Alkyl Halides
Filtered Search Results
1-(Bromomethyl)naphthalene, 98%, Thermo Scientific Chemicals
CAS: 3163-27-7 Molecular Formula: C11H9Br Molecular Weight (g/mol): 221.097 MDL Number: MFCD00010804 InChI Key: RZJGKPNCYQZFGR-UHFFFAOYSA-N Synonym: 1-bromomethyl naphthalene,1-bromomethyl-naphthalene,naphthalene, 1-bromomethyl,1-bromomethy naphthalene,naphtylmethylbromide,bromomethylnaphthalene,naphthylmethyl bromide,pubchem9389 PubChem CID: 137844 IUPAC Name: 1-(bromomethyl)naphthalene SMILES: C1=CC=C2C(=C1)C=CC=C2CBr
| PubChem CID | 137844 |
|---|---|
| CAS | 3163-27-7 |
| Molecular Weight (g/mol) | 221.097 |
| MDL Number | MFCD00010804 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CBr |
| Synonym | 1-bromomethyl naphthalene,1-bromomethyl-naphthalene,naphthalene, 1-bromomethyl,1-bromomethy naphthalene,naphtylmethylbromide,bromomethylnaphthalene,naphthylmethyl bromide,pubchem9389 |
| IUPAC Name | 1-(bromomethyl)naphthalene |
| InChI Key | RZJGKPNCYQZFGR-UHFFFAOYSA-N |
| Molecular Formula | C11H9Br |
Diiodomethane, 99+%, stabilized with silver wire
CAS: 75-11-6 Molecular Formula: CH2I2 Molecular Weight (g/mol): 267.84 MDL Number: MFCD00001079 InChI Key: NZZFYRREKKOMAT-UHFFFAOYSA-N Synonym: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC Name: diiodomethane SMILES: ICI
| PubChem CID | 6346 |
|---|---|
| CAS | 75-11-6 |
| Molecular Weight (g/mol) | 267.84 |
| MDL Number | MFCD00001079 |
| SMILES | ICI |
| Synonym | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
| IUPAC Name | diiodomethane |
| InChI Key | NZZFYRREKKOMAT-UHFFFAOYSA-N |
| Molecular Formula | CH2I2 |
Bromoform, 99+%, stabilized
CAS: 75-25-2 Molecular Formula: CHBr3 Molecular Weight (g/mol): 252.73 InChI Key: DIKBFYAXUHHXCS-UHFFFAOYSA-N Synonym: tribromomethane,methane, tribromo,tribrommethan,methenyl tribromide,methyl tribromide,tribrommethaan,tribromometan,bromoforme,bromoformio,rcra waste number u225 PubChem CID: 5558 ChEBI: CHEBI:38682 IUPAC Name: bromoform SMILES: C(Br)(Br)Br
| PubChem CID | 5558 |
|---|---|
| CAS | 75-25-2 |
| Molecular Weight (g/mol) | 252.73 |
| ChEBI | CHEBI:38682 |
| SMILES | C(Br)(Br)Br |
| Synonym | tribromomethane,methane, tribromo,tribrommethan,methenyl tribromide,methyl tribromide,tribrommethaan,tribromometan,bromoforme,bromoformio,rcra waste number u225 |
| IUPAC Name | bromoform |
| InChI Key | DIKBFYAXUHHXCS-UHFFFAOYSA-N |
| Molecular Formula | CHBr3 |
Dichloromethane-d{2}, 99.9% (Isotopic)
CAS: 1665-00-5 MDL Number: MFCD00000882 Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d
| CAS | 1665-00-5 |
|---|---|
| MDL Number | MFCD00000882 |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
Dibromomethane 99.0+%, TCI America™
CAS: 74-95-3 Molecular Formula: CH2Br2 Molecular Weight (g/mol): 173.835 MDL Number: MFCD00000168 InChI Key: FJBFPHVGVWTDIP-UHFFFAOYSA-N Synonym: methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 PubChem CID: 3024 ChEBI: CHEBI:47077 IUPAC Name: dibromomethane SMILES: C(Br)Br
| PubChem CID | 3024 |
|---|---|
| CAS | 74-95-3 |
| Molecular Weight (g/mol) | 173.835 |
| ChEBI | CHEBI:47077 |
| MDL Number | MFCD00000168 |
| SMILES | C(Br)Br |
| Synonym | methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 |
| IUPAC Name | dibromomethane |
| InChI Key | FJBFPHVGVWTDIP-UHFFFAOYSA-N |
| Molecular Formula | CH2Br2 |
Heptafluorobutyric Acid, 99.6%, MP Biomedicals™
CAS: 375-22-4 Molecular Formula: C4HF7O2 Molecular Weight (g/mol): 214.039 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Synonym: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| PubChem CID | 9777 |
|---|---|
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.039 |
| ChEBI | CHEBI:39426 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| Synonym | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Molecular Formula | C4HF7O2 |
1-Bromononane, 99%
CAS: 693-58-3 Molecular Formula: C9H19Br Molecular Weight (g/mol): 207.155 MDL Number: MFCD00000278 InChI Key: AYMUQTNXKPEMLM-UHFFFAOYSA-N Synonym: n-nonyl bromide,nonyl bromide,nonane, 1-bromo,1-nonyl bromide,1-n-nonyl bromide,n-nonyl-1-bromide,bromononane,nonylbromide,1-bromo-n-nonane,labotest-bb ltbb001163 PubChem CID: 12742 IUPAC Name: 1-bromononane SMILES: CCCCCCCCCBr
| PubChem CID | 12742 |
|---|---|
| CAS | 693-58-3 |
| Molecular Weight (g/mol) | 207.155 |
| MDL Number | MFCD00000278 |
| SMILES | CCCCCCCCCBr |
| Synonym | n-nonyl bromide,nonyl bromide,nonane, 1-bromo,1-nonyl bromide,1-n-nonyl bromide,n-nonyl-1-bromide,bromononane,nonylbromide,1-bromo-n-nonane,labotest-bb ltbb001163 |
| IUPAC Name | 1-bromononane |
| InChI Key | AYMUQTNXKPEMLM-UHFFFAOYSA-N |
| Molecular Formula | C9H19Br |
Heptafluorobutyric anhydride, 98%
CAS: 336-59-4 Molecular Formula: C8F14O3 Molecular Weight (g/mol): 410.06 MDL Number: MFCD00000432 InChI Key: UFFSXJKVKBQEHC-UHFFFAOYSA-N Synonym: heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization PubChem CID: 67643 ChEBI: CHEBI:39424 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate SMILES: FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 67643 |
|---|---|
| CAS | 336-59-4 |
| Molecular Weight (g/mol) | 410.06 |
| ChEBI | CHEBI:39424 |
| MDL Number | MFCD00000432 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChI Key | UFFSXJKVKBQEHC-UHFFFAOYSA-N |
| Molecular Formula | C8F14O3 |
Dibromomethane, 99%
CAS: 74-95-3 Molecular Formula: CH2Br2 Molecular Weight (g/mol): 173.83 MDL Number: MFCD00000168 InChI Key: FJBFPHVGVWTDIP-UHFFFAOYSA-N Synonym: methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 PubChem CID: 3024 ChEBI: CHEBI:47077 IUPAC Name: dibromomethane SMILES: C(Br)Br
| PubChem CID | 3024 |
|---|---|
| CAS | 74-95-3 |
| Molecular Weight (g/mol) | 173.83 |
| ChEBI | CHEBI:47077 |
| MDL Number | MFCD00000168 |
| SMILES | C(Br)Br |
| Synonym | methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 |
| IUPAC Name | dibromomethane |
| InChI Key | FJBFPHVGVWTDIP-UHFFFAOYSA-N |
| Molecular Formula | CH2Br2 |
Perfluorodecanoic acid, 97%
CAS: 335-76-2 Molecular Formula: C10HF19O2 Molecular Weight (g/mol): 514.09 MDL Number: MFCD00004175 InChI Key: PCIUEQPBYFRTEM-UHFFFAOYSA-N Synonym: perfluorodecanoic acid,nonadecafluorodecanoic acid,ndfda,pfda,perfluoro-n-decanoic acid,nonadecafluoro-n-decanoic acid,decanoic acid, nonadecafluoro,ccris 4417,decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro,perfluorocapric acid PubChem CID: 9555 ChEBI: CHEBI:35546 IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid SMILES: OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 9555 |
|---|---|
| CAS | 335-76-2 |
| Molecular Weight (g/mol) | 514.09 |
| ChEBI | CHEBI:35546 |
| MDL Number | MFCD00004175 |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | perfluorodecanoic acid,nonadecafluorodecanoic acid,ndfda,pfda,perfluoro-n-decanoic acid,nonadecafluoro-n-decanoic acid,decanoic acid, nonadecafluoro,ccris 4417,decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro,perfluorocapric acid |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid |
| InChI Key | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| Molecular Formula | C10HF19O2 |
1,1,2,2-Tetrabromoethane, 97%
CAS: 79-27-6 Molecular Formula: C2H2Br4 Molecular Weight (g/mol): 345.65 MDL Number: MFCD00000133 InChI Key: QXSZNDIIPUOQMB-UHFFFAOYSA-N Synonym: acetylene tetrabromide,muthmann's liquid,ethane, 1,1,2,2-tetrabromo,tetrabromoacetylene,sym-tetrabromoethane,s-tetrabromoethane,1,1,2,2-tetrabromaethan,1,1,2,2-tetrabromoetano,tbe,unii-v00gkc584o PubChem CID: 6588 IUPAC Name: 1,1,2,2-tetrabromoethane SMILES: BrC(Br)C(Br)Br
| PubChem CID | 6588 |
|---|---|
| CAS | 79-27-6 |
| Molecular Weight (g/mol) | 345.65 |
| MDL Number | MFCD00000133 |
| SMILES | BrC(Br)C(Br)Br |
| Synonym | acetylene tetrabromide,muthmann's liquid,ethane, 1,1,2,2-tetrabromo,tetrabromoacetylene,sym-tetrabromoethane,s-tetrabromoethane,1,1,2,2-tetrabromaethan,1,1,2,2-tetrabromoetano,tbe,unii-v00gkc584o |
| IUPAC Name | 1,1,2,2-tetrabromoethane |
| InChI Key | QXSZNDIIPUOQMB-UHFFFAOYSA-N |
| Molecular Formula | C2H2Br4 |
1-Bromo-3-methyl-2-butene (stabilized with Silver chip) 90.0+%, TCI America™
CAS: 870-63-3 Molecular Formula: C5H9Br Molecular Weight (g/mol): 149.031 MDL Number: MFCD00000242 InChI Key: LOYZVRIHVZEDMW-UHFFFAOYSA-N Synonym: 1-bromo-3-methyl-2-butene,3,3-dimethylallyl bromide,prenyl bromide,3-methyl-2-butenyl bromide,2-butene, 1-bromo-3-methyl,dimethylallyl bromide,1-bromo-3-methyl-but-2-ene,.gamma.,.gamma.-dimethylallyl bromide,3-methylcrotyl bromide,3,3-dimethylallylbromide PubChem CID: 70092 IUPAC Name: 1-bromo-3-methylbut-2-ene SMILES: CC(=CCBr)C
| PubChem CID | 70092 |
|---|---|
| CAS | 870-63-3 |
| Molecular Weight (g/mol) | 149.031 |
| MDL Number | MFCD00000242 |
| SMILES | CC(=CCBr)C |
| Synonym | 1-bromo-3-methyl-2-butene,3,3-dimethylallyl bromide,prenyl bromide,3-methyl-2-butenyl bromide,2-butene, 1-bromo-3-methyl,dimethylallyl bromide,1-bromo-3-methyl-but-2-ene,.gamma.,.gamma.-dimethylallyl bromide,3-methylcrotyl bromide,3,3-dimethylallylbromide |
| IUPAC Name | 1-bromo-3-methylbut-2-ene |
| InChI Key | LOYZVRIHVZEDMW-UHFFFAOYSA-N |
| Molecular Formula | C5H9Br |
(Perfluorocyclohexyl)methyl acrylate, 96%, stab. with 50ppm to 100ppm 4-methoxyphenol
CAS: 40677-94-9 Molecular Formula: C10H5F11O2 Molecular Weight (g/mol): 366.13 MDL Number: MFCD00080614 InChI Key: OZGWOALFBHODRB-UHFFFAOYSA-N Synonym: perfluorocyclohexylmethyl acrylate,perfluorocyclohexyl methyl acrylate,undecafluorocyclohexyl methyl prop-2-enoate,1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl methyl prop-2-enoate,acrylic acid 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexylmethyl ester,1,2,2,3,3,4,4,5,5,6,6-undecakis fluoranyl cyclohexyl methyl prop-2-enoate,2-propenoic acid 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl methyl ester PubChem CID: 2776049 IUPAC Name: (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl prop-2-enoate SMILES: C=CC(=O)OCC1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F
| PubChem CID | 2776049 |
|---|---|
| CAS | 40677-94-9 |
| Molecular Weight (g/mol) | 366.13 |
| MDL Number | MFCD00080614 |
| SMILES | C=CC(=O)OCC1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F |
| Synonym | perfluorocyclohexylmethyl acrylate,perfluorocyclohexyl methyl acrylate,undecafluorocyclohexyl methyl prop-2-enoate,1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl methyl prop-2-enoate,acrylic acid 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexylmethyl ester,1,2,2,3,3,4,4,5,5,6,6-undecakis fluoranyl cyclohexyl methyl prop-2-enoate,2-propenoic acid 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl methyl ester |
| IUPAC Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl prop-2-enoate |
| InChI Key | OZGWOALFBHODRB-UHFFFAOYSA-N |
| Molecular Formula | C10H5F11O2 |
Chloroiodomethane, 98%, stab. with copper
CAS: 593-71-5 Molecular Formula: CH2ClI MDL Number: MFCD00001078 InChI Key: PJGJQVRXEUVAFT-UHFFFAOYSA-N Synonym: chloro iodo methane,methane, chloroiodo,methylene chloroiodide,chloro-iodomethane,chloro-iodo-methane,iodochloromethane,chlor iod methan,chloroiodo-methane,chloromethyl iodide,qmablxaih@ PubChem CID: 11644 IUPAC Name: chloro(iodo)methane
| PubChem CID | 11644 |
|---|---|
| CAS | 593-71-5 |
| MDL Number | MFCD00001078 |
| Synonym | chloro iodo methane,methane, chloroiodo,methylene chloroiodide,chloro-iodomethane,chloro-iodo-methane,iodochloromethane,chlor iod methan,chloroiodo-methane,chloromethyl iodide,qmablxaih@ |
| IUPAC Name | chloro(iodo)methane |
| InChI Key | PJGJQVRXEUVAFT-UHFFFAOYSA-N |
| Molecular Formula | CH2ClI |
5-Bromo-2-methyl-2-pentene, 97%
CAS: 2270-59-9 Molecular Formula: C6H11Br Molecular Weight (g/mol): 163.06 MDL Number: MFCD00009887 InChI Key: UNXURIHDFUQNOC-UHFFFAOYSA-N Synonym: 5-bromo-2-methyl-2-pentene,acmc-20ah0m,1-bromo4-methyl-3-pentene,5-brom-2-methyl-2-pentene,1-bromo-4-methyl-3-pentene,2-methyl-5-bromo-2-pentene,2-pentene,5-bromo-2-methyl,5-bromo-2-methyl-pent-2-ene PubChem CID: 137521 IUPAC Name: 5-bromo-2-methylpent-2-ene SMILES: CC(C)=CCCBr
| PubChem CID | 137521 |
|---|---|
| CAS | 2270-59-9 |
| Molecular Weight (g/mol) | 163.06 |
| MDL Number | MFCD00009887 |
| SMILES | CC(C)=CCCBr |
| Synonym | 5-bromo-2-methyl-2-pentene,acmc-20ah0m,1-bromo4-methyl-3-pentene,5-brom-2-methyl-2-pentene,1-bromo-4-methyl-3-pentene,2-methyl-5-bromo-2-pentene,2-pentene,5-bromo-2-methyl,5-bromo-2-methyl-pent-2-ene |
| IUPAC Name | 5-bromo-2-methylpent-2-ene |
| InChI Key | UNXURIHDFUQNOC-UHFFFAOYSA-N |
| Molecular Formula | C6H11Br |