Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2,4-Pentanedione, 99+%
CAS: 123-54-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00008787 InChI Key: YRKCREAYFQTBPV-UHFFFAOYSA-N Synonym: 2,4-pentanedione,acetylacetone,2,4-pentadione,diacetylmethane,acetoacetone,acac,2,4-dioxopentane,pentanedione,pentan-2,4-dione,acetyl acetone PubChem CID: 31261 ChEBI: CHEBI:14750 IUPAC Name: pentane-2,4-dione SMILES: CC(=O)CC(C)=O
| PubChem CID | 31261 |
|---|---|
| CAS | 123-54-6 |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:14750 |
| MDL Number | MFCD00008787 |
| SMILES | CC(=O)CC(C)=O |
| Synonym | 2,4-pentanedione,acetylacetone,2,4-pentadione,diacetylmethane,acetoacetone,acac,2,4-dioxopentane,pentanedione,pentan-2,4-dione,acetyl acetone |
| IUPAC Name | pentane-2,4-dione |
| InChI Key | YRKCREAYFQTBPV-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Lecithin, MP Biomedicals™
CAS: 8030-76-0 Molecular Formula: C11H22NO8P Synonym: L-a-Phosphatidylcholine
| CAS | 8030-76-0 |
|---|---|
| Synonym | L-a-Phosphatidylcholine |
| Molecular Formula | C11H22NO8P |
(±)-1,3-Butanediol, 99%, extra pure
CAS: 107-88-0 Molecular Formula: C4H10O2 Molecular Weight (g/mol): 90.12 MDL Number: MFCD00004554 InChI Key: PUPZLCDOIYMWBV-UHFFFAOYSA-N Synonym: 1,3-butanediol,1,3-butylene glycol,1,3-dihydroxybutane,methyltrimethylene glycol,1,3-butandiol,1-methyl-1,3-propanediol,beta-butylene glycol,1,3 butylene glycol,1,3-butylenglykol,rs-1,3-butandiol PubChem CID: 7896 ChEBI: CHEBI:52683 IUPAC Name: butane-1,3-diol SMILES: CC(CCO)O
| PubChem CID | 7896 |
|---|---|
| CAS | 107-88-0 |
| Molecular Weight (g/mol) | 90.12 |
| ChEBI | CHEBI:52683 |
| MDL Number | MFCD00004554 |
| SMILES | CC(CCO)O |
| Synonym | 1,3-butanediol,1,3-butylene glycol,1,3-dihydroxybutane,methyltrimethylene glycol,1,3-butandiol,1-methyl-1,3-propanediol,beta-butylene glycol,1,3 butylene glycol,1,3-butylenglykol,rs-1,3-butandiol |
| IUPAC Name | butane-1,3-diol |
| InChI Key | PUPZLCDOIYMWBV-UHFFFAOYSA-N |
| Molecular Formula | C4H10O2 |
Thermo Scientific Chemicals D-Lactose
CAS: 63-42-3 Molecular Formula: C12H22O11 MDL Number: MFCD00151251 Synonym: Gal-beta-1,4-Glc; 4-O-beta-D-Galactopyranosyl-D-glucopyranose
| CAS | 63-42-3 |
|---|---|
| MDL Number | MFCD00151251 |
| Synonym | Gal-beta-1,4-Glc; 4-O-beta-D-Galactopyranosyl-D-glucopyranose |
| Molecular Formula | C12H22O11 |
Salicylic acid, sodium salt, 99+%, Thermo Scientific Chemicals
CAS: 54-21-7 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.104 MDL Number: MFCD00002440 InChI Key: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC Name: sodium;2-hydroxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
| PubChem CID | 16760658 |
|---|---|
| CAS | 54-21-7 |
| Molecular Weight (g/mol) | 160.104 |
| ChEBI | CHEBI:9180 |
| MDL Number | MFCD00002440 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| IUPAC Name | sodium;2-hydroxybenzoate |
| InChI Key | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
Cyclohexylamine, 99%
CAS: 108-91-8 Molecular Formula: C6H13N Molecular Weight (g/mol): 99.18 InChI Key: PAFZNILMFXTMIY-UHFFFAOYSA-N Synonym: cyclohexylamine,aminocyclohexane,hexahydroaniline,hexahydrobenzenamine,aminohexahydrobenzene,cyclohexyl amine,1-cyclohexylamine,1-aminocyclohexane,aniline, hexahydro,benzenamine, hexahydro PubChem CID: 7965 ChEBI: CHEBI:15773 IUPAC Name: cyclohexanamine SMILES: C1CCC(CC1)N
| PubChem CID | 7965 |
|---|---|
| CAS | 108-91-8 |
| Molecular Weight (g/mol) | 99.18 |
| ChEBI | CHEBI:15773 |
| SMILES | C1CCC(CC1)N |
| Synonym | cyclohexylamine,aminocyclohexane,hexahydroaniline,hexahydrobenzenamine,aminohexahydrobenzene,cyclohexyl amine,1-cyclohexylamine,1-aminocyclohexane,aniline, hexahydro,benzenamine, hexahydro |
| IUPAC Name | cyclohexanamine |
| InChI Key | PAFZNILMFXTMIY-UHFFFAOYSA-N |
| Molecular Formula | C6H13N |
Tetrabutylammonium hydroxide, 0.1N sol. in toluene/methanol for non-aq.titr.
Tetrabutylammonium hydroxide, 0.1N sol. in toluene/methanol for non-aq.titr., Quantity: 500mL, Packaging: Glass bottle, Colorless to Yellow, Molecular Weight: 259.47, Beilstein: 04,II,634, CAS: 2052-49-5, 108-88-3, 67-56-1, Density: 0.8500g/mL, EINECS Number: 218-147-6 | CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.8500g/mL |
| PubChem CID | 2723671 |
| Fieser | 05,645; 11,500; 07,332 |
| Formula Weight | 259.47 |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF SWALLOWED: rinse mouth. Do NOT induce vomi |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Harmful if swallowed. Harmful in contact with skin. Harmful if inhaled. Causes damage to organs. Suspected of damaging the unborn child. May be fatal if swallow |
| Solubility Information | Solubility in water: insoluble |
| Packaging | Glass bottle |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.3775 |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04,II,634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.85 |
Dithiothreitol, >99.5%, Molecular Biology Grade, Ultrapure
CAS: 12-3-3483 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 MDL Number: MFCD00004877 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2 S,3 S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:42170 |
| MDL Number | MFCD00004877 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2 S,3 S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Molecular Formula | C4H10O2S2 |
Benzyl bromide, 99%
CAS: 100-39-0 Molecular Formula: C7H7Br Molecular Weight (g/mol): 171.037 MDL Number: MFCD00000172 InChI Key: AGEZXYOZHKGVCM-UHFFFAOYSA-N Synonym: benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite PubChem CID: 7498 ChEBI: CHEBI:59858 IUPAC Name: bromomethylbenzene SMILES: C1=CC=C(C=C1)CBr
| PubChem CID | 7498 |
|---|---|
| CAS | 100-39-0 |
| Molecular Weight (g/mol) | 171.037 |
| ChEBI | CHEBI:59858 |
| MDL Number | MFCD00000172 |
| SMILES | C1=CC=C(C=C1)CBr |
| Synonym | benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite |
| IUPAC Name | bromomethylbenzene |
| InChI Key | AGEZXYOZHKGVCM-UHFFFAOYSA-N |
| Molecular Formula | C7H7Br |
Benzophenone, 99%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
Mercaptoacetic Acid, 98%
CAS: 68-11-1 Molecular Formula: C2H4O2S Molecular Weight (g/mol): 92.11 MDL Number: MFCD00004876 InChI Key: CWERGRDVMFNCDR-UHFFFAOYSA-N Synonym: mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio PubChem CID: 1133 ChEBI: CHEBI:30065 IUPAC Name: 2-sulfanylacetic acid SMILES: C(C(=O)O)S
| PubChem CID | 1133 |
|---|---|
| CAS | 68-11-1 |
| Molecular Weight (g/mol) | 92.11 |
| ChEBI | CHEBI:30065 |
| MDL Number | MFCD00004876 |
| SMILES | C(C(=O)O)S |
| Synonym | mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio |
| IUPAC Name | 2-sulfanylacetic acid |
| InChI Key | CWERGRDVMFNCDR-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2S |
Urea, ultrapure, 99%
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Urea, 99%, ACS reagent
CAS: 57-13-6 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
Sodium succinate hexahydrate, 99%
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 MDL Number: MFCD00149117 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| MDL Number | MFCD00149117 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
Diisopropylamine, 99.5%, redistilled, AcroSeal™, Thermo Scientific Chemicals
CAS: 108-18-9 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.19 MDL Number: MFCD00008862 InChI Key: UAOMVDZJSHZZME-UHFFFAOYSA-N Synonym: diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine PubChem CID: 7912 IUPAC Name: N-propan-2-ylpropan-2-amine SMILES: CC(C)NC(C)C
| PubChem CID | 7912 |
|---|---|
| CAS | 108-18-9 |
| Molecular Weight (g/mol) | 101.19 |
| MDL Number | MFCD00008862 |
| SMILES | CC(C)NC(C)C |
| Synonym | diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine |
| IUPAC Name | N-propan-2-ylpropan-2-amine |
| InChI Key | UAOMVDZJSHZZME-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |