Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
TMS-HT (=HMDS and TMCS in Anhydrous Pyridine) [for Gas Chromatography], TCI America™
MDL Number: MFCD00192427 Synonym: Hexamethyldisilazane and Trimethylchlorosilane in Anhydrous Pyridine, Trimethylchlorosilane and Hexamethyldisilazane in Anhydrous Pyridine
| MDL Number | MFCD00192427 |
|---|---|
| Synonym | Hexamethyldisilazane and Trimethylchlorosilane in Anhydrous Pyridine, Trimethylchlorosilane and Hexamethyldisilazane in Anhydrous Pyridine |
2-Chloro-L-mandelic Acid 98.0+%, TCI America™
CAS: 52950-19-3 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.591 MDL Number: MFCD00798437 InChI Key: RWOLDZZTBNYTMS-ZETCQYMHSA-N Synonym: s-+-2-chloromandelic acid,s-2-2-chlorophenyl-2-hydroxyacetic acid,s-2-chloromandelic acid,s-o-chloromandelicacid,2-chloro-l-mandelic acid,2s-2-2-chlorophenyl-2-hydroxy-acetic acid,s-2-chlorophenyl hydroxy acetic acid,pubchem5743,s-o-chloromandelic acid,ksc914s2j PubChem CID: 6922874 IUPAC Name: (2S)-2-(2-chlorophenyl)-2-hydroxyacetic acid SMILES: C1=CC=C(C(=C1)C(C(=O)O)O)Cl
| PubChem CID | 6922874 |
|---|---|
| CAS | 52950-19-3 |
| Molecular Weight (g/mol) | 186.591 |
| MDL Number | MFCD00798437 |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)Cl |
| Synonym | s-+-2-chloromandelic acid,s-2-2-chlorophenyl-2-hydroxyacetic acid,s-2-chloromandelic acid,s-o-chloromandelicacid,2-chloro-l-mandelic acid,2s-2-2-chlorophenyl-2-hydroxy-acetic acid,s-2-chlorophenyl hydroxy acetic acid,pubchem5743,s-o-chloromandelic acid,ksc914s2j |
| IUPAC Name | (2S)-2-(2-chlorophenyl)-2-hydroxyacetic acid |
| InChI Key | RWOLDZZTBNYTMS-ZETCQYMHSA-N |
| Molecular Formula | C8H7ClO3 |
4-Chlorophenylacetyl Chloride 98.0+%, TCI America™
CAS: 25026-34-0 Molecular Formula: C8H6Cl2O Molecular Weight (g/mol): 189.04 MDL Number: MFCD00037111 InChI Key: UMQUIRYNOVNYPA-UHFFFAOYSA-N Synonym: 4-chlorophenylacetyl chloride,p-chlorophenylacetyl chloride,2-4-chlorophenyl acetyl chloride,4-chlorobenzeneacetyl chloride,benzeneacetyl chloride, 4-chloro,4-chlorophenylacetylchloride,acmc-1cch1,4-chlorobenzeneacetylchloride,4-chlorobenzenacetyl chloride,p-chlorophenyl-acetyl chloride PubChem CID: 90692 IUPAC Name: 2-(4-chlorophenyl)acetyl chloride SMILES: ClC(=O)CC1=CC=C(Cl)C=C1
| PubChem CID | 90692 |
|---|---|
| CAS | 25026-34-0 |
| Molecular Weight (g/mol) | 189.04 |
| MDL Number | MFCD00037111 |
| SMILES | ClC(=O)CC1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorophenylacetyl chloride,p-chlorophenylacetyl chloride,2-4-chlorophenyl acetyl chloride,4-chlorobenzeneacetyl chloride,benzeneacetyl chloride, 4-chloro,4-chlorophenylacetylchloride,acmc-1cch1,4-chlorobenzeneacetylchloride,4-chlorobenzenacetyl chloride,p-chlorophenyl-acetyl chloride |
| IUPAC Name | 2-(4-chlorophenyl)acetyl chloride |
| InChI Key | UMQUIRYNOVNYPA-UHFFFAOYSA-N |
| Molecular Formula | C8H6Cl2O |
1,2-O-Isopropylidene-alpha-D-xylofuranose 98.0+%, TCI America™
CAS: 20031-21-4 Molecular Formula: C8H14O5 Molecular Weight (g/mol): 190.195 MDL Number: MFCD00063295 InChI Key: JAUQZVBVVJJRKM-XZBKPIIZSA-N Synonym: 1,2-o-isopropylidene-alpha-d-xylofuranose,3ar,5r,6s,6ar-5-hydroxymethyl-2,2-dimethyltetrahydrofuro 2,3-d 1,3 dioxol-6-ol,1,2-o-isopropylidene-a-d-xylofuranose,alpha-d-xylofuranose, 1,2-o-1-methylethylidene,1,2-o-isopropylidene-d-xylofuranose,3ar,5r,6s,6ar-5-hydroxymethyl-2,2-dimethyl-tetrahydro-2h-furo 2,3-d 1,3 dioxol-6-ol,3ar,5r,6s,6ar-5-hydroxymethyl-2,2-dimethyl-tetrahydrofuro 2,3-d 1,3 dioxol-6-ol,3ar,5r,6s,6ar-5-hydroxymethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro 2,3-d 1,3 dioxol-6-ol,.alpha.-d-xylofuranose, 1,2-o-1-methylethylidene,1,2-o-isopropylidene-,a-d-xylofuranose PubChem CID: 88338 IUPAC Name: (3aR,5R,6S,6aR)-5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol SMILES: CC1(OC2C(C(OC2O1)CO)O)C
| PubChem CID | 88338 |
|---|---|
| CAS | 20031-21-4 |
| Molecular Weight (g/mol) | 190.195 |
| MDL Number | MFCD00063295 |
| SMILES | CC1(OC2C(C(OC2O1)CO)O)C |
| Synonym | 1,2-o-isopropylidene-alpha-d-xylofuranose,3ar,5r,6s,6ar-5-hydroxymethyl-2,2-dimethyltetrahydrofuro 2,3-d 1,3 dioxol-6-ol,1,2-o-isopropylidene-a-d-xylofuranose,alpha-d-xylofuranose, 1,2-o-1-methylethylidene,1,2-o-isopropylidene-d-xylofuranose,3ar,5r,6s,6ar-5-hydroxymethyl-2,2-dimethyl-tetrahydro-2h-furo 2,3-d 1,3 dioxol-6-ol,3ar,5r,6s,6ar-5-hydroxymethyl-2,2-dimethyl-tetrahydrofuro 2,3-d 1,3 dioxol-6-ol,3ar,5r,6s,6ar-5-hydroxymethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro 2,3-d 1,3 dioxol-6-ol,.alpha.-d-xylofuranose, 1,2-o-1-methylethylidene,1,2-o-isopropylidene-,a-d-xylofuranose |
| IUPAC Name | (3aR,5R,6S,6aR)-5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| InChI Key | JAUQZVBVVJJRKM-XZBKPIIZSA-N |
| Molecular Formula | C8H14O5 |
2,5-Dimethylphenylacetic Acid 98.0+%, TCI America™
CAS: 13612-34-5 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.204 MDL Number: MFCD00014369 InChI Key: RUSCTNYOPQOXDJ-UHFFFAOYSA-N Synonym: 2,5-dimethylphenylacetic acid,2-2,5-dimethylphenyl acetic acid,2,5-dimethylphenyl acetic acid,2,5-xylylacetic acid,2,5-dimethylphenylaceticacid,2,5-dimethylbenzeneacetic acid,benzeneacetic acid, 2,5-dimethyl,pubchem22525,acmc-1bb4h PubChem CID: 83615 IUPAC Name: 2-(2,5-dimethylphenyl)acetic acid SMILES: CC1=CC(=C(C=C1)C)CC(=O)O
| PubChem CID | 83615 |
|---|---|
| CAS | 13612-34-5 |
| Molecular Weight (g/mol) | 164.204 |
| MDL Number | MFCD00014369 |
| SMILES | CC1=CC(=C(C=C1)C)CC(=O)O |
| Synonym | 2,5-dimethylphenylacetic acid,2-2,5-dimethylphenyl acetic acid,2,5-dimethylphenyl acetic acid,2,5-xylylacetic acid,2,5-dimethylphenylaceticacid,2,5-dimethylbenzeneacetic acid,benzeneacetic acid, 2,5-dimethyl,pubchem22525,acmc-1bb4h |
| IUPAC Name | 2-(2,5-dimethylphenyl)acetic acid |
| InChI Key | RUSCTNYOPQOXDJ-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
2-Iodo-m-xylene 98.0+%, TCI America™
CAS: 608-28-6 Molecular Formula: C8H9I Molecular Weight (g/mol): 232.064 MDL Number: MFCD00019012 InChI Key: QTUGGVBKWIYQSS-UHFFFAOYSA-N Synonym: 2-iodo-m-xylene,2,6-dimethyliodobenzene,m-xylene, 2-iodo,benzene, 2-iodo-1,3-dimethyl,1,3-dimethyl-2-iodobenzene,2-iodo-1,3-dimethyl-benzene,2,6-dimethyl-1-iodobenzene,2-iodo-o-xylene,pubchem3867,acmc-1axwc PubChem CID: 69097 IUPAC Name: 2-iodo-1,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)C)I
| PubChem CID | 69097 |
|---|---|
| CAS | 608-28-6 |
| Molecular Weight (g/mol) | 232.064 |
| MDL Number | MFCD00019012 |
| SMILES | CC1=C(C(=CC=C1)C)I |
| Synonym | 2-iodo-m-xylene,2,6-dimethyliodobenzene,m-xylene, 2-iodo,benzene, 2-iodo-1,3-dimethyl,1,3-dimethyl-2-iodobenzene,2-iodo-1,3-dimethyl-benzene,2,6-dimethyl-1-iodobenzene,2-iodo-o-xylene,pubchem3867,acmc-1axwc |
| IUPAC Name | 2-iodo-1,3-dimethylbenzene |
| InChI Key | QTUGGVBKWIYQSS-UHFFFAOYSA-N |
| Molecular Formula | C8H9I |
2,5-Dimethylphenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 85199-06-0 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01863525 InChI Key: OOMZKLJLVGQZGV-UHFFFAOYSA-N Synonym: 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid PubChem CID: 2734347 IUPAC Name: (2,5-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C)C(=C1)B(O)O
| PubChem CID | 2734347 |
|---|---|
| CAS | 85199-06-0 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01863525 |
| SMILES | CC1=CC=C(C)C(=C1)B(O)O |
| Synonym | 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid |
| IUPAC Name | (2,5-dimethylphenyl)boronic acid |
| InChI Key | OOMZKLJLVGQZGV-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
Tetrahydrofurfuryl Butyrate 98.0+%, TCI America™
CAS: 2217-33-6 Molecular Formula: C9H16O3 Molecular Weight (g/mol): 172.224 MDL Number: MFCD00059734 InChI Key: DPZVDLFOAZNCBU-UHFFFAOYSA-N Synonym: Butyric Acid Tetrahydrofurfuryl Ester, 2-(Butyryloxymethyl)tetrahydrofuran PubChem CID: 551316 IUPAC Name: oxolan-2-ylmethyl butanoate SMILES: CCCC(=O)OCC1CCCO1
| PubChem CID | 551316 |
|---|---|
| CAS | 2217-33-6 |
| Molecular Weight (g/mol) | 172.224 |
| MDL Number | MFCD00059734 |
| SMILES | CCCC(=O)OCC1CCCO1 |
| Synonym | Butyric Acid Tetrahydrofurfuryl Ester, 2-(Butyryloxymethyl)tetrahydrofuran |
| IUPAC Name | oxolan-2-ylmethyl butanoate |
| InChI Key | DPZVDLFOAZNCBU-UHFFFAOYSA-N |
| Molecular Formula | C9H16O3 |
Chloroform (stabilized with Ethanol) 99.0+%, TCI America™
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 IUPAC Name: trichloromethane SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| IUPAC Name | trichloromethane |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
1-(4-Chlorophenyl)-1-cyclopropanecarboxylic Acid 98.0+%, TCI America™
CAS: 72934-37-3 Molecular Formula: C10H9ClO2 Molecular Weight (g/mol): 196.63 MDL Number: MFCD00001289 InChI Key: YAHLWSGIQJATGG-UHFFFAOYSA-N Synonym: 1-4-chlorophenyl cyclopropanecarboxylic acid,1-4-chlorophenyl cyclopropane-1-carboxylic acid,1-4-chlorophenyl-1-cyclopropanecarboxylic acid,cyclopropanecarboxylic acid, 1-4-chlorophenyl,1-p-chlorophenyl cyclopropanecarboxylic acid,acmc-209oos,1-4-chlorophenyl cyclopropanecarboxylicacid,1-4chloro-phenyl-cyclopropylcarboxylic acid,1-4-chloro-phenyl-cyclopropylcarboxylic acid PubChem CID: 98606 IUPAC Name: 1-(4-chlorophenyl)cyclopropane-1-carboxylic acid SMILES: C1CC1(C2=CC=C(C=C2)Cl)C(=O)O
| PubChem CID | 98606 |
|---|---|
| CAS | 72934-37-3 |
| Molecular Weight (g/mol) | 196.63 |
| MDL Number | MFCD00001289 |
| SMILES | C1CC1(C2=CC=C(C=C2)Cl)C(=O)O |
| Synonym | 1-4-chlorophenyl cyclopropanecarboxylic acid,1-4-chlorophenyl cyclopropane-1-carboxylic acid,1-4-chlorophenyl-1-cyclopropanecarboxylic acid,cyclopropanecarboxylic acid, 1-4-chlorophenyl,1-p-chlorophenyl cyclopropanecarboxylic acid,acmc-209oos,1-4-chlorophenyl cyclopropanecarboxylicacid,1-4chloro-phenyl-cyclopropylcarboxylic acid,1-4-chloro-phenyl-cyclopropylcarboxylic acid |
| IUPAC Name | 1-(4-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChI Key | YAHLWSGIQJATGG-UHFFFAOYSA-N |
| Molecular Formula | C10H9ClO2 |
4-Chlorothiobenzamide 97.0+%, TCI America™
CAS: 2521-24-6 Molecular Formula: C7H6ClNS Molecular Weight (g/mol): 171.64 MDL Number: MFCD00040956 InChI Key: OKPUICCJRDBRJT-UHFFFAOYSA-N Synonym: 4-chlorothiobenzamide,4-chlorobenzothioamide,p-chlorothiobenzamide,p-chlorobenzothiamide,4-chlorobenzene-1-carbothioamide,4-chloro-thiobenzamide,benzenecarbothioamide, 4-chloro,benzamide, p-chlorothio,benzamide, p-chlorothio-8ci,amino 4-chlorophenyl methane-1-thione PubChem CID: 2734826 IUPAC Name: 4-chlorobenzene-1-carbothioamide SMILES: NC(=S)C1=CC=C(Cl)C=C1
| PubChem CID | 2734826 |
|---|---|
| CAS | 2521-24-6 |
| Molecular Weight (g/mol) | 171.64 |
| MDL Number | MFCD00040956 |
| SMILES | NC(=S)C1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorothiobenzamide,4-chlorobenzothioamide,p-chlorothiobenzamide,p-chlorobenzothiamide,4-chlorobenzene-1-carbothioamide,4-chloro-thiobenzamide,benzenecarbothioamide, 4-chloro,benzamide, p-chlorothio,benzamide, p-chlorothio-8ci,amino 4-chlorophenyl methane-1-thione |
| IUPAC Name | 4-chlorobenzene-1-carbothioamide |
| InChI Key | OKPUICCJRDBRJT-UHFFFAOYSA-N |
| Molecular Formula | C7H6ClNS |
2-(3-Chlorophenyl)ethanol 98.0+%, TCI America™
CAS: 5182-44-5 Molecular Formula: C8H9ClO Molecular Weight (g/mol): 156.61 MDL Number: MFCD00002892 InChI Key: NDWAVJKRSASRPH-UHFFFAOYSA-N Synonym: 2-3-chlorophenyl ethanol,3-chlorophenethyl alcohol,benzeneethanol, 3-chloro,3-chlorophenethylalcohol,2-3-chlorophenyl ethan-1-ol,m-chlorophenethyl alcohol,m-chlorophenethylic alcohol,phenethyl alcohol, m-chloro,3-chlorobenzeneethanol,acmc-1cuee PubChem CID: 78856 IUPAC Name: 2-(3-chlorophenyl)ethan-1-ol SMILES: OCCC1=CC=CC(Cl)=C1
| PubChem CID | 78856 |
|---|---|
| CAS | 5182-44-5 |
| Molecular Weight (g/mol) | 156.61 |
| MDL Number | MFCD00002892 |
| SMILES | OCCC1=CC=CC(Cl)=C1 |
| Synonym | 2-3-chlorophenyl ethanol,3-chlorophenethyl alcohol,benzeneethanol, 3-chloro,3-chlorophenethylalcohol,2-3-chlorophenyl ethan-1-ol,m-chlorophenethyl alcohol,m-chlorophenethylic alcohol,phenethyl alcohol, m-chloro,3-chlorobenzeneethanol,acmc-1cuee |
| IUPAC Name | 2-(3-chlorophenyl)ethan-1-ol |
| InChI Key | NDWAVJKRSASRPH-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO |
Methyl (2-Chlorophenyl)acetate 98.0+%, TCI America™
CAS: 57486-68-7 Molecular Formula: C9H9ClO2 Molecular Weight (g/mol): 184.619 MDL Number: MFCD00137445 InChI Key: KHBWTRFWQROKJZ-UHFFFAOYSA-N Synonym: methyl 2-chlorophenylacetate,methyl 2-2-chlorophenyl acetate,methyl 2-chlorophenyl acetate,2-chlorophenyl acetic acid methyl ester,benzeneacetic acid, 2-chloro-, methyl ester,2-chlorophenylacetic acid methylester,2-chlorobenzeneacetic acid methyl ester,acmc-209lyj,methyl2-chlorophenylacetate PubChem CID: 93683 IUPAC Name: methyl 2-(2-chlorophenyl)acetate SMILES: COC(=O)CC1=CC=CC=C1Cl
| PubChem CID | 93683 |
|---|---|
| CAS | 57486-68-7 |
| Molecular Weight (g/mol) | 184.619 |
| MDL Number | MFCD00137445 |
| SMILES | COC(=O)CC1=CC=CC=C1Cl |
| Synonym | methyl 2-chlorophenylacetate,methyl 2-2-chlorophenyl acetate,methyl 2-chlorophenyl acetate,2-chlorophenyl acetic acid methyl ester,benzeneacetic acid, 2-chloro-, methyl ester,2-chlorophenylacetic acid methylester,2-chlorobenzeneacetic acid methyl ester,acmc-209lyj,methyl2-chlorophenylacetate |
| IUPAC Name | methyl 2-(2-chlorophenyl)acetate |
| InChI Key | KHBWTRFWQROKJZ-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO2 |
2,5-Dimethylnitrobenzene 99.0+%, TCI America™
CAS: 89-58-7 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.17 MDL Number: MFCD00024284 InChI Key: BSFHJMGROOFSRA-UHFFFAOYSA-N Synonym: Nitro-p-xylene PubChem CID: 6974 IUPAC Name: 1,4-dimethyl-2-nitrobenzene SMILES: CC1=CC=C(C)C(=C1)[N+]([O-])=O
| PubChem CID | 6974 |
|---|---|
| CAS | 89-58-7 |
| Molecular Weight (g/mol) | 151.17 |
| MDL Number | MFCD00024284 |
| SMILES | CC1=CC=C(C)C(=C1)[N+]([O-])=O |
| Synonym | Nitro-p-xylene |
| IUPAC Name | 1,4-dimethyl-2-nitrobenzene |
| InChI Key | BSFHJMGROOFSRA-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Hexane 96.0+%, TCI America™
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |