Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Poly(3-octylthiophene-2,5-diyl), regiorandom, low metals, Thermo Scientific Chemicals
CAS: 104934-51-2 Molecular Formula: (C12H18S)n Molecular Weight (g/mol): 241.44 MDL Number: MFCD00241412 InChI Key: RXIQSINDOTYIGV-UHFFFAOYSA-N Synonym: poly 3-octylthiophene-2,5-diyl , regiorandom, low metals,poly 3-octylthiophene-2,5-diyl , regioregular, low metals PubChem CID: 121233643 IUPAC Name: azane;2,5-dimethyl-3-octylthiophene SMILES: CCCCCCCCC1=C(-*)SC(-*)=C1
| PubChem CID | 121233643 |
|---|---|
| CAS | 104934-51-2 |
| Molecular Weight (g/mol) | 241.44 |
| MDL Number | MFCD00241412 |
| SMILES | CCCCCCCCC1=C(-*)SC(-*)=C1 |
| Synonym | poly 3-octylthiophene-2,5-diyl , regiorandom, low metals,poly 3-octylthiophene-2,5-diyl , regioregular, low metals |
| IUPAC Name | azane;2,5-dimethyl-3-octylthiophene |
| InChI Key | RXIQSINDOTYIGV-UHFFFAOYSA-N |
| Molecular Formula | (C12H18S)n |
3-(Boc-amino)-3-phenylpropionic acid, 97%
CAS: 14676-01-8 Molecular Formula: C14H19NO4 Molecular Weight (g/mol): 265.309 MDL Number: MFCD02090695 InChI Key: JTNQFJPZRTURSI-UHFFFAOYSA-N Synonym: 3-boc-amino-3-phenylpropionic acid,3-n-boc-3-phenylpropionic acid,boc-dl-beta-phe-oh,3-tert-butoxycarbonyl amino-3-phenylpropanoic acid,3-boc-amino-3-phenyl-propionic acid,3-tert-butoxycarbonylamino-3-phenylpropanoic acid,3-tert-butoxy carbonyl amino-3-phenylpropanoic acid,boc-d-,a-phe-oh,pubchem16181 PubChem CID: 2756815 IUPAC Name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid SMILES: CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC=CC=C1
| PubChem CID | 2756815 |
|---|---|
| CAS | 14676-01-8 |
| Molecular Weight (g/mol) | 265.309 |
| MDL Number | MFCD02090695 |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC=CC=C1 |
| Synonym | 3-boc-amino-3-phenylpropionic acid,3-n-boc-3-phenylpropionic acid,boc-dl-beta-phe-oh,3-tert-butoxycarbonyl amino-3-phenylpropanoic acid,3-boc-amino-3-phenyl-propionic acid,3-tert-butoxycarbonylamino-3-phenylpropanoic acid,3-tert-butoxy carbonyl amino-3-phenylpropanoic acid,boc-d-,a-phe-oh,pubchem16181 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChI Key | JTNQFJPZRTURSI-UHFFFAOYSA-N |
| Molecular Formula | C14H19NO4 |
Polyethylene glycol diacrylate, M.W. 8,000
CAS: 26570-48-9 Molecular Formula: C5H10O4 Molecular Weight (g/mol): 134.131 MDL Number: MFCD00081876 InChI Key: FCDZZFLRLVQGEH-UHFFFAOYSA-N Synonym: acrylic acid; ethylene glycol,poly ethylene glycol diacrylate,polyethylene glycol diacrylate,poly ethylene glycol acrylate, average mn ∼375 PubChem CID: 16212859 IUPAC Name: ethane-1,2-diol;prop-2-enoic acid SMILES: C=CC(=O)O.C(CO)O
| PubChem CID | 16212859 |
|---|---|
| CAS | 26570-48-9 |
| Molecular Weight (g/mol) | 134.131 |
| MDL Number | MFCD00081876 |
| SMILES | C=CC(=O)O.C(CO)O |
| Synonym | acrylic acid; ethylene glycol,poly ethylene glycol diacrylate,polyethylene glycol diacrylate,poly ethylene glycol acrylate, average mn ∼375 |
| IUPAC Name | ethane-1,2-diol;prop-2-enoic acid |
| InChI Key | FCDZZFLRLVQGEH-UHFFFAOYSA-N |
| Molecular Formula | C5H10O4 |
Potassium bis(trifluoromethylsulfonyl)imide
CAS: 90076-67-8 Molecular Formula: C2F6KNO4S2 Molecular Weight (g/mol): 319.234 MDL Number: MFCD06200829 InChI Key: KVFIZLDWRFTUEM-UHFFFAOYSA-N Synonym: potassium bistriflylimide anion,methanesulfonamide,1,1,1-trifluoro-n-trifluoromethyl sulfonyl-, potassium salt 1:1,potassium bis trifluoromethanesulfonly imide,ktfsi,potassium trifluoromethanesulfonimide,potassiobis trifluoromethylsulfonyl amine,potassium bis trifluoromethanesulfonyl amide,potassium bis trifluoromethyl sulfonyl imide,1,1,1-trifluoro-n-potassio-n-trifluoromethanesulfonylmethanesulfonamide PubChem CID: 11099217 IUPAC Name: potassium;bis(trifluoromethylsulfonyl)azanide SMILES: C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[K+]
| PubChem CID | 11099217 |
|---|---|
| CAS | 90076-67-8 |
| Molecular Weight (g/mol) | 319.234 |
| MDL Number | MFCD06200829 |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[K+] |
| Synonym | potassium bistriflylimide anion,methanesulfonamide,1,1,1-trifluoro-n-trifluoromethyl sulfonyl-, potassium salt 1:1,potassium bis trifluoromethanesulfonly imide,ktfsi,potassium trifluoromethanesulfonimide,potassiobis trifluoromethylsulfonyl amine,potassium bis trifluoromethanesulfonyl amide,potassium bis trifluoromethyl sulfonyl imide,1,1,1-trifluoro-n-potassio-n-trifluoromethanesulfonylmethanesulfonamide |
| IUPAC Name | potassium;bis(trifluoromethylsulfonyl)azanide |
| InChI Key | KVFIZLDWRFTUEM-UHFFFAOYSA-N |
| Molecular Formula | C2F6KNO4S2 |
1,3-Diiodopropane, 98+%, stab. with copper
CAS: 627-31-6 Molecular Formula: C3H6I2 Molecular Weight (g/mol): 295.89 MDL Number: MFCD00001097 InChI Key: AAAXMNYUNVCMCJ-UHFFFAOYSA-N Synonym: trimethylene diiodide,propane, 1,3-diiodo,trimethylene iodide,propane,3-diiodo,pubchem3858,1,3-bis iodanyl propane,acmc-1av5p,4-01-00-00228 beilstein handbook reference,1,3-diiodopropane, contains copper as stabilizer PubChem CID: 12314 IUPAC Name: 1,3-diiodopropane SMILES: C(CI)CI
| PubChem CID | 12314 |
|---|---|
| CAS | 627-31-6 |
| Molecular Weight (g/mol) | 295.89 |
| MDL Number | MFCD00001097 |
| SMILES | C(CI)CI |
| Synonym | trimethylene diiodide,propane, 1,3-diiodo,trimethylene iodide,propane,3-diiodo,pubchem3858,1,3-bis iodanyl propane,acmc-1av5p,4-01-00-00228 beilstein handbook reference,1,3-diiodopropane, contains copper as stabilizer |
| IUPAC Name | 1,3-diiodopropane |
| InChI Key | AAAXMNYUNVCMCJ-UHFFFAOYSA-N |
| Molecular Formula | C3H6I2 |
Methyl 4-(bromomethyl)benzoate, 98%
CAS: 2417-72-3 Molecular Formula: C9H9BrO2 Molecular Weight (g/mol): 229.07 MDL Number: MFCD00032453 InChI Key: NLWBJPPMPLPZIE-UHFFFAOYSA-N PubChem CID: 256687 IUPAC Name: methyl 4-(bromomethyl)benzoate SMILES: COC(=O)C1=CC=C(CBr)C=C1
| PubChem CID | 256687 |
|---|---|
| CAS | 2417-72-3 |
| Molecular Weight (g/mol) | 229.07 |
| MDL Number | MFCD00032453 |
| SMILES | COC(=O)C1=CC=C(CBr)C=C1 |
| IUPAC Name | methyl 4-(bromomethyl)benzoate |
| InChI Key | NLWBJPPMPLPZIE-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |
Bis(2-ethylhexyl) terephthalate, 97%, Thermo Scientific™
CAS: 6422-86-2 Molecular Formula: C24H38O4 Molecular Weight (g/mol): 390.55 InChI Key: RWPICVVBGZBXNA-UHFFFAOYSA-N Synonym: bis 2-ethylhexyl terephthalate,kodaflex dotp,di-2-ethylhexyl terephthalate,1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester,terephthalic acid, bis 2-ethylhexyl ester,eastman 168,ccris 7052,di 2-ethylhexyl terephthalate,bis 2-ethylhexyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester PubChem CID: 22932 IUPAC Name: bis(2-ethylhexyl) benzene-1,4-dicarboxylate SMILES: CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC
| PubChem CID | 22932 |
|---|---|
| CAS | 6422-86-2 |
| Molecular Weight (g/mol) | 390.55 |
| SMILES | CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl terephthalate,kodaflex dotp,di-2-ethylhexyl terephthalate,1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester,terephthalic acid, bis 2-ethylhexyl ester,eastman 168,ccris 7052,di 2-ethylhexyl terephthalate,bis 2-ethylhexyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| InChI Key | RWPICVVBGZBXNA-UHFFFAOYSA-N |
| Molecular Formula | C24H38O4 |
4-Amino-3-hydroxy-1-naphthalenesulfonic acid, 90+%, ACS reagent
CAS: 116-63-2 Molecular Formula: C10H9NO4S Molecular Weight (g/mol): 239.25 MDL Number: MFCD00004019 InChI Key: RXCMFQDTWCCLBL-UHFFFAOYSA-N Synonym: 1-amino-2-naphthol-4-sulfonic acid,4-amino-3-hydroxy-1-naphthalenesulfonic acid,1-amino-4-sulfo-2-naphthol,1,2,4-acid,unii-w46sk3p33g,1-naphthalenesulfonic acid, 4-amino-3-hydroxy,4-amino-3-hydroxynaphthalene-1-sulphonic acid,4-amino-3-hydroxynaphthalenesulfonic acid,1,2,4-aminonaphtholsulfonic acid,2-hydroxy-4-sulfo-1-naphthylamine PubChem CID: 8316 ChEBI: CHEBI:19024 IUPAC Name: 4-amino-3-hydroxynaphthalene-1-sulfonic acid SMILES: C1=CC=C2C(=C1)C(=CC(=C2N)O)S(=O)(=O)O
| PubChem CID | 8316 |
|---|---|
| CAS | 116-63-2 |
| Molecular Weight (g/mol) | 239.25 |
| ChEBI | CHEBI:19024 |
| MDL Number | MFCD00004019 |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)O)S(=O)(=O)O |
| Synonym | 1-amino-2-naphthol-4-sulfonic acid,4-amino-3-hydroxy-1-naphthalenesulfonic acid,1-amino-4-sulfo-2-naphthol,1,2,4-acid,unii-w46sk3p33g,1-naphthalenesulfonic acid, 4-amino-3-hydroxy,4-amino-3-hydroxynaphthalene-1-sulphonic acid,4-amino-3-hydroxynaphthalenesulfonic acid,1,2,4-aminonaphtholsulfonic acid,2-hydroxy-4-sulfo-1-naphthylamine |
| IUPAC Name | 4-amino-3-hydroxynaphthalene-1-sulfonic acid |
| InChI Key | RXCMFQDTWCCLBL-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO4S |
1-Cyclohexenylboronic acid pinacol ester, 97%
CAS: 141091-37-4 Molecular Formula: C12H21BO2 Molecular Weight (g/mol): 208.11 MDL Number: MFCD05663845 InChI Key: QNZFUMVTUFOLRT-UHFFFAOYSA-N Synonym: 2-cyclohex-1-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,1-cyclohexen-yl-boronic acid pinacol ester,cyclohexene-1-boronic acid pinacol ester,1-cyclohexen-1-yl-boronic acid pinacol ester,2-cyclohexenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,1-cyclohexeneboronic acid,2-1-cyclohexenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,cyclohexen-1-ylboronic acid, pinacol ester,2-1-cyclohexen-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,1-cyclohexeneboronic acid pinacol ester PubChem CID: 10932675 IUPAC Name: 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: CC1(C)OB(OC1(C)C)C1=CCCCC1
| PubChem CID | 10932675 |
|---|---|
| CAS | 141091-37-4 |
| Molecular Weight (g/mol) | 208.11 |
| MDL Number | MFCD05663845 |
| SMILES | CC1(C)OB(OC1(C)C)C1=CCCCC1 |
| Synonym | 2-cyclohex-1-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,1-cyclohexen-yl-boronic acid pinacol ester,cyclohexene-1-boronic acid pinacol ester,1-cyclohexen-1-yl-boronic acid pinacol ester,2-cyclohexenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,1-cyclohexeneboronic acid,2-1-cyclohexenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,cyclohexen-1-ylboronic acid, pinacol ester,2-1-cyclohexen-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,1-cyclohexeneboronic acid pinacol ester |
| IUPAC Name | 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | QNZFUMVTUFOLRT-UHFFFAOYSA-N |
| Molecular Formula | C12H21BO2 |
2,6-Di-tert-butylphenol, 99%
CAS: 128-39-2 Molecular Formula: C14H22O Molecular Weight (g/mol): 206.33 MDL Number: MFCD00008820 InChI Key: DKCPKDPYUFEZCP-UHFFFAOYSA-N Synonym: 2,6-di-tert-butylphenol,2,6-di-t-butylphenol,2,6-bis tert-butyl phenol,2,6-bis 1,1-dimethylethyl phenol,phenol, 2,6-bis 1,1-dimethylethyl,2,6 di-tert-butylphenol,ethanox 701,isonox 103,ethyl 701,ethyl an 701 PubChem CID: 31405 IUPAC Name: 2,6-ditert-butylphenol SMILES: CC(C)(C)C1=CC=CC(=C1O)C(C)(C)C
| PubChem CID | 31405 |
|---|---|
| CAS | 128-39-2 |
| Molecular Weight (g/mol) | 206.33 |
| MDL Number | MFCD00008820 |
| SMILES | CC(C)(C)C1=CC=CC(=C1O)C(C)(C)C |
| Synonym | 2,6-di-tert-butylphenol,2,6-di-t-butylphenol,2,6-bis tert-butyl phenol,2,6-bis 1,1-dimethylethyl phenol,phenol, 2,6-bis 1,1-dimethylethyl,2,6 di-tert-butylphenol,ethanox 701,isonox 103,ethyl 701,ethyl an 701 |
| IUPAC Name | 2,6-ditert-butylphenol |
| InChI Key | DKCPKDPYUFEZCP-UHFFFAOYSA-N |
| Molecular Formula | C14H22O |
1-Fluoro-4-nitrobenzene, 99%
CAS: 350-46-9 Molecular Formula: C6H4FNO2 Molecular Weight (g/mol): 141.1 MDL Number: MFCD00007282 InChI Key: WFQDTOYDVUWQMS-UHFFFAOYSA-N Synonym: 4-fluoronitrobenzene,p-fluoronitrobenzene,p-nitrofluorobenzene,benzene, 1-fluoro-4-nitro,4-nitrofluorobenzene,1-nitro-4-fluorobenzene,4-fluoro-1-nitrobenzene,1-fluoro-4-nitro-benzene,unii-a2m2fh7xhh,p-fluoro nitrobenzene PubChem CID: 9590 IUPAC Name: 1-fluoro-4-nitrobenzene SMILES: C1=CC(=CC=C1[N+](=O)[O-])F
| PubChem CID | 9590 |
|---|---|
| CAS | 350-46-9 |
| Molecular Weight (g/mol) | 141.1 |
| MDL Number | MFCD00007282 |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])F |
| Synonym | 4-fluoronitrobenzene,p-fluoronitrobenzene,p-nitrofluorobenzene,benzene, 1-fluoro-4-nitro,4-nitrofluorobenzene,1-nitro-4-fluorobenzene,4-fluoro-1-nitrobenzene,1-fluoro-4-nitro-benzene,unii-a2m2fh7xhh,p-fluoro nitrobenzene |
| IUPAC Name | 1-fluoro-4-nitrobenzene |
| InChI Key | WFQDTOYDVUWQMS-UHFFFAOYSA-N |
| Molecular Formula | C6H4FNO2 |
N-(4-Bromobutyl)phthalimide, 98%
CAS: 5394-18-3 Molecular Formula: C12H12BrNO2 Molecular Weight (g/mol): 282.14 MDL Number: MFCD00005905 InChI Key: UXFWTIGUWHJKDD-UHFFFAOYSA-N Synonym: n-4-bromobutyl phthalimide,2-4-bromobutyl isoindoline-1,3-dione,1h-isoindole-1,3 2h-dione, 2-4-bromobutyl,2-4-bromobutyl-1h-isoindole-1,3 2h-dione,n-4-bromobutyl-phthalimide,2-4-bromobutyl isoindole-1,3-dione,2-4-bromobutyl-2,3-dihydro-1h-isoindole-1,3-dione,n-4-bromobutyl,n-bromobutylphthalimide PubChem CID: 93575 IUPAC Name: 2-(4-bromobutyl)isoindole-1,3-dione SMILES: BrCCCCN1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 93575 |
|---|---|
| CAS | 5394-18-3 |
| Molecular Weight (g/mol) | 282.14 |
| MDL Number | MFCD00005905 |
| SMILES | BrCCCCN1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-4-bromobutyl phthalimide,2-4-bromobutyl isoindoline-1,3-dione,1h-isoindole-1,3 2h-dione, 2-4-bromobutyl,2-4-bromobutyl-1h-isoindole-1,3 2h-dione,n-4-bromobutyl-phthalimide,2-4-bromobutyl isoindole-1,3-dione,2-4-bromobutyl-2,3-dihydro-1h-isoindole-1,3-dione,n-4-bromobutyl,n-bromobutylphthalimide |
| IUPAC Name | 2-(4-bromobutyl)isoindole-1,3-dione |
| InChI Key | UXFWTIGUWHJKDD-UHFFFAOYSA-N |
| Molecular Formula | C12H12BrNO2 |
Thiazolidine, 98%
CAS: 504-78-9 Molecular Formula: C3H8NS Molecular Weight (g/mol): 90.16 MDL Number: MFCD00005211 InChI Key: OGYGFUAIIOPWQD-UHFFFAOYSA-O Synonym: thiazolidine,tetrahydrothiazole,1-thia-3-azacyclopentane,thiazole, tetrahydro,unii-i320806bkw,ccris 4275,acmc-1ao0m,4-27-00-00009 beilstein handbook reference PubChem CID: 10444 ChEBI: CHEBI:50120 SMILES: C1CSC[NH2+]1
| PubChem CID | 10444 |
|---|---|
| CAS | 504-78-9 |
| Molecular Weight (g/mol) | 90.16 |
| ChEBI | CHEBI:50120 |
| MDL Number | MFCD00005211 |
| SMILES | C1CSC[NH2+]1 |
| Synonym | thiazolidine,tetrahydrothiazole,1-thia-3-azacyclopentane,thiazole, tetrahydro,unii-i320806bkw,ccris 4275,acmc-1ao0m,4-27-00-00009 beilstein handbook reference |
| InChI Key | OGYGFUAIIOPWQD-UHFFFAOYSA-O |
| Molecular Formula | C3H8NS |
7-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid hydrate, 95%
CAS: 1020038-42-9 Molecular Formula: C8H5ClN2O2 Molecular Weight (g/mol): 196.59 MDL Number: MFCD09991784 InChI Key: BEFUOITXMHRTRQ-UHFFFAOYSA-N Synonym: 7-chloroimidazo 1,2-a pyridine-2-carboxylic acid,7-chloro-imidazo 1,2-a pyridine-2-carboxylic acid,7-chloro-4-hydroimidazo 1,2-a pyridine-2-carboxylic acid PubChem CID: 28875810 IUPAC Name: 7-chloroimidazo[1,2-a]pyridine-2-carboxylic acid SMILES: OC(=O)C1=CN2C=CC(Cl)=CC2=N1
| PubChem CID | 28875810 |
|---|---|
| CAS | 1020038-42-9 |
| Molecular Weight (g/mol) | 196.59 |
| MDL Number | MFCD09991784 |
| SMILES | OC(=O)C1=CN2C=CC(Cl)=CC2=N1 |
| Synonym | 7-chloroimidazo 1,2-a pyridine-2-carboxylic acid,7-chloro-imidazo 1,2-a pyridine-2-carboxylic acid,7-chloro-4-hydroimidazo 1,2-a pyridine-2-carboxylic acid |
| IUPAC Name | 7-chloroimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChI Key | BEFUOITXMHRTRQ-UHFFFAOYSA-N |
| Molecular Formula | C8H5ClN2O2 |
Thiophene-2-boronic acid pinacol ester, 98%
CAS: 193978-23-3 Molecular Formula: C10H15BO2S Molecular Weight (g/mol): 210.098 MDL Number: MFCD05663878 InChI Key: FFZHICFAHSDFKZ-UHFFFAOYSA-N Synonym: 2-thiopheneboronic acid pinacol ester,4,4,5,5-tetramethyl-2-thiophen-2-yl-1,3,2-dioxaborolane,4,4,5,5-tetramethyl-2-2-thienyl-1,3,2-dioxaborolane,thiophene-2-boronic acid pinacol ester,2-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl thiophene,thiophene-2-boronic acid, pinacol ester,1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-2-thienyl,4,4,5,5-tetramethyl-2-thien-2-yl-1,3,2-dioxaborolane,pubchem18441 PubChem CID: 10703628 IUPAC Name: 4,4,5,5-tetramethyl-2-thiophen-2-yl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C2=CC=CS2
| PubChem CID | 10703628 |
|---|---|
| CAS | 193978-23-3 |
| Molecular Weight (g/mol) | 210.098 |
| MDL Number | MFCD05663878 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CS2 |
| Synonym | 2-thiopheneboronic acid pinacol ester,4,4,5,5-tetramethyl-2-thiophen-2-yl-1,3,2-dioxaborolane,4,4,5,5-tetramethyl-2-2-thienyl-1,3,2-dioxaborolane,thiophene-2-boronic acid pinacol ester,2-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl thiophene,thiophene-2-boronic acid, pinacol ester,1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-2-thienyl,4,4,5,5-tetramethyl-2-thien-2-yl-1,3,2-dioxaborolane,pubchem18441 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-thiophen-2-yl-1,3,2-dioxaborolane |
| InChI Key | FFZHICFAHSDFKZ-UHFFFAOYSA-N |
| Molecular Formula | C10H15BO2S |