Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Pentane, HPLC Grade, J.T. Baker™
CAS: 109-66-0 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009498 InChI Key: OFBQJSOFQDEBGM-UHFFFAOYSA-N Synonym: n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish PubChem CID: 8003 ChEBI: CHEBI:37830 IUPAC Name: pentane SMILES: CCCCC
| PubChem CID | 8003 |
|---|---|
| CAS | 109-66-0 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:37830 |
| MDL Number | MFCD00009498 |
| SMILES | CCCCC |
| Synonym | n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish |
| IUPAC Name | pentane |
| InChI Key | OFBQJSOFQDEBGM-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Tetrachloroethylene, CHROMASOLV™, for HPLC, ≥99.9%, Honeywell Riedel-de Haen
CAS: 127-18-4 Molecular Formula: C2Cl4 Molecular Weight (g/mol): 165.82 MDL Number: MFCD00000834 InChI Key: CYTYCFOTNPOANT-UHFFFAOYSA-N Synonym: tetrachloroethylene,tetrachloroethene,perchloroethylene,perchlorethylene,perc,ethene, tetrachloro,tetrachlorethylene,ethylene tetrachloride,carbon dichloride,ankilostin PubChem CID: 31373 ChEBI: CHEBI:17300 SMILES: ClC(Cl)=C(Cl)Cl
| PubChem CID | 31373 |
|---|---|
| CAS | 127-18-4 |
| Molecular Weight (g/mol) | 165.82 |
| ChEBI | CHEBI:17300 |
| MDL Number | MFCD00000834 |
| SMILES | ClC(Cl)=C(Cl)Cl |
| Synonym | tetrachloroethylene,tetrachloroethene,perchloroethylene,perchlorethylene,perc,ethene, tetrachloro,tetrachlorethylene,ethylene tetrachloride,carbon dichloride,ankilostin |
| InChI Key | CYTYCFOTNPOANT-UHFFFAOYSA-N |
| Molecular Formula | C2Cl4 |
1-Pentanesulfonic Acid Sodium Salt, HPLC Grade, J.T. Baker™
CAS: 22767-49-3 Molecular Formula: C5H11NaO3S Molecular Weight (g/mol): 174.19 MDL Number: MFCD00007541,MFCD00149548 InChI Key: ROBLTDOHDSGGDT-UHFFFAOYSA-M Synonym: sodium 1-pentanesulfonate,sodium pentane-1-sulfonate,sodium pentanesulfonate,1-pentanesulfonic acid sodium salt,1-pentanesulfonic acid, sodium salt,1-pentylsodiumsulfonate,ipc-alks-5,1-pentanesulfonate, sodium,pentanesulfonic acid na-salt,pentanesulfonic acidsodiumsalt PubChem CID: 23664617 IUPAC Name: sodium pentane-1-sulfonate SMILES: [Na+].CCCCCS([O-])(=O)=O
| PubChem CID | 23664617 |
|---|---|
| CAS | 22767-49-3 |
| Molecular Weight (g/mol) | 174.19 |
| MDL Number | MFCD00007541,MFCD00149548 |
| SMILES | [Na+].CCCCCS([O-])(=O)=O |
| Synonym | sodium 1-pentanesulfonate,sodium pentane-1-sulfonate,sodium pentanesulfonate,1-pentanesulfonic acid sodium salt,1-pentanesulfonic acid, sodium salt,1-pentylsodiumsulfonate,ipc-alks-5,1-pentanesulfonate, sodium,pentanesulfonic acid na-salt,pentanesulfonic acidsodiumsalt |
| IUPAC Name | sodium pentane-1-sulfonate |
| InChI Key | ROBLTDOHDSGGDT-UHFFFAOYSA-M |
| Molecular Formula | C5H11NaO3S |
1-Heptanesulfonic Acid Sodium Salt, HPLC Grade, J.T. Baker™
CAS: 22767-50-6 Molecular Formula: C7H15NaO3S Molecular Weight (g/mol): 202.244 InChI Key: REFMEZARFCPESH-UHFFFAOYSA-M Synonym: sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate PubChem CID: 23672332 IUPAC Name: sodium;heptane-1-sulfonate SMILES: CCCCCCCS(=O)(=O)[O-].[Na+]
| PubChem CID | 23672332 |
|---|---|
| CAS | 22767-50-6 |
| Molecular Weight (g/mol) | 202.244 |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Synonym | sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate |
| IUPAC Name | sodium;heptane-1-sulfonate |
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
| Molecular Formula | C7H15NaO3S |
1-Hexanesulfonic Acid Sodium Salt, HPLC Grade, J.T. Baker™
CAS: 2832-45-3 Molecular Formula: C6H13NaO3S Molecular Weight (g/mol): 188.22 MDL Number: MFCD00007542 InChI Key: QWSZRRAAFHGKCH-UHFFFAOYSA-M Synonym: sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt PubChem CID: 23677630 SMILES: [Na+].CCCCCCS([O-])(=O)=O
| PubChem CID | 23677630 |
|---|---|
| CAS | 2832-45-3 |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00007542 |
| SMILES | [Na+].CCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt |
| InChI Key | QWSZRRAAFHGKCH-UHFFFAOYSA-M |
| Molecular Formula | C6H13NaO3S |
1-Octanesulfonic Acid Sodium Salt, HPLC Grade, J.T. Baker™
CAS: 5324-84-5 Molecular Formula: C8H17NaO3S Molecular Weight (g/mol): 216.27 MDL Number: MFCD00007544 InChI Key: HRQDCDQDOPSGBR-UHFFFAOYSA-M Synonym: sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 PubChem CID: 23669624 SMILES: [Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23669624 |
|---|---|
| CAS | 5324-84-5 |
| Molecular Weight (g/mol) | 216.27 |
| MDL Number | MFCD00007544 |
| SMILES | [Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 |
| InChI Key | HRQDCDQDOPSGBR-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO3S |
Avantor Methyl Ethyl Ketone, HPLC Grade, J.T. Baker™
CAS: 78-93-3 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00011648 InChI Key: ZWEHNKRNPOVVGH-UHFFFAOYSA-N Synonym: 2-butanone,methyl ethyl ketone,butanone,ethyl methyl ketone,methylethyl ketone,meetco,methyl acetone,methylethylketone,3-butanone,ethylmethylketon PubChem CID: 6569 ChEBI: CHEBI:28398 IUPAC Name: butan-2-one SMILES: CCC(C)=O
| PubChem CID | 6569 |
|---|---|
| CAS | 78-93-3 |
| Molecular Weight (g/mol) | 72.11 |
| ChEBI | CHEBI:28398 |
| MDL Number | MFCD00011648 |
| SMILES | CCC(C)=O |
| Synonym | 2-butanone,methyl ethyl ketone,butanone,ethyl methyl ketone,methylethyl ketone,meetco,methyl acetone,methylethylketone,3-butanone,ethylmethylketon |
| IUPAC Name | butan-2-one |
| InChI Key | ZWEHNKRNPOVVGH-UHFFFAOYSA-N |
| Molecular Formula | C4H8O |
Avantor J.T.Baker Tetrabutylammonium Hydroxide, in Water, HPLC Grade, J.T. Baker™
CAS: 2052-49-5 Molecular Formula: C16H37NO Molecular Weight (g/mol): 259.48 MDL Number: MFCD00009425 InChI Key: VDZOOKBUILJEDG-UHFFFAOYSA-M Synonym: tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 PubChem CID: 2723671 IUPAC Name: tetrabutylazanium hydroxide SMILES: [OH-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2723671 |
|---|---|
| CAS | 2052-49-5 |
| Molecular Weight (g/mol) | 259.48 |
| MDL Number | MFCD00009425 |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium hydroxide |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO |
| Molecular Weight (g/mol) | 72.1057 |
|---|
2-Methylbutane, CHROMASOLV™, for HPLC, ≥99.5%, Honeywell Riedel-de Haën™
CAS: 78-78-4 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009338 InChI Key: QWTDNUCVQCZILF-UHFFFAOYSA-N Synonym: isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 PubChem CID: 6556 ChEBI: CHEBI:30362 IUPAC Name: 2-methylbutane SMILES: CCC(C)C
| PubChem CID | 6556 |
|---|---|
| CAS | 78-78-4 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:30362 |
| MDL Number | MFCD00009338 |
| SMILES | CCC(C)C |
| Synonym | isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 |
| IUPAC Name | 2-methylbutane |
| InChI Key | QWTDNUCVQCZILF-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Butyl acetate, CHROMASOLV™ Plus, for HPLC, 99.7%, Honeywell Riedel-de Haën™
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
1-Chlorobutane CHROMASOLV™, for HPLC, ≥99.8%, Honeywell Riedel-de Haën™
CAS: 109-69-3 Molecular Formula: C4H9Cl Molecular Weight (g/mol): 92.57 MDL Number: MFCD00001009 InChI Key: VFWCMGCRMGJXDK-UHFFFAOYSA-N Synonym: butyl chloride,n-butyl chloride,butane, 1-chloro,chlorure de butyle,nbc wormer,n-propylcarbinyl chloride,sure shot,butane, chloro,chlorobutane,n-chlorobutane PubChem CID: 8005 IUPAC Name: 1-chlorobutane SMILES: CCCCCl
| PubChem CID | 8005 |
|---|---|
| CAS | 109-69-3 |
| Molecular Weight (g/mol) | 92.57 |
| MDL Number | MFCD00001009 |
| SMILES | CCCCCl |
| Synonym | butyl chloride,n-butyl chloride,butane, 1-chloro,chlorure de butyle,nbc wormer,n-propylcarbinyl chloride,sure shot,butane, chloro,chlorobutane,n-chlorobutane |
| IUPAC Name | 1-chlorobutane |
| InChI Key | VFWCMGCRMGJXDK-UHFFFAOYSA-N |
| Molecular Formula | C4H9Cl |
Spectrum Chemical Manufacturing Corporation Methylene Chloride, Hydrocarbon Stabilized, Exceeds A.C.S. Specifications, HPLC Grade, 99.9%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N IUPAC Name: dichloromethane SMILES: ClCCl
| CAS | 75-09-2 |
|---|---|
| Molecular Weight (g/mol) | 84.93 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
4-Methyl-2-pentanone, CHROMASOLV™, for HPLC, ≥99.5%, Honeywell Riedel-de Haen
CAS: 108-10-1 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.161 MDL Number: MFCD00008938 InChI Key: NTIZESTWPVYFNL-UHFFFAOYSA-N Synonym: 4-methyl-2-pentanone,methyl isobutyl ketone,isopropylacetone,isobutyl methyl ketone,hexone,mibk,2-pentanone, 4-methyl,2-methyl-4-pentanone,4-methyl-2-oxopentane,methylisobutylketon PubChem CID: 7909 ChEBI: CHEBI:82344 IUPAC Name: 4-methylpentan-2-one SMILES: CC(C)CC(=O)C
| PubChem CID | 7909 |
|---|---|
| CAS | 108-10-1 |
| Molecular Weight (g/mol) | 100.161 |
| ChEBI | CHEBI:82344 |
| MDL Number | MFCD00008938 |
| SMILES | CC(C)CC(=O)C |
| Synonym | 4-methyl-2-pentanone,methyl isobutyl ketone,isopropylacetone,isobutyl methyl ketone,hexone,mibk,2-pentanone, 4-methyl,2-methyl-4-pentanone,4-methyl-2-oxopentane,methylisobutylketon |
| IUPAC Name | 4-methylpentan-2-one |
| InChI Key | NTIZESTWPVYFNL-UHFFFAOYSA-N |
| Molecular Formula | C6H12O |
Tetrabutylammonium Hydroxide, Titrant (0.4M in H2O), HPLC Grade, J.T. Baker™
CAS: 2052-49-5 Molecular Formula: C16H37NO Molecular Weight (g/mol): 259.48 MDL Number: MFCD00009425 InChI Key: VDZOOKBUILJEDG-UHFFFAOYSA-M Synonym: tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 PubChem CID: 2723671 IUPAC Name: tetrabutylazanium;hydroxide SMILES: [OH-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2723671 |
|---|---|
| CAS | 2052-49-5 |
| Molecular Weight (g/mol) | 259.48 |
| MDL Number | MFCD00009425 |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO |