Solvents
Filtered Search Results
Iodomethane-d3, for NMR, 99+ atom % D
CAS: 865-50-9 Molecular Formula: CH3I Molecular Weight (g/mol): 144.96 MDL Number: MFCD00001074 InChI Key: INQOMBQAUSQDDS-FIBGUPNXSA-N Synonym: iodomethane-d3,iodo 2h3 methane,trideuterio iodo methane,iodo 2 h? methane,methyl-d3 iodide,trideuteromethyl iodide,iodomethane-12c,d3,methyl-12c,d3 iodide,iodoethane-d5 ethyliodid-d5,methyl iodide d3 stored over copper PubChem CID: 2723978 IUPAC Name: trideuterio(iodo)methane SMILES: [2H]C([2H])([2H])I
| PubChem CID | 2723978 |
|---|---|
| CAS | 865-50-9 |
| Molecular Weight (g/mol) | 144.96 |
| MDL Number | MFCD00001074 |
| SMILES | [2H]C([2H])([2H])I |
| Synonym | iodomethane-d3,iodo 2h3 methane,trideuterio iodo methane,iodo 2 h? methane,methyl-d3 iodide,trideuteromethyl iodide,iodomethane-12c,d3,methyl-12c,d3 iodide,iodoethane-d5 ethyliodid-d5,methyl iodide d3 stored over copper |
| IUPAC Name | trideuterio(iodo)methane |
| InChI Key | INQOMBQAUSQDDS-FIBGUPNXSA-N |
| Molecular Formula | CH3I |
4-Bromochlorobenzene, 99%
CAS: 106-39-8 Molecular Formula: C6H4BrCl Molecular Weight (g/mol): 191.45 MDL Number: MFCD00000600 InChI Key: NHDODQWIKUYWMW-UHFFFAOYSA-N Synonym: 4-bromochlorobenzene,p-bromochlorobenzene,4-chlorobromobenzene,p-chlorobromobenzene,p-chlorophenyl bromide,benzene, 1-bromo-4-chloro,4-chlorophenyl bromide,1-chloro-4-bromobenzene,4-chloro-1-bromobenzene,p-bromoclorobenzene PubChem CID: 7806 IUPAC Name: 1-bromo-4-chlorobenzene SMILES: ClC1=CC=C(Br)C=C1
| PubChem CID | 7806 |
|---|---|
| CAS | 106-39-8 |
| Molecular Weight (g/mol) | 191.45 |
| MDL Number | MFCD00000600 |
| SMILES | ClC1=CC=C(Br)C=C1 |
| Synonym | 4-bromochlorobenzene,p-bromochlorobenzene,4-chlorobromobenzene,p-chlorobromobenzene,p-chlorophenyl bromide,benzene, 1-bromo-4-chloro,4-chlorophenyl bromide,1-chloro-4-bromobenzene,4-chloro-1-bromobenzene,p-bromoclorobenzene |
| IUPAC Name | 1-bromo-4-chlorobenzene |
| InChI Key | NHDODQWIKUYWMW-UHFFFAOYSA-N |
| Molecular Formula | C6H4BrCl |
| PubChem CID | 679 |
|---|---|
| CAS | 67-68-5 |
| ChEBI | CHEBI:28262 |
2-Bromo-m-xylene, 98+%
CAS: 576-22-7 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.064 MDL Number: MFCD00000075 InChI Key: MYMYVYZLMUEVED-UHFFFAOYSA-N Synonym: 2,6-dimethylbromobenzene,2-bromo-m-xylene,1-bromo-2,6-dimethylbenzene,benzene, 2-bromo-1,3-dimethyl,2,6-dimethyl bromobenzene,m-xylene, 2-bromo,2,6-dimethylphenyl bromide,2-bromo-meta-xylene,2-bromo-1,3-dimethyl-benzene,pubchem3206 PubChem CID: 68471 IUPAC Name: 2-bromo-1,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)C)Br
| PubChem CID | 68471 |
|---|---|
| CAS | 576-22-7 |
| Molecular Weight (g/mol) | 185.064 |
| MDL Number | MFCD00000075 |
| SMILES | CC1=C(C(=CC=C1)C)Br |
| Synonym | 2,6-dimethylbromobenzene,2-bromo-m-xylene,1-bromo-2,6-dimethylbenzene,benzene, 2-bromo-1,3-dimethyl,2,6-dimethyl bromobenzene,m-xylene, 2-bromo,2,6-dimethylphenyl bromide,2-bromo-meta-xylene,2-bromo-1,3-dimethyl-benzene,pubchem3206 |
| IUPAC Name | 2-bromo-1,3-dimethylbenzene |
| InChI Key | MYMYVYZLMUEVED-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
3,5-Dimethylaniline, 97+%
CAS: 108-69-0 Molecular Formula: C8H11N Molecular Weight (g/mol): 121.183 MDL Number: MFCD00007813 InChI Key: MKARNSWMMBGSHX-UHFFFAOYSA-N Synonym: 3,5-xylidine,benzenamine, 3,5-dimethyl,3,5-xylylamine,3,5-dimethylphenylamine,3,5-xylidene,5-amino-1,3-xylene,1-amino-3,5-dimethylbenzene,3,5-dimethylbenzenamine,3,5-dimethylbenzeneamine,5-amino-1,3-dimethylbenzene PubChem CID: 7949 IUPAC Name: 3,5-dimethylaniline SMILES: CC1=CC(=CC(=C1)N)C
| PubChem CID | 7949 |
|---|---|
| CAS | 108-69-0 |
| Molecular Weight (g/mol) | 121.183 |
| MDL Number | MFCD00007813 |
| SMILES | CC1=CC(=CC(=C1)N)C |
| Synonym | 3,5-xylidine,benzenamine, 3,5-dimethyl,3,5-xylylamine,3,5-dimethylphenylamine,3,5-xylidene,5-amino-1,3-xylene,1-amino-3,5-dimethylbenzene,3,5-dimethylbenzenamine,3,5-dimethylbenzeneamine,5-amino-1,3-dimethylbenzene |
| IUPAC Name | 3,5-dimethylaniline |
| InChI Key | MKARNSWMMBGSHX-UHFFFAOYSA-N |
| Molecular Formula | C8H11N |
3-Chlorobenzonitrile, 99%
CAS: 766-84-7 Molecular Formula: C7H4ClN Molecular Weight (g/mol): 137.57 MDL Number: MFCD00001798 InChI Key: WBUOVKBZJOIOAE-UHFFFAOYSA-N Synonym: m-chlorobenzonitrile,benzonitrile, 3-chloro,m-chloro benzonitrile,m-cyanochlorobenzene,benzonitrile, m-chloro,3-chlorobenzenecarbonitrile,5-chlorobenzonitrile,3-chloro benzonitrile,3-chloro-benzonitrile,pubchem3624 PubChem CID: 13015 IUPAC Name: 3-chlorobenzonitrile SMILES: ClC1=CC=CC(=C1)C#N
| PubChem CID | 13015 |
|---|---|
| CAS | 766-84-7 |
| Molecular Weight (g/mol) | 137.57 |
| MDL Number | MFCD00001798 |
| SMILES | ClC1=CC=CC(=C1)C#N |
| Synonym | m-chlorobenzonitrile,benzonitrile, 3-chloro,m-chloro benzonitrile,m-cyanochlorobenzene,benzonitrile, m-chloro,3-chlorobenzenecarbonitrile,5-chlorobenzonitrile,3-chloro benzonitrile,3-chloro-benzonitrile,pubchem3624 |
| IUPAC Name | 3-chlorobenzonitrile |
| InChI Key | WBUOVKBZJOIOAE-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClN |
Naphthalene-d8, for NMR, 98+ atom % D
CAS: 1146-65-2 Molecular Formula: C10H8 Molecular Weight (g/mol): 136.22 MDL Number: MFCD00001743 InChI Key: UFWIBTONFRDIAS-PGRXLJNUSA-N Synonym: naphthalene-d8,2h8 naphthalene,perdeuteronaphthalene,naphthalene d8,perdeuterated naphthalene,2 h? naphthalene,naphthalene-d8, analytical standard,naphthalene-d8 >98.0 atom % d,naphthalene d8 10 microg/ml in cyclohexane PubChem CID: 92148 IUPAC Name: 1,2,3,4,5,6,7,8-octadeuterionaphthalene SMILES: [2H]C1=C([2H])C2=C([2H])C([2H])=C([2H])C([2H])=C2C([2H])=C1[2H]
| PubChem CID | 92148 |
|---|---|
| CAS | 1146-65-2 |
| Molecular Weight (g/mol) | 136.22 |
| MDL Number | MFCD00001743 |
| SMILES | [2H]C1=C([2H])C2=C([2H])C([2H])=C([2H])C([2H])=C2C([2H])=C1[2H] |
| Synonym | naphthalene-d8,2h8 naphthalene,perdeuteronaphthalene,naphthalene d8,perdeuterated naphthalene,2 h? naphthalene,naphthalene-d8, analytical standard,naphthalene-d8 >98.0 atom % d,naphthalene d8 10 microg/ml in cyclohexane |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterionaphthalene |
| InChI Key | UFWIBTONFRDIAS-PGRXLJNUSA-N |
| Molecular Formula | C10H8 |
n-Heptane, anhydrous, over molecular sieves, packaged under Argon in resealable ChemSeal™ bottles
CAS: 142-82-5 Molecular Formula: C7H16 Molecular Weight (g/mol): 100.21 MDL Number: MFCD00009544 InChI Key: IMNFDUFMRHMDMM-UHFFFAOYSA-N Synonym: n-heptane,dipropylmethane,heptan,heptyl hydride,dipropyl methane,gettysolve-c,skellysolve c,heptanen,eptani,heptan polish PubChem CID: 8900 ChEBI: CHEBI:43098 IUPAC Name: heptane SMILES: CCCCCCC
| PubChem CID | 8900 |
|---|---|
| CAS | 142-82-5 |
| Molecular Weight (g/mol) | 100.21 |
| ChEBI | CHEBI:43098 |
| MDL Number | MFCD00009544 |
| SMILES | CCCCCCC |
| Synonym | n-heptane,dipropylmethane,heptan,heptyl hydride,dipropyl methane,gettysolve-c,skellysolve c,heptanen,eptani,heptan polish |
| IUPAC Name | heptane |
| InChI Key | IMNFDUFMRHMDMM-UHFFFAOYSA-N |
| Molecular Formula | C7H16 |
Pyridine, ACS Reagent, ≥99%, Honeywell™ Riedel-de Haën™
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
CERILLIANT™ Ethanol-150, 150 mg/dL in H2O, Sold by MilliporeSigma™ Supelco™
A kit of NIST traceable ethanol standards suitable for calibration of ethanol testing methods. These Certified Reference Materials are widely used in forensic analysis and clinical toxicology applications for determination of blood alcohol content.
Methyl Isobutyl Ketone, Honeywell Burdick & Jackson™
CAS: 108-10-1 PubChem CID: 7909 ChEBI: CHEBI:82344
| PubChem CID | 7909 |
|---|---|
| CAS | 108-10-1 |
| ChEBI | CHEBI:82344 |
Ethyl Ether, Anhydrous, 99.8% min., DriSolv, MilliporeSigma™
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Toluene-d8, for NMR, 100.0 atom % D, packaged in 0.50 ml ampoules
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 MDL Number: MFCD00044638 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene SMILES: CC1=CC=CC=C1
| PubChem CID | 74861 |
|---|---|
| CAS | 2037-26-5 |
| Molecular Weight (g/mol) | 100.19 |
| MDL Number | MFCD00044638 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |
Dichloromethane, 99.8% min., MilliporeSigma™
Chemical Name or Material: Dichloromethane Name Note: For HPLC, ACS analysis CAS: 75-09-2 Physical Form: Liquid Assay Percent Range: 99.8% min. Molecular Formula: CH2Cl2 Formula Weight: 84.93 Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm
| Name Note | For HPLC, ACS analysis |
|---|---|
| CAS | 75-09-2 |
| Physical Form | Liquid |
| Chemical Name or Material | Dichloromethane |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Molecular Formula | CH2Cl2 |
| Formula Weight | 84.93 |
| Assay Percent Range | 99.8% min. |
Avantor Macron Dimethyl Sulfoxide ChromAR, Macron Fine Chemicals™
CAS: 67-68-5 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00002089 InChI Key: IAZDPXIOMUYVGZ-UHFFFAOYSA-N Synonym: dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide PubChem CID: 679 ChEBI: CHEBI:28262 IUPAC Name: methanesulfinylmethane SMILES: CS(C)=O
| PubChem CID | 679 |
|---|---|
| CAS | 67-68-5 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:28262 |
| MDL Number | MFCD00002089 |
| SMILES | CS(C)=O |
| Synonym | dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide |
| IUPAC Name | methanesulfinylmethane |
| InChI Key | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |