Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Benzylamine, 99%, pure
CAS: 100-46-9 Molecular Formula: C7H9N Molecular Weight (g/mol): 107.15 MDL Number: MFCD00008106 InChI Key: WGQKYBSKWIADBV-UHFFFAOYSA-N Synonym: benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine PubChem CID: 7504 ChEBI: CHEBI:40538 IUPAC Name: phenylmethanamine SMILES: C1=CC=C(C=C1)CN
| PubChem CID | 7504 |
|---|---|
| CAS | 100-46-9 |
| Molecular Weight (g/mol) | 107.15 |
| ChEBI | CHEBI:40538 |
| MDL Number | MFCD00008106 |
| SMILES | C1=CC=C(C=C1)CN |
| Synonym | benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine |
| IUPAC Name | phenylmethanamine |
| InChI Key | WGQKYBSKWIADBV-UHFFFAOYSA-N |
| Molecular Formula | C7H9N |
Hydroquinone, 99%
CAS: 123-31-9 Molecular Formula: C6H6O2 Molecular Weight (g/mol): 110.112 MDL Number: MFCD00002339 InChI Key: QIGBRXMKCJKVMJ-UHFFFAOYSA-N Synonym: hydroquinone,1,4-benzenediol,quinol,1,4-dihydroxybenzene,p-benzenediol,4-hydroxyphenol,p-hydroquinone,p-hydroxyphenol,p-dihydroxybenzene,benzoquinol PubChem CID: 785 ChEBI: CHEBI:17594 IUPAC Name: benzene-1,4-diol SMILES: C1=CC(=CC=C1O)O
| PubChem CID | 785 |
|---|---|
| CAS | 123-31-9 |
| Molecular Weight (g/mol) | 110.112 |
| ChEBI | CHEBI:17594 |
| MDL Number | MFCD00002339 |
| SMILES | C1=CC(=CC=C1O)O |
| Synonym | hydroquinone,1,4-benzenediol,quinol,1,4-dihydroxybenzene,p-benzenediol,4-hydroxyphenol,p-hydroquinone,p-hydroxyphenol,p-dihydroxybenzene,benzoquinol |
| IUPAC Name | benzene-1,4-diol |
| InChI Key | QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2 |
1,4-Dimethoxybenzene, 99+%
CAS: 150-78-7 Molecular Formula: C8H10O2 Molecular Weight (g/mol): 138.17 MDL Number: MFCD00008401 InChI Key: OHBQPCCCRFSCAX-UHFFFAOYSA-N Synonym: p-dimethoxybenzene,p-methoxyanisole,hydroquinone dimethyl ether,benzene, 1,4-dimethoxy,quinol dimethyl ether,benzene, p-dimethoxy,dimethylhydroquinone ether,dimethyl ether hydroquinone,1,4-dimethoxybenzol,usaf an-9 PubChem CID: 9016 IUPAC Name: 1,4-dimethoxybenzene SMILES: COC1=CC=C(OC)C=C1
| PubChem CID | 9016 |
|---|---|
| CAS | 150-78-7 |
| Molecular Weight (g/mol) | 138.17 |
| MDL Number | MFCD00008401 |
| SMILES | COC1=CC=C(OC)C=C1 |
| Synonym | p-dimethoxybenzene,p-methoxyanisole,hydroquinone dimethyl ether,benzene, 1,4-dimethoxy,quinol dimethyl ether,benzene, p-dimethoxy,dimethylhydroquinone ether,dimethyl ether hydroquinone,1,4-dimethoxybenzol,usaf an-9 |
| IUPAC Name | 1,4-dimethoxybenzene |
| InChI Key | OHBQPCCCRFSCAX-UHFFFAOYSA-N |
| Molecular Formula | C8H10O2 |
n-Hexatriacontane, 97+%
CAS: 630-06-8 Molecular Formula: C36H74 Molecular Weight (g/mol): 506.99 MDL Number: MFCD00009413 InChI Key: YDLYQMBWCWFRAI-UHFFFAOYSA-N Synonym: n-hexatriacontane,hexatriacontane,ch3-ch2 34-ch3,hexatriacontane, analytical standard,hexatriacontane, n,acmc-1b3b7,n-hexatriacontane 10g PubChem CID: 12412 ChEBI: CHEBI:72688 IUPAC Name: hexatriacontane SMILES: CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC
| PubChem CID | 12412 |
|---|---|
| CAS | 630-06-8 |
| Molecular Weight (g/mol) | 506.99 |
| ChEBI | CHEBI:72688 |
| MDL Number | MFCD00009413 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC |
| Synonym | n-hexatriacontane,hexatriacontane,ch3-ch2 34-ch3,hexatriacontane, analytical standard,hexatriacontane, n,acmc-1b3b7,n-hexatriacontane 10g |
| IUPAC Name | hexatriacontane |
| InChI Key | YDLYQMBWCWFRAI-UHFFFAOYSA-N |
| Molecular Formula | C36H74 |
3-Maleimidopropionic acid N-hydroxysuccinimide ester, 99%
CAS: 55750-62-4 Molecular Formula: C11H10N2O6 Molecular Weight (g/mol): 266.21 InChI Key: JKHVDAUOODACDU-UHFFFAOYSA-N Synonym: n-succinimidyl 3-maleimidopropionate,2,5-dioxopyrrolidin-1-yl 3-2,5-dioxo-2,5-dihydro-1h-pyrrol-1-yl propanoate,3-maleimido propionic acid n-hydroxysuccinimide ester,bmps,3-maleimidopropionic acid n-succinimidyl ester,3-maleimidopropionic acid nhs,succinimido 3-maleimidopropanoate,2,5-dioxopyrrolidin-1-yl 3-2,5-dioxopyrrol-1-yl propanoate,3-maleimidopropionic acid n-hydroxysuccinimide ester PubChem CID: 4620597 IUPAC Name: (2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate SMILES: C1CC(=O)N(C1=O)OC(=O)CCN2C(=O)C=CC2=O
| PubChem CID | 4620597 |
|---|---|
| CAS | 55750-62-4 |
| Molecular Weight (g/mol) | 266.21 |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCN2C(=O)C=CC2=O |
| Synonym | n-succinimidyl 3-maleimidopropionate,2,5-dioxopyrrolidin-1-yl 3-2,5-dioxo-2,5-dihydro-1h-pyrrol-1-yl propanoate,3-maleimido propionic acid n-hydroxysuccinimide ester,bmps,3-maleimidopropionic acid n-succinimidyl ester,3-maleimidopropionic acid nhs,succinimido 3-maleimidopropanoate,2,5-dioxopyrrolidin-1-yl 3-2,5-dioxopyrrol-1-yl propanoate,3-maleimidopropionic acid n-hydroxysuccinimide ester |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate |
| InChI Key | JKHVDAUOODACDU-UHFFFAOYSA-N |
| Molecular Formula | C11H10N2O6 |
| CAS | 9000-70-8 |
|---|---|
| MDL Number | MFCD00081638 |
Thermo Scientific Chemicals D-Panthenol, 98+%
CAS: 81-13-0 Molecular Formula: C9H19NO4 Molecular Weight (g/mol): 205.25 MDL Number: MFCD00065006 InChI Key: SNPLKNRPJHDVJA-ZETCQYMHSA-N Synonym: dexpanthenol,d-panthenol,pantothenol,bepanthen,d-pantothenyl alcohol,ilopan,+-panthenol,bepanthene,panthoderm,thenalton PubChem CID: 131204 ChEBI: CHEBI:27373 IUPAC Name: (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide SMILES: CC(C)(CO)[C@@H](O)C(=O)NCCCO
| PubChem CID | 131204 |
|---|---|
| CAS | 81-13-0 |
| Molecular Weight (g/mol) | 205.25 |
| ChEBI | CHEBI:27373 |
| MDL Number | MFCD00065006 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCCO |
| Synonym | dexpanthenol,d-panthenol,pantothenol,bepanthen,d-pantothenyl alcohol,ilopan,+-panthenol,bepanthene,panthoderm,thenalton |
| IUPAC Name | (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
| InChI Key | SNPLKNRPJHDVJA-ZETCQYMHSA-N |
| Molecular Formula | C9H19NO4 |
Perfluorooctanesulfonamide, 95%
CAS: 754-91-6 Molecular Formula: C8H2F17NO2S Molecular Weight (g/mol): 499.15 InChI Key: RRRXPPIDPYTNJG-UHFFFAOYSA-N Synonym: perfluorooctanesulfonamide,perfluoroctylsulfonamide,perfluorooctane sulfonamide,pfosa,heptadecafluorooctanesulphonamide,perfluorooctanesulfonic acid amide,unii-80am718fml,1-octanesulfonamide, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro,deethylsulfluramie,perfluorooctanesulphonamide PubChem CID: 69785 IUPAC Name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide SMILES: C(C(C(C(C(F)(F)S(=O)(=O)N)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F
| PubChem CID | 69785 |
|---|---|
| CAS | 754-91-6 |
| Molecular Weight (g/mol) | 499.15 |
| SMILES | C(C(C(C(C(F)(F)S(=O)(=O)N)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
| Synonym | perfluorooctanesulfonamide,perfluoroctylsulfonamide,perfluorooctane sulfonamide,pfosa,heptadecafluorooctanesulphonamide,perfluorooctanesulfonic acid amide,unii-80am718fml,1-octanesulfonamide, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro,deethylsulfluramie,perfluorooctanesulphonamide |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
| InChI Key | RRRXPPIDPYTNJG-UHFFFAOYSA-N |
| Molecular Formula | C8H2F17NO2S |
L-Phenylalanine methyl ester hydrochloride, 98%
CAS: 7524-50-7 Molecular Formula: C10H14ClNO2 Molecular Weight (g/mol): 215.68 MDL Number: MFCD00012489 InChI Key: SWVMLNPDTIFDDY-UHFFFAOYNA-N Synonym: l-phenylalanine methyl ester hydrochloride,h-phe-ome.hcl,methyl l-phenylalaninate hydrochloride,s-methyl 2-amino-3-phenylpropanoate hydrochloride,unii-47hk4y94ja,h-phe-ome hcl,h-phe-ome hydrochloride,l-phenylalanine, methyl ester, hydrochloride,l-phenylalanine methyl ester hcl PubChem CID: 75736 SMILES: [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1
| PubChem CID | 75736 |
|---|---|
| CAS | 7524-50-7 |
| Molecular Weight (g/mol) | 215.68 |
| MDL Number | MFCD00012489 |
| SMILES | [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 |
| Synonym | l-phenylalanine methyl ester hydrochloride,h-phe-ome.hcl,methyl l-phenylalaninate hydrochloride,s-methyl 2-amino-3-phenylpropanoate hydrochloride,unii-47hk4y94ja,h-phe-ome hcl,h-phe-ome hydrochloride,l-phenylalanine, methyl ester, hydrochloride,l-phenylalanine methyl ester hcl |
| InChI Key | SWVMLNPDTIFDDY-UHFFFAOYNA-N |
| Molecular Formula | C10H14ClNO2 |
Diphenylamine, 98+%
CAS: 122-39-4 Molecular Formula: C12H11N Molecular Weight (g/mol): 169.227 MDL Number: MFCD00003014 InChI Key: DMBHHRLKUKUOEG-UHFFFAOYSA-N Synonym: diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald PubChem CID: 11487 ChEBI: CHEBI:4640 IUPAC Name: N-phenylaniline SMILES: C1=CC=C(C=C1)NC2=CC=CC=C2
| PubChem CID | 11487 |
|---|---|
| CAS | 122-39-4 |
| Molecular Weight (g/mol) | 169.227 |
| ChEBI | CHEBI:4640 |
| MDL Number | MFCD00003014 |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
| Synonym | diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald |
| IUPAC Name | N-phenylaniline |
| InChI Key | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Molecular Formula | C12H11N |
D(-)-Quinic acid, 98+%
CAS: 77-95-2 Molecular Formula: C7H12O6 Molecular Weight (g/mol): 192.17 MDL Number: MFCD00003864 InChI Key: AAWZDTNXLSGCEK-UHFFFAOYNA-N Synonym: quinic acid,d---quinic acid,--quinic acid,chinic acid,kinic acid,chinasaure,quinate,l-quinic acid,d-quinic acid,unii-058c04bgyi PubChem CID: 6508 IUPAC Name: (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid SMILES: OC1CC(O)(CC(O)C1O)C(O)=O
| PubChem CID | 6508 |
|---|---|
| CAS | 77-95-2 |
| Molecular Weight (g/mol) | 192.17 |
| MDL Number | MFCD00003864 |
| SMILES | OC1CC(O)(CC(O)C1O)C(O)=O |
| Synonym | quinic acid,d---quinic acid,--quinic acid,chinic acid,kinic acid,chinasaure,quinate,l-quinic acid,d-quinic acid,unii-058c04bgyi |
| IUPAC Name | (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
| InChI Key | AAWZDTNXLSGCEK-UHFFFAOYNA-N |
| Molecular Formula | C7H12O6 |
Ammonium formate, 97%
CAS: 540-69-2 Molecular Formula: CH5NO2 Molecular Weight (g/mol): 63.056 MDL Number: MFCD00013103 InChI Key: VZTDIZULWFCMLS-UHFFFAOYSA-N Synonym: ammonium formate,formic acid, ammonium salt,formic acid ammonium salt,ammoniumformate,azanium formate,ammonium formiate,formic acid, ammonium salt 1:1,mravencan amonny czech,hsdb 479,mravencan amonny PubChem CID: 2723923 ChEBI: CHEBI:63050 IUPAC Name: azanium;formate SMILES: C(=O)[O-].[NH4+]
| PubChem CID | 2723923 |
|---|---|
| CAS | 540-69-2 |
| Molecular Weight (g/mol) | 63.056 |
| ChEBI | CHEBI:63050 |
| MDL Number | MFCD00013103 |
| SMILES | C(=O)[O-].[NH4+] |
| Synonym | ammonium formate,formic acid, ammonium salt,formic acid ammonium salt,ammoniumformate,azanium formate,ammonium formiate,formic acid, ammonium salt 1:1,mravencan amonny czech,hsdb 479,mravencan amonny |
| IUPAC Name | azanium;formate |
| InChI Key | VZTDIZULWFCMLS-UHFFFAOYSA-N |
| Molecular Formula | CH5NO2 |
MetFormin hydrochloride, 98%, For HPLC analysis, MP Biomedicals™
CAS: 1115-70-4 Molecular Formula: C4H12ClN5 Molecular Weight (g/mol): 165.63 MDL Number: MFCD00012582 InChI Key: OETHQSJEHLVLGH-UHFFFAOYSA-N Synonym: metformin hydrochloride,1,1-dimethylbiguanide hydrochloride,metformin hcl,glucophage,riomet,diabefagos,meguan,metformin monohydrochloride,benofomin,denkaform PubChem CID: 14219 IUPAC Name: hydrogen 1-[(diaminomethylidene)amino]-N,N-dimethylmethanimidamide chloride SMILES: [H+].[Cl-].CN(C)C(=N)N=C(N)N
| PubChem CID | 14219 |
|---|---|
| CAS | 1115-70-4 |
| Molecular Weight (g/mol) | 165.63 |
| MDL Number | MFCD00012582 |
| SMILES | [H+].[Cl-].CN(C)C(=N)N=C(N)N |
| Synonym | metformin hydrochloride,1,1-dimethylbiguanide hydrochloride,metformin hcl,glucophage,riomet,diabefagos,meguan,metformin monohydrochloride,benofomin,denkaform |
| IUPAC Name | hydrogen 1-[(diaminomethylidene)amino]-N,N-dimethylmethanimidamide chloride |
| InChI Key | OETHQSJEHLVLGH-UHFFFAOYSA-N |
| Molecular Formula | C4H12ClN5 |
Chloroacetic acid, ACS, 99%
CAS: 79-11-8 Molecular Formula: C2H3ClO2 Molecular Weight (g/mol): 94.494 MDL Number: MFCD00002683 InChI Key: FOCAUTSVDIKZOP-UHFFFAOYSA-N Synonym: chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure PubChem CID: 300 ChEBI: CHEBI:27869 IUPAC Name: 2-chloroacetic acid SMILES: C(C(=O)O)Cl
| PubChem CID | 300 |
|---|---|
| CAS | 79-11-8 |
| Molecular Weight (g/mol) | 94.494 |
| ChEBI | CHEBI:27869 |
| MDL Number | MFCD00002683 |
| SMILES | C(C(=O)O)Cl |
| Synonym | chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure |
| IUPAC Name | 2-chloroacetic acid |
| InChI Key | FOCAUTSVDIKZOP-UHFFFAOYSA-N |
| Molecular Formula | C2H3ClO2 |