Organooxygen compounds
eMolecules 1256359-03-1 | 2-Benzyloxypyridine-4-boronic acid, pinacol ester | Combi-Blocks | MFCD11878170 | 311.190 | C18H22BNO3 | 98.000 | CC1(C)OB(OC1(C)C)c1ccnc(OCc2ccccc2)c1 | 1g | 117529932
2-Benzyloxypyridine-4-boronic acid, pinacol ester | Combi-Blocks | 1256359-03-1 | MFCD11878170 | 311.190 | C18H22BNO3 | 98.000 | CC1(C)OB(OC1(C)C)c1ccnc(OCc2ccccc2)c1 | 1g | 117529932
Apexbio Technology LLC Nabumetone 42924-53-8 5g
Nabumetone (CAS 42924-53-8) is a non-steroidal anti-inflammatory compound that undergoes hepatic metabolism to yield its active form 6-methoxy-2-naphthylacetic acid (6-MNA) The active metabolite selectively inhibits cyclooxygenase (COX) particularly COX-2 resulting in reduced synthesis of prostaglandins involved in inflammation and pain signaling Nabumetone is commonly utilized in research to study prostaglandin-mediated inflammatory pathways COX enzyme function and the pharmacological modulation of inflammatory responses in preclinical models
Strem, An Ascensus Company CAS# 14187-32-7. 10g. Dibenzo-18-crown-6, min. 98%. MFCD00005098
CAS# 14187-32-7. 10g. Dibenzo-18-crown-6, min. 98%. MFCD00005098. Molecular Weight: 360.41. Molecular Formula: C20H24O6. Color/form: white pwdr. Strem# 08-0500. http://www.strem.com/catalog/v/08-0500/
eMolecules 251660-96-5 | (2-METHOXY-1,1-DIMETHYLETHYL)AMINE HCL | AstaTech | MFCD16036163 | 139.620 | C5H14ClNO | 97.000 | Cl.COCC(C)(C)N | 5g | 410711913
(2-METHOXY-1,1-DIMETHYLETHYL)AMINE HCL | AstaTech | 251660-96-5 | MFCD16036163 | 139.620 | C5H14ClNO | 97.000 | Cl.COCC(C)(C)N | 5g | 410711913
eMolecules 957060-88-7 | 3-Chloro-2-methoxypyridine-4-boronic acid | Combi-Blocks | MFCD06798255 | 187.390 | C6H7BClNO3 | 97.000 | COc1nccc(B(O)O)c1Cl | 1g | 117523097
3-Chloro-2-methoxypyridine-4-boronic acid | Combi-Blocks | 957060-88-7 | MFCD06798255 | 187.390 | C6H7BClNO3 | 97.000 | COc1nccc(B(O)O)c1Cl | 1g | 117523097
eMolecules 6639-82-3 | 6-METHOXYQUINOXALINE | AstaTech | MFCD00666601 | 160.176 | C9H8N2O | 95.000 | COc1ccc2nccnc2c1 | 1g | 206683701
6-METHOXYQUINOXALINE | AstaTech | 6639-82-3 | MFCD00666601 | 160.176 | C9H8N2O | 95.000 | COc1ccc2nccnc2c1 | 1g | 206683701
Chem-Impex International, Inc. 2-Methoxy-5-pyridine boronic acid | 163105-89-3 | MFCD02093044 | 1G
2-Methoxy-5-pyridine boronic acid, 163105-89-3, MFCD02093044, 1G
eMolecules 52449-77-1 | Ambeed | 3-Hydroxy-2-naphthonitrile | 250mg | 600848935 | A847790 | MFCD17012306 | 169.183 | C11H7NO
Ambeed | 3-Hydroxy-2-naphthonitrile | 250mg | 600848935 | A847790 | 52449-77-1 | MFCD17012306 | 169.183 | C11H7NO
Accela Chembio Inc 4-methoxypyridine | 25g | 620-08-6 | MFCD00674049 | 97+% | D: 1.075 | Shelf Life: 900 Days | Light Sensitive
4-methoxypyridine | 25g | 620-08-6 | MFCD00674049 | 97+% | D: 1.075 | Shelf Life: 900 Days | Light Sensitive
Chemscene ChemScene | 2,7-Dimethoxynaphthalene | 100G | CS-M0858 | 0.98 | 3469-26-9| MFCD00004064 | 188.23
ChemScene | 2,7-Dimethoxynaphthalene | 100G | CS-M0858 | 0.98 | 3469-26-9| MFCD00004064 | 188.23
eMolecules 98276-69-8 | 6-Methoxypyridine-2-carboxamide | MFCD08062921 | 25g
Combi-Blocks | 6-Methoxypyridine-2-carboxamide | 25g | 457919428 | PY-7067 | 98.000 | 98276-69-8 | MFCD08062921 | 152.153 | C7H8N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Chemscene ChemScene | 7-Bromo-2-methoxyquinoxaline | 250MG | CS-0150012 | 0.98 | 212327-10-1| MFCD03067025 | 239.072
ChemScene | 7-Bromo-2-methoxyquinoxaline | 250MG | CS-0150012 | 0.98 | 212327-10-1| MFCD03067025 | 239.072
Chemscene ChemScene | 2-(Methylsulfonyl)imidazole | 250MG | CS-0130450 | 0.97 | 27098-98-2| MFCD01721366 | 146.17
ChemScene | 2-(Methylsulfonyl)imidazole | 250MG | CS-0130450 | 0.97 | 27098-98-2| MFCD01721366 | 146.17
Chemscene ChemScene | 2-Methoxythiophene | 100G | CS-W001141 | 0.98 | 16839-97-7| MFCD00014526 | 114.17
ChemScene | 2-Methoxythiophene | 100G | CS-W001141 | 0.98 | 16839-97-7| MFCD00014526 | 114.17
