Organic acids and derivatives
Filtered Search Results
Thermo Scientific Chemicals Urea, 99.5%, for analysis
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Thermo Scientific Chemicals N,N-Dimethylacetamide, 99%
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Thermo Scientific Chemicals Dibutylboron trifluoromethanesulfonate, 1M sol. in dichloromethane
CAS: 60669-69-4 | C9H18BF3O3S | 274.11 g/mol
| Linear Formula | CF3SO3B[(CH2)3CH3]2 |
|---|---|
| Molecular Weight (g/mol) | 274.11 |
| Color | Orange to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Dibutylboron trifluoromethanesulfonate |
| SMILES | CCCCB(CCCC)OS(=O)(=O)C(F)(F)F |
| InChI Key | FAVAVMFXAKZTMV-UHFFFAOYSA-N |
| Density | 1.2710g/mL |
| Assay Percent Range | 98% |
| PubChem CID | 2724243 |
| Fieser | 07,91; 09,140; 16,109 |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse |
| MDL Number | MFCD00009669 |
| Health Hazard 2 | GHS H Statement Flammable liquid and vapour. Suspected of causing cancer. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. |
| Solubility Information | Solubility in water: reacts. |
| Packaging | Glass Bottle |
| Flash Point | 27°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | dibutylboron trifluoromethanesulfonate,dibutylboryl trifluoromethanesulfonate solution,nbu2botf,bu2botf,dibutylboron triflate,n-bu 2botf,dibutylboryl trifluoromethanesulfonate,dibutylboron triflate solution,trifluoromethylsulfonyloxy dibutylborane,dibutyl trifluoromethyl sulfonyl oxy borane |
| IUPAC Name | dibutylboranyl trifluoromethanesulfonate |
| Molecular Formula | C9H18BF3O3S |
| Formula Weight | 274.11 |
| Specific Gravity | 1.271 |
Thermo Scientific Chemicals O-(7-Aza-1H-benzotriazol-1-yl)-N,N,N',N'-tetramethyluronium hexafluorophosphate, 99%
CAS: 148893-10-1 Molecular Formula: C10H15F6N6OP Molecular Weight (g/mol): 380.24 MDL Number: MFCD00274639 InChI Key: JNWBBCNCSMBKNE-UHFFFAOYSA-N Synonym: hatu,2-7-aza-1h-benzotriazole-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,o-7-azabenzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,o-7-azabenzotriazol-1-yl-n,n,n,n-tetramethyl uronium hexafluorophosphate,2-3h-1,2,3 triazolo 4,5-b pyridin-3-yl-1,1,3,3-tetramethyluronium hexafluorophosphate v,dimethylamino triazolo 4,5-b pyridin-3-yloxy methylene-dimethyl-ammonium hexafluorophosphate,2-7-aza-1h-benzotriazole-1-yl-1,1,3,3-tetramethyl uronium hexafluorophosphate,2-3h-1,2,3 triazolo 4,5-b pyridin-3-yl-1,1,3,3-tetramethylisouronium hexafluorophosphate v,n-dimethylamino 3h-1,2,3 triazolo 4,5-b pyridin-3-yloxy methylene-n-methylmethanaminium hexafluorophosphate,n-dimethylamino-1h-1,2,3-triazolo-4,5-b pyridin-1-ylmethylene-n-methylmethanaminium hexafluorophosphate n-oxide PubChem CID: 9886157 IUPAC Name: [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium;hexafluorophosphate SMILES: F[P-](F)(F)(F)(F)F.CN(C)C(ON1N=NC2=CC=CN=C12)=[N+](C)C
| PubChem CID | 9886157 |
|---|---|
| CAS | 148893-10-1 |
| Molecular Weight (g/mol) | 380.24 |
| MDL Number | MFCD00274639 |
| SMILES | F[P-](F)(F)(F)(F)F.CN(C)C(ON1N=NC2=CC=CN=C12)=[N+](C)C |
| Synonym | hatu,2-7-aza-1h-benzotriazole-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,o-7-azabenzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,o-7-azabenzotriazol-1-yl-n,n,n,n-tetramethyl uronium hexafluorophosphate,2-3h-1,2,3 triazolo 4,5-b pyridin-3-yl-1,1,3,3-tetramethyluronium hexafluorophosphate v,dimethylamino triazolo 4,5-b pyridin-3-yloxy methylene-dimethyl-ammonium hexafluorophosphate,2-7-aza-1h-benzotriazole-1-yl-1,1,3,3-tetramethyl uronium hexafluorophosphate,2-3h-1,2,3 triazolo 4,5-b pyridin-3-yl-1,1,3,3-tetramethylisouronium hexafluorophosphate v,n-dimethylamino 3h-1,2,3 triazolo 4,5-b pyridin-3-yloxy methylene-n-methylmethanaminium hexafluorophosphate,n-dimethylamino-1h-1,2,3-triazolo-4,5-b pyridin-1-ylmethylene-n-methylmethanaminium hexafluorophosphate n-oxide |
| IUPAC Name | [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium;hexafluorophosphate |
| InChI Key | JNWBBCNCSMBKNE-UHFFFAOYSA-N |
| Molecular Formula | C10H15F6N6OP |
Thermo Scientific Chemicals 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one, 97%
CAS: 5381-99-7 Molecular Formula: C7H4ClO3P Molecular Weight (g/mol): 202.53 MDL Number: MFCD00013353 InChI Key: BVOITXUNGDUXRW-UHFFFAOYNA-N Synonym: 2-chloro-4h-1,3,2-benzodioxaphosphorin-4-one,2-chloro-4h-benzo d 1,3,2 dioxaphosphinin-4-one,van boom's reagent,2-chloro-4h-1,2,3-benzodioxaphosphorin-4-one,4h-1,3,2-benzodioxaphosphorin-4-one, 2-chloro,salicylchlorophosphite,salicyl chlorophosphite,acmc-1an3b,2-chloro-4h-1,3,2-benzodioxaphosphinin-4-one,salicylchlorophosphite; van boom's reagent PubChem CID: 237010 IUPAC Name: 2-chloro-1,3,2-benzodioxaphosphinin-4-one SMILES: ClP1OC(=O)C2=CC=CC=C2O1
| PubChem CID | 237010 |
|---|---|
| CAS | 5381-99-7 |
| Molecular Weight (g/mol) | 202.53 |
| MDL Number | MFCD00013353 |
| SMILES | ClP1OC(=O)C2=CC=CC=C2O1 |
| Synonym | 2-chloro-4h-1,3,2-benzodioxaphosphorin-4-one,2-chloro-4h-benzo d 1,3,2 dioxaphosphinin-4-one,van boom's reagent,2-chloro-4h-1,2,3-benzodioxaphosphorin-4-one,4h-1,3,2-benzodioxaphosphorin-4-one, 2-chloro,salicylchlorophosphite,salicyl chlorophosphite,acmc-1an3b,2-chloro-4h-1,3,2-benzodioxaphosphinin-4-one,salicylchlorophosphite; van boom's reagent |
| IUPAC Name | 2-chloro-1,3,2-benzodioxaphosphinin-4-one |
| InChI Key | BVOITXUNGDUXRW-UHFFFAOYNA-N |
| Molecular Formula | C7H4ClO3P |
Thermo Scientific Chemicals (-)-Epigallocatechin gallate, 95%
CAS: 989-51-5 Molecular Formula: C22H18O11 Molecular Weight (g/mol): 458.37 InChI Key: WMBWREPUVVBILR-WIYYLYMNSA-N Synonym: =--epigallocatechin gallate,egcg,epigallocatechin gallate,epigallocatechin 3-gallate,tea catechin,epigallocatechin-3-gallate,=--epigallocatechin-3-o-gallate,teavigo,=--epigallocatechol gallate,epigallocatechin-3-monogallate PubChem CID: 65064 ChEBI: CHEBI:4806 IUPAC Name: [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate SMILES: C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O
| PubChem CID | 65064 |
|---|---|
| CAS | 989-51-5 |
| Molecular Weight (g/mol) | 458.37 |
| ChEBI | CHEBI:4806 |
| SMILES | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| Synonym | =--epigallocatechin gallate,egcg,epigallocatechin gallate,epigallocatechin 3-gallate,tea catechin,epigallocatechin-3-gallate,=--epigallocatechin-3-o-gallate,teavigo,=--epigallocatechol gallate,epigallocatechin-3-monogallate |
| IUPAC Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| InChI Key | WMBWREPUVVBILR-WIYYLYMNSA-N |
| Molecular Formula | C22H18O11 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate, 99.5%, for molecular biology, DNAse, RNAse and Protease free
CAS: 13235-36-4 Molecular Formula: C10H20N2Na4O12 Molecular Weight (g/mol): 452.23 MDL Number: MFCD00150027 InChI Key: XFLNVMPCPRLYBE-UHFFFAOYSA-J Synonym: tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 PubChem CID: 23287279 IUPAC Name: tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrahydrate SMILES: O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 23287279 |
|---|---|
| CAS | 13235-36-4 |
| Molecular Weight (g/mol) | 452.23 |
| MDL Number | MFCD00150027 |
| SMILES | O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 |
| IUPAC Name | tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrahydrate |
| InChI Key | XFLNVMPCPRLYBE-UHFFFAOYSA-J |
| Molecular Formula | C10H20N2Na4O12 |
Thermo Scientific Chemicals trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic Acid Monohydrate, 98%
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
Thioglycolic Acid 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 68-11-1 Molecular Formula: C2H4O2S Molecular Weight (g/mol): 92.112 MDL Number: MFCD00004876 InChI Key: CWERGRDVMFNCDR-UHFFFAOYSA-N Synonym: mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio PubChem CID: 1133 ChEBI: CHEBI:30065 IUPAC Name: 2-sulfanylacetic acid SMILES: C(C(=O)O)S
| PubChem CID | 1133 |
|---|---|
| CAS | 68-11-1 |
| Molecular Weight (g/mol) | 92.112 |
| ChEBI | CHEBI:30065 |
| MDL Number | MFCD00004876 |
| SMILES | C(C(=O)O)S |
| Synonym | mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio |
| IUPAC Name | 2-sulfanylacetic acid |
| InChI Key | CWERGRDVMFNCDR-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2S |
Thermo Scientific Chemicals Dimethyl carbonate, 99+%, Extra Dry, AcroSeal™
CAS: 616-38-6 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.08 MDL Number: MFCD00008420 InChI Key: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC Name: dimethyl carbonate SMILES: COC(=O)OC
| PubChem CID | 12021 |
|---|---|
| CAS | 616-38-6 |
| Molecular Weight (g/mol) | 90.08 |
| ChEBI | CHEBI:36596 |
| MDL Number | MFCD00008420 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| IUPAC Name | dimethyl carbonate |
| InChI Key | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
Thermo Scientific Chemicals Phenylboronic acid, 98+%, may contain varying amounts of anhydride
CAS: 98-80-6 Molecular Formula: C6H7BO2 Molecular Weight (g/mol): 121.93 MDL Number: MFCD00002103 InChI Key: HXITXNWTGFUOAU-UHFFFAOYSA-N Synonym: benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 PubChem CID: 66827 ChEBI: CHEBI:44923 IUPAC Name: phenylboronic acid SMILES: OB(O)C1=CC=CC=C1
| PubChem CID | 66827 |
|---|---|
| CAS | 98-80-6 |
| Molecular Weight (g/mol) | 121.93 |
| ChEBI | CHEBI:44923 |
| MDL Number | MFCD00002103 |
| SMILES | OB(O)C1=CC=CC=C1 |
| Synonym | benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 |
| IUPAC Name | phenylboronic acid |
| InChI Key | HXITXNWTGFUOAU-UHFFFAOYSA-N |
| Molecular Formula | C6H7BO2 |
Thermo Scientific Chemicals tert-Butyldimethylsilyl trifluoromethanesulfonate, 98%
CAS: 69739-34-0 Molecular Formula: C7H15F3O3SSi Molecular Weight (g/mol): 264.33 MDL Number: MFCD00000405 InChI Key: WLLIXJBWWFGEHT-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate PubChem CID: 123564 IUPAC Name: [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate SMILES: CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F
| PubChem CID | 123564 |
|---|---|
| CAS | 69739-34-0 |
| Molecular Weight (g/mol) | 264.33 |
| MDL Number | MFCD00000405 |
| SMILES | CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| Synonym | tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate |
| IUPAC Name | [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate |
| InChI Key | WLLIXJBWWFGEHT-UHFFFAOYSA-N |
| Molecular Formula | C7H15F3O3SSi |
Thermo Scientific Chemicals Bis(2-ethylhexyl) phosphate, 95%
CAS: 298-07-7 Molecular Formula: C16H35O4P Molecular Weight (g/mol): 322.43 MDL Number: MFCD00009492 InChI Key: SEGLCEQVOFDUPX-UHFFFAOYNA-N Synonym: bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid PubChem CID: 9275 IUPAC Name: bis(2-ethylhexyl) hydrogen phosphate SMILES: CCCCC(CC)COP(O)(=O)OCC(CC)CCCC
| PubChem CID | 9275 |
|---|---|
| CAS | 298-07-7 |
| Molecular Weight (g/mol) | 322.43 |
| MDL Number | MFCD00009492 |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate |
| InChI Key | SEGLCEQVOFDUPX-UHFFFAOYNA-N |
| Molecular Formula | C16H35O4P |
Thermo Scientific Chemicals Triethyl citrate, 99%
CAS: 77-93-0 Molecular Formula: C12H20O7 Molecular Weight (g/mol): 276.285 MDL Number: MFCD00009201 InChI Key: DOOTYTYQINUNNV-UHFFFAOYSA-N Synonym: triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester PubChem CID: 6506 IUPAC Name: triethyl 2-hydroxypropane-1,2,3-tricarboxylate SMILES: CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O
| PubChem CID | 6506 |
|---|---|
| CAS | 77-93-0 |
| Molecular Weight (g/mol) | 276.285 |
| MDL Number | MFCD00009201 |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| Synonym | triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester |
| IUPAC Name | triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Molecular Formula | C12H20O7 |
Thermo Scientific MES Monohydrate, ≥98.5% (Dry Basis), Ultrapure
CAS: 145224-94-8 Molecular Formula: C6H15NO5S Molecular Weight (g/mol): 213.248 MDL Number: MFCD00149409 InChI Key: MIIIXQJBDGSIKL-UHFFFAOYSA-N Synonym: mes monohydrate,2-morpholinoethanesulfonic acid hydrate,mes hydrate,mes buffer hydrate,4-morpholineethanesulfonic acid monohydrate,4-morpholineethanesulfonic acid, monohydrate,2-4-morpholinyl ethanesulfonic acid hydrate,mes hydrate buffer,4-morpholineethanesulfonicacid, hydrate 1:1,mesmonohydrate PubChem CID: 16218417 IUPAC Name: 2-morpholin-4-ylethanesulfonic acid;hydrate SMILES: C1COCCN1CCS(=O)(=O)O.O
| PubChem CID | 16218417 |
|---|---|
| CAS | 145224-94-8 |
| Molecular Weight (g/mol) | 213.248 |
| MDL Number | MFCD00149409 |
| SMILES | C1COCCN1CCS(=O)(=O)O.O |
| Synonym | mes monohydrate,2-morpholinoethanesulfonic acid hydrate,mes hydrate,mes buffer hydrate,4-morpholineethanesulfonic acid monohydrate,4-morpholineethanesulfonic acid, monohydrate,2-4-morpholinyl ethanesulfonic acid hydrate,mes hydrate buffer,4-morpholineethanesulfonicacid, hydrate 1:1,mesmonohydrate |
| IUPAC Name | 2-morpholin-4-ylethanesulfonic acid;hydrate |
| InChI Key | MIIIXQJBDGSIKL-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO5S |