Halohydrins
eMolecules 1033203-46-1 | 2,5-Dibromo-4-fluoropyridine | Combi-Blocks, Inc. | MFCD11100660 | 254.884 | C5H2Br2FN | 96.000 | Fc1cc(Br)ncc1Br | 10g | 882681573
2,5-Dibromo-4-fluoropyridine | Combi-Blocks, Inc. | 1033203-46-1 | MFCD11100660 | 254.884 | C5H2Br2FN | 96.000 | Fc1cc(Br)ncc1Br | 10g | 882681573
eMolecules 627-18-9 | 3-Bromo-1-propanol | Accela ChemBio (ASD) | MFCD00002942 | 138.992 | C3H7BrO | 95.000 | OCCCBr | 5g | 444744177
3-Bromo-1-propanol | Accela ChemBio (ASD) | 627-18-9 | MFCD00002942 | 138.992 | C3H7BrO | 95.000 | OCCCBr | 5g | 444744177
![eMolecules 1394048-67-9 | Potassium trifluoro[(propan-2-yloxy)methyl]boranuide | Combi-Blocks | MFCD11505927 | 180.020 | C4H9BF3KO | 97.000 | [K+].CC(C)OC[B-](F)(F)F | 1g | 457915531](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502189616.JPG-250.jpg)
eMolecules 1394048-67-9 | Potassium trifluoro[(propan-2-yloxy)methyl]boranuide | Combi-Blocks | MFCD11505927 | 180.020 | C4H9BF3KO | 97.000 | [K+].CC(C)OC[B-](F)(F)F | 1g | 457915531
Potassium trifluoro[(propan-2-yloxy)methyl]boranuide | Combi-Blocks | 1394048-67-9 | MFCD11505927 | 180.020 | C4H9BF3KO | 97.000 | [K+].CC(C)OC[B-](F)(F)F | 1g | 457915531
Apexbio Technology LLC 2,2,2-Tribromoethanol 75-80-9 1g
2 2 2-Tribromoethanol is a small-molecule anesthetic agent that enhances gamma-aminobutyric acid (GABA) receptor activity thereby modulating central nervous system function It exerts its biological activity primarily through potentiation of GABAergic neurotransmission resulting in reversible sedation and anesthesia states Widely used in biomedical research 2 2 2-tribromoethanol facilitates controlled immobilization in rodent models during surgical procedures physiological measurements and behavioral analysis Based on these pharmacological properties 2 2 2-tribromoethanol serves as a valuable agent for experimental anesthesia and procedural support in laboratory rodent studies
eMolecules 627-18-9 | 3-Bromo-1-propanol | Oakwood Chemicals | MFCD00002942 | 138.992 | C3H7BrO | 90.000 | OCCCBr | 500g | 491485105
3-Bromo-1-propanol | Oakwood Chemicals | 627-18-9 | MFCD00002942 | 138.992 | C3H7BrO | 90.000 | OCCCBr | 500g | 491485105
Aobchem 1-Bromo-2 3 4 5-tetrafluoro-6-methoxybenzene | ≥97% | CAS 66684-51-3 | C7H3BrF4O | 250mg
1-Bromo-2 3 4 5-tetrafluoro-6-methoxybenzene | ≥97% | CAS 66684-51-3 | C7H3BrF4O | 250mg
eMolecules 58943-98-9 | Hexakis(2,2,3,3-tetrafluoropropoxy)phosphazene | Apollo Scientific | MFCD00798140 | 921.240 | C18H18F24N3O6P3 | 95.000 | FC(F)C(F)(F)COP1(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=N1 | 1g | 562428362
Hexakis(2,2,3,3-tetrafluoropropoxy)phosphazene | Apollo Scientific | 58943-98-9 | MFCD00798140 | 921.240 | C18H18F24N3O6P3 | 95.000 | FC(F)C(F)(F)COP1(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=NP(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)=N1 | 1g | 562428362
Aobchem 1-(2 3-Dimethylphenyl)-1-propanone | ≥95% | CAS 35028-14-9 | C11H14O | 1g
1-(2 3-Dimethylphenyl)-1-propanone | ≥95% | CAS 35028-14-9 | C11H14O | 1g
Aobchem 2-(2-Methylthiophen-3-yl)propan-2-ol | 95% | CAS 1597198-15-6 | C8H12OS | 500mg
2-(2-Methylthiophen-3-yl)propan-2-ol | 95% | CAS 1597198-15-6 | C8H12OS | 500mg
Aobchem 2 3 4 5 6-Pentafluoro- -phenylbenzenemethanol | ≥97% | CAS 1944-05-4 | C13H7F5O | 1g
2 3 4 5 6-Pentafluoro- -phenylbenzenemethanol | ≥97% | CAS 1944-05-4 | C13H7F5O | 1g
Aobchem 2 3 5 6-Tetrafluoro-4-methoxybenzoic acid | ≥97% | CAS 3153-01-3 | C8H4F4O3 | 1g
2 3 5 6-Tetrafluoro-4-methoxybenzoic acid | ≥97% | CAS 3153-01-3 | C8H4F4O3 | 1g
Apexbio Technology LLC Anti-F3-TF-CD142-Ab-Tisotumab
Anti-F3/Factor III/Tissue Factor/CD142 Antibody (Tisotumab) (CAS No 1418628-81-5) is utilized in the biomedical research field to study hemostasis and thrombosis mechanisms Originating from engineered antibodies it primarily targets tissue factor (TF) a key initiator in the coagulation cascade By binding to TF Tisotumab effectively interrupts the interaction with factor VIIa inhibiting downstream signaling pathways involved in blood coagulation and angiogenesis In vitro activity is often observed in the nanomolar to low micromolar range indicating its potent efficacy It is widely applied in various research models including cell-based assays and animal studies to explore tumor progression and metastatic processes as well as to evaluate potential therapeutic interventions in drug screening programs Experimental concentrations typically depend on the specific research design ensuring adaptability across diverse experimental setups
