Organonitrogen Compounds
eMolecules 2198-45-0 | 5-AMINONONANE | AstaTech | MFCD00047923 | 143.274 | C9H21N | 95.000 | CCCCC(N)CCCC | 1g | 561151569
5-AMINONONANE | AstaTech | 2198-45-0 | MFCD00047923 | 143.274 | C9H21N | 95.000 | CCCCC(N)CCCC | 1g | 561151569
eMolecules 13952-84-6 | sec-Butylamine | Oakwood Chemicals | MFCD00008094 | 73.139 | C4H11N | 99.000 | CCC(C)N | 25g | 480144841
sec-Butylamine | Oakwood Chemicals | 13952-84-6 | MFCD00008094 | 73.139 | C4H11N | 99.000 | CCC(C)N | 25g | 480144841
Apexbio Technology LLC ACTB-1003 939805-30-8 50mg
ACTB-1003 (CAS 939805-30-8) also known as EOC317 is an orally bioavailable small-molecule kinase inhibitor that selectively targets fibroblast growth factor receptor 1 (FGFR1) vascular endothelial growth factor receptor 2 (VEGFR2) and the endothelial-specific tyrosine kinase Tie-2 In vitro studies demonstrate that ACTB-1003 suppresses the activity of these kinases at nanomolar concentrations By modulating these angiogenesis-associated signaling pathways ACTB-1003 serves as a valuable tool for investigating tumor angiogenesis and related signal transduction mechanisms in biomedical research
eMolecules 111-68-2 | 1-Aminoheptane | Combi-Blocks | MFCD00008244 | 115.220 | C7H17N | 98.000 | CCCCCCCN | 5g | 335344717
1-Aminoheptane | Combi-Blocks | 111-68-2 | MFCD00008244 | 115.220 | C7H17N | 98.000 | CCCCCCCN | 5g | 335344717
eMolecules 142356-33-0 | N-Boc-6-bromo-hexylamine | Combi-Blocks | MFCD06201019 | 280.206 | C11H22BrNO2 | 97.000 | CC(C)(C)OC(=O)NCCCCCCBr | 1g | 267168733
N-Boc-6-bromo-hexylamine | Combi-Blocks | 142356-33-0 | MFCD06201019 | 280.206 | C11H22BrNO2 | 97.000 | CC(C)(C)OC(=O)NCCCCCCBr | 1g | 267168733
Medchemexpress LLC 6-azido-1-hexanamine | 349553-73-7 | MFCD07369845 | 98.7% | 142.20 g/mol | C6H14N4 | 500 MG
6-azido-1-hexanamine is an azide-functionalized hexylamine reagent used as a cleavable linker in antibody-drug conjugate (ADC) synthesis and for click chemistry conjugation. It provides an azide handle for azide-alkyne cycloaddition reactions and is supplied as a colorless to light yellow liquid.
- CAS number 349553-73-7
- Molecular formula C6H14N4
- Molecular weight 142.20 g/mol
- Purity 98.7%
- Pack size 500 mg
- Storage 4°C, protect from light; in solvent: -80°C (6 months), -20°C (1 month)
- Applications ADC linker synthesis and click chemistry conjugation
eMolecules Dibenzyl 2-aminopentanedioate hydrochloride | MFCD29037723 | 250mg
Ambeed | Dibenzyl 2-aminopentanedioate hydrochloride | 250mg | 600829995 | A1360271 | | MFCD29037723 | 363.840 | C19H22ClNO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 115269-99-3 | N,N-Bis-Boc-N-allylamine | Oakwood Chemical | MFCD04115302 | 257.330 | C13H23NO4 | 97.000 | CC(C)(C)OC(=O)N(CC=C)C(=O)OC(C)(C)C | 1g | 537690562
N,N-Bis-Boc-N-allylamine | Oakwood Chemical | 115269-99-3 | MFCD04115302 | 257.330 | C13H23NO4 | 97.000 | CC(C)(C)OC(=O)N(CC=C)C(=O)OC(C)(C)C | 1g | 537690562
eMolecules 75-64-9 | tert-Butylamine | Oakwood Chemicals | MFCD00008050 | 73.139 | C4H11N | 99.000 | CC(C)(C)N | 100g | 480155607
tert-Butylamine | Oakwood Chemicals | 75-64-9 | MFCD00008050 | 73.139 | C4H11N | 99.000 | CC(C)(C)N | 100g | 480155607
eMolecules 765-30-0 | Cyclopropylamine | Combi-Blocks | MFCD00001301 | 57.096 | C3H7N | 98.000 | NC1CC1 | 25g | 290698613
Cyclopropylamine | Combi-Blocks | 765-30-0 | MFCD00001301 | 57.096 | C3H7N | 98.000 | NC1CC1 | 25g | 290698613
eMolecules 57260-73-8 | N-Boc-Ethylenediamine | AA Blocks LLC | MFCD00191871 | 160.217 | C7H16N2O2 | 0.000 | CC(C)(C)OC(=O)NCCN | 100g | 410167694
N-Boc-Ethylenediamine | AA Blocks LLC | 57260-73-8 | MFCD00191871 | 160.217 | C7H16N2O2 | 0.000 | CC(C)(C)OC(=O)NCCN | 100g | 410167694
eMolecules 343269-59-0 | N-(2-Bromophenyl)cyanamide | Apollo Scientific | MFCD16767981 | 197.035 | C7H5BrN2 | 95.000 | Brc1ccccc1NC#N | 1g | 562462043
N-(2-Bromophenyl)cyanamide | Apollo Scientific | 343269-59-0 | MFCD16767981 | 197.035 | C7H5BrN2 | 95.000 | Brc1ccccc1NC#N | 1g | 562462043
eMolecules 765-30-0 | Cyclopropylamine | Oakwood Chemical | MFCD00001301 | 57.096 | C3H7N | 98.000 | NC1CC1 | 2kg | 850217327
Cyclopropylamine | Oakwood Chemical | 765-30-0 | MFCD00001301 | 57.096 | C3H7N | 98.000 | NC1CC1 | 2kg | 850217327
Strem, An Ascensus Company CAS# 107-15-3. 1kg. Ethylenediamine, 99%. MFCD00008204
CAS# 107-15-3. 1kg. Ethylenediamine, 99%. MFCD00008204. Molecular Weight: 60.10. Molecular Formula: NH2CH2CH2NH2. Color/form: colorless to pale yellow liq. Strem# 07-0570. http://www.strem.com/catalog/v/07-0570/
