Acetylides
eMolecules 764-37-4 | (E)-Pent-3-en-1-ol | ChemScene | MFCD07636756 | 86.134 | C5H10O | 97.000 | C\C=C\CCO | 50mg | 894452652
(E)-Pent-3-en-1-ol | ChemScene | 764-37-4 | MFCD07636756 | 86.134 | C5H10O | 97.000 | C\C=C\CCO | 50mg | 894452652
Medchemexpress LLC Boc-Propargylamine | 92136-39-5 | 99.5% | C8H13NO2 | 25 G
Boc-Propargylamine is a biochemical reagent suitable for use as a biological material or organic compound in life science research. It functions as a click chemistry reagent, containing an Alkyne group that can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules possessing Azide groups.
- Used to prepare triazolobenzylidene-thiazolopyrimidines, which act as CDC25 phosphatase inhibitors.
- Used for the synthesis of beta-glucan polysaccharide analogs.
- Involved in the Pauson-Kh reaction of norbornadiene and N-Boc-propargylamine to prepare 4,5-dissubstituted cyclopentenones.
Medchemexpress LLC 4-Ethynylaniline | 14235-81-5 | 117.15 | 10 G
4-Ethynylaniline is a biochemical reagent used as a biological material or organic compound for life science-related research. It is a click chemistry reagent containing an Alkyne group, enabling it to undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. Click chemistry is characterized by selective, modular, wide-ranging, and high-yield chemical reactions that facilitate rapid synthesis of new compounds through heteroatom linking (C-X-C).
- Contains an alkyne group
- Undergoes copper-catalyzed azide-alkyne cycloaddition (CuAAc)
- Enables rapid synthesis of new compounds
- Used in bioorthogonal chemistry
- For research use only
eMolecules 870822-78-9 | 5-Chloro-2-(trifluoromethoxy)phenylboronic acid | Combi-Blocks | MFCD10697424 | 240.370 | C7H5BClF3O3 | 96.000 | OB(O)c1cc(Cl)ccc1OC(F)(F)F | 1g | 117529394
5-Chloro-2-(trifluoromethoxy)phenylboronic acid | Combi-Blocks | 870822-78-9 | MFCD10697424 | 240.370 | C7H5BClF3O3 | 96.000 | OB(O)c1cc(Cl)ccc1OC(F)(F)F | 1g | 117529394
eMolecules 886501-26-4 | 4-Fluoro-3-(trifluoromethoxy)phenol | Apollo Scientific | MFCD06660257 | 196.101 | C7H4F4O2 | 95.000 | Oc1ccc(F)c(OC(F)(F)F)c1 | 1g | 562453217
4-Fluoro-3-(trifluoromethoxy)phenol | Apollo Scientific | 886501-26-4 | MFCD06660257 | 196.101 | C7H4F4O2 | 95.000 | Oc1ccc(F)c(OC(F)(F)F)c1 | 1g | 562453217
eMolecules 1129-65-3 | 1-Phenyl-1-hexyne | Ambeed | MFCD00039969 | 158.244 | C12H14 | 98.000 | CCCCC#Cc1ccccc1 | 250mg | 517263003
1-Phenyl-1-hexyne | Ambeed | 1129-65-3 | MFCD00039969 | 158.244 | C12H14 | 98.000 | CCCCC#Cc1ccccc1 | 250mg | 517263003
eMolecules 1703955-84-3 | 5-Fluoro-2-(trifluoromethoxy)-DL-phenylalanine | Apollo Scientific267.180 | C10H9F4NO3 | 95.000 | NC(Cc1cc(F)ccc1OC(F)(F)F)C(O)=O | 1g | 562457991
5-Fluoro-2-(trifluoromethoxy)-DL-phenylalanine | Apollo Scientific | 1703955-84-3267.180 | C10H9F4NO3 | 95.000 | NC(Cc1cc(F)ccc1OC(F)(F)F)C(O)=O | 1g | 562457991
![Medchemexpress LLC Propanoic acid, 3-[2-[[2-(2-propyn-1-yloxy)ethyl]dithio]ethoxy]- | 1807503-85-0 | >95.0% | 264.36 g/mol | C10H16O4S2 | 100 MG](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000204167.png-250.jpg)
Medchemexpress LLC Propanoic acid, 3-[2-[[2-(2-propyn-1-yloxy)ethyl]dithio]ethoxy]- | 1807503-85-0 | >95.0% | 264.36 g/mol | C10H16O4S2 | 100 MG
Propargyl-PEG1-SS-PEG1-acid is a cleavable two-unit polyethylene glycol (PEG) linker containing a propargyl (alkyne) group and a disulfide bond, terminating in a carboxylic acid. It is intended for click-chemistry-enabled bioconjugation and as a reducible linker in antibody-drug conjugate synthesis.
- Cleavable disulfide linkage for reductive release.
- Alkyne handle compatible with copper-catalyzed azide-alkyne cycloaddition.
- Carboxylic acid terminus for amide coupling or further functionalization.
- Purity typically ≥95%.
- Available in multiple sizes, including 100 mg.
- Stable when stored under recommended temperatures.
Sigma Aldrich Fine Chemicals Biosciences (tert-Butyldimethylsilyl)acetylene 99% | 86318-61-8 | MFCD00191877 | 1G
(tert-Butyldimethylsilyl)acetylene 99% | Purity: 99% | Mol Wt: 140.3 | 86318-61-8 | MFCD00191877 | 1G
Medchemexpress LLC D(+)-Raffinose pentahydrate | 17629-30-0 | 594.51 | 5 G
D(+)-Raffinose pentahydrate is an orally active inhibitor of LecA (Kd = 32 μM) and GtfC. It functions by reducing cyclic diguanylate (c-di-GMP) through increased activity of a c-di-GMP specific phosphodiesterase and interferes with GTF function. This compound decreases IL-4 and IL-5 mRNA, exhibits biofilm-inhibitory activity against *Pseudomonas aeruginosa* and *Streptococcus mutans*, and inhibits allergic airway eosinophilia. It is intended for research use only and not for sale to patients.
- Orally active inhibitor of LecA and GtfC
- Reduces cyclic diguanylate (c-di-GMP)
- Interferes with GTF function
- Decreases IL-4 and IL-5 mRNA
- Exhibits biofilm-inhibitory activity against *Pseudomonas aeruginosa* and *Streptococcus mutans*
- Inhibits allergic airway eosinophilia
eMolecules 886763-11-7 | 2-Methyl-4-(trifluoromethoxy)phenylacetic acid | Apollo Scientific | MFCD07368720 | 234.174 | C10H9F3O3 | 98.000 | Cc1cc(OC(F)(F)F)ccc1CC(O)=O | 5g | 562425878
2-Methyl-4-(trifluoromethoxy)phenylacetic acid | Apollo Scientific | 886763-11-7 | MFCD07368720 | 234.174 | C10H9F3O3 | 98.000 | Cc1cc(OC(F)(F)F)ccc1CC(O)=O | 5g | 562425878
![eMolecules 886465-16-3 | 2-CHLORO-5-(TRIFLUOROMETHOXY)BENZIMIDAZOLE | AstaTech | MFCD11111667 | 236.580 | C8H4ClF3N2O | 95.000 | FC(F)(F)Oc1ccc2[nH]c(Cl)nc2c1 | 1g | 533784314](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502182441.JPG-250.jpg)
eMolecules 886465-16-3 | 2-CHLORO-5-(TRIFLUOROMETHOXY)BENZIMIDAZOLE | AstaTech | MFCD11111667 | 236.580 | C8H4ClF3N2O | 95.000 | FC(F)(F)Oc1ccc2[nH]c(Cl)nc2c1 | 1g | 533784314
2-CHLORO-5-(TRIFLUOROMETHOXY)BENZIMIDAZOLE | AstaTech | 886465-16-3 | MFCD11111667 | 236.580 | C8H4ClF3N2O | 95.000 | FC(F)(F)Oc1ccc2[nH]c(Cl)nc2c1 | 1g | 533784314