Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Phenetole, 98+%
CAS: 103-73-1 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.167 MDL Number: MFCD00009090 InChI Key: DLRJIFUOBPOJNS-UHFFFAOYSA-N Synonym: phenetole,benzene, ethoxy,ethyl phenyl ether,phenetol,phenyl ethyl ether,phenoxyethane,a phenoxyethane,ether, ethyl phenyl,unii-rb8lu2c57f PubChem CID: 7674 ChEBI: CHEBI:67129 IUPAC Name: ethoxybenzene SMILES: CCOC1=CC=CC=C1
| PubChem CID | 7674 |
|---|---|
| CAS | 103-73-1 |
| Molecular Weight (g/mol) | 122.167 |
| ChEBI | CHEBI:67129 |
| MDL Number | MFCD00009090 |
| SMILES | CCOC1=CC=CC=C1 |
| Synonym | phenetole,benzene, ethoxy,ethyl phenyl ether,phenetol,phenyl ethyl ether,phenoxyethane,a phenoxyethane,ether, ethyl phenyl,unii-rb8lu2c57f |
| IUPAC Name | ethoxybenzene |
| InChI Key | DLRJIFUOBPOJNS-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
2-Amino-5-cyanopyridine, 98%
CAS: 4214-73-7 Molecular Formula: C6H6N3 Molecular Weight (g/mol): 120.13 MDL Number: MFCD00128902 InChI Key: KDVBYUUGYXUXNL-UHFFFAOYSA-O Synonym: 2-amino-5-cyanopyridine,6-aminonicotinonitrile,6-amino-3-pyridinecarbonitrile,6-amino-nicotinonitrile,3-pyridinecarbonitrile, 6-amino,2-amino-5-cyano pyridine,6-aminonicotinonitril,zlchem 518,pubchem5752,acmc-209jnu PubChem CID: 818260 IUPAC Name: 6-aminopyridine-3-carbonitrile SMILES: NC1=CC=C(C=[NH+]1)C#N
| PubChem CID | 818260 |
|---|---|
| CAS | 4214-73-7 |
| Molecular Weight (g/mol) | 120.13 |
| MDL Number | MFCD00128902 |
| SMILES | NC1=CC=C(C=[NH+]1)C#N |
| Synonym | 2-amino-5-cyanopyridine,6-aminonicotinonitrile,6-amino-3-pyridinecarbonitrile,6-amino-nicotinonitrile,3-pyridinecarbonitrile, 6-amino,2-amino-5-cyano pyridine,6-aminonicotinonitril,zlchem 518,pubchem5752,acmc-209jnu |
| IUPAC Name | 6-aminopyridine-3-carbonitrile |
| InChI Key | KDVBYUUGYXUXNL-UHFFFAOYSA-O |
| Molecular Formula | C6H6N3 |
1,2-Dimethylimidazole, 96+%
CAS: 1739-84-0 Molecular Formula: C5H8N2 Molecular Weight (g/mol): 96.13 MDL Number: MFCD00005294 InChI Key: GIWQSPITLQVMSG-UHFFFAOYSA-N Synonym: 1,2-dimethyl-1h-imidazole,1h-imidazole, 1,2-dimethyl,imidazole, 1,2-dimethyl,1h-imidazole, dimethyl,unii-q41bc3grjb,q41bc3grjb,lupragen r dmi,1,2-dimethylimdazole,1,2 dimethylimidazole,n,2-dimethylimidazole PubChem CID: 15617 IUPAC Name: 1,2-dimethylimidazole SMILES: CN1C=CN=C1C
| PubChem CID | 15617 |
|---|---|
| CAS | 1739-84-0 |
| Molecular Weight (g/mol) | 96.13 |
| MDL Number | MFCD00005294 |
| SMILES | CN1C=CN=C1C |
| Synonym | 1,2-dimethyl-1h-imidazole,1h-imidazole, 1,2-dimethyl,imidazole, 1,2-dimethyl,1h-imidazole, dimethyl,unii-q41bc3grjb,q41bc3grjb,lupragen r dmi,1,2-dimethylimdazole,1,2 dimethylimidazole,n,2-dimethylimidazole |
| IUPAC Name | 1,2-dimethylimidazole |
| InChI Key | GIWQSPITLQVMSG-UHFFFAOYSA-N |
| Molecular Formula | C5H8N2 |
| CAS | 3368-04-5 |
|---|---|
| MDL Number | MFCD00016969 |
alpha-Monothioglycerol, 99.1%, For GC analysis, MP Biomedicals™
CAS: 96-27-5 Molecular Formula: C3H8O2S Molecular Weight (g/mol): 108.16 MDL Number: MFCD00004879 InChI Key: PJUIMOJAAPLTRJ-UHFFFAOYNA-N Synonym: 3-mercapto-1,2-propanediol,monothioglycerol,1-thioglycerol,thioglycerol,thioglycerine,thioglycerin,thiovanol,3-mercaptopropane-1,2-diol,alpha-thioglycerol,glycerol-1-thiol PubChem CID: 7291 ChEBI: CHEBI:74537 IUPAC Name: 3-sulfanylpropane-1,2-diol SMILES: OCC(O)CS
| PubChem CID | 7291 |
|---|---|
| CAS | 96-27-5 |
| Molecular Weight (g/mol) | 108.16 |
| ChEBI | CHEBI:74537 |
| MDL Number | MFCD00004879 |
| SMILES | OCC(O)CS |
| Synonym | 3-mercapto-1,2-propanediol,monothioglycerol,1-thioglycerol,thioglycerol,thioglycerine,thioglycerin,thiovanol,3-mercaptopropane-1,2-diol,alpha-thioglycerol,glycerol-1-thiol |
| IUPAC Name | 3-sulfanylpropane-1,2-diol |
| InChI Key | PJUIMOJAAPLTRJ-UHFFFAOYNA-N |
| Molecular Formula | C3H8O2S |
L-Phenylalanine methyl ester hydrochloride, 98%
CAS: 7524-50-7 Molecular Formula: C10H14ClNO2 Molecular Weight (g/mol): 215.68 MDL Number: MFCD00012489 InChI Key: SWVMLNPDTIFDDY-UHFFFAOYNA-N Synonym: l-phenylalanine methyl ester hydrochloride,h-phe-ome.hcl,methyl l-phenylalaninate hydrochloride,s-methyl 2-amino-3-phenylpropanoate hydrochloride,unii-47hk4y94ja,h-phe-ome hcl,h-phe-ome hydrochloride,l-phenylalanine, methyl ester, hydrochloride,l-phenylalanine methyl ester hcl PubChem CID: 75736 SMILES: [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1
| PubChem CID | 75736 |
|---|---|
| CAS | 7524-50-7 |
| Molecular Weight (g/mol) | 215.68 |
| MDL Number | MFCD00012489 |
| SMILES | [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 |
| Synonym | l-phenylalanine methyl ester hydrochloride,h-phe-ome.hcl,methyl l-phenylalaninate hydrochloride,s-methyl 2-amino-3-phenylpropanoate hydrochloride,unii-47hk4y94ja,h-phe-ome hcl,h-phe-ome hydrochloride,l-phenylalanine, methyl ester, hydrochloride,l-phenylalanine methyl ester hcl |
| InChI Key | SWVMLNPDTIFDDY-UHFFFAOYNA-N |
| Molecular Formula | C10H14ClNO2 |
[Bis(2-methoxyethyl)amino]sulfur trifluoride, 2.7M (50 wt.%) solution in toluene
CAS: 202289-38-1 | C6H14F3NO2S | 221.24 g/mol
| Linear Formula | (CH3OCHCH2)2NSF3 |
|---|---|
| Molecular Weight (g/mol) | 221.24 |
| Color | Orange-Yellow |
| Physical Form | Liquid |
| CAS Min % | 49.0 |
| Chemical Name or Material | [Bis(2-methoxyethyl)amino]sulfur trifluoride |
| SMILES | COCCN(CCOC)S(F)(F)F |
| Merck Index | 15,2899 |
| InChI Key | APOYTRAZFJURPB-UHFFFAOYSA-N |
| Density | 1.2000g/mL |
| PubChem CID | 2734690 |
| Percent Purity | ≥95% (NMR, neat substance) |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Use personal protective equipment as required. Avoid breathing dust/fume/gas/mist/vapors/spray. Do not breathe dust/fume/gas/mist/vapors/spray. IF SWALLOWED: Immediately call a POISON CENTRE or doctor/physician. Do NOT induce vomiting. Store in a dry place. Store in a closed container. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. |
| Health Hazard 2 | GHS H Statement Toxic if swallowed. May be fatal if swallowed and enters airways. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. Highly flammable liquid and vapor. Reacts violently with water. |
| Packaging | Plastic bottle |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | bis 2-methoxyethyl aminosulfur trifluoride,deoxo-fluor,2-methoxy-n-2-methoxyethyl-n-trifluorothio-ethanamine,deoxo-fluor r,bis 2-methoxyethyl aminosulphurtrifluoride,bast,bis 2-methoxyethyl amino sulfur trifluoride,bis 2-methoxyethyl aminosulphur trifluoride |
| IUPAC Name | 2-methoxy-N-(2-methoxyethyl)-N-(trifluoro-$l^{4}-sulfanyl)ethanamine |
| Molecular Formula | C6H14F3NO2S |
| Formula Weight | 221.24 |
| Specific Gravity | 1.2 |
| CAS Max % | 51.0 |
Methoxylamine hydrochloride, 98+%
CAS: 593-56-6 Molecular Formula: CH6ClNO Molecular Weight (g/mol): 83.515 MDL Number: MFCD00012951 InChI Key: XNXVOSBNFZWHBV-UHFFFAOYSA-N Synonym: o-methylhydroxylamine hydrochloride,methoxyamine hydrochloride,methoxylamine hydrochloride,methoxyammonium chloride,o-methylhydroxylamine hcl,aminooxy methane hydrochloride,methoxyamine hcl,unii-203546olmf,hydroxylamine, o-methyl-, hydrochloride,o-methylhydroxyamine hydrochloride PubChem CID: 521874 IUPAC Name: O-methylhydroxylamine;hydrochloride SMILES: CON.Cl
| PubChem CID | 521874 |
|---|---|
| CAS | 593-56-6 |
| Molecular Weight (g/mol) | 83.515 |
| MDL Number | MFCD00012951 |
| SMILES | CON.Cl |
| Synonym | o-methylhydroxylamine hydrochloride,methoxyamine hydrochloride,methoxylamine hydrochloride,methoxyammonium chloride,o-methylhydroxylamine hcl,aminooxy methane hydrochloride,methoxyamine hcl,unii-203546olmf,hydroxylamine, o-methyl-, hydrochloride,o-methylhydroxyamine hydrochloride |
| IUPAC Name | O-methylhydroxylamine;hydrochloride |
| InChI Key | XNXVOSBNFZWHBV-UHFFFAOYSA-N |
| Molecular Formula | CH6ClNO |
trans-Aconitic acid, 98%
CAS: 4023-65-8 Molecular Formula: C6H6O6 Molecular Weight (g/mol): 174.108 MDL Number: MFCD00002721 InChI Key: GTZCVFVGUGFEME-HNQUOIGGSA-N Synonym: trans-aconitic acid,trans-aconitate,e-1-propene-1,2,3-tricarboxylic acid,aconitic acid,e-prop-1-ene-1,2,3-tricarboxylic acid,aconitic acid, trans,trans aconitic acid,e-aconitic acid,unii-7db37960cw,1e-1-propene-1,2,3-tricarboxylic acid PubChem CID: 444212 ChEBI: CHEBI:32806 IUPAC Name: (E)-prop-1-ene-1,2,3-tricarboxylic acid SMILES: C(C(=CC(=O)O)C(=O)O)C(=O)O
| PubChem CID | 444212 |
|---|---|
| CAS | 4023-65-8 |
| Molecular Weight (g/mol) | 174.108 |
| ChEBI | CHEBI:32806 |
| MDL Number | MFCD00002721 |
| SMILES | C(C(=CC(=O)O)C(=O)O)C(=O)O |
| Synonym | trans-aconitic acid,trans-aconitate,e-1-propene-1,2,3-tricarboxylic acid,aconitic acid,e-prop-1-ene-1,2,3-tricarboxylic acid,aconitic acid, trans,trans aconitic acid,e-aconitic acid,unii-7db37960cw,1e-1-propene-1,2,3-tricarboxylic acid |
| IUPAC Name | (E)-prop-1-ene-1,2,3-tricarboxylic acid |
| InChI Key | GTZCVFVGUGFEME-HNQUOIGGSA-N |
| Molecular Formula | C6H6O6 |
Deltamethrin 97.0+%, TCI America™
CAS: 52918-63-5 Molecular Formula: C22H19Br2NO3 Molecular Weight (g/mol): 505.206 MDL Number: MFCD00870122 InChI Key: OWZREIFADZCYQD-FLXSOZOKSA-N Synonym: deltamethrin PubChem CID: 13013599 IUPAC Name: [(S)-cyano-(3-phenoxyphenyl)methyl] (1R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate SMILES: CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Br)Br)C
| PubChem CID | 13013599 |
|---|---|
| CAS | 52918-63-5 |
| Molecular Weight (g/mol) | 505.206 |
| MDL Number | MFCD00870122 |
| SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Br)Br)C |
| Synonym | deltamethrin |
| IUPAC Name | [(S)-cyano-(3-phenoxyphenyl)methyl] (1R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChI Key | OWZREIFADZCYQD-FLXSOZOKSA-N |
| Molecular Formula | C22H19Br2NO3 |
4-Amino-3-fluoropyridine 98.0+%, TCI America™
CAS: 2247-88-3 Molecular Formula: C5H5FN2 Molecular Weight (g/mol): 112.107 MDL Number: MFCD00234072 InChI Key: UFIKBUVVVGSMGW-UHFFFAOYSA-N Synonym: 4-amino-3-fluoropyridine,3-fluoro-4-aminopyridine,3-fluoro-pyridin-4-ylamine,3-fluoro-4-pyridylamine,3-fluoro-4-pyridinamine,4-pyridinamine, 3-fluoro,pubchem1261,3-amine-5-fluoropyridine,3-fluoropyridine-4-amine,acmc-1ck3i PubChem CID: 817122 IUPAC Name: 3-fluoropyridin-4-amine SMILES: C1=CN=CC(=C1N)F
| PubChem CID | 817122 |
|---|---|
| CAS | 2247-88-3 |
| Molecular Weight (g/mol) | 112.107 |
| MDL Number | MFCD00234072 |
| SMILES | C1=CN=CC(=C1N)F |
| Synonym | 4-amino-3-fluoropyridine,3-fluoro-4-aminopyridine,3-fluoro-pyridin-4-ylamine,3-fluoro-4-pyridylamine,3-fluoro-4-pyridinamine,4-pyridinamine, 3-fluoro,pubchem1261,3-amine-5-fluoropyridine,3-fluoropyridine-4-amine,acmc-1ck3i |
| IUPAC Name | 3-fluoropyridin-4-amine |
| InChI Key | UFIKBUVVVGSMGW-UHFFFAOYSA-N |
| Molecular Formula | C5H5FN2 |
Samarium(III) trifluoromethanesulfonate, 98%
CAS: 52093-28-4 Molecular Formula: C3F9O9S3Sm Molecular Weight (g/mol): 597.55 MDL Number: MFCD00192431 InChI Key: DDCWGUIPLGMBPO-UHFFFAOYSA-K Synonym: samarium iii trifluoromethanesulfonate,samarium triflate,samarium iii triflate,samarium trifluoromethanesulfonate,trifluoromethanesulfonic acid samarium iii salt,samarium iii trifluoromethanesulfonate 97+%,sm otf 3,3cf3o3s.sm,samarium 3+ tritriflate PubChem CID: 10145316 IUPAC Name: samarium(3+);trifluoromethanesulfonate SMILES: [Sm+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F
| PubChem CID | 10145316 |
|---|---|
| CAS | 52093-28-4 |
| Molecular Weight (g/mol) | 597.55 |
| MDL Number | MFCD00192431 |
| SMILES | [Sm+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| Synonym | samarium iii trifluoromethanesulfonate,samarium triflate,samarium iii triflate,samarium trifluoromethanesulfonate,trifluoromethanesulfonic acid samarium iii salt,samarium iii trifluoromethanesulfonate 97+%,sm otf 3,3cf3o3s.sm,samarium 3+ tritriflate |
| IUPAC Name | samarium(3+);trifluoromethanesulfonate |
| InChI Key | DDCWGUIPLGMBPO-UHFFFAOYSA-K |
| Molecular Formula | C3F9O9S3Sm |
Iron(III) trifluoromethanesulfonate, tech. 90%
CAS: 63295-48-7 Molecular Formula: C3F9FeO9S3 Molecular Weight (g/mol): 503.035 MDL Number: MFCD15144785 InChI Key: OSHOQERNFGVVRH-UHFFFAOYSA-K Synonym: iron iii trifluoromethanesulfonate,fe otf 3,ferric triflate,iron iii triflate,fe cf3so3 3,ksc497q0p,iron 3+ tritriflate,ferric trifluoromethanesulfonate,iron 1,1,1-trifluoromethanesulfonic acid,iron 3+ ion tritrifluoromethanesulfonate PubChem CID: 11656316 IUPAC Name: iron(3+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Fe+3]
| PubChem CID | 11656316 |
|---|---|
| CAS | 63295-48-7 |
| Molecular Weight (g/mol) | 503.035 |
| MDL Number | MFCD15144785 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Fe+3] |
| Synonym | iron iii trifluoromethanesulfonate,fe otf 3,ferric triflate,iron iii triflate,fe cf3so3 3,ksc497q0p,iron 3+ tritriflate,ferric trifluoromethanesulfonate,iron 1,1,1-trifluoromethanesulfonic acid,iron 3+ ion tritrifluoromethanesulfonate |
| IUPAC Name | iron(3+);trifluoromethanesulfonate |
| InChI Key | OSHOQERNFGVVRH-UHFFFAOYSA-K |
| Molecular Formula | C3F9FeO9S3 |
HEPES, free acid, >98%, MP Biomedicals™
CAS: 7365-45-9 Molecular Formula: C8H18N2O4S Molecular Weight (g/mol): 238.30 MDL Number: MFCD00006158 InChI Key: JKMHFZQWWAIEOD-UHFFFAOYSA-N Synonym: hepes,2-4-2-hydroxyethyl piperazin-1-yl ethanesulfonic acid,4-2-hydroxyethyl-1-piperazineethanesulfonic acid,1-piperazineethanesulfonic acid, 4-2-hydroxyethyl,monosodium salt, hepes,4-2-hydroxyethyl piperazine-1-ethanesulfonic acid,unii-rww266ye9i,4-2-hydroxyethyl-1-piperazineethane sulfonic acid,n-2-hydroxyethylpiperazine-n'-ethanesulfonate PubChem CID: 23831 ChEBI: CHEBI:42334 SMILES: OCCN1CCN(CCS(O)(=O)=O)CC1
| PubChem CID | 23831 |
|---|---|
| CAS | 7365-45-9 |
| Molecular Weight (g/mol) | 238.30 |
| ChEBI | CHEBI:42334 |
| MDL Number | MFCD00006158 |
| SMILES | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| Synonym | hepes,2-4-2-hydroxyethyl piperazin-1-yl ethanesulfonic acid,4-2-hydroxyethyl-1-piperazineethanesulfonic acid,1-piperazineethanesulfonic acid, 4-2-hydroxyethyl,monosodium salt, hepes,4-2-hydroxyethyl piperazine-1-ethanesulfonic acid,unii-rww266ye9i,4-2-hydroxyethyl-1-piperazineethane sulfonic acid,n-2-hydroxyethylpiperazine-n'-ethanesulfonate |
| InChI Key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| Molecular Formula | C8H18N2O4S |
Poly(2-ethyl-2-oxazoline), M.W. 200,000
CAS: 25805-17-8 Molecular Formula: (C5H9NO)n Molecular Weight (g/mol): 99.13 MDL Number: MFCD00134377 InChI Key: NYEZZYQZRQDLEH-UHFFFAOYSA-N Synonym: 2-ethyl-2-oxazoline,2-ethyloxazoline,2-ethyl-4,5-dihydrooxazole,oxazole, 2-ethyl-4,5-dihydro,2-oxazoline, 2-ethyl,unii-b8cd92t4p5,unii-jm7uh9q3yn,unii-hnx7574gtx,unii-s5dpg6k67i,ethyl oxazoline PubChem CID: 66412 IUPAC Name: 2-ethyl-4,5-dihydro-1,3-oxazole SMILES: CCC(=O)N(-*)CC-*
| PubChem CID | 66412 |
|---|---|
| CAS | 25805-17-8 |
| Molecular Weight (g/mol) | 99.13 |
| MDL Number | MFCD00134377 |
| SMILES | CCC(=O)N(-*)CC-* |
| Synonym | 2-ethyl-2-oxazoline,2-ethyloxazoline,2-ethyl-4,5-dihydrooxazole,oxazole, 2-ethyl-4,5-dihydro,2-oxazoline, 2-ethyl,unii-b8cd92t4p5,unii-jm7uh9q3yn,unii-hnx7574gtx,unii-s5dpg6k67i,ethyl oxazoline |
| IUPAC Name | 2-ethyl-4,5-dihydro-1,3-oxazole |
| InChI Key | NYEZZYQZRQDLEH-UHFFFAOYSA-N |
| Molecular Formula | (C5H9NO)n |