Organic acids and derivatives
Filtered Search Results
5-Bromooxindole, 98%
CAS: 20870-78-4 Molecular Formula: C8H6BrNO Molecular Weight (g/mol): 212.046 MDL Number: MFCD00456998 InChI Key: VIMNAEVMZXIKFL-UHFFFAOYSA-N Synonym: 5-bromooxindole,5-bromoindolin-2-one,5-bromo-2-oxindole,5-bromo-1,3-dihydro-2h-indol-2-one,5-bromo-2,3-dihydro-1h-indol-2-one,5-bromo-2-indolinone,5-bromo-1,3-dihydro-indol-2-one,2h-indol-2-one, 5-bromo-1,3-dihydro,5-bromo-2-oxindol,1,3-dihydro-5-bromoindol-2-one PubChem CID: 611193 IUPAC Name: 5-bromo-1,3-dihydroindol-2-one SMILES: C1C2=C(C=CC(=C2)Br)NC1=O
| PubChem CID | 611193 |
|---|---|
| CAS | 20870-78-4 |
| Molecular Weight (g/mol) | 212.046 |
| MDL Number | MFCD00456998 |
| SMILES | C1C2=C(C=CC(=C2)Br)NC1=O |
| Synonym | 5-bromooxindole,5-bromoindolin-2-one,5-bromo-2-oxindole,5-bromo-1,3-dihydro-2h-indol-2-one,5-bromo-2,3-dihydro-1h-indol-2-one,5-bromo-2-indolinone,5-bromo-1,3-dihydro-indol-2-one,2h-indol-2-one, 5-bromo-1,3-dihydro,5-bromo-2-oxindol,1,3-dihydro-5-bromoindol-2-one |
| IUPAC Name | 5-bromo-1,3-dihydroindol-2-one |
| InChI Key | VIMNAEVMZXIKFL-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrNO |
Mercury(II) trifluoromethanesulfonate, 98%
CAS: 49540-00-3 Molecular Formula: C2F6HgO6S2 Molecular Weight (g/mol): 498.718 MDL Number: MFCD00144746 InChI Key: BPVYMDMPLCOQPJ-UHFFFAOYSA-L Synonym: mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis PubChem CID: 2775250 IUPAC Name: mercury(2+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2]
| PubChem CID | 2775250 |
|---|---|
| CAS | 49540-00-3 |
| Molecular Weight (g/mol) | 498.718 |
| MDL Number | MFCD00144746 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2] |
| Synonym | mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis |
| IUPAC Name | mercury(2+);trifluoromethanesulfonate |
| InChI Key | BPVYMDMPLCOQPJ-UHFFFAOYSA-L |
| Molecular Formula | C2F6HgO6S2 |
Spectrum Chemical Manufacturing Corporation 1-Octanesulfonic Acid Sodium Salt, Monohydrate, Reagent HPLC, 99%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 207596-29-0 Molecular Formula: C8H19NaO4S Molecular Weight (g/mol): 234.29 MDL Number: MFCD00149551 InChI Key: MBURIAHQXJQKRE-UHFFFAOYSA-M IUPAC Name: sodium hydrate octane-1-sulfonate SMILES: O.[Na+].CCCCCCCCS([O-])(=O)=O
| CAS | 207596-29-0 |
|---|---|
| Molecular Weight (g/mol) | 234.29 |
| MDL Number | MFCD00149551 |
| SMILES | O.[Na+].CCCCCCCCS([O-])(=O)=O |
| IUPAC Name | sodium hydrate octane-1-sulfonate |
| InChI Key | MBURIAHQXJQKRE-UHFFFAOYSA-M |
| Molecular Formula | C8H19NaO4S |
Naproxen Sodium, USP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 26159-34-2 Molecular Formula: C14H13NaO3 Molecular Weight (g/mol): 252.25 MDL Number: MFCD00058507 InChI Key: CDBRNDSHEYLDJV-FVGYRXGTSA-M IUPAC Name: sodium (2S)-2-(6-methoxynaphthalen-2-yl)propanoate SMILES: [Na+].COC1=CC=C2C=C(C=CC2=C1)[C@H](C)C([O-])=O
| CAS | 26159-34-2 |
|---|---|
| Molecular Weight (g/mol) | 252.25 |
| MDL Number | MFCD00058507 |
| SMILES | [Na+].COC1=CC=C2C=C(C=CC2=C1)[C@H](C)C([O-])=O |
| IUPAC Name | sodium (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| InChI Key | CDBRNDSHEYLDJV-FVGYRXGTSA-M |
| Molecular Formula | C14H13NaO3 |
6-chlorooxindole, 98%, Thermo Scientific™
CAS: 56341-37-8 Molecular Formula: C8H6ClNO Molecular Weight (g/mol): 167.59 MDL Number: MFCD00209962 InChI Key: CENVPIZOTHULGJ-UHFFFAOYSA-N Synonym: 6-chlorooxindole,6-chloroindolin-2-one,6-chloro-2-oxindole,6-chloro-2-indolinone,6-chloro-1,3-dihydro-2h-indol-2-one,6-chloro 2-oxindole,2h-indol-2-one, 6-chloro-1,3-dihydro,6-chloro-1,3-dihydro-indol-2-one,6-chloroindole-2 3h-one,6-chloro-2,3-dihydro-1h-indol-2-one PubChem CID: 736344 IUPAC Name: 6-chloro-1,3-dihydroindol-2-one SMILES: C1C2=C(C=C(C=C2)Cl)NC1=O
| PubChem CID | 736344 |
|---|---|
| CAS | 56341-37-8 |
| Molecular Weight (g/mol) | 167.59 |
| MDL Number | MFCD00209962 |
| SMILES | C1C2=C(C=C(C=C2)Cl)NC1=O |
| Synonym | 6-chlorooxindole,6-chloroindolin-2-one,6-chloro-2-oxindole,6-chloro-2-indolinone,6-chloro-1,3-dihydro-2h-indol-2-one,6-chloro 2-oxindole,2h-indol-2-one, 6-chloro-1,3-dihydro,6-chloro-1,3-dihydro-indol-2-one,6-chloroindole-2 3h-one,6-chloro-2,3-dihydro-1h-indol-2-one |
| IUPAC Name | 6-chloro-1,3-dihydroindol-2-one |
| InChI Key | CENVPIZOTHULGJ-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClNO |
Methylsulfuric acid potassium salt, 97%
CAS: 562-54-9 Molecular Formula: CH3KO4S Molecular Weight (g/mol): 150.19 MDL Number: MFCD00040472 InChI Key: WBGWGHYJIFOATF-UHFFFAOYSA-M Synonym: potassium methyl sulfate,methyl potassium sulfate,methylsulfuric acid potassium salt,unii-9b0jf05o1c,sulfuric acid, monomethyl ester, potassium salt,potassium methyl sulphate,potassium monomethylsulfate,sulfuric acid, monomethyl ester, potassium salt 1:1,75-93-4 parent,potassium methylsulfate PubChem CID: 2733094 IUPAC Name: potassium;methyl sulfate SMILES: [K+].COS([O-])(=O)=O
| PubChem CID | 2733094 |
|---|---|
| CAS | 562-54-9 |
| Molecular Weight (g/mol) | 150.19 |
| MDL Number | MFCD00040472 |
| SMILES | [K+].COS([O-])(=O)=O |
| Synonym | potassium methyl sulfate,methyl potassium sulfate,methylsulfuric acid potassium salt,unii-9b0jf05o1c,sulfuric acid, monomethyl ester, potassium salt,potassium methyl sulphate,potassium monomethylsulfate,sulfuric acid, monomethyl ester, potassium salt 1:1,75-93-4 parent,potassium methylsulfate |
| IUPAC Name | potassium;methyl sulfate |
| InChI Key | WBGWGHYJIFOATF-UHFFFAOYSA-M |
| Molecular Formula | CH3KO4S |
Methyl 3-methylphenylacetate, 98%
CAS: 53088-69-0 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD00968468 InChI Key: AWTKFTNNPQGGLX-UHFFFAOYSA-N Synonym: methyl 2-m-tolyl acetate,methyl 3-methylphenylacetate,methyl 2-3-methylphenyl acetate,3-methylphenylacetic acid methyl ester,benzeneacetic acid, 3-methyl-, methyl ester,methyl 2-m-tolylacetate,m-tolylacetic acid methyl ester,m-toly-acetic acid methyl ester,m-tolyl-acetic acid methyl ester,methyl 2-3-methylphenyl ethanoate PubChem CID: 5135288 IUPAC Name: methyl 2-(3-methylphenyl)acetate SMILES: COC(=O)CC1=CC=CC(C)=C1
| PubChem CID | 5135288 |
|---|---|
| CAS | 53088-69-0 |
| Molecular Weight (g/mol) | 164.20 |
| MDL Number | MFCD00968468 |
| SMILES | COC(=O)CC1=CC=CC(C)=C1 |
| Synonym | methyl 2-m-tolyl acetate,methyl 3-methylphenylacetate,methyl 2-3-methylphenyl acetate,3-methylphenylacetic acid methyl ester,benzeneacetic acid, 3-methyl-, methyl ester,methyl 2-m-tolylacetate,m-tolylacetic acid methyl ester,m-toly-acetic acid methyl ester,m-tolyl-acetic acid methyl ester,methyl 2-3-methylphenyl ethanoate |
| IUPAC Name | methyl 2-(3-methylphenyl)acetate |
| InChI Key | AWTKFTNNPQGGLX-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
1,1-Dimethylurea, 98+%
CAS: 598-94-7 Molecular Formula: C3H8N2O Molecular Weight (g/mol): 88.11 MDL Number: MFCD00007959 InChI Key: YBBLOADPFWKNGS-UHFFFAOYSA-N Synonym: n,n-dimethylurea,urea, n,n-dimethyl,asym-dimethylurea,urea, dimethyl,urea, 1,1-dimethyl,n,n-dimethylharnstoff german,n,n-dimethylharnstoff,dimethyl urea,1.1-dimethylurea,1,1-dimethyl-urea PubChem CID: 11737 IUPAC Name: 1,1-dimethylurea SMILES: CN(C)C(=O)N
| PubChem CID | 11737 |
|---|---|
| CAS | 598-94-7 |
| Molecular Weight (g/mol) | 88.11 |
| MDL Number | MFCD00007959 |
| SMILES | CN(C)C(=O)N |
| Synonym | n,n-dimethylurea,urea, n,n-dimethyl,asym-dimethylurea,urea, dimethyl,urea, 1,1-dimethyl,n,n-dimethylharnstoff german,n,n-dimethylharnstoff,dimethyl urea,1.1-dimethylurea,1,1-dimethyl-urea |
| IUPAC Name | 1,1-dimethylurea |
| InChI Key | YBBLOADPFWKNGS-UHFFFAOYSA-N |
| Molecular Formula | C3H8N2O |
2,2,2-Trifluoroacetamide, 97%
CAS: 354-38-1 Molecular Formula: C2H2F3NO Molecular Weight (g/mol): 113.04 MDL Number: MFCD00008008 InChI Key: NRKYWOKHZRQRJR-UHFFFAOYSA-N Synonym: trifluoroacetamide,acetamide, 2,2,2-trifluoro,unii-36mu16byfk,n-trifluoroacetamide,2,2,2-trifluoro-acetamide,36mu16byfk,trifluroacetamide,trifluoro-acetamide,snylgqhjptadtaetp@,pubchem12622 PubChem CID: 67717 IUPAC Name: 2,2,2-trifluoroacetamide SMILES: NC(=O)C(F)(F)F
| PubChem CID | 67717 |
|---|---|
| CAS | 354-38-1 |
| Molecular Weight (g/mol) | 113.04 |
| MDL Number | MFCD00008008 |
| SMILES | NC(=O)C(F)(F)F |
| Synonym | trifluoroacetamide,acetamide, 2,2,2-trifluoro,unii-36mu16byfk,n-trifluoroacetamide,2,2,2-trifluoro-acetamide,36mu16byfk,trifluroacetamide,trifluoro-acetamide,snylgqhjptadtaetp@,pubchem12622 |
| IUPAC Name | 2,2,2-trifluoroacetamide |
| InChI Key | NRKYWOKHZRQRJR-UHFFFAOYSA-N |
| Molecular Formula | C2H2F3NO |
Benzenesulfonic acid, sodium salt, 98%
CAS: 515-42-4 Molecular Formula: C6H5NaO3S Molecular Weight (g/mol): 180.16 MDL Number: MFCD00065179 InChI Key: MZSDGDXXBZSFTG-UHFFFAOYSA-M Synonym: sodium benzenesulfonate,benzenesulfonic acid sodium salt,benzenesulfonic acid, sodium salt,dispersant gn,sodium phenylsulfonate,sodium benzenesulphonate,sodium benzene sulfonate,sodium benzene monosulfate,unii-k5rm14azhx,sodium benzene monosulfonate PubChem CID: 517327 IUPAC Name: sodium;benzenesulfonate SMILES: C1=CC=C(C=C1)S(=O)(=O)[O-].[Na+]
| PubChem CID | 517327 |
|---|---|
| CAS | 515-42-4 |
| Molecular Weight (g/mol) | 180.16 |
| MDL Number | MFCD00065179 |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] |
| Synonym | sodium benzenesulfonate,benzenesulfonic acid sodium salt,benzenesulfonic acid, sodium salt,dispersant gn,sodium phenylsulfonate,sodium benzenesulphonate,sodium benzene sulfonate,sodium benzene monosulfate,unii-k5rm14azhx,sodium benzene monosulfonate |
| IUPAC Name | sodium;benzenesulfonate |
| InChI Key | MZSDGDXXBZSFTG-UHFFFAOYSA-M |
| Molecular Formula | C6H5NaO3S |
N-Phenylbenzohydroxamic acid, 98%
CAS: 304-88-1 Molecular Formula: C13H11NO2 Molecular Weight (g/mol): 213.24 MDL Number: MFCD00002111 InChI Key: YLYIXDZITBMCIW-UHFFFAOYSA-N Synonym: n-benzoyl-n-phenylhydroxylamine,n-phenylbenzohydroxamic acid,n-hydroxybenzanilide,benzamide, n-hydroxy-n-phenyl,n-benzoyl-n-phenylhydroxamic acid,n-benzoylphenylhydroxylamine,benzohydroxamic acid, n-phenyl,tantalon,acmc-1cqm9,n-phenylbenzohydroxamicacid PubChem CID: 67536 IUPAC Name: N-hydroxy-N-phenylbenzamide SMILES: ON(C(=O)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 67536 |
|---|---|
| CAS | 304-88-1 |
| Molecular Weight (g/mol) | 213.24 |
| MDL Number | MFCD00002111 |
| SMILES | ON(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | n-benzoyl-n-phenylhydroxylamine,n-phenylbenzohydroxamic acid,n-hydroxybenzanilide,benzamide, n-hydroxy-n-phenyl,n-benzoyl-n-phenylhydroxamic acid,n-benzoylphenylhydroxylamine,benzohydroxamic acid, n-phenyl,tantalon,acmc-1cqm9,n-phenylbenzohydroxamicacid |
| IUPAC Name | N-hydroxy-N-phenylbenzamide |
| InChI Key | YLYIXDZITBMCIW-UHFFFAOYSA-N |
| Molecular Formula | C13H11NO2 |
4-Nitrophenyl trifluoromethanesulfonate, 99%, Thermo Scientific™
CAS: 17763-80-3 Molecular Formula: C7H4F3NO5S Molecular Weight (g/mol): 271.17 MDL Number: MFCD00192354 InChI Key: NDTIXHNCNLKURN-UHFFFAOYSA-N Synonym: trifluoromethanesulfonic acid 4-nitrophenyl ester,4-nitrophenyltriflate,4-nitrophenyl triflate,acmc-20amc8,4-nitrophenyl trifluoromethyl sulfonate,4-nitrophenyl trifluoromethanesulfonate,1-trifluoromethylsulfonyloxy-4-nitrobenzene,4-trifluoromethylsulfonyloxy-1-nitrobenzene PubChem CID: 549870 IUPAC Name: (4-nitrophenyl) trifluoromethanesulfonate SMILES: [O-][N+](=O)C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1
| PubChem CID | 549870 |
|---|---|
| CAS | 17763-80-3 |
| Molecular Weight (g/mol) | 271.17 |
| MDL Number | MFCD00192354 |
| SMILES | [O-][N+](=O)C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1 |
| Synonym | trifluoromethanesulfonic acid 4-nitrophenyl ester,4-nitrophenyltriflate,4-nitrophenyl triflate,acmc-20amc8,4-nitrophenyl trifluoromethyl sulfonate,4-nitrophenyl trifluoromethanesulfonate,1-trifluoromethylsulfonyloxy-4-nitrobenzene,4-trifluoromethylsulfonyloxy-1-nitrobenzene |
| IUPAC Name | (4-nitrophenyl) trifluoromethanesulfonate |
| InChI Key | NDTIXHNCNLKURN-UHFFFAOYSA-N |
| Molecular Formula | C7H4F3NO5S |
Methyl glycolate, 98%
CAS: 96-35-5 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.08 InChI Key: GSJFXBNYJCXDGI-UHFFFAOYSA-N Synonym: methyl glycolate,methyl hydroxyacetate,acetic acid, hydroxy-, methyl ester,glycolic acid, methyl ester,acetic acid, 2-hydroxy-, methyl ester,glycolic acid methyl ester,unii-7g7r729ej0,hydroxyacetic acid methyl ester,glycolic acid methyl,methyl2-hydroxyethanoate PubChem CID: 66774 IUPAC Name: methyl 2-hydroxyacetate SMILES: COC(=O)CO
| PubChem CID | 66774 |
|---|---|
| CAS | 96-35-5 |
| Molecular Weight (g/mol) | 90.08 |
| SMILES | COC(=O)CO |
| Synonym | methyl glycolate,methyl hydroxyacetate,acetic acid, hydroxy-, methyl ester,glycolic acid, methyl ester,acetic acid, 2-hydroxy-, methyl ester,glycolic acid methyl ester,unii-7g7r729ej0,hydroxyacetic acid methyl ester,glycolic acid methyl,methyl2-hydroxyethanoate |
| IUPAC Name | methyl 2-hydroxyacetate |
| InChI Key | GSJFXBNYJCXDGI-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
Ethylenebis(oxyethylenenitrilo)tetraacetic acid, 98%
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.34 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.34 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
3-Cyano-5-fluorophenylboronic acid, 97%, Thermo Scientific™
CAS: 304858-67-1 Molecular Formula: C7H5BFNO2 Molecular Weight (g/mol): 164.93 MDL Number: MFCD09263608 InChI Key: DLYWCECHXBOCAS-UHFFFAOYSA-N Synonym: 3-cyano-5-fluorophenyl boronic acid,3-cyano-5-fluorobenzeneboronic acid,3-borono-5-fluorobenzonitrile,boronic acid, 3-cyano-5-fluorophenyl-9ci,boronic acid, 3-cyano-5-fluorophenyl,pubchem17351,acmc-1csdr,ksc495g6d,3-cyano-5-fluorophenylboronicacid PubChem CID: 23435605 IUPAC Name: (3-cyano-5-fluorophenyl)boronic acid SMILES: OB(O)C1=CC(=CC(F)=C1)C#N
| PubChem CID | 23435605 |
|---|---|
| CAS | 304858-67-1 |
| Molecular Weight (g/mol) | 164.93 |
| MDL Number | MFCD09263608 |
| SMILES | OB(O)C1=CC(=CC(F)=C1)C#N |
| Synonym | 3-cyano-5-fluorophenyl boronic acid,3-cyano-5-fluorobenzeneboronic acid,3-borono-5-fluorobenzonitrile,boronic acid, 3-cyano-5-fluorophenyl-9ci,boronic acid, 3-cyano-5-fluorophenyl,pubchem17351,acmc-1csdr,ksc495g6d,3-cyano-5-fluorophenylboronicacid |
| IUPAC Name | (3-cyano-5-fluorophenyl)boronic acid |
| InChI Key | DLYWCECHXBOCAS-UHFFFAOYSA-N |
| Molecular Formula | C7H5BFNO2 |