Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Thermo Scientific Chemicals Sodium n-dodecyl sulfate, 99%, Molecular Biology Grade
CAS: 151-21-3 Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal PubChem CID: 3423265 ChEBI: CHEBI:8984 SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| CAS | 151-21-3 |
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
Sodium succinate hexahydrate
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 MDL Number: MFCD00149117 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| MDL Number | MFCD00149117 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
Ethyl 3-aminobenzoate, methanesulfonic acid salt, 98%
CAS: 886-86-2 Molecular Formula: C9H11NO2·CH4O3S Molecular Weight (g/mol): 261.29 MDL Number: MFCD00013176 InChI Key: FQZJYWMRQDKBQN-UHFFFAOYSA-N Synonym: ethyl 3-aminobenzoate methanesulfonate,tricaine,tricaine methanesulfonate,finquel,metacaine,tricaine mesylate,3-aminobenzoic acid ethyl ester methanesulfonate,ethyl m-aminobenzoate methanesulfonate,ethyl 3-aminobenzoate methanesulfonic acid salt,3-aminobenzoic acid ethyl ester methanesulfonate salt PubChem CID: 261501 IUPAC Name: ethyl 3-aminobenzoate;methanesulfonic acid SMILES: CCOC(=O)C1=CC(=CC=C1)N.CS(=O)(=O)O
| PubChem CID | 261501 |
|---|---|
| CAS | 886-86-2 |
| Molecular Weight (g/mol) | 261.29 |
| MDL Number | MFCD00013176 |
| SMILES | CCOC(=O)C1=CC(=CC=C1)N.CS(=O)(=O)O |
| Synonym | ethyl 3-aminobenzoate methanesulfonate,tricaine,tricaine methanesulfonate,finquel,metacaine,tricaine mesylate,3-aminobenzoic acid ethyl ester methanesulfonate,ethyl m-aminobenzoate methanesulfonate,ethyl 3-aminobenzoate methanesulfonic acid salt,3-aminobenzoic acid ethyl ester methanesulfonate salt |
| IUPAC Name | ethyl 3-aminobenzoate;methanesulfonic acid |
| InChI Key | FQZJYWMRQDKBQN-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO2·CH4O3S |
1-Methyladenine, 95%, Thermo Scientific Chemicals
CAS: 5142-22-3 Molecular Formula: C6H7N5 Molecular Weight (g/mol): 149.16 MDL Number: MFCD00010532 InChI Key: HPZMWTNATZPBIH-UHFFFAOYSA-N Synonym: 1-methyladenine,1-methyl-1h-purin-6-amine,1h-purin-6-amine, 1-methyl,adenine, 1-methyl,n1-methyladenine,1-methyl-1h-purin-6-ylamine,6h-purin-6-imine, 1,9-dihydro-1-methyl,1-methyl-adenine,1-methyl-9h-purin-6-imine,1-methylhydropurine-6-ylamine PubChem CID: 78821 ChEBI: CHEBI:18083 IUPAC Name: 1-methylpurin-6-amine SMILES: CN1C=NC2=NC=NC2=C1N
| PubChem CID | 78821 |
|---|---|
| CAS | 5142-22-3 |
| Molecular Weight (g/mol) | 149.16 |
| ChEBI | CHEBI:18083 |
| MDL Number | MFCD00010532 |
| SMILES | CN1C=NC2=NC=NC2=C1N |
| Synonym | 1-methyladenine,1-methyl-1h-purin-6-amine,1h-purin-6-amine, 1-methyl,adenine, 1-methyl,n1-methyladenine,1-methyl-1h-purin-6-ylamine,6h-purin-6-imine, 1,9-dihydro-1-methyl,1-methyl-adenine,1-methyl-9h-purin-6-imine,1-methylhydropurine-6-ylamine |
| IUPAC Name | 1-methylpurin-6-amine |
| InChI Key | HPZMWTNATZPBIH-UHFFFAOYSA-N |
| Molecular Formula | C6H7N5 |
Dodecyltrimethylammonium chloride, 98%
CAS: 112-00-5 Molecular Formula: C15H34ClN Molecular Weight (g/mol): 263.88 MDL Number: MFCD00041974 InChI Key: DDXLVDQZPFLQMZ-UHFFFAOYSA-M Synonym: dodecyltrimethylammonium chloride,alicop,cation bb,aliquat 4,n,n,n-trimethyldodecan-1-aminium chloride,laurtrimonium chloride,dehyquart lt,cation fb,nissan cation bb,lauryltrimethylammonium chloride PubChem CID: 8152 IUPAC Name: dodecyl(trimethyl)azanium;chloride SMILES: CCCCCCCCCCCC[N+](C)(C)C.[Cl-]
| PubChem CID | 8152 |
|---|---|
| CAS | 112-00-5 |
| Molecular Weight (g/mol) | 263.88 |
| MDL Number | MFCD00041974 |
| SMILES | CCCCCCCCCCCC[N+](C)(C)C.[Cl-] |
| Synonym | dodecyltrimethylammonium chloride,alicop,cation bb,aliquat 4,n,n,n-trimethyldodecan-1-aminium chloride,laurtrimonium chloride,dehyquart lt,cation fb,nissan cation bb,lauryltrimethylammonium chloride |
| IUPAC Name | dodecyl(trimethyl)azanium;chloride |
| InChI Key | DDXLVDQZPFLQMZ-UHFFFAOYSA-M |
| Molecular Formula | C15H34ClN |
2-Methyl-2-butanol, 98%
CAS: 75-85-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00004478 InChI Key: MSXVEPNJUHWQHW-UHFFFAOYSA-N Synonym: 2-methyl-2-butanol,tert-amyl alcohol,amylene hydrate,tert-pentyl alcohol,tert-pentanol,t-amyl alcohol,2-butanol, 2-methyl,dimethylethylcarbinol,ethyldimethylcarbinol,tert-isoamyl alcohol PubChem CID: 6405 IUPAC Name: 2-methylbutan-2-ol SMILES: CCC(C)(C)O
| PubChem CID | 6405 |
|---|---|
| CAS | 75-85-4 |
| Molecular Weight (g/mol) | 88.15 |
| MDL Number | MFCD00004478 |
| SMILES | CCC(C)(C)O |
| Synonym | 2-methyl-2-butanol,tert-amyl alcohol,amylene hydrate,tert-pentyl alcohol,tert-pentanol,t-amyl alcohol,2-butanol, 2-methyl,dimethylethylcarbinol,ethyldimethylcarbinol,tert-isoamyl alcohol |
| IUPAC Name | 2-methylbutan-2-ol |
| InChI Key | MSXVEPNJUHWQHW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Thermo Scientific Chemicals Guanidine hydrochloride, Molecular Biology Grade
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
Propyl 4-hydroxybenzoate, 99+%
CAS: 94-13-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.2 MDL Number: MFCD00002354 InChI Key: QELSKZZBTMNZEB-UHFFFAOYSA-N Synonym: propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept PubChem CID: 7175 ChEBI: CHEBI:32063 IUPAC Name: propyl 4-hydroxybenzoate SMILES: CCCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7175 |
|---|---|
| CAS | 94-13-3 |
| Molecular Weight (g/mol) | 180.2 |
| ChEBI | CHEBI:32063 |
| MDL Number | MFCD00002354 |
| SMILES | CCCOC(=O)C1=CC=C(C=C1)O |
| Synonym | propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept |
| IUPAC Name | propyl 4-hydroxybenzoate |
| InChI Key | QELSKZZBTMNZEB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Benzyltriphenylphosphonium Chloride, 99%
CAS: 1100-88-5 Molecular Formula: C25H22ClP Molecular Weight (g/mol): 388.87 MDL Number: MFCD00011913 InChI Key: USFRYJRPHFMVBZ-UHFFFAOYSA-M Synonym: benzyltriphenylphosphonium chloride,triphenylbenzylphosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride,benzyltriphenylphosphanium chloride,benzyl triphenylphosphonium chloride,benzyl-triphenyl-phosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride 1:1,triphenylbenzylphosphine, chloride,benzyl triphenyl phosphoniumchlorid PubChem CID: 70671 IUPAC Name: benzyl(triphenyl)phosphanium;chloride SMILES: [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 70671 |
|---|---|
| CAS | 1100-88-5 |
| Molecular Weight (g/mol) | 388.87 |
| MDL Number | MFCD00011913 |
| SMILES | [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | benzyltriphenylphosphonium chloride,triphenylbenzylphosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride,benzyltriphenylphosphanium chloride,benzyl triphenylphosphonium chloride,benzyl-triphenyl-phosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride 1:1,triphenylbenzylphosphine, chloride,benzyl triphenyl phosphoniumchlorid |
| IUPAC Name | benzyl(triphenyl)phosphanium;chloride |
| InChI Key | USFRYJRPHFMVBZ-UHFFFAOYSA-M |
| Molecular Formula | C25H22ClP |
Thermo Scientific Chemicals Cyanocobalamin, 96%
CAS: 68-19-9 Molecular Formula: C63H88CoN14O14P Molecular Weight (g/mol): 1355.39 MDL Number: MFCD00151092 InChI Key: YUWVGNQGDAPKCX-BVWPOUIRNA-L Synonym: vitamin b12 PubChem CID: 129893524 IUPAC Name: cobalt(2+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- SMILES: [C@@H]1(C2=CC3=[N+]4C(C(C3(C)C)CCC(N)=O)=C(C3=[N+]5C6C7(N8C(C([C@@]7(C)CC(N)=O)CCC(N)=O)=C(C(=[N+]2[Co+]458([N+]2=CN(C4=CC(=C(C)C=C24)C)[C@@]2([H])O[C@@H]([C@]([H])(OP([O-])(=O)OC(C)CNC(=O)CCC3(C)[C@@H]6CC(N)=O)C2O)CO)C#N)C1(C)CC(N)=O)C)C)C)CCC(N)=O
| PubChem CID | 129893524 |
|---|---|
| CAS | 68-19-9 |
| Molecular Weight (g/mol) | 1355.39 |
| MDL Number | MFCD00151092 |
| SMILES | [C@@H]1(C2=CC3=[N+]4C(C(C3(C)C)CCC(N)=O)=C(C3=[N+]5C6C7(N8C(C([C@@]7(C)CC(N)=O)CCC(N)=O)=C(C(=[N+]2[Co+]458([N+]2=CN(C4=CC(=C(C)C=C24)C)[C@@]2([H])O[C@@H]([C@]([H])(OP([O-])(=O)OC(C)CNC(=O)CCC3(C)[C@@H]6CC(N)=O)C2O)CO)C#N)C1(C)CC(N)=O)C)C)C)CCC(N)=O |
| Synonym | vitamin b12 |
| IUPAC Name | cobalt(2+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- |
| InChI Key | YUWVGNQGDAPKCX-BVWPOUIRNA-L |
| Molecular Formula | C63H88CoN14O14P |
Isopropenylmagnesium bromide, 0.5M solution in THF, AcroSeal™
CAS: 13291-18-4 Molecular Formula: C3H5BrMg Molecular Weight (g/mol): 145.28 MDL Number: MFCD00192240 InChI Key: LFTYALBVGVNGLI-UHFFFAOYSA-M Synonym: isopropenylmagnesium bromide,isopropenylmagnesium bromide solution,isopropenyl magnesium bromide,bromo prop-1-en-2-yl magnesium,magnesium, bromo 1-methylethenyl,bromo isopropenyl magnesium,1-methylethenylmagnesium bromide,2-propen-2-ylmagnesium bromide,prop-1-en-2-ylmagnesium bromide,lftyalbvgvngli-uhfffaoysa-m,grignard reagent PubChem CID: 4187787 IUPAC Name: magnesium;prop-1-ene;bromide SMILES: CC(=C)[Mg]Br
| PubChem CID | 4187787 |
|---|---|
| CAS | 13291-18-4 |
| Molecular Weight (g/mol) | 145.28 |
| MDL Number | MFCD00192240 |
| SMILES | CC(=C)[Mg]Br |
| Synonym | isopropenylmagnesium bromide,isopropenylmagnesium bromide solution,isopropenyl magnesium bromide,bromo prop-1-en-2-yl magnesium,magnesium, bromo 1-methylethenyl,bromo isopropenyl magnesium,1-methylethenylmagnesium bromide,2-propen-2-ylmagnesium bromide,prop-1-en-2-ylmagnesium bromide,lftyalbvgvngli-uhfffaoysa-m,grignard reagent |
| IUPAC Name | magnesium;prop-1-ene;bromide |
| InChI Key | LFTYALBVGVNGLI-UHFFFAOYSA-M |
| Molecular Formula | C3H5BrMg |
Methoxylamine hydrochloride, 98+%
CAS: 593-56-6 Molecular Formula: CH6ClNO Molecular Weight (g/mol): 83.515 MDL Number: MFCD00012951 InChI Key: XNXVOSBNFZWHBV-UHFFFAOYSA-N Synonym: o-methylhydroxylamine hydrochloride,methoxyamine hydrochloride,methoxylamine hydrochloride,methoxyammonium chloride,o-methylhydroxylamine hcl,aminooxy methane hydrochloride,methoxyamine hcl,unii-203546olmf,hydroxylamine, o-methyl-, hydrochloride,o-methylhydroxyamine hydrochloride PubChem CID: 521874 IUPAC Name: O-methylhydroxylamine;hydrochloride SMILES: CON.Cl
| PubChem CID | 521874 |
|---|---|
| CAS | 593-56-6 |
| Molecular Weight (g/mol) | 83.515 |
| MDL Number | MFCD00012951 |
| SMILES | CON.Cl |
| Synonym | o-methylhydroxylamine hydrochloride,methoxyamine hydrochloride,methoxylamine hydrochloride,methoxyammonium chloride,o-methylhydroxylamine hcl,aminooxy methane hydrochloride,methoxyamine hcl,unii-203546olmf,hydroxylamine, o-methyl-, hydrochloride,o-methylhydroxyamine hydrochloride |
| IUPAC Name | O-methylhydroxylamine;hydrochloride |
| InChI Key | XNXVOSBNFZWHBV-UHFFFAOYSA-N |
| Molecular Formula | CH6ClNO |
Octadecylbenzene, 98%
CAS: 4445-07-2 Molecular Formula: C24H42 Molecular Weight (g/mol): 330.59 MDL Number: MFCD00048500 InChI Key: WSVDSBZMYJJMSB-UHFFFAOYSA-N IUPAC Name: octadecylbenzene SMILES: CCCCCCCCCCCCCCCCCCC1=CC=CC=C1
| CAS | 4445-07-2 |
|---|---|
| Molecular Weight (g/mol) | 330.59 |
| MDL Number | MFCD00048500 |
| SMILES | CCCCCCCCCCCCCCCCCCC1=CC=CC=C1 |
| IUPAC Name | octadecylbenzene |
| InChI Key | WSVDSBZMYJJMSB-UHFFFAOYSA-N |
| Molecular Formula | C24H42 |
o-Dianisidine dihydrochloride, 98%
CAS: 20325-40-0 Molecular Formula: C14H18Cl2N2O2 Molecular Weight (g/mol): 317.21 MDL Number: MFCD00012488 InChI Key: UXTIAFYTYOEQHV-UHFFFAOYSA-N Synonym: 3,3'-dimethoxybenzidine dihydrochloride,o-dianisidine dihydrochloride,3,3'-dimethoxy-1,1'-biphenyl-4,4'-diamine dihydrochloride,unii-qv96qa6ukk,dianisidine dihydrochloride,ccris 998,o-dianisidine hcl,qv96qa6ukk,c.i. disperse black 6 dihydrochloride PubChem CID: 62311 IUPAC Name: 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;dihydrochloride SMILES: COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N.Cl.Cl
| PubChem CID | 62311 |
|---|---|
| CAS | 20325-40-0 |
| Molecular Weight (g/mol) | 317.21 |
| MDL Number | MFCD00012488 |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N.Cl.Cl |
| Synonym | 3,3'-dimethoxybenzidine dihydrochloride,o-dianisidine dihydrochloride,3,3'-dimethoxy-1,1'-biphenyl-4,4'-diamine dihydrochloride,unii-qv96qa6ukk,dianisidine dihydrochloride,ccris 998,o-dianisidine hcl,qv96qa6ukk,c.i. disperse black 6 dihydrochloride |
| IUPAC Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;dihydrochloride |
| InChI Key | UXTIAFYTYOEQHV-UHFFFAOYSA-N |
| Molecular Formula | C14H18Cl2N2O2 |
Chondroitin sulfate A sodium salt, 90%
Chondroitin sulfate A (chondroitin 4'-sulfate), CAS # 9007-28-7, is a structural polysaccharide of the chondroitin sulfate family.
| Percent Purity | 90% |
|---|---|
| MDL Number | MFCD00130792 |
| Color | White |
| Physical Form | Powder |
| Solubility Information | Insoluble in water. |
| Chemical Name or Material | Chondroitin sulfate A sodium salt |
| TSCA | No |
| Recommended Storage | Keep cold |