Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Ethanol, for spectroscopy, anhydrous, denat. with 5% 2-Propanol + 5% Methanol
CAS: 64-17-5 Molecular Formula: C2H6O Molecular Weight (g/mol): 46.069 InChI Key: LFQSCWFLJHTTHZ-UHFFFAOYSA-N Synonym: ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol PubChem CID: 702 ChEBI: CHEBI:16236 IUPAC Name: ethanol SMILES: CCO
| PubChem CID | 702 |
|---|---|
| CAS | 64-17-5 |
| Molecular Weight (g/mol) | 46.069 |
| ChEBI | CHEBI:16236 |
| SMILES | CCO |
| Synonym | ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol |
| IUPAC Name | ethanol |
| InChI Key | LFQSCWFLJHTTHZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6O |
n-Pentane, Spectrophotometric Grade, 99+% min.
CAS: 109-66-0 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009498 InChI Key: OFBQJSOFQDEBGM-UHFFFAOYSA-N Synonym: n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish PubChem CID: 8003 ChEBI: CHEBI:37830 IUPAC Name: pentane SMILES: CCCCC
| PubChem CID | 8003 |
|---|---|
| CAS | 109-66-0 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:37830 |
| MDL Number | MFCD00009498 |
| SMILES | CCCCC |
| Synonym | n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish |
| IUPAC Name | pentane |
| InChI Key | OFBQJSOFQDEBGM-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Tetrachlorobis(tetrahydrofuran)zirconium(IV), Thermo Scientific Chemicals
CAS: 21959-01-3 Molecular Formula: C8H16Cl4O2Zr Molecular Weight (g/mol): 377.238 MDL Number: MFCD00145367 InChI Key: VDJJKYYENYIHFF-UHFFFAOYSA-J Synonym: tetrachlorobis tetrahydrofuran zirconium,zrcl4 thf 2,oxolane; tetrachlorozirconium,tetrachlorobis tetrahydrofurane zirconium,zirconium tetrachloride tetrahydrofuran complex,zirconium iv chloride tetrahydrofuran complex,bis tetrahydrofuran ; zirconium iv chloride,zirconium iv chloride tetrahydrofuran complex 1:2 PubChem CID: 2734040 IUPAC Name: oxolane;tetrachlorozirconium SMILES: C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl
| PubChem CID | 2734040 |
|---|---|
| CAS | 21959-01-3 |
| Molecular Weight (g/mol) | 377.238 |
| MDL Number | MFCD00145367 |
| SMILES | C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl |
| Synonym | tetrachlorobis tetrahydrofuran zirconium,zrcl4 thf 2,oxolane; tetrachlorozirconium,tetrachlorobis tetrahydrofurane zirconium,zirconium tetrachloride tetrahydrofuran complex,zirconium iv chloride tetrahydrofuran complex,bis tetrahydrofuran ; zirconium iv chloride,zirconium iv chloride tetrahydrofuran complex 1:2 |
| IUPAC Name | oxolane;tetrachlorozirconium |
| InChI Key | VDJJKYYENYIHFF-UHFFFAOYSA-J |
| Molecular Formula | C8H16Cl4O2Zr |
Ethylene glycol, EMPLURA™, MilliporeSigma™
CAS: 107-21-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 62.068 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC Name: ethane-1,2-diol SMILES: C(CO)O
| PubChem CID | 174 |
|---|---|
| CAS | 107-21-1 |
| Molecular Weight (g/mol) | 62.068 |
| ChEBI | CHEBI:30742 |
| SMILES | C(CO)O |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2 |
Carbon Disulfide, 99.9% min., ACS, MilliporeSigma™
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |
1,2-Dichloroethane, ACS, 99+%
CAS: 107-06-2 Molecular Formula: C2H4Cl2 Molecular Weight (g/mol): 98.95 MDL Number: MFCD00000963 InChI Key: WSLDOOZREJYCGB-UHFFFAOYSA-N Synonym: ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion PubChem CID: 11 ChEBI: CHEBI:27789 IUPAC Name: 1,2-dichloroethane SMILES: ClCCCl
| PubChem CID | 11 |
|---|---|
| CAS | 107-06-2 |
| Molecular Weight (g/mol) | 98.95 |
| ChEBI | CHEBI:27789 |
| MDL Number | MFCD00000963 |
| SMILES | ClCCCl |
| Synonym | ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion |
| IUPAC Name | 1,2-dichloroethane |
| InChI Key | WSLDOOZREJYCGB-UHFFFAOYSA-N |
| Molecular Formula | C2H4Cl2 |
N,N-Dimethylacetamide, 99.8+%, for HPLC
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Pyridine-d5, for NMR, contains 1 v/v% TMS, 99 atom % D
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
Trifluoroacetic acid-d, 99.5%(Isotopic)
CAS: 599-00-8 Molecular Formula: C2HF3O2 Molecular Weight (g/mol): 115.029 MDL Number: MFCD00044563 InChI Key: DTQVDTLACAAQTR-DYCDLGHISA-N Synonym: trifluoroacetic acid-d,deuterotrifluoroacetic acid,acetic acid-d, trifluoro,acetic acid-d,2,2,2-trifluoro,acetic acid-d, 2,2,2-trifluoro,trifluoroacetic acid-d tfa-d,trifluoroacetic acid-d, 99.5 atom % d,tfa-d,cf3cood,trifluoroacetic 2h acid PubChem CID: 71502 IUPAC Name: deuterio 2,2,2-trifluoroacetate SMILES: C(=O)(C(F)(F)F)O
| PubChem CID | 71502 |
|---|---|
| CAS | 599-00-8 |
| Molecular Weight (g/mol) | 115.029 |
| MDL Number | MFCD00044563 |
| SMILES | C(=O)(C(F)(F)F)O |
| Synonym | trifluoroacetic acid-d,deuterotrifluoroacetic acid,acetic acid-d, trifluoro,acetic acid-d,2,2,2-trifluoro,acetic acid-d, 2,2,2-trifluoro,trifluoroacetic acid-d tfa-d,trifluoroacetic acid-d, 99.5 atom % d,tfa-d,cf3cood,trifluoroacetic 2h acid |
| IUPAC Name | deuterio 2,2,2-trifluoroacetate |
| InChI Key | DTQVDTLACAAQTR-DYCDLGHISA-N |
| Molecular Formula | C2HF3O2 |
Ethyl acetate, 99.6%, ACS reagent, meets the requirements of Reag. Ph.Eur.
CAS: 141-78-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00009171 InChI Key: XEKOWRVHYACXOJ-UHFFFAOYSA-N Synonym: ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester PubChem CID: 8857 ChEBI: CHEBI:27750 IUPAC Name: ethyl acetate SMILES: CCOC(=O)C
| PubChem CID | 8857 |
|---|---|
| CAS | 141-78-6 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:27750 |
| MDL Number | MFCD00009171 |
| SMILES | CCOC(=O)C |
| Synonym | ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester |
| IUPAC Name | ethyl acetate |
| InChI Key | XEKOWRVHYACXOJ-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
2,4-Dimethylphenol, 99%
CAS: 105-67-9 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.17 MDL Number: MFCD00002233 InChI Key: KUFFULVDNCHOFZ-UHFFFAOYSA-N Synonym: 2,4-xylenol,phenol, 2,4-dimethyl,gallex,4,6-dimethylphenol,1-hydroxy-2,4-dimethylbenzene,4-hydroxy-1,3-dimethylbenzene,rcra waste number u101,2,4-dimethyl phenol,caswell no. 907a,lysol brand disinfectant PubChem CID: 7771 ChEBI: CHEBI:34241 IUPAC Name: 2,4-dimethylphenol SMILES: CC1=CC(=C(C=C1)O)C
| PubChem CID | 7771 |
|---|---|
| CAS | 105-67-9 |
| Molecular Weight (g/mol) | 122.17 |
| ChEBI | CHEBI:34241 |
| MDL Number | MFCD00002233 |
| SMILES | CC1=CC(=C(C=C1)O)C |
| Synonym | 2,4-xylenol,phenol, 2,4-dimethyl,gallex,4,6-dimethylphenol,1-hydroxy-2,4-dimethylbenzene,4-hydroxy-1,3-dimethylbenzene,rcra waste number u101,2,4-dimethyl phenol,caswell no. 907a,lysol brand disinfectant |
| IUPAC Name | 2,4-dimethylphenol |
| InChI Key | KUFFULVDNCHOFZ-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
Methyl sulfoxide-d6, for NMR, packaged in 1.00 ml ampoules, 99.9 atom % D
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
Dimethyl sulfoxide, 99.97%, MP Biomedicals™
CAS: 67-68-5 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00002089 InChI Key: IAZDPXIOMUYVGZ-UHFFFAOYSA-N Synonym: dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide PubChem CID: 679 ChEBI: CHEBI:28262 SMILES: CS(C)=O
| PubChem CID | 679 |
|---|---|
| CAS | 67-68-5 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:28262 |
| MDL Number | MFCD00002089 |
| SMILES | CS(C)=O |
| Synonym | dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide |
| InChI Key | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |
Dichloromethane, 99.5%, for analysis, stabilized with ethanol
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Dexmedetomidine Hydrochloride 98.0+%, TCI America™
CAS: 145108-58-3 Molecular Formula: C13H17ClN2 Molecular Weight (g/mol): 236.743 MDL Number: MFCD12912677 InChI Key: VPNGEIHDPSLNMU-MERQFXBCSA-N Synonym: dexmedetomidine hydrochloride,dexmedetomidine hcl,precedex,4-s-alpha,2,3-trimethylbenzyl imidazole monohydrochloride,unii-1018wh7f9i,dexmedetomidine hcl precedex,s-5-1-2,3-dimethylphenyl ethyl-1h-imidazole hydrochloride,dexdor,4-1s-1-2,3-dimethylphenyl ethyl-1h-imidazole hydrochloride PubChem CID: 6918081 ChEBI: CHEBI:31472 IUPAC Name: 5-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole;hydrochloride SMILES: CC1=C(C(=CC=C1)C(C)C2=CN=CN2)C.Cl
| PubChem CID | 6918081 |
|---|---|
| CAS | 145108-58-3 |
| Molecular Weight (g/mol) | 236.743 |
| ChEBI | CHEBI:31472 |
| MDL Number | MFCD12912677 |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN=CN2)C.Cl |
| Synonym | dexmedetomidine hydrochloride,dexmedetomidine hcl,precedex,4-s-alpha,2,3-trimethylbenzyl imidazole monohydrochloride,unii-1018wh7f9i,dexmedetomidine hcl precedex,s-5-1-2,3-dimethylphenyl ethyl-1h-imidazole hydrochloride,dexdor,4-1s-1-2,3-dimethylphenyl ethyl-1h-imidazole hydrochloride |
| IUPAC Name | 5-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole;hydrochloride |
| InChI Key | VPNGEIHDPSLNMU-MERQFXBCSA-N |
| Molecular Formula | C13H17ClN2 |