Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
4-Picoline N-oxide, 98%
CAS: 1003-67-4 Molecular Formula: C6H7NO Molecular Weight (g/mol): 109.13 MDL Number: MFCD00006210 InChI Key: IWYYIZOHWPCALJ-UHFFFAOYSA-N Synonym: 4-picoline-n-oxide,4-picoline n-oxide,4-methylpyridine n-oxide,4-methylpyridine 1-oxide,pyridine, 4-methyl-, 1-oxide,4-picoline 1-oxide,4-picoline, 1-oxide,gamma-picoline n-oxide,gamma-picoline 1-oxide,4-methylpyridin-1-ium-1-olate PubChem CID: 13857 SMILES: CC1=CC=[N+]([O-])C=C1
| PubChem CID | 13857 |
|---|---|
| CAS | 1003-67-4 |
| Molecular Weight (g/mol) | 109.13 |
| MDL Number | MFCD00006210 |
| SMILES | CC1=CC=[N+]([O-])C=C1 |
| Synonym | 4-picoline-n-oxide,4-picoline n-oxide,4-methylpyridine n-oxide,4-methylpyridine 1-oxide,pyridine, 4-methyl-, 1-oxide,4-picoline 1-oxide,4-picoline, 1-oxide,gamma-picoline n-oxide,gamma-picoline 1-oxide,4-methylpyridin-1-ium-1-olate |
| InChI Key | IWYYIZOHWPCALJ-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO |
N-Benzyl-N-phenylhydrazine hydrochloride, 98+%
CAS: 5705-15-7 Molecular Formula: C13H15ClN2 Molecular Weight (g/mol): 234.73 MDL Number: MFCD00050690 InChI Key: JTYLHYOCBGPMNO-UHFFFAOYSA-N Synonym: 1-benzyl-1-phenylhydrazine hydrochloride,n-benzyl-n-phenylhydrazine hydrochloride,usaf ek-1666,hydrazine, 1-phenyl-1-phenylmethyl-, monohydrochloride,alpha-benzyl-alpha-phenylhydrazine hydrochloride,n-benzyl-n-phenylhydrazinium 1+ chloride,hydrazine, 1-benzyl-1-phenyl-, hydrochloride,1-benzyl-1-phenylhydrazine hydrochloride van,hydrazine, 1-phenyl-1-phenylmethyl-, hydrochloride 1:1,acmc-209lvq PubChem CID: 79785 IUPAC Name: 1-benzyl-1-phenylhydrazine;hydrochloride SMILES: [H+].[Cl-].NN(CC1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 79785 |
|---|---|
| CAS | 5705-15-7 |
| Molecular Weight (g/mol) | 234.73 |
| MDL Number | MFCD00050690 |
| SMILES | [H+].[Cl-].NN(CC1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 1-benzyl-1-phenylhydrazine hydrochloride,n-benzyl-n-phenylhydrazine hydrochloride,usaf ek-1666,hydrazine, 1-phenyl-1-phenylmethyl-, monohydrochloride,alpha-benzyl-alpha-phenylhydrazine hydrochloride,n-benzyl-n-phenylhydrazinium 1+ chloride,hydrazine, 1-benzyl-1-phenyl-, hydrochloride,1-benzyl-1-phenylhydrazine hydrochloride van,hydrazine, 1-phenyl-1-phenylmethyl-, hydrochloride 1:1,acmc-209lvq |
| IUPAC Name | 1-benzyl-1-phenylhydrazine;hydrochloride |
| InChI Key | JTYLHYOCBGPMNO-UHFFFAOYSA-N |
| Molecular Formula | C13H15ClN2 |
2,6-Bis(hydroxymethyl)-p-cresol, tech. 90%
CAS: 91-04-3 Molecular Formula: C9H12O3 Molecular Weight (g/mol): 168.192 MDL Number: MFCD00004619 InChI Key: KUMMBDBTERQYCG-UHFFFAOYSA-N Synonym: 2,6-bis hydroxymethyl-4-methylphenol,2,6-bis hydroxymethyl-p-cresol,2,6-dimethylol-p-cresol,2-hydroxy-5-methyl-1,3-phenylene dimethanol,2,6-dimethylol-4-methylphenol,2,6-di hydroxymethyl-p-cresol,1,3-benzenedimethanol, 2-hydroxy-5-methyl,2-hydroxy-5-methyl-1,3-benzenedimethanol,3,5-bis hydroxymethyl-p-cresol,alpha1,alpha,2-trihydroxymesitylene PubChem CID: 7039 IUPAC Name: 2,6-bis(hydroxymethyl)-4-methylphenol SMILES: CC1=CC(=C(C(=C1)CO)O)CO
| PubChem CID | 7039 |
|---|---|
| CAS | 91-04-3 |
| Molecular Weight (g/mol) | 168.192 |
| MDL Number | MFCD00004619 |
| SMILES | CC1=CC(=C(C(=C1)CO)O)CO |
| Synonym | 2,6-bis hydroxymethyl-4-methylphenol,2,6-bis hydroxymethyl-p-cresol,2,6-dimethylol-p-cresol,2-hydroxy-5-methyl-1,3-phenylene dimethanol,2,6-dimethylol-4-methylphenol,2,6-di hydroxymethyl-p-cresol,1,3-benzenedimethanol, 2-hydroxy-5-methyl,2-hydroxy-5-methyl-1,3-benzenedimethanol,3,5-bis hydroxymethyl-p-cresol,alpha1,alpha,2-trihydroxymesitylene |
| IUPAC Name | 2,6-bis(hydroxymethyl)-4-methylphenol |
| InChI Key | KUMMBDBTERQYCG-UHFFFAOYSA-N |
| Molecular Formula | C9H12O3 |
Pyridine-4-carboxaldoxime, 97%
CAS: 696-54-8 Molecular Formula: C6H6N2O Molecular Weight (g/mol): 122.13 MDL Number: MFCD00006446 InChI Key: OFYLBLSSPQTTHT-VMPITWQZSA-N Synonym: pyridine-4-aldoxime,4-pyridinealdoxime,isonicotinaldehyde oxime,4-pyridinecarboxaldehyde, oxime,isonicotinaldoxime,4-hydroxyiminomethyl pyridine,4-pyridinaldoxime,4-pyridine aldoxime,pyridine, 4-formyl-, oxime,ccris 7744 PubChem CID: 5324569 IUPAC Name: 4-(nitrosomethylidene)-1H-pyridine SMILES: O\N=C\C1=CC=NC=C1
| PubChem CID | 5324569 |
|---|---|
| CAS | 696-54-8 |
| Molecular Weight (g/mol) | 122.13 |
| MDL Number | MFCD00006446 |
| SMILES | O\N=C\C1=CC=NC=C1 |
| Synonym | pyridine-4-aldoxime,4-pyridinealdoxime,isonicotinaldehyde oxime,4-pyridinecarboxaldehyde, oxime,isonicotinaldoxime,4-hydroxyiminomethyl pyridine,4-pyridinaldoxime,4-pyridine aldoxime,pyridine, 4-formyl-, oxime,ccris 7744 |
| IUPAC Name | 4-(nitrosomethylidene)-1H-pyridine |
| InChI Key | OFYLBLSSPQTTHT-VMPITWQZSA-N |
| Molecular Formula | C6H6N2O |
Ethylenediaminetetraacetic acid tetrasodium salt hydrate, 98%
CAS: 194491-31-1 Molecular Formula: C10H12N2Na4O8 Molecular Weight (g/mol): 380.17 MDL Number: MFCD00150025 InChI Key: UEUXEKPTXMALOB-UHFFFAOYSA-J Synonym: edta tetrasodium salt,ethylenediaminetetraacetic acid tetrasodium salt hydrate,tetrasodium 2-2-bis carboxylatomethyl amino ethyl carboxylatomethyl amino acetate hydrate,tetrasodium ion 4-edta hydrate,ethylenediaminetetraacetic acid, tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate kt,ethylenediaminetetraacetic acid tetrasodium salt hydrate, bioultra kt,ethylenediaminetetraacetic acid tetrasodium salt hydrate, practical grade PubChem CID: 16211056 IUPAC Name: tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;hydrate SMILES: [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 16211056 |
|---|---|
| CAS | 194491-31-1 |
| Molecular Weight (g/mol) | 380.17 |
| MDL Number | MFCD00150025 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta tetrasodium salt,ethylenediaminetetraacetic acid tetrasodium salt hydrate,tetrasodium 2-2-bis carboxylatomethyl amino ethyl carboxylatomethyl amino acetate hydrate,tetrasodium ion 4-edta hydrate,ethylenediaminetetraacetic acid, tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate kt,ethylenediaminetetraacetic acid tetrasodium salt hydrate, bioultra kt,ethylenediaminetetraacetic acid tetrasodium salt hydrate, practical grade |
| IUPAC Name | tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;hydrate |
| InChI Key | UEUXEKPTXMALOB-UHFFFAOYSA-J |
| Molecular Formula | C10H12N2Na4O8 |
Terbium(III) acetate hydrate, 99.99%
CAS: 100587-92-6 Molecular Formula: C6H9O6Tb Molecular Weight (g/mol): 336.06 MDL Number: MFCD00149233 InChI Key: JQBILSNVGUAPMM-UHFFFAOYSA-K IUPAC Name: terbium(3+) triacetate SMILES: [Tb+3].CC([O-])=O.CC([O-])=O.CC([O-])=O
| CAS | 100587-92-6 |
|---|---|
| Molecular Weight (g/mol) | 336.06 |
| MDL Number | MFCD00149233 |
| SMILES | [Tb+3].CC([O-])=O.CC([O-])=O.CC([O-])=O |
| IUPAC Name | terbium(3+) triacetate |
| InChI Key | JQBILSNVGUAPMM-UHFFFAOYSA-K |
| Molecular Formula | C6H9O6Tb |
1,3-Dibromotetrafluorobenzene, 98+%
CAS: 1559-87-1 Molecular Formula: C6Br2F4 Molecular Weight (g/mol): 307.87 MDL Number: MFCD00031533 InChI Key: UCWKDDQEZQRGDR-UHFFFAOYSA-N PubChem CID: 73793 IUPAC Name: 1,3-dibromo-2,4,5,6-tetrafluorobenzene SMILES: FC1=C(F)C(Br)=C(F)C(Br)=C1F
| PubChem CID | 73793 |
|---|---|
| CAS | 1559-87-1 |
| Molecular Weight (g/mol) | 307.87 |
| MDL Number | MFCD00031533 |
| SMILES | FC1=C(F)C(Br)=C(F)C(Br)=C1F |
| IUPAC Name | 1,3-dibromo-2,4,5,6-tetrafluorobenzene |
| InChI Key | UCWKDDQEZQRGDR-UHFFFAOYSA-N |
| Molecular Formula | C6Br2F4 |
(+/-)-Ethyl mandelate, 97%
CAS: 774-40-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00004494 InChI Key: SAXHIDRUJXPDOD-UHFFFAOYSA-N Synonym: ethyl mandelate,ethyl phenylglycolate,mandelic acid, ethyl ester,dl-mandelic acid ethyl ester,mandelic acid ethyl ester,ethyl dl-mandelate,mandelsaeureaethylester,ethyl hydroxy phenyl acetate,mandelsaeureaethylester german,+-ethyl mandelate PubChem CID: 13050 ChEBI: CHEBI:38750 IUPAC Name: ethyl 2-hydroxy-2-phenylacetate SMILES: CCOC(=O)C(C1=CC=CC=C1)O
| PubChem CID | 13050 |
|---|---|
| CAS | 774-40-3 |
| Molecular Weight (g/mol) | 180.203 |
| ChEBI | CHEBI:38750 |
| MDL Number | MFCD00004494 |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)O |
| Synonym | ethyl mandelate,ethyl phenylglycolate,mandelic acid, ethyl ester,dl-mandelic acid ethyl ester,mandelic acid ethyl ester,ethyl dl-mandelate,mandelsaeureaethylester,ethyl hydroxy phenyl acetate,mandelsaeureaethylester german,+-ethyl mandelate |
| IUPAC Name | ethyl 2-hydroxy-2-phenylacetate |
| InChI Key | SAXHIDRUJXPDOD-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
2-Nitrothiophene, tech. 85%
CAS: 609-40-5 Molecular Formula: C4H3NO2S Molecular Weight (g/mol): 129.133 MDL Number: MFCD00005425 InChI Key: JIZRGGUCOQKGQD-UHFFFAOYSA-N Synonym: thiophene, 2-nitro,2-nitro-thiophene,2-nitro thiophene,2-nitrothiophene, tech,nitrothiophene,2-nitrothiofene,pubchem5570,2-nitrothiophene, tech.,acmc-1aw2t,wln: t5sj bnw PubChem CID: 11866 IUPAC Name: 2-nitrothiophene SMILES: C1=CSC(=C1)[N+](=O)[O-]
| PubChem CID | 11866 |
|---|---|
| CAS | 609-40-5 |
| Molecular Weight (g/mol) | 129.133 |
| MDL Number | MFCD00005425 |
| SMILES | C1=CSC(=C1)[N+](=O)[O-] |
| Synonym | thiophene, 2-nitro,2-nitro-thiophene,2-nitro thiophene,2-nitrothiophene, tech,nitrothiophene,2-nitrothiofene,pubchem5570,2-nitrothiophene, tech.,acmc-1aw2t,wln: t5sj bnw |
| IUPAC Name | 2-nitrothiophene |
| InChI Key | JIZRGGUCOQKGQD-UHFFFAOYSA-N |
| Molecular Formula | C4H3NO2S |
1-(2-Pyridylazo)-2-naphthol, 98%
CAS: 85-85-8 Molecular Formula: C15H11N3O Molecular Weight (g/mol): 249.273 MDL Number: MFCD00004071 InChI Key: RAXUMGMWXZYADR-OBGWFSINSA-N Synonym: 1-2-pyridylazo-2-naphthol,unii-095b53y3xv,pan indicator,2-naphthalenol, 1-2-pyridinylazo,1e-1-pyridin-2-ylhydrazinylidene naphthalen-2-one,1-2-pyridylazo-2-hydroxynaphthalene,pan van,1-2-pyridyldiazenyl naphthalen-2-ol,1-pyridin-2-azo-2-naphthol,2-naphthalenol, 1-2-2-pyridinyl diazenyl PubChem CID: 5376264 IUPAC Name: (1E)-1-(pyridin-2-ylhydrazinylidene)naphthalen-2-one SMILES: C1=CC=C2C(=C1)C=CC(=O)C2=NNC3=CC=CC=N3
| PubChem CID | 5376264 |
|---|---|
| CAS | 85-85-8 |
| Molecular Weight (g/mol) | 249.273 |
| MDL Number | MFCD00004071 |
| SMILES | C1=CC=C2C(=C1)C=CC(=O)C2=NNC3=CC=CC=N3 |
| Synonym | 1-2-pyridylazo-2-naphthol,unii-095b53y3xv,pan indicator,2-naphthalenol, 1-2-pyridinylazo,1e-1-pyridin-2-ylhydrazinylidene naphthalen-2-one,1-2-pyridylazo-2-hydroxynaphthalene,pan van,1-2-pyridyldiazenyl naphthalen-2-ol,1-pyridin-2-azo-2-naphthol,2-naphthalenol, 1-2-2-pyridinyl diazenyl |
| IUPAC Name | (1E)-1-(pyridin-2-ylhydrazinylidene)naphthalen-2-one |
| InChI Key | RAXUMGMWXZYADR-OBGWFSINSA-N |
| Molecular Formula | C15H11N3O |
2-Bromophenylacetonitrile, 97%
CAS: 19472-74-3 Molecular Formula: C8H6BrN Molecular Weight (g/mol): 196.05 MDL Number: MFCD00001896 InChI Key: BVCOJESIQPNOIF-UHFFFAOYSA-N Synonym: 2-bromophenylacetonitrile,2-bromobenzyl cyanide,2-2-bromophenyl acetonitrile,o-bromobenzyl cyanide,2-bromophenyl acetonitrile,o-bromophenylacetonitrile,benzeneacetonitrile, bromo,2-2-bromophenyl ethanenitrile,benzeneacetonitrile, 2-bromo,2-bromo-phenyl-acetonitrile PubChem CID: 29625 IUPAC Name: 2-(2-bromophenyl)acetonitrile SMILES: BrC1=CC=CC=C1CC#N
| PubChem CID | 29625 |
|---|---|
| CAS | 19472-74-3 |
| Molecular Weight (g/mol) | 196.05 |
| MDL Number | MFCD00001896 |
| SMILES | BrC1=CC=CC=C1CC#N |
| Synonym | 2-bromophenylacetonitrile,2-bromobenzyl cyanide,2-2-bromophenyl acetonitrile,o-bromobenzyl cyanide,2-bromophenyl acetonitrile,o-bromophenylacetonitrile,benzeneacetonitrile, bromo,2-2-bromophenyl ethanenitrile,benzeneacetonitrile, 2-bromo,2-bromo-phenyl-acetonitrile |
| IUPAC Name | 2-(2-bromophenyl)acetonitrile |
| InChI Key | BVCOJESIQPNOIF-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrN |
Tetra-n-hexylammonium iodide, 99%
CAS: 2138-24-1 Molecular Formula: C24H52IN Molecular Weight (g/mol): 481.591 MDL Number: MFCD00041981 InChI Key: VRKHAMWCGMJAMI-UHFFFAOYSA-M Synonym: tetrahexylammonium iodide,tetra-n-hexylammonium iodide,1-hexanaminium, n,n,n-trihexyl-, iodide,tetrahexylazanium iodide,1-hexanaminium, n,n,n-trihexyl-, iodide 1:1,acmc-209fjk,tetrahexyl ammonium iodide,tetra-n-hexyl ammonium iodide,ammonium, tetrahexyl-, iodide,1-hexanaminium,n,n-trihexyl-, iodide PubChem CID: 75056 IUPAC Name: tetrahexylazanium;iodide SMILES: CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.[I-]
| PubChem CID | 75056 |
|---|---|
| CAS | 2138-24-1 |
| Molecular Weight (g/mol) | 481.591 |
| MDL Number | MFCD00041981 |
| SMILES | CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.[I-] |
| Synonym | tetrahexylammonium iodide,tetra-n-hexylammonium iodide,1-hexanaminium, n,n,n-trihexyl-, iodide,tetrahexylazanium iodide,1-hexanaminium, n,n,n-trihexyl-, iodide 1:1,acmc-209fjk,tetrahexyl ammonium iodide,tetra-n-hexyl ammonium iodide,ammonium, tetrahexyl-, iodide,1-hexanaminium,n,n-trihexyl-, iodide |
| IUPAC Name | tetrahexylazanium;iodide |
| InChI Key | VRKHAMWCGMJAMI-UHFFFAOYSA-M |
| Molecular Formula | C24H52IN |
2,2'-Dibromobiphenyl, 98%
CAS: 13029-09-9 Molecular Formula: C12H8Br2 Molecular Weight (g/mol): 312.004 MDL Number: MFCD00093707 InChI Key: DRKHIWKXLZCAKP-UHFFFAOYSA-N Synonym: 2,2'-dibromobiphenyl,2,2'-dibromo-1,1'-biphenyl,o,o'-dibromobiphenyl,1-bromo-2-2-bromophenyl benzene,1,1'-biphenyl, 2,2'-dibromo,unii-gsl06p6p2l,biphenyl, 2,2'-dibromo,gsl06p6p2l,1,1'-biphenyl, 2,2'-dibromo-9ci,biphenyl,2'-dibromo PubChem CID: 83060 IUPAC Name: 1-bromo-2-(2-bromophenyl)benzene SMILES: C1=CC=C(C(=C1)C2=CC=CC=C2Br)Br
| PubChem CID | 83060 |
|---|---|
| CAS | 13029-09-9 |
| Molecular Weight (g/mol) | 312.004 |
| MDL Number | MFCD00093707 |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2Br)Br |
| Synonym | 2,2'-dibromobiphenyl,2,2'-dibromo-1,1'-biphenyl,o,o'-dibromobiphenyl,1-bromo-2-2-bromophenyl benzene,1,1'-biphenyl, 2,2'-dibromo,unii-gsl06p6p2l,biphenyl, 2,2'-dibromo,gsl06p6p2l,1,1'-biphenyl, 2,2'-dibromo-9ci,biphenyl,2'-dibromo |
| IUPAC Name | 1-bromo-2-(2-bromophenyl)benzene |
| InChI Key | DRKHIWKXLZCAKP-UHFFFAOYSA-N |
| Molecular Formula | C12H8Br2 |
2-Hydroxy-4-methoxybenzophenone, 98+%
CAS: 131-57-7 Molecular Formula: C14H12O3 Molecular Weight (g/mol): 228.247 MDL Number: MFCD00008387 InChI Key: DXGLGDHPHMLXJC-UHFFFAOYSA-N Synonym: oxybenzone,2-hydroxy-4-methoxybenzophenone,benzophenone-3,oxybenzon,4-methoxy-2-hydroxybenzophenone,2-benzoyl-5-methoxyphenol,oxibenzona,oxybenzonum,2-hydroxy-4-methoxyphenyl phenyl methanone,anuvex PubChem CID: 4632 ChEBI: CHEBI:34283 IUPAC Name: (2-hydroxy-4-methoxyphenyl)-phenylmethanone SMILES: COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O
| PubChem CID | 4632 |
|---|---|
| CAS | 131-57-7 |
| Molecular Weight (g/mol) | 228.247 |
| ChEBI | CHEBI:34283 |
| MDL Number | MFCD00008387 |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O |
| Synonym | oxybenzone,2-hydroxy-4-methoxybenzophenone,benzophenone-3,oxybenzon,4-methoxy-2-hydroxybenzophenone,2-benzoyl-5-methoxyphenol,oxibenzona,oxybenzonum,2-hydroxy-4-methoxyphenyl phenyl methanone,anuvex |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-phenylmethanone |
| InChI Key | DXGLGDHPHMLXJC-UHFFFAOYSA-N |
| Molecular Formula | C14H12O3 |
Nonanoyl chloride, 96%, Thermo Scientific Chemicals
CAS: 764-85-2 Molecular Formula: C9H17ClO Molecular Weight (g/mol): 176.684 MDL Number: MFCD00000768 InChI Key: NTQYXUJLILNTFH-UHFFFAOYSA-N Synonym: nonanoic acid chloride,pelargonoyl chloride,pelargonyl chloride,nonanoylchloride,n-nonanoyl chloride,unii-0v0dum0390,nonanoylchlorid,nananoyl chloride,nonanic acid chloride,pelargonic acid chloride PubChem CID: 69819 IUPAC Name: nonanoyl chloride SMILES: CCCCCCCCC(=O)Cl
| PubChem CID | 69819 |
|---|---|
| CAS | 764-85-2 |
| Molecular Weight (g/mol) | 176.684 |
| MDL Number | MFCD00000768 |
| SMILES | CCCCCCCCC(=O)Cl |
| Synonym | nonanoic acid chloride,pelargonoyl chloride,pelargonyl chloride,nonanoylchloride,n-nonanoyl chloride,unii-0v0dum0390,nonanoylchlorid,nananoyl chloride,nonanic acid chloride,pelargonic acid chloride |
| IUPAC Name | nonanoyl chloride |
| InChI Key | NTQYXUJLILNTFH-UHFFFAOYSA-N |
| Molecular Formula | C9H17ClO |