ambotzpeg1655,m-dpeg r 12-amine,aminopolyethylene glycol 5'000 monomethyl ether,3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaheptatriacontane-1-amine |
| IUPAC Name | 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontan-37-amine |
| InChI Key | QWCGXANSAOXRFE-UHFFFAOYSA-N |
| Molecular Formula | H2NCH2CH2(OCH2CH2)nOCH3 |
Tetrasodium N,N-Bis(carboxymethyl)-L-glutamate (ca. 40% in Water), TCI America™
CAS: 51981-21-6 Molecular Formula: C9H9NNa4O8 Molecular Weight (g/mol): 351.129 MDL Number: MFCD01862262 InChI Key: UZVUJVFQFNHRSY-OUTKXMMCSA-J Synonym: N,N-Bis(carboxymethyl)-L-glutamic Acid Tetrasodium Salt PubChem CID: 44630158 IUPAC Name: tetrasodium;(2S)-2-[bis(carboxylatomethyl)amino]pentanedioate SMILES: C(CC(=O)[O-])C(C(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].[Na+]
| PubChem CID | 44630158 |
|---|---|
| CAS | 51981-21-6 |
| Molecular Weight (g/mol) | 351.129 |
| MDL Number | MFCD01862262 |
| SMILES | C(CC(=O)[O-])C(C(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
| Synonym | N,N-Bis(carboxymethyl)-L-glutamic Acid Tetrasodium Salt |
| IUPAC Name | tetrasodium;(2S)-2-[bis(carboxylatomethyl)amino]pentanedioate |
| InChI Key | UZVUJVFQFNHRSY-OUTKXMMCSA-J |
| Molecular Formula | C9H9NNa4O8 |
Cyanogen iodide, 98%, Thermo Scientific Chemicals
CAS: 506-78-5 Molecular Formula: CIN InChI Key: WPBXOELOQKLBDF-UHFFFAOYSA-N Synonym: cyanogen iodide,iodine cyanide,jodcyan,iodocyanide,iodine monocyanide,cyanogen monoiodide,iodine cyanide i cn,unii-81esv254uf,cyanic iodide,cyano iodide PubChem CID: 10478 IUPAC Name: carbononitridic iodide SMILES: C(#N)I
| PubChem CID | 10478 |
|---|---|
| CAS | 506-78-5 |
| SMILES | C(#N)I |
| Synonym | cyanogen iodide,iodine cyanide,jodcyan,iodocyanide,iodine monocyanide,cyanogen monoiodide,iodine cyanide i cn,unii-81esv254uf,cyanic iodide,cyano iodide |
| IUPAC Name | carbononitridic iodide |
| InChI Key | WPBXOELOQKLBDF-UHFFFAOYSA-N |
| Molecular Formula | CIN |
Pyromellitic dianhydride, 98%
CAS: 89-32-7 Molecular Formula: C10H2O6 Molecular Weight (g/mol): 218.12 MDL Number: MFCD00005005 InChI Key: ANSXAPJVJOKRDJ-UHFFFAOYSA-N Synonym: pyromellitic dianhydride,pyromellitic anhydride,pyromellitic acid anhydride,1,2,4,5-benzenetetracarboxylic anhydride,pyromellitic acid dianhydride,1h,3h-benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetrone,pmda,benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetraone,unii-2z22t30qzq,1,2,4,5-benzenetetracarboxylic dianhydride PubChem CID: 6966 SMILES: O=C1OC(=O)C2=CC3=C(C=C12)C(=O)OC3=O
| PubChem CID | 6966 |
|---|---|
| CAS | 89-32-7 |
| Molecular Weight (g/mol) | 218.12 |
| MDL Number | MFCD00005005 |
| SMILES | O=C1OC(=O)C2=CC3=C(C=C12)C(=O)OC3=O |
| Synonym | pyromellitic dianhydride,pyromellitic anhydride,pyromellitic acid anhydride,1,2,4,5-benzenetetracarboxylic anhydride,pyromellitic acid dianhydride,1h,3h-benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetrone,pmda,benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetraone,unii-2z22t30qzq,1,2,4,5-benzenetetracarboxylic dianhydride |
| InChI Key | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| Molecular Formula | C10H2O6 |
1-Octanesulfonic acid, sodium salt, 99+%, Ion pair chromatography, anhydrous
CAS: 5324-84-5 Molecular Formula: C8H17NaO3S Molecular Weight (g/mol): 216.27 MDL Number: MFCD00007544 InChI Key: HRQDCDQDOPSGBR-UHFFFAOYSA-M Synonym: sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 PubChem CID: 23669624 IUPAC Name: sodium;octane-1-sulfonate SMILES: [Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23669624 |
|---|---|
| CAS | 5324-84-5 |
| Molecular Weight (g/mol) | 216.27 |
| MDL Number | MFCD00007544 |
| SMILES | [Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 |
| IUPAC Name | sodium;octane-1-sulfonate |
| InChI Key | HRQDCDQDOPSGBR-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO3S |