Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Nitromethane, 99+%, for analysis
CAS: 75-52-5 Molecular Formula: CH3NO2 Molecular Weight (g/mol): 61.04 MDL Number: MFCD00007400 InChI Key: LYGJENNIWJXYER-UHFFFAOYSA-N Synonym: methane, nitro,nitrocarbol,nitrometan,nitrometan polish,nitro-methane,unii-ru5wg8c3f4,ccris 1205,hsdb 106,meno2,ru5wg8c3f4 PubChem CID: 6375 ChEBI: CHEBI:77701 IUPAC Name: nitromethane SMILES: C[N+]([O-])=O
| PubChem CID | 6375 |
|---|---|
| CAS | 75-52-5 |
| Molecular Weight (g/mol) | 61.04 |
| ChEBI | CHEBI:77701 |
| MDL Number | MFCD00007400 |
| SMILES | C[N+]([O-])=O |
| Synonym | methane, nitro,nitrocarbol,nitrometan,nitrometan polish,nitro-methane,unii-ru5wg8c3f4,ccris 1205,hsdb 106,meno2,ru5wg8c3f4 |
| IUPAC Name | nitromethane |
| InChI Key | LYGJENNIWJXYER-UHFFFAOYSA-N |
| Molecular Formula | CH3NO2 |
Methyl methanesulfonate, 99%
CAS: 66-27-3 Molecular Formula: C2H6O3S Molecular Weight (g/mol): 110.13 MDL Number: MFCD00007557 InChI Key: MBABOKRGFJTBAE-UHFFFAOYSA-N Synonym: methyl mesylate,methanesulfonic acid methyl ester,methanesulfonic acid, methyl ester,methylmethane sulfonate,methylmethansulfonat,methyl methanesulphonate,as-dimethyl sulfite,as-dimethyl sulphite,methylmethanesulfonate,methyl methansulfonate PubChem CID: 4156 ChEBI: CHEBI:25255 IUPAC Name: methyl methanesulfonate SMILES: COS(=O)(=O)C
| PubChem CID | 4156 |
|---|---|
| CAS | 66-27-3 |
| Molecular Weight (g/mol) | 110.13 |
| ChEBI | CHEBI:25255 |
| MDL Number | MFCD00007557 |
| SMILES | COS(=O)(=O)C |
| Synonym | methyl mesylate,methanesulfonic acid methyl ester,methanesulfonic acid, methyl ester,methylmethane sulfonate,methylmethansulfonat,methyl methanesulphonate,as-dimethyl sulfite,as-dimethyl sulphite,methylmethanesulfonate,methyl methansulfonate |
| IUPAC Name | methyl methanesulfonate |
| InChI Key | MBABOKRGFJTBAE-UHFFFAOYSA-N |
| Molecular Formula | C2H6O3S |
N,N,N',N'-Tetramethylethylenediamine, 99%, extra pure
CAS: 110-18-9 Molecular Formula: C6H16N2 Molecular Weight (g/mol): 116.21 InChI Key: KWYHDKDOAIKMQN-UHFFFAOYSA-N Synonym: temed,n,n,n',n'-tetramethylethylenediamine,tmeda,1,2-bis dimethylamino ethane,tetramethylethylenediamine,tetramethyldiaminoethane,tetrameen,propamine d,n1,n1,n2,n2-tetramethylethane-1,2-diamine,1,2-ethanediamine, n,n,n',n'-tetramethyl PubChem CID: 8037 ChEBI: CHEBI:32850 IUPAC Name: N,N,N',N'-tetramethylethane-1,2-diamine SMILES: CN(C)CCN(C)C
| PubChem CID | 8037 |
|---|---|
| CAS | 110-18-9 |
| Molecular Weight (g/mol) | 116.21 |
| ChEBI | CHEBI:32850 |
| SMILES | CN(C)CCN(C)C |
| Synonym | temed,n,n,n',n'-tetramethylethylenediamine,tmeda,1,2-bis dimethylamino ethane,tetramethylethylenediamine,tetramethyldiaminoethane,tetrameen,propamine d,n1,n1,n2,n2-tetramethylethane-1,2-diamine,1,2-ethanediamine, n,n,n',n'-tetramethyl |
| IUPAC Name | N,N,N',N'-tetramethylethane-1,2-diamine |
| InChI Key | KWYHDKDOAIKMQN-UHFFFAOYSA-N |
| Molecular Formula | C6H16N2 |
Urea, Ultra Pure, 5lb, MP Biomedicals
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Potassium isopropoxide, 99% (metals basis), 5% w/v in isopropanol
CAS: 6831-82-9 Molecular Formula: C3H7KO Molecular Weight (g/mol): 98.186 MDL Number: MFCD00210641 InChI Key: WQKGAJDYBZOFSR-UHFFFAOYSA-N Synonym: potassium isopropoxide,potassium propan-2-olate,koipr,potassium isopropoxide w/v in isopropanol,potassium isopropoxide w/v in 2-propanol trace metals basis 25ml PubChem CID: 23663646 IUPAC Name: potassium;propan-2-olate SMILES: CC(C)[O-].[K+]
| PubChem CID | 23663646 |
|---|---|
| CAS | 6831-82-9 |
| Molecular Weight (g/mol) | 98.186 |
| MDL Number | MFCD00210641 |
| SMILES | CC(C)[O-].[K+] |
| Synonym | potassium isopropoxide,potassium propan-2-olate,koipr,potassium isopropoxide w/v in isopropanol,potassium isopropoxide w/v in 2-propanol trace metals basis 25ml |
| IUPAC Name | potassium;propan-2-olate |
| InChI Key | WQKGAJDYBZOFSR-UHFFFAOYSA-N |
| Molecular Formula | C3H7KO |
Phenylarsine oxide, 97%
CAS: 637-03-6 Molecular Formula: C6H5AsO Molecular Weight (g/mol): 168.03 MDL Number: MFCD00001990 InChI Key: BQVCCPGCDUSGOE-UHFFFAOYSA-N Synonym: phenylarsine oxide,oxophenylarsine,arzene,phenylarsenoxide,arsenosobenzene,arsine, oxophenyl,phenyl arsine oxide,benzene, arsenoso,fenylarsinoxid,caswell no. 060 PubChem CID: 4778 ChEBI: CHEBI:75253 IUPAC Name: arsorosobenzene SMILES: O=[As]C1=CC=CC=C1
| PubChem CID | 4778 |
|---|---|
| CAS | 637-03-6 |
| Molecular Weight (g/mol) | 168.03 |
| ChEBI | CHEBI:75253 |
| MDL Number | MFCD00001990 |
| SMILES | O=[As]C1=CC=CC=C1 |
| Synonym | phenylarsine oxide,oxophenylarsine,arzene,phenylarsenoxide,arsenosobenzene,arsine, oxophenyl,phenyl arsine oxide,benzene, arsenoso,fenylarsinoxid,caswell no. 060 |
| IUPAC Name | arsorosobenzene |
| InChI Key | BQVCCPGCDUSGOE-UHFFFAOYSA-N |
| Molecular Formula | C6H5AsO |
Cyclopentanone, 99+%, pure
CAS: 120-92-3 Molecular Formula: C5H8O Molecular Weight (g/mol): 84.12 MDL Number: MFCD00001409 InChI Key: BGTOWKSIORTVQH-UHFFFAOYSA-N Synonym: adipic ketone,ketocyclopentane,ketopentamethylene,adipinketon,dumasin,cyclopentanon,oxocyclopentane,cyclopentan-1-one,unii-220w81tn3s,cyclopentyloxy PubChem CID: 8452 ChEBI: CHEBI:16486 IUPAC Name: cyclopentanone SMILES: O=C1CCCC1
| PubChem CID | 8452 |
|---|---|
| CAS | 120-92-3 |
| Molecular Weight (g/mol) | 84.12 |
| ChEBI | CHEBI:16486 |
| MDL Number | MFCD00001409 |
| SMILES | O=C1CCCC1 |
| Synonym | adipic ketone,ketocyclopentane,ketopentamethylene,adipinketon,dumasin,cyclopentanon,oxocyclopentane,cyclopentan-1-one,unii-220w81tn3s,cyclopentyloxy |
| IUPAC Name | cyclopentanone |
| InChI Key | BGTOWKSIORTVQH-UHFFFAOYSA-N |
| Molecular Formula | C5H8O |
2,3-Dimethylbutane, 98+%
CAS: 79-29-8 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.178 MDL Number: MFCD00008925 InChI Key: ZFFMLCVRJBZUDZ-UHFFFAOYSA-N Synonym: diisopropyl,biisopropyl,butane, 2,3-dimethyl,1,1,2,2-tetramethylethane,hsdb 76,unii-68isq7a432,ccris 6020,ch3 2chch ch3 2,acmc-1bmfq,dsstox_cid_5112 PubChem CID: 6589 IUPAC Name: 2,3-dimethylbutane SMILES: CC(C)C(C)C
| PubChem CID | 6589 |
|---|---|
| CAS | 79-29-8 |
| Molecular Weight (g/mol) | 86.178 |
| MDL Number | MFCD00008925 |
| SMILES | CC(C)C(C)C |
| Synonym | diisopropyl,biisopropyl,butane, 2,3-dimethyl,1,1,2,2-tetramethylethane,hsdb 76,unii-68isq7a432,ccris 6020,ch3 2chch ch3 2,acmc-1bmfq,dsstox_cid_5112 |
| IUPAC Name | 2,3-dimethylbutane |
| InChI Key | ZFFMLCVRJBZUDZ-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
Azido-PEG3-biotin conjugate
CAS: 875770-34-6 Molecular Formula: C18H32N6O5S Molecular Weight (g/mol): 444.551 MDL Number: MFCD20134145 InChI Key: ZWFOOMQCYIGZBE-ZOBUZTSGSA-N Synonym: biotin-peg3-azide,n-2-2-2-2-azidoethoxy ethoxy ethoxy ethyl biotinamide,n-2-2-2-2-azidoethoxy ethoxy ethoxy ethyl-5-3as,4s,6ar-2-oxohexahydro-1h-thieno 3,4-d imidazol-4-yl pentanamide,biotin-peg4-n3,azide-peg3-biotin conjugate,azido-peg3-biotin conjugate,11-r-+-biotinylamino-1-azido-3,6,9-trioxaundecane,3abeta,6abeta-n-2-2-2-2-azidoethoxy ethoxy ethoxy ethyl-2-oxohexahydro-1h-thieno 3,4-d imidazole-4alpha-pentanamide PubChem CID: 60146223 IUPAC Name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]pentanamide SMILES: C1C2C(C(S1)CCCCC(=O)NCCOCCOCCOCCN=[N+]=[N-])NC(=O)N2
| PubChem CID | 60146223 |
|---|---|
| CAS | 875770-34-6 |
| Molecular Weight (g/mol) | 444.551 |
| MDL Number | MFCD20134145 |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCOCCN=[N+]=[N-])NC(=O)N2 |
| Synonym | biotin-peg3-azide,n-2-2-2-2-azidoethoxy ethoxy ethoxy ethyl biotinamide,n-2-2-2-2-azidoethoxy ethoxy ethoxy ethyl-5-3as,4s,6ar-2-oxohexahydro-1h-thieno 3,4-d imidazol-4-yl pentanamide,biotin-peg4-n3,azide-peg3-biotin conjugate,azido-peg3-biotin conjugate,11-r-+-biotinylamino-1-azido-3,6,9-trioxaundecane,3abeta,6abeta-n-2-2-2-2-azidoethoxy ethoxy ethoxy ethyl-2-oxohexahydro-1h-thieno 3,4-d imidazole-4alpha-pentanamide |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| InChI Key | ZWFOOMQCYIGZBE-ZOBUZTSGSA-N |
| Molecular Formula | C18H32N6O5S |
Sulfuric acid, for analysis, ca. 96% solution in water
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Ethyl L-lactate, 99%
CAS: 687-47-8 Molecular Formula: C5H10O3 Molecular Weight (g/mol): 118.132 MDL Number: MFCD00065359 InChI Key: LZCLXQDLBQLTDK-BYPYZUCNSA-N Synonym: ethyl l-lactate,ethyl 2s-2-hydroxypropanoate,l-ethyl lactate,l---ethyl lactate,ethyl l--lactate,ethyl s-2-hydroxypropionate,ethyl l---lactate,s-ethyl lactate,propanoic acid, 2-hydroxy-, ethyl ester, 2s PubChem CID: 92831 ChEBI: CHEBI:78322 IUPAC Name: ethyl (2S)-2-hydroxypropanoate SMILES: CCOC(=O)C(C)O
| PubChem CID | 92831 |
|---|---|
| CAS | 687-47-8 |
| Molecular Weight (g/mol) | 118.132 |
| ChEBI | CHEBI:78322 |
| MDL Number | MFCD00065359 |
| SMILES | CCOC(=O)C(C)O |
| Synonym | ethyl l-lactate,ethyl 2s-2-hydroxypropanoate,l-ethyl lactate,l---ethyl lactate,ethyl l--lactate,ethyl s-2-hydroxypropionate,ethyl l---lactate,s-ethyl lactate,propanoic acid, 2-hydroxy-, ethyl ester, 2s |
| IUPAC Name | ethyl (2S)-2-hydroxypropanoate |
| InChI Key | LZCLXQDLBQLTDK-BYPYZUCNSA-N |
| Molecular Formula | C5H10O3 |
Methyl 4-(aminomethyl)benzoate hydrochloride, 97%
CAS: 6232-11-7 Molecular Formula: C9H11NO2·ClH Molecular Weight (g/mol): 201.65 MDL Number: MFCD00182671 InChI Key: GIZCKBSSWNIUMZ-UHFFFAOYSA-N Synonym: methyl 4-aminomethyl benzoate hydrochloride,methyl 4-aminomethylbenzoate hydrochloride,methyl-4-aminomethyl benzoate hydrochloride,methyl 4-aminomethylbenzoate hcl,methyl 4-aminomethyl benzoate, hcl,4-aminomethyl benzoic acid methyl ester hydrochloride,methyl4-aminomethyl benzoatehydrochloride,methyl 4-aminomethyl-benzoate hydrochloride,4-aminomethyl benzoic acid methyl ester hcl,4-aminomethylbenzoic acid methyl ester hydrochloride PubChem CID: 2729253 IUPAC Name: methyl 4-(aminomethyl)benzoate;hydrochloride SMILES: COC(=O)C1=CC=C(C=C1)CN.Cl
| PubChem CID | 2729253 |
|---|---|
| CAS | 6232-11-7 |
| Molecular Weight (g/mol) | 201.65 |
| MDL Number | MFCD00182671 |
| SMILES | COC(=O)C1=CC=C(C=C1)CN.Cl |
| Synonym | methyl 4-aminomethyl benzoate hydrochloride,methyl 4-aminomethylbenzoate hydrochloride,methyl-4-aminomethyl benzoate hydrochloride,methyl 4-aminomethylbenzoate hcl,methyl 4-aminomethyl benzoate, hcl,4-aminomethyl benzoic acid methyl ester hydrochloride,methyl4-aminomethyl benzoatehydrochloride,methyl 4-aminomethyl-benzoate hydrochloride,4-aminomethyl benzoic acid methyl ester hcl,4-aminomethylbenzoic acid methyl ester hydrochloride |
| IUPAC Name | methyl 4-(aminomethyl)benzoate;hydrochloride |
| InChI Key | GIZCKBSSWNIUMZ-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO2·ClH |
Di-n-butyl phthalate, 99+%
CAS: 84-74-2 Molecular Formula: C16H22O4 Molecular Weight (g/mol): 278.35 MDL Number: MFCD00009441 InChI Key: DOIRQSBPFJWKBE-UHFFFAOYSA-N Synonym: dibutyl phthalate,di-n-butyl phthalate,n-butyl phthalate,butyl phthalate,celluflex dpb,elaol,genoplast b,palatinol c,polycizer dbp,unimoll db PubChem CID: 3026 ChEBI: CHEBI:34687 IUPAC Name: 1,2-dibutyl benzene-1,2-dicarboxylate SMILES: CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC
| PubChem CID | 3026 |
|---|---|
| CAS | 84-74-2 |
| Molecular Weight (g/mol) | 278.35 |
| ChEBI | CHEBI:34687 |
| MDL Number | MFCD00009441 |
| SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC |
| Synonym | dibutyl phthalate,di-n-butyl phthalate,n-butyl phthalate,butyl phthalate,celluflex dpb,elaol,genoplast b,palatinol c,polycizer dbp,unimoll db |
| IUPAC Name | 1,2-dibutyl benzene-1,2-dicarboxylate |
| InChI Key | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
| Molecular Formula | C16H22O4 |
Butyl acrylate, 99+%, stabilized
CAS: 141-32-2 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00009446 InChI Key: CQEYYJKEWSMYFG-UHFFFAOYSA-N Synonym: butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove PubChem CID: 8846 ChEBI: CHEBI:3245 IUPAC Name: butyl prop-2-enoate SMILES: CCCCOC(=O)C=C
| PubChem CID | 8846 |
|---|---|
| CAS | 141-32-2 |
| Molecular Weight (g/mol) | 128.17 |
| ChEBI | CHEBI:3245 |
| MDL Number | MFCD00009446 |
| SMILES | CCCCOC(=O)C=C |
| Synonym | butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove |
| IUPAC Name | butyl prop-2-enoate |
| InChI Key | CQEYYJKEWSMYFG-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
4-(Trifluoromethyl)benzoic acid, 98+%
CAS: 455-24-3 Molecular Formula: C8H5F3O2 Molecular Weight (g/mol): 190.121 MDL Number: MFCD00002562 InChI Key: SWKPKONEIZGROQ-UHFFFAOYSA-N Synonym: 4-trifluoromethyl benzoic acid,p-trifluoromethylbenzoic acid,alpha,alpha,alpha-trifluoro-p-toluic acid,benzoic acid, 4-trifluoromethyl,p-carboxybenzotrifluoride,4-trifluoromethyl-benzoic acid,a,a,a-trifluoro-p-toluic acid,ptf-boa,4-carboxybenzotrifluoride PubChem CID: 9966 ChEBI: CHEBI:60696 IUPAC Name: 4-(trifluoromethyl)benzoic acid SMILES: C1=CC(=CC=C1C(=O)O)C(F)(F)F
| PubChem CID | 9966 |
|---|---|
| CAS | 455-24-3 |
| Molecular Weight (g/mol) | 190.121 |
| ChEBI | CHEBI:60696 |
| MDL Number | MFCD00002562 |
| SMILES | C1=CC(=CC=C1C(=O)O)C(F)(F)F |
| Synonym | 4-trifluoromethyl benzoic acid,p-trifluoromethylbenzoic acid,alpha,alpha,alpha-trifluoro-p-toluic acid,benzoic acid, 4-trifluoromethyl,p-carboxybenzotrifluoride,4-trifluoromethyl-benzoic acid,a,a,a-trifluoro-p-toluic acid,ptf-boa,4-carboxybenzotrifluoride |
| IUPAC Name | 4-(trifluoromethyl)benzoic acid |
| InChI Key | SWKPKONEIZGROQ-UHFFFAOYSA-N |
| Molecular Formula | C8H5F3O2 |