Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
N,N'-Bis(acryloyl)cystamine, 98%
CAS: 60984-57-8 Molecular Formula: C10H16N2O2S2 Molecular Weight (g/mol): 260.37 MDL Number: MFCD00036225 InChI Key: DJVKJGIZQFBFGS-UHFFFAOYSA-N Synonym: n,n'-bis acryloyl cystamine,n,n'-bisacrylylcystamine,2-propenamide, n,n'-dithiodi-2,1-ethanediyl bis,2,2'-bisacrylamino diethyldisulfide,bis-acrylylcystamine: bac,n,n'-dithiodi-2,1-ethanediyl bis acrylamide,n-2-2-prop-2-enamido ethyl disulfanyl ethyl prop-2-enamide,n-2-2-prop-2-enoylamino ethyldisulfanyl ethyl prop-2-enamide,acmc-20ak9p,n,n-bis-acrylylcystamine PubChem CID: 100602 IUPAC Name: N-[2-[2-(prop-2-enoylamino)ethyldisulfanyl]ethyl]prop-2-enamide SMILES: C=CC(=O)NCCSSCCNC(=O)C=C
| PubChem CID | 100602 |
|---|---|
| CAS | 60984-57-8 |
| Molecular Weight (g/mol) | 260.37 |
| MDL Number | MFCD00036225 |
| SMILES | C=CC(=O)NCCSSCCNC(=O)C=C |
| Synonym | n,n'-bis acryloyl cystamine,n,n'-bisacrylylcystamine,2-propenamide, n,n'-dithiodi-2,1-ethanediyl bis,2,2'-bisacrylamino diethyldisulfide,bis-acrylylcystamine: bac,n,n'-dithiodi-2,1-ethanediyl bis acrylamide,n-2-2-prop-2-enamido ethyl disulfanyl ethyl prop-2-enamide,n-2-2-prop-2-enoylamino ethyldisulfanyl ethyl prop-2-enamide,acmc-20ak9p,n,n-bis-acrylylcystamine |
| IUPAC Name | N-[2-[2-(prop-2-enoylamino)ethyldisulfanyl]ethyl]prop-2-enamide |
| InChI Key | DJVKJGIZQFBFGS-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O2S2 |
2,4,6-Trimethylphenol, 99%
CAS: 527-60-6 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.19 MDL Number: MFCD00002235 InChI Key: BPRYUXCVCCNUFE-UHFFFAOYSA-N Synonym: mesitol,phenol, 2,4,6-trimethyl,mesityl alcohol,2-hydroxymesitylene,2,4,6-trimetylofenol,1,3,5-trimethylphenol,2,4,6-trimethyl-phenol,1-hydroxy-2,4,6-trimethylbenzene,2,4,6-trimethylofenol,unii-fpz32614n6 PubChem CID: 10698 IUPAC Name: 2,4,6-trimethylphenol SMILES: CC1=CC(=C(C(=C1)C)O)C
| PubChem CID | 10698 |
|---|---|
| CAS | 527-60-6 |
| Molecular Weight (g/mol) | 136.19 |
| MDL Number | MFCD00002235 |
| SMILES | CC1=CC(=C(C(=C1)C)O)C |
| Synonym | mesitol,phenol, 2,4,6-trimethyl,mesityl alcohol,2-hydroxymesitylene,2,4,6-trimetylofenol,1,3,5-trimethylphenol,2,4,6-trimethyl-phenol,1-hydroxy-2,4,6-trimethylbenzene,2,4,6-trimethylofenol,unii-fpz32614n6 |
| IUPAC Name | 2,4,6-trimethylphenol |
| InChI Key | BPRYUXCVCCNUFE-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
N,N-Dimethyl-p-phenylenediamine sulfate, 98%
CAS: 536-47-0 Molecular Formula: C8H14N2O4S Molecular Weight (g/mol): 234.27 MDL Number: MFCD00012992 InChI Key: GLUKPDKNLKRLHX-UHFFFAOYSA-N Synonym: n,n-dimethyl-1,4-phenylenediamine sulfate,n,n-dimethyl-p-phenylenediamine sulfate,n1,n1-dimethylbenzene-1,4-diamine sulfate,1,4-benzenediamine, n,n-dimethyl-, sulfate,unii-x997ivp3ja,4-amino-n,n-dimethylaniline sulphate,x997ivp3ja,1,4-benzenediamine, n,n-dimethyl-, sulfate 1:1,dimethyl-p-phenylenediamine; sulfuric acid,1,4-benzenediamine, n1,n1-dimethyl-, sulfate 1:? PubChem CID: 80351 IUPAC Name: 4-N,4-N-dimethylbenzene-1,4-diamine;sulfuric acid SMILES: OS(O)(=O)=O.CN(C)C1=CC=C(N)C=C1
| PubChem CID | 80351 |
|---|---|
| CAS | 536-47-0 |
| Molecular Weight (g/mol) | 234.27 |
| MDL Number | MFCD00012992 |
| SMILES | OS(O)(=O)=O.CN(C)C1=CC=C(N)C=C1 |
| Synonym | n,n-dimethyl-1,4-phenylenediamine sulfate,n,n-dimethyl-p-phenylenediamine sulfate,n1,n1-dimethylbenzene-1,4-diamine sulfate,1,4-benzenediamine, n,n-dimethyl-, sulfate,unii-x997ivp3ja,4-amino-n,n-dimethylaniline sulphate,x997ivp3ja,1,4-benzenediamine, n,n-dimethyl-, sulfate 1:1,dimethyl-p-phenylenediamine; sulfuric acid,1,4-benzenediamine, n1,n1-dimethyl-, sulfate 1:? |
| IUPAC Name | 4-N,4-N-dimethylbenzene-1,4-diamine;sulfuric acid |
| InChI Key | GLUKPDKNLKRLHX-UHFFFAOYSA-N |
| Molecular Formula | C8H14N2O4S |
Graphene, Single Layer
CAS: 1034343-98-0 Molecular Formula: Cx Molecular Weight (g/mol): 16.04 MDL Number: MFCD00144065 InChI Key: VNWKTOKETHGBQD-UHFFFAOYSA-N Synonym: methyl hydride,marsh gas,biogas,fire damp,r 50 refrigerant,methan,metano,hsdb 167,in gaseus state,tetrahydridocarbon PubChem CID: 297 ChEBI: CHEBI:16183 IUPAC Name: methane SMILES: C
| PubChem CID | 297 |
|---|---|
| CAS | 1034343-98-0 |
| Molecular Weight (g/mol) | 16.04 |
| ChEBI | CHEBI:16183 |
| MDL Number | MFCD00144065 |
| SMILES | C |
| Synonym | methyl hydride,marsh gas,biogas,fire damp,r 50 refrigerant,methan,metano,hsdb 167,in gaseus state,tetrahydridocarbon |
| IUPAC Name | methane |
| InChI Key | VNWKTOKETHGBQD-UHFFFAOYSA-N |
| Molecular Formula | Cx |
2-(2-Bromoethyl)-1,3-dioxolane, 96%
CAS: 18742-02-4 Molecular Formula: C5H9BrO2 Molecular Weight (g/mol): 181.03 MDL Number: MFCD00003216 InChI Key: GGZQLTVZPOGLCC-UHFFFAOYSA-N Synonym: 2-2-bromoethyl-1,3-dioxolane,1,3-dioxolane, 2-2-bromoethyl,bromoethyl-1,3-dioxolane,acmc-1bol0,2-2-bromoethyl-dioxolane,ksc496m8b,2-bromoethyl-1,3-dioxolane,2 2-bromoethyl-1,3-dioxolane,2-2-bromoethyl-1,3-dioxolan PubChem CID: 87776 IUPAC Name: 2-(2-bromoethyl)-1,3-dioxolane SMILES: BrCCC1OCCO1
| PubChem CID | 87776 |
|---|---|
| CAS | 18742-02-4 |
| Molecular Weight (g/mol) | 181.03 |
| MDL Number | MFCD00003216 |
| SMILES | BrCCC1OCCO1 |
| Synonym | 2-2-bromoethyl-1,3-dioxolane,1,3-dioxolane, 2-2-bromoethyl,bromoethyl-1,3-dioxolane,acmc-1bol0,2-2-bromoethyl-dioxolane,ksc496m8b,2-bromoethyl-1,3-dioxolane,2 2-bromoethyl-1,3-dioxolane,2-2-bromoethyl-1,3-dioxolan |
| IUPAC Name | 2-(2-bromoethyl)-1,3-dioxolane |
| InChI Key | GGZQLTVZPOGLCC-UHFFFAOYSA-N |
| Molecular Formula | C5H9BrO2 |
tert-Butyldimethylsilyl trifluoromethanesulfonate, 98%
CAS: 69739-34-0 Molecular Formula: C7H15F3O3SSi Molecular Weight (g/mol): 264.33 MDL Number: MFCD00000405 InChI Key: WLLIXJBWWFGEHT-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate PubChem CID: 123564 IUPAC Name: [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate SMILES: CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F
| PubChem CID | 123564 |
|---|---|
| CAS | 69739-34-0 |
| Molecular Weight (g/mol) | 264.33 |
| MDL Number | MFCD00000405 |
| SMILES | CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| Synonym | tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate |
| IUPAC Name | [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate |
| InChI Key | WLLIXJBWWFGEHT-UHFFFAOYSA-N |
| Molecular Formula | C7H15F3O3SSi |
| Molecular Weight (g/mol) | 117.15 |
|---|---|
| ChEBI | CHEBI:52093 |
| CAS Min % | 48.0 |
| InChI Key | LFTLOKWAGJYHHR-UHFFFAOYSA-N |
| Density | 1.1300g/mL |
| PubChem CID | 82029 |
| Name Note | 50 wt.% solution in water |
| Fieser | 07,244 |
| Formula Weight | 117.15 |
| Melting Point | -20.0°C |
| CAS Max % | 50.0 |
| Boiling Point | 118.0°C to 119.0°C |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | 4-Methylmorpholine N-oxide |
| SMILES | C[N+]1([O-])CCOCC1 |
| Merck Index | 15, 6171 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF ON SKIN: Wash with plenty of soap and water. If skin irritation occurs: Get medical advice/attention. If eye irritation persists: Get medical advice/attention. Wear protective gloves/protective clothing/eye protec |
| MDL Number | MFCD00005947 |
| Health Hazard 2 | GHS H Statement Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| Solubility Information | Solubility in water: miscible |
| Packaging | Glass bottle |
| Flash Point | >100°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | 4-methylmorpholine n-oxide,4-methylmorpholine 4-oxide,n-methylmorpholine oxide,n-methylmorpholine n-oxide,morpholine, 4-methyl-, 4-oxide,4-methylmorpholine-4-oxide,methyl morpholine oxide,n-methylmorpholine-n-oxide,nmo,unii-arc64pkj0f |
| IUPAC Name | 4-methyl-4-oxidomorpholin-4-ium |
| Molecular Formula | C5H11NO2 |
| EINECS Number | 231-391-8 |
| Specific Gravity | 1.13 |
Lecithin from Egg, MP Biomedicals™
Synonym: 1,2-Diacyl-sn-glycero-3-phosphocholine,3-sn-Phosphatidylcholine,L-α-Lecithin,Azolectin
| Synonym | 1,2-Diacyl-sn-glycero-3-phosphocholine,3-sn-Phosphatidylcholine,L-α-Lecithin,Azolectin |
|---|
Ethyl caproate, 99+%
CAS: 123-66-0 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.21 MDL Number: MFCD00009511 InChI Key: SHZIWNPUGXLXDT-UHFFFAOYSA-N Synonym: ethyl caproate,ethyl hexoate,hexanoic acid, ethyl ester,hexanoic acid ethyl ester,capronic ether absolute,caproic acid ethyl ester,ethyl n-hexanoate,ethyl butyl acetate,caproate,acetic acid, butyl-, ethyl ester PubChem CID: 31265 ChEBI: CHEBI:86055 IUPAC Name: ethyl hexanoate SMILES: CCCCCC(=O)OCC
| PubChem CID | 31265 |
|---|---|
| CAS | 123-66-0 |
| Molecular Weight (g/mol) | 144.21 |
| ChEBI | CHEBI:86055 |
| MDL Number | MFCD00009511 |
| SMILES | CCCCCC(=O)OCC |
| Synonym | ethyl caproate,ethyl hexoate,hexanoic acid, ethyl ester,hexanoic acid ethyl ester,capronic ether absolute,caproic acid ethyl ester,ethyl n-hexanoate,ethyl butyl acetate,caproate,acetic acid, butyl-, ethyl ester |
| IUPAC Name | ethyl hexanoate |
| InChI Key | SHZIWNPUGXLXDT-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
4-Dimethylaminopyridine, 99%
CAS: 1122-58-3 MDL Number: MFCD00006418 InChI Key: VHYFNPMBLIVWCW-UHFFFAOYSA-N Synonym: 4-dimethylaminopyridine,dmap,4-dimethylamino pyridine,4-pyridinamine, n,n-dimethyl,n,n-dimethyl-4-pyridinamine,p-dimethylaminopyridine,pyridine, 4-dimethylamino,ccris 6176,dimethylpyridin-4-ylamine PubChem CID: 14284 IUPAC Name: N,N-dimethylpyridin-4-amine SMILES: CN(C)C1=CC=NC=C1
| PubChem CID | 14284 |
|---|---|
| CAS | 1122-58-3 |
| MDL Number | MFCD00006418 |
| SMILES | CN(C)C1=CC=NC=C1 |
| Synonym | 4-dimethylaminopyridine,dmap,4-dimethylamino pyridine,4-pyridinamine, n,n-dimethyl,n,n-dimethyl-4-pyridinamine,p-dimethylaminopyridine,pyridine, 4-dimethylamino,ccris 6176,dimethylpyridin-4-ylamine |
| IUPAC Name | N,N-dimethylpyridin-4-amine |
| InChI Key | VHYFNPMBLIVWCW-UHFFFAOYSA-N |
Thermo Scientific Chemicals 2-Deoxy-D-ribose, 99%
CAS: 533-67-5 Molecular Formula: C5H10O4 Molecular Weight (g/mol): 134.13 MDL Number: MFCD00135904 InChI Key: PDWIQYODPROSQH-GLULIZFNNA-N Synonym: 2-deoxy-d-ribose,thyminose,3s,4r-3,4,5-trihydroxypentanal,deoxyribose,2-deoxy-d-erythro-pentose,2-deoxyribose,d-drib,2-deoxy-d-arabinose,unii-lsw4h01241,2-deoxy-d-erythropentose PubChem CID: 5460005 ChEBI: CHEBI:28816 IUPAC Name: (3S,4R)-3,4,5-trihydroxypentanal SMILES: OC[C@H]1OC(O)C[C@@H]1O
| PubChem CID | 5460005 |
|---|---|
| CAS | 533-67-5 |
| Molecular Weight (g/mol) | 134.13 |
| ChEBI | CHEBI:28816 |
| MDL Number | MFCD00135904 |
| SMILES | OC[C@H]1OC(O)C[C@@H]1O |
| Synonym | 2-deoxy-d-ribose,thyminose,3s,4r-3,4,5-trihydroxypentanal,deoxyribose,2-deoxy-d-erythro-pentose,2-deoxyribose,d-drib,2-deoxy-d-arabinose,unii-lsw4h01241,2-deoxy-d-erythropentose |
| IUPAC Name | (3S,4R)-3,4,5-trihydroxypentanal |
| InChI Key | PDWIQYODPROSQH-GLULIZFNNA-N |
| Molecular Formula | C5H10O4 |
Dimidium bromide, 95%
CAS: 518-67-2 Molecular Formula: C20H18BrN3 Molecular Weight (g/mol): 380.29 MDL Number: MFCD00011757 InChI Key: MQOKYEROIFEEBH-UHFFFAOYSA-N Synonym: dimidium bromide,trypadine,3,8-diamino-5-methyl-6-phenylphenanthridinium bromide,phenanthridinium 1553,phenanthridinium compound 1553,phenanthridinium, 3,8-diamino-5-methyl-6-phenyl-, bromide,2,7-diamino-10-methyl-9-phenylphenanthridinium bromide,3,8-diamino-5-methyl-6-phenylphenanthridin-5-ium bromide,phenanthridium 1553 PubChem CID: 68207 IUPAC Name: 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide SMILES: [Br-].C[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12
| PubChem CID | 68207 |
|---|---|
| CAS | 518-67-2 |
| Molecular Weight (g/mol) | 380.29 |
| MDL Number | MFCD00011757 |
| SMILES | [Br-].C[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 |
| Synonym | dimidium bromide,trypadine,3,8-diamino-5-methyl-6-phenylphenanthridinium bromide,phenanthridinium 1553,phenanthridinium compound 1553,phenanthridinium, 3,8-diamino-5-methyl-6-phenyl-, bromide,2,7-diamino-10-methyl-9-phenylphenanthridinium bromide,3,8-diamino-5-methyl-6-phenylphenanthridin-5-ium bromide,phenanthridium 1553 |
| IUPAC Name | 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide |
| InChI Key | MQOKYEROIFEEBH-UHFFFAOYSA-N |
| Molecular Formula | C20H18BrN3 |
Nitromethane, 99+%, for analysis
CAS: 75-52-5 Molecular Formula: CH3NO2 Molecular Weight (g/mol): 61.04 MDL Number: MFCD00007400 InChI Key: LYGJENNIWJXYER-UHFFFAOYSA-N Synonym: methane, nitro,nitrocarbol,nitrometan,nitrometan polish,nitro-methane,unii-ru5wg8c3f4,ccris 1205,hsdb 106,meno2,ru5wg8c3f4 PubChem CID: 6375 ChEBI: CHEBI:77701 IUPAC Name: nitromethane SMILES: C[N+]([O-])=O
| PubChem CID | 6375 |
|---|---|
| CAS | 75-52-5 |
| Molecular Weight (g/mol) | 61.04 |
| ChEBI | CHEBI:77701 |
| MDL Number | MFCD00007400 |
| SMILES | C[N+]([O-])=O |
| Synonym | methane, nitro,nitrocarbol,nitrometan,nitrometan polish,nitro-methane,unii-ru5wg8c3f4,ccris 1205,hsdb 106,meno2,ru5wg8c3f4 |
| IUPAC Name | nitromethane |
| InChI Key | LYGJENNIWJXYER-UHFFFAOYSA-N |
| Molecular Formula | CH3NO2 |
Indigo Carmine 95.0+%, TCI America™
CAS: 860-22-0 Molecular Formula: C16H8N2Na2O8S2 Molecular Weight (g/mol): 466.35 MDL Number: MFCD00005723 InChI Key: KHLVKKOJDHCJMG-QDBORUFSSA-L Synonym: indigo carmine,indigocarmine,acid blue 74,indigocarmin,indigotindisulfonate sodium,c.i. acid blue 74,food blue no. 2,amacid brilliant blue,c.i. food blue 1,fd&c blue no. 2 PubChem CID: 5284351 IUPAC Name: disodium (E)-3,3'-dioxo-1H,1'H,3H,3'H-[2,2'-biindolylidene]-5,5'-disulfonate SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C2N\C(C(=O)C2=C1)=C1\NC2=CC=C(C=C2C1=O)S([O-])(=O)=O
| PubChem CID | 5284351 |
|---|---|
| CAS | 860-22-0 |
| Molecular Weight (g/mol) | 466.35 |
| MDL Number | MFCD00005723 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C2N\C(C(=O)C2=C1)=C1\NC2=CC=C(C=C2C1=O)S([O-])(=O)=O |
| Synonym | indigo carmine,indigocarmine,acid blue 74,indigocarmin,indigotindisulfonate sodium,c.i. acid blue 74,food blue no. 2,amacid brilliant blue,c.i. food blue 1,fd&c blue no. 2 |
| IUPAC Name | disodium (E)-3,3'-dioxo-1H,1'H,3H,3'H-[2,2'-biindolylidene]-5,5'-disulfonate |
| InChI Key | KHLVKKOJDHCJMG-QDBORUFSSA-L |
| Molecular Formula | C16H8N2Na2O8S2 |
2,6-Di-tert-butylphenol, 99%
CAS: 128-39-2 Molecular Formula: C14H22O Molecular Weight (g/mol): 206.33 MDL Number: MFCD00008820 InChI Key: DKCPKDPYUFEZCP-UHFFFAOYSA-N Synonym: 2,6-di-tert-butylphenol,2,6-di-t-butylphenol,2,6-bis tert-butyl phenol,2,6-bis 1,1-dimethylethyl phenol,phenol, 2,6-bis 1,1-dimethylethyl,2,6 di-tert-butylphenol,ethanox 701,isonox 103,ethyl 701,ethyl an 701 PubChem CID: 31405 IUPAC Name: 2,6-ditert-butylphenol SMILES: CC(C)(C)C1=CC=CC(=C1O)C(C)(C)C
| PubChem CID | 31405 |
|---|---|
| CAS | 128-39-2 |
| Molecular Weight (g/mol) | 206.33 |
| MDL Number | MFCD00008820 |
| SMILES | CC(C)(C)C1=CC=CC(=C1O)C(C)(C)C |
| Synonym | 2,6-di-tert-butylphenol,2,6-di-t-butylphenol,2,6-bis tert-butyl phenol,2,6-bis 1,1-dimethylethyl phenol,phenol, 2,6-bis 1,1-dimethylethyl,2,6 di-tert-butylphenol,ethanox 701,isonox 103,ethyl 701,ethyl an 701 |
| IUPAC Name | 2,6-ditert-butylphenol |
| InChI Key | DKCPKDPYUFEZCP-UHFFFAOYSA-N |
| Molecular Formula | C14H22O |