Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Deuterium oxide, for NMR, packaged in 0.75 ml ampoules, 99.9 atom % D
CAS: 7789-20-0 Molecular Formula: H2O Molecular Weight (g/mol): 20.03 MDL Number: MFCD00044636 InChI Key: XLYOFNOQVPJJNP-ZSJDYOACSA-N Synonym: deuterium oxide,water-d2,heavy water,deuterated water,dideuterium oxide,heavy water-d2,heavy water d2o,water sup 2-h2,deuterium oxide usan,water, heavy d2-o PubChem CID: 24602 ChEBI: CHEBI:41981 IUPAC Name: [(²H)oxy](²H) SMILES: [2H]O[2H]
| PubChem CID | 24602 |
|---|---|
| CAS | 7789-20-0 |
| Molecular Weight (g/mol) | 20.03 |
| ChEBI | CHEBI:41981 |
| MDL Number | MFCD00044636 |
| SMILES | [2H]O[2H] |
| Synonym | deuterium oxide,water-d2,heavy water,deuterated water,dideuterium oxide,heavy water-d2,heavy water d2o,water sup 2-h2,deuterium oxide usan,water, heavy d2-o |
| IUPAC Name | [(²H)oxy](²H) |
| InChI Key | XLYOFNOQVPJJNP-ZSJDYOACSA-N |
| Molecular Formula | H2O |
n-Hexane, 97%, for electronic use (MOS), residue free
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
Dichloromethane, 99.9%, Extra Dry, stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Acetone-d6, for NMR, packaged in 0.75 ml ampoules, 99.9 atom % D
CAS: 666-52-4 Molecular Formula: C3H6O Molecular Weight (g/mol): 64.117 MDL Number: MFCD00044635 InChI Key: CSCPPACGZOOCGX-WFGJKAKNSA-N Synonym: acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone PubChem CID: 522220 ChEBI: CHEBI:78217 IUPAC Name: 1,1,1,3,3,3-hexadeuteriopropan-2-one SMILES: CC(=O)C
| PubChem CID | 522220 |
|---|---|
| CAS | 666-52-4 |
| Molecular Weight (g/mol) | 64.117 |
| ChEBI | CHEBI:78217 |
| MDL Number | MFCD00044635 |
| SMILES | CC(=O)C |
| Synonym | acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone |
| IUPAC Name | 1,1,1,3,3,3-hexadeuteriopropan-2-one |
| InChI Key | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| Molecular Formula | C3H6O |
2,5-Dimethylbenzeneboronic acid, 98%
CAS: 85199-06-0 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01863525 InChI Key: OOMZKLJLVGQZGV-UHFFFAOYSA-N Synonym: 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid PubChem CID: 2734347 IUPAC Name: (2,5-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C)C(=C1)B(O)O
| PubChem CID | 2734347 |
|---|---|
| CAS | 85199-06-0 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01863525 |
| SMILES | CC1=CC=C(C)C(=C1)B(O)O |
| Synonym | 2,5-dimethylphenyl boronic acid,2,5-dimethylbenzeneboronic acid,2,5-dimethylphenylboronicacid,2,5-dimethylphenyl boranediol,p-xylene-2-boronic acid,boronic acid, 2,5-dimethylphenyl,pubchem1831,p-xyleneboronic acid,ksc448a1r,2,5-dimehylphenylboronic acid |
| IUPAC Name | (2,5-dimethylphenyl)boronic acid |
| InChI Key | OOMZKLJLVGQZGV-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
2-Chloro-6-methylphenyl isocyanate, 97%
CAS: 40398-01-4 Molecular Formula: C8H6ClNO Molecular Weight (g/mol): 167.592 MDL Number: MFCD00037030 InChI Key: FBTQQNYGMICJQZ-UHFFFAOYSA-N Synonym: 2-chloro-6-methylphenyl isocyanate,2-chloro-6-methylphenylisocyanate,benzene, 1-chloro-2-isocyanato-3-methyl,acmc-1ake5,2-chloro-6-methylbenzenisocyanate,2-chloro 6-methyl phenylisocyanate,2-chloro 6-methyl phenyl isocyanate,2-chloro-1-isocyanato-6-methyl benzene,1-chloro-2-isocyanato-3-methyl-benzene,6-chloro-2-methylphenylisocyanate PubChem CID: 268123 IUPAC Name: 1-chloro-2-isocyanato-3-methylbenzene SMILES: CC1=C(C(=CC=C1)Cl)N=C=O
| PubChem CID | 268123 |
|---|---|
| CAS | 40398-01-4 |
| Molecular Weight (g/mol) | 167.592 |
| MDL Number | MFCD00037030 |
| SMILES | CC1=C(C(=CC=C1)Cl)N=C=O |
| Synonym | 2-chloro-6-methylphenyl isocyanate,2-chloro-6-methylphenylisocyanate,benzene, 1-chloro-2-isocyanato-3-methyl,acmc-1ake5,2-chloro-6-methylbenzenisocyanate,2-chloro 6-methyl phenylisocyanate,2-chloro 6-methyl phenyl isocyanate,2-chloro-1-isocyanato-6-methyl benzene,1-chloro-2-isocyanato-3-methyl-benzene,6-chloro-2-methylphenylisocyanate |
| IUPAC Name | 1-chloro-2-isocyanato-3-methylbenzene |
| InChI Key | FBTQQNYGMICJQZ-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClNO |
5-Chloro-m-phenylenediamine, 97%
CAS: 33786-89-9 Molecular Formula: C6H7ClN2 Molecular Weight (g/mol): 142.586 MDL Number: MFCD00014775 InChI Key: VZNUCJOYPXKLTA-UHFFFAOYSA-N Synonym: 5-chloro-m-phenylenediamine,3,5-diaminochlorobenzene,5-chloro-1,3-benzenediamine,1,3-benzenediamine, 5-chloro,5-chloro-1,3-phenylenediamine,ccris 2886,5-amino-3-chloroaniline,acmc-20am42,2-13-00-00029 beilstein handbook reference,5-chloro-1,3-diaminobenzene PubChem CID: 73335 IUPAC Name: 5-chlorobenzene-1,3-diamine SMILES: C1=C(C=C(C=C1N)Cl)N
| PubChem CID | 73335 |
|---|---|
| CAS | 33786-89-9 |
| Molecular Weight (g/mol) | 142.586 |
| MDL Number | MFCD00014775 |
| SMILES | C1=C(C=C(C=C1N)Cl)N |
| Synonym | 5-chloro-m-phenylenediamine,3,5-diaminochlorobenzene,5-chloro-1,3-benzenediamine,1,3-benzenediamine, 5-chloro,5-chloro-1,3-phenylenediamine,ccris 2886,5-amino-3-chloroaniline,acmc-20am42,2-13-00-00029 beilstein handbook reference,5-chloro-1,3-diaminobenzene |
| IUPAC Name | 5-chlorobenzene-1,3-diamine |
| InChI Key | VZNUCJOYPXKLTA-UHFFFAOYSA-N |
| Molecular Formula | C6H7ClN2 |
3-Chlorophenyl isothiocyanate, 97%
CAS: 2392-68-9 Molecular Formula: C7H4ClNS Molecular Weight (g/mol): 169.63 MDL Number: MFCD00004805 InChI Key: WGXCKFMVBAOIFH-UHFFFAOYSA-N Synonym: 3-chlorophenyl isothiocyanate,3-chlorophenylisothiocyanate,benzene, 1-chloro-3-isothiocyanato,isothiocyanic acid, 3-chlorophenyl ester,isothiocyanic acid, m-chlorophenyl ester,m-chlorophenyl isothiocyanate,1-chloro-3-isothiocyanato-benzene,3-chlorobenzenisothiocyanate,wln: scnr cg,acmc-1cfb8 PubChem CID: 75449 IUPAC Name: 1-chloro-3-isothiocyanatobenzene SMILES: ClC1=CC=CC(=C1)N=C=S
| PubChem CID | 75449 |
|---|---|
| CAS | 2392-68-9 |
| Molecular Weight (g/mol) | 169.63 |
| MDL Number | MFCD00004805 |
| SMILES | ClC1=CC=CC(=C1)N=C=S |
| Synonym | 3-chlorophenyl isothiocyanate,3-chlorophenylisothiocyanate,benzene, 1-chloro-3-isothiocyanato,isothiocyanic acid, 3-chlorophenyl ester,isothiocyanic acid, m-chlorophenyl ester,m-chlorophenyl isothiocyanate,1-chloro-3-isothiocyanato-benzene,3-chlorobenzenisothiocyanate,wln: scnr cg,acmc-1cfb8 |
| IUPAC Name | 1-chloro-3-isothiocyanatobenzene |
| InChI Key | WGXCKFMVBAOIFH-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNS |
Ether ChromAR, Macron Fine Chemicals™
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Avantor Ether USP, Macron Fine Chemicals™
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
4-Bromo-2,6-dimethylaniline, 98%, Thermo Scientific Chemicals
CAS: 24596-19-8 Molecular Formula: C8H10BrN Molecular Weight (g/mol): 200.08 MDL Number: MFCD00007826 InChI Key: QGLAYJCJLHNIGJ-UHFFFAOYSA-N Synonym: 4-bromo-2,6-xylidine,benzenamine, 4-bromo-2,6-dimethyl,4-bromo-2,6-dimethyl-phenylamine,2-amino-5-bromo-m-xylene,2,6-dimethyl-4-bromoaniline,4-bromo-2,6-dimethylbenzenamine,4-bromo-2,6-dimethylphenylamine,4-bromo-2,6-dimethyl-aniline,4-bromo-2,6-dimethylaniline,4-bromo-2,6-dimethyl-benzenamine PubChem CID: 90549 IUPAC Name: 4-bromo-2,6-dimethylaniline SMILES: CC1=CC(Br)=CC(C)=C1N
| PubChem CID | 90549 |
|---|---|
| CAS | 24596-19-8 |
| Molecular Weight (g/mol) | 200.08 |
| MDL Number | MFCD00007826 |
| SMILES | CC1=CC(Br)=CC(C)=C1N |
| Synonym | 4-bromo-2,6-xylidine,benzenamine, 4-bromo-2,6-dimethyl,4-bromo-2,6-dimethyl-phenylamine,2-amino-5-bromo-m-xylene,2,6-dimethyl-4-bromoaniline,4-bromo-2,6-dimethylbenzenamine,4-bromo-2,6-dimethylphenylamine,4-bromo-2,6-dimethyl-aniline,4-bromo-2,6-dimethylaniline,4-bromo-2,6-dimethyl-benzenamine |
| IUPAC Name | 4-bromo-2,6-dimethylaniline |
| InChI Key | QGLAYJCJLHNIGJ-UHFFFAOYSA-N |
| Molecular Formula | C8H10BrN |
4-Chloromandelic acid, 98%
CAS: 492-86-4 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.591 MDL Number: MFCD00042724 InChI Key: BWSFWXSSALIZAU-UHFFFAOYSA-N Synonym: 4-chloromandelic acid,2-4-chlorophenyl-2-hydroxyacetic acid,p-chloromandelic acid,p-chloro mandelic acid,4-chloro-dl-mandelic acid,4-chloromandelic acid, pract.,benzeneacetic acid, 4-chloro-.alpha.-hydroxy,dl-4-chloromandelic acid,mandelic acid, p-chloro,4-chlorophenyl hydroxy acetic acid PubChem CID: 10299 IUPAC Name: 2-(4-chlorophenyl)-2-hydroxyacetic acid SMILES: C1=CC(=CC=C1C(C(=O)O)O)Cl
| PubChem CID | 10299 |
|---|---|
| CAS | 492-86-4 |
| Molecular Weight (g/mol) | 186.591 |
| MDL Number | MFCD00042724 |
| SMILES | C1=CC(=CC=C1C(C(=O)O)O)Cl |
| Synonym | 4-chloromandelic acid,2-4-chlorophenyl-2-hydroxyacetic acid,p-chloromandelic acid,p-chloro mandelic acid,4-chloro-dl-mandelic acid,4-chloromandelic acid, pract.,benzeneacetic acid, 4-chloro-.alpha.-hydroxy,dl-4-chloromandelic acid,mandelic acid, p-chloro,4-chlorophenyl hydroxy acetic acid |
| IUPAC Name | 2-(4-chlorophenyl)-2-hydroxyacetic acid |
| InChI Key | BWSFWXSSALIZAU-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |
2-Chloro-5-fluoroaniline, 97%
CAS: 452-83-5 Molecular Formula: C6H5ClFN Molecular Weight (g/mol): 145.561 MDL Number: MFCD00084852 InChI Key: VWUFOZAFKYOZJB-UHFFFAOYSA-N Synonym: 5-fluoro-2-chloroaniline,2-chloro-5-fluorobenzenamine,2-chloro-5-fluoro-phenylamine,2-chloranyl-5-fluoranyl-aniline,pubchem1517,acmc-1bn9k,2-chloro-5-fluoro-aniline,2-chloro-5-fluorophenylamine,ksc235o7b,2-chloro-5-fluorobenzeneamine PubChem CID: 2736509 IUPAC Name: 2-chloro-5-fluoroaniline SMILES: C1=CC(=C(C=C1F)N)Cl
| PubChem CID | 2736509 |
|---|---|
| CAS | 452-83-5 |
| Molecular Weight (g/mol) | 145.561 |
| MDL Number | MFCD00084852 |
| SMILES | C1=CC(=C(C=C1F)N)Cl |
| Synonym | 5-fluoro-2-chloroaniline,2-chloro-5-fluorobenzenamine,2-chloro-5-fluoro-phenylamine,2-chloranyl-5-fluoranyl-aniline,pubchem1517,acmc-1bn9k,2-chloro-5-fluoro-aniline,2-chloro-5-fluorophenylamine,ksc235o7b,2-chloro-5-fluorobenzeneamine |
| IUPAC Name | 2-chloro-5-fluoroaniline |
| InChI Key | VWUFOZAFKYOZJB-UHFFFAOYSA-N |
| Molecular Formula | C6H5ClFN |
4-Amino-2-chlorobenzonitrile, 97+%
CAS: 20925-27-3 Molecular Formula: C7H5ClN2 Molecular Weight (g/mol): 152.58 MDL Number: MFCD00035926 InChI Key: ZFBKYGFPUCUYIF-UHFFFAOYSA-N Synonym: 3-chloro-4-cyanoaniline,2-chloro-4-aminobenzonitrile,benzonitrile, 4-amino-2-chloro,4-amino-2-chloro-benzonitrile,4-amino-2-chlorobenzenecarbonitrile,pubchem4620,4-cyano-3-chloroaniline,acmc-1cfb7,3-chloro-4-cyanobenzenamine,ksc497i5p PubChem CID: 88728 IUPAC Name: 4-amino-2-chlorobenzonitrile SMILES: NC1=CC=C(C#N)C(Cl)=C1
| PubChem CID | 88728 |
|---|---|
| CAS | 20925-27-3 |
| Molecular Weight (g/mol) | 152.58 |
| MDL Number | MFCD00035926 |
| SMILES | NC1=CC=C(C#N)C(Cl)=C1 |
| Synonym | 3-chloro-4-cyanoaniline,2-chloro-4-aminobenzonitrile,benzonitrile, 4-amino-2-chloro,4-amino-2-chloro-benzonitrile,4-amino-2-chlorobenzenecarbonitrile,pubchem4620,4-cyano-3-chloroaniline,acmc-1cfb7,3-chloro-4-cyanobenzenamine,ksc497i5p |
| IUPAC Name | 4-amino-2-chlorobenzonitrile |
| InChI Key | ZFBKYGFPUCUYIF-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClN2 |
Methyl sulfoxide, 99.5+%, for analysis, Thermo Scientific Chemicals
CAS: 67-68-5 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00002089 InChI Key: IAZDPXIOMUYVGZ-UHFFFAOYSA-N Synonym: dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide PubChem CID: 679 ChEBI: CHEBI:28262 IUPAC Name: methylsulfinylmethane SMILES: CS(C)=O
| PubChem CID | 679 |
|---|---|
| CAS | 67-68-5 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:28262 |
| MDL Number | MFCD00002089 |
| SMILES | CS(C)=O |
| Synonym | dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide |
| IUPAC Name | methylsulfinylmethane |
| InChI Key | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |