Organosulfur Compounds
Filtered Search Results
Thermo Scientific Chemicals p-Phenylene diisothiocyanate, 99%
CAS: 4044-65-9 Molecular Formula: C8H4N2S2 Molecular Weight (g/mol): 192.27 MDL Number: MFCD00004811 InChI Key: OMWQUXGVXQELIX-UHFFFAOYSA-N Synonym: bitoscanate,1,4-phenylene diisothiocyanate,jonit,p-phenylene diisothiocyanate,benzene, 1,4-diisothiocyanato,bitoscanat,bitoscanate inn,phenylene thiocyanate,bitoscanatum latin,1,4-phenylenediisothiocyanate PubChem CID: 19958 IUPAC Name: 1,4-diisothiocyanatobenzene SMILES: C1=CC(=CC=C1N=C=S)N=C=S
| PubChem CID | 19958 |
|---|---|
| CAS | 4044-65-9 |
| Molecular Weight (g/mol) | 192.27 |
| MDL Number | MFCD00004811 |
| SMILES | C1=CC(=CC=C1N=C=S)N=C=S |
| Synonym | bitoscanate,1,4-phenylene diisothiocyanate,jonit,p-phenylene diisothiocyanate,benzene, 1,4-diisothiocyanato,bitoscanat,bitoscanate inn,phenylene thiocyanate,bitoscanatum latin,1,4-phenylenediisothiocyanate |
| IUPAC Name | 1,4-diisothiocyanatobenzene |
| InChI Key | OMWQUXGVXQELIX-UHFFFAOYSA-N |
| Molecular Formula | C8H4N2S2 |
Thermo Scientific Chemicals Methyl phenyl sulfoxide, 98+%
CAS: 1193-82-4 Molecular Formula: C7H8OS Molecular Weight (g/mol): 140.21 MDL Number: MFCD00002088 InChI Key: JXTGICXCHWMCPM-UHFFFAOYSA-N Synonym: methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene PubChem CID: 14516 IUPAC Name: methylsulfinylbenzene SMILES: CS(=O)C1=CC=CC=C1
| PubChem CID | 14516 |
|---|---|
| CAS | 1193-82-4 |
| Molecular Weight (g/mol) | 140.21 |
| MDL Number | MFCD00002088 |
| SMILES | CS(=O)C1=CC=CC=C1 |
| Synonym | methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene |
| IUPAC Name | methylsulfinylbenzene |
| InChI Key | JXTGICXCHWMCPM-UHFFFAOYSA-N |
| Molecular Formula | C7H8OS |
Thermo Scientific Chemicals Phenyl sulfoxide, 97%
CAS: 945-51-7 Molecular Formula: C12H10OS Molecular Weight (g/mol): 202.27 MDL Number: MFCD00002085 InChI Key: JJHHIJFTHRNPIK-UHFFFAOYSA-N Synonym: diphenyl sulfoxide,phenyl sulfoxide,sulfinyldibenzene,phenylsulfinylbenzene,diphenyl sulphoxide,sulfoxide, diphenyl,diphenylsulfoxide,benzene, 1,1'-sulfinylbis,1,1'-sulfinyldibenzene,phenylsulfinyl benzene PubChem CID: 13679 IUPAC Name: benzenesulfinylbenzene SMILES: C1=CC=C(C=C1)S(=O)C2=CC=CC=C2
| PubChem CID | 13679 |
|---|---|
| CAS | 945-51-7 |
| Molecular Weight (g/mol) | 202.27 |
| MDL Number | MFCD00002085 |
| SMILES | C1=CC=C(C=C1)S(=O)C2=CC=CC=C2 |
| Synonym | diphenyl sulfoxide,phenyl sulfoxide,sulfinyldibenzene,phenylsulfinylbenzene,diphenyl sulphoxide,sulfoxide, diphenyl,diphenylsulfoxide,benzene, 1,1'-sulfinylbis,1,1'-sulfinyldibenzene,phenylsulfinyl benzene |
| IUPAC Name | benzenesulfinylbenzene |
| InChI Key | JJHHIJFTHRNPIK-UHFFFAOYSA-N |
| Molecular Formula | C12H10OS |
Thermo Scientific Chemicals n-Butyl disulfide, 97%
CAS: 629-45-8 Molecular Formula: C8H18S2 Molecular Weight (g/mol): 178.35 MDL Number: MFCD00009467 InChI Key: CUDSBWGCGSUXDB-UHFFFAOYSA-N Synonym: dibutyl disulfide,butyl disulfide,disulfide, dibutyl,n-butyl disulfide,di-n-butyl disulfide,dibutyl disulphide,5,6-dithiadecane,1-butyldisulfanyl butane,unii-z77ef35c0q,1-butyldisulfanyl-butane PubChem CID: 12386 IUPAC Name: 1-(butyldisulfanyl)butane SMILES: CCCCSSCCCC
| PubChem CID | 12386 |
|---|---|
| CAS | 629-45-8 |
| Molecular Weight (g/mol) | 178.35 |
| MDL Number | MFCD00009467 |
| SMILES | CCCCSSCCCC |
| Synonym | dibutyl disulfide,butyl disulfide,disulfide, dibutyl,n-butyl disulfide,di-n-butyl disulfide,dibutyl disulphide,5,6-dithiadecane,1-butyldisulfanyl butane,unii-z77ef35c0q,1-butyldisulfanyl-butane |
| IUPAC Name | 1-(butyldisulfanyl)butane |
| InChI Key | CUDSBWGCGSUXDB-UHFFFAOYSA-N |
| Molecular Formula | C8H18S2 |
Thermo Scientific Chemicals Thiazolidine, 98%
CAS: 504-78-9 Molecular Formula: C3H8NS Molecular Weight (g/mol): 90.16 MDL Number: MFCD00005211 InChI Key: OGYGFUAIIOPWQD-UHFFFAOYSA-O Synonym: thiazolidine,tetrahydrothiazole,1-thia-3-azacyclopentane,thiazole, tetrahydro,unii-i320806bkw,ccris 4275,acmc-1ao0m,4-27-00-00009 beilstein handbook reference PubChem CID: 10444 ChEBI: CHEBI:50120 SMILES: C1CSC[NH2+]1
| PubChem CID | 10444 |
|---|---|
| CAS | 504-78-9 |
| Molecular Weight (g/mol) | 90.16 |
| ChEBI | CHEBI:50120 |
| MDL Number | MFCD00005211 |
| SMILES | C1CSC[NH2+]1 |
| Synonym | thiazolidine,tetrahydrothiazole,1-thia-3-azacyclopentane,thiazole, tetrahydro,unii-i320806bkw,ccris 4275,acmc-1ao0m,4-27-00-00009 beilstein handbook reference |
| InChI Key | OGYGFUAIIOPWQD-UHFFFAOYSA-O |
| Molecular Formula | C3H8NS |
Thermo Scientific Chemicals 2-Cyanothioacetamide, 97%
CAS: 7357-70-2 Molecular Formula: C3H4N2S Molecular Weight (g/mol): 100.14 MDL Number: MFCD00010025 InChI Key: BHPYMZQTCPRLNR-UHFFFAOYSA-N Synonym: 2-cyanothioacetamide,cyanothioacetamide,ethanethioamide, 2-cyano,cyano thioacetamide,2-cyano-thioacetamide,3-amino-3-thioxopropanenitrile,cyanthioacetamide,cyanoacetothioamide,2-cyanothioactamide,alpha-cyanothioacetamide PubChem CID: 1416277 IUPAC Name: 2-cyanoethanethioamide SMILES: NC(=S)CC#N
| PubChem CID | 1416277 |
|---|---|
| CAS | 7357-70-2 |
| Molecular Weight (g/mol) | 100.14 |
| MDL Number | MFCD00010025 |
| SMILES | NC(=S)CC#N |
| Synonym | 2-cyanothioacetamide,cyanothioacetamide,ethanethioamide, 2-cyano,cyano thioacetamide,2-cyano-thioacetamide,3-amino-3-thioxopropanenitrile,cyanthioacetamide,cyanoacetothioamide,2-cyanothioactamide,alpha-cyanothioacetamide |
| IUPAC Name | 2-cyanoethanethioamide |
| InChI Key | BHPYMZQTCPRLNR-UHFFFAOYSA-N |
| Molecular Formula | C3H4N2S |
Thermo Scientific Chemicals Ethyl isothiocyanate, 96%
CAS: 542-85-8 Molecular Formula: C3H5NS Molecular Weight (g/mol): 87.14 MDL Number: MFCD00004820 InChI Key: HBNYJWAFDZLWRS-UHFFFAOYSA-N Synonym: ethyl isothiocyanate,ethane, isothiocyanato,ethyl mustard oil,ethylisothiocyanate,isothiocyanic acid, ethyl ester,unii-3284mj2t8p,ccris 7323,ethylisothio-cyanate,isothiocyanato-ethane PubChem CID: 10966 ChEBI: CHEBI:85098 IUPAC Name: isothiocyanatoethane SMILES: CCN=C=S
| PubChem CID | 10966 |
|---|---|
| CAS | 542-85-8 |
| Molecular Weight (g/mol) | 87.14 |
| ChEBI | CHEBI:85098 |
| MDL Number | MFCD00004820 |
| SMILES | CCN=C=S |
| Synonym | ethyl isothiocyanate,ethane, isothiocyanato,ethyl mustard oil,ethylisothiocyanate,isothiocyanic acid, ethyl ester,unii-3284mj2t8p,ccris 7323,ethylisothio-cyanate,isothiocyanato-ethane |
| IUPAC Name | isothiocyanatoethane |
| InChI Key | HBNYJWAFDZLWRS-UHFFFAOYSA-N |
| Molecular Formula | C3H5NS |
Thermo Scientific Chemicals 2,4-Dimethoxyphenyl isothiocyanate, 95%, Thermo Scientific™
CAS: 33904-03-9 Molecular Formula: C9H9NO2S Molecular Weight (g/mol): 195.24 InChI Key: CNXSCEPTSXPBTP-UHFFFAOYSA-N Synonym: 2,4-dimethoxyphenyl isothiocyanate,1-isothiocyanato-2,4-dimethoxy-benzene,2,4-dimethoxybenzenisothiocyanate,acmc-20aock,2,4-dimethoxyphenylisothiocyanate,1-isothiocyanato-2.4-dimethoxybenzene,isothiocyanic acid 2,4-dimethoxyphenyl ester PubChem CID: 2736202 IUPAC Name: 1-isothiocyanato-2,4-dimethoxybenzene SMILES: COC1=CC(=C(C=C1)N=C=S)OC
| PubChem CID | 2736202 |
|---|---|
| CAS | 33904-03-9 |
| Molecular Weight (g/mol) | 195.24 |
| SMILES | COC1=CC(=C(C=C1)N=C=S)OC |
| Synonym | 2,4-dimethoxyphenyl isothiocyanate,1-isothiocyanato-2,4-dimethoxy-benzene,2,4-dimethoxybenzenisothiocyanate,acmc-20aock,2,4-dimethoxyphenylisothiocyanate,1-isothiocyanato-2.4-dimethoxybenzene,isothiocyanic acid 2,4-dimethoxyphenyl ester |
| IUPAC Name | 1-isothiocyanato-2,4-dimethoxybenzene |
| InChI Key | CNXSCEPTSXPBTP-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO2S |
Thermo Scientific Chemicals 2-(Methyldithio)isobutyraldehyde, 95%
CAS: 67952-60-7 Molecular Formula: C5H10OS2 Molecular Weight (g/mol): 150.25 InChI Key: VLBWEJJOETYCSE-UHFFFAOYSA-N Synonym: 2-methyldithio isobutyraldehyde,2-methyl-2-methyldithio propanal,unii-3d5g4az6l5,propanal, 2-methyl-2-methyldithio,2-methyldithio-isobutyraldehyde,alpha-methyldithio isobutyraldehyde,2-methyl-2-methyldisulfanyl propanal,2-methyl-2-methyldithio propionaldehyde,2-methyldisulfanyl isobutyraldehyde,cocoa propanal PubChem CID: 106217 IUPAC Name: 2-methyl-2-(methyldisulfanyl)propanal SMILES: CC(C)(C=O)SSC
| PubChem CID | 106217 |
|---|---|
| CAS | 67952-60-7 |
| Molecular Weight (g/mol) | 150.25 |
| SMILES | CC(C)(C=O)SSC |
| Synonym | 2-methyldithio isobutyraldehyde,2-methyl-2-methyldithio propanal,unii-3d5g4az6l5,propanal, 2-methyl-2-methyldithio,2-methyldithio-isobutyraldehyde,alpha-methyldithio isobutyraldehyde,2-methyl-2-methyldisulfanyl propanal,2-methyl-2-methyldithio propionaldehyde,2-methyldisulfanyl isobutyraldehyde,cocoa propanal |
| IUPAC Name | 2-methyl-2-(methyldisulfanyl)propanal |
| InChI Key | VLBWEJJOETYCSE-UHFFFAOYSA-N |
| Molecular Formula | C5H10OS2 |
Thermo Scientific Chemicals Thionicotinamide, 99%
CAS: 4621-66-3 Molecular Formula: C6H6N2S Molecular Weight (g/mol): 138.19 MDL Number: MFCD00006399 InChI Key: XQWBMZWDJAZPPX-UHFFFAOYSA-N Synonym: thionicotinamide,3-pyridinecarbothioamide,nicotinothioamide,3-thiocarbamoylpyridine,3-thioamidopyridine,nicotinamide, thio,3-pyridylthioformamide,3-pyridinethiocarboxamide,thio-3-pyridinecarboxamide,unii-6a0hxx0753 PubChem CID: 737155 IUPAC Name: pyridine-3-carbothioamide SMILES: NC(=S)C1=CC=CN=C1
| PubChem CID | 737155 |
|---|---|
| CAS | 4621-66-3 |
| Molecular Weight (g/mol) | 138.19 |
| MDL Number | MFCD00006399 |
| SMILES | NC(=S)C1=CC=CN=C1 |
| Synonym | thionicotinamide,3-pyridinecarbothioamide,nicotinothioamide,3-thiocarbamoylpyridine,3-thioamidopyridine,nicotinamide, thio,3-pyridylthioformamide,3-pyridinethiocarboxamide,thio-3-pyridinecarboxamide,unii-6a0hxx0753 |
| IUPAC Name | pyridine-3-carbothioamide |
| InChI Key | XQWBMZWDJAZPPX-UHFFFAOYSA-N |
| Molecular Formula | C6H6N2S |
Thermo Scientific Chemicals Triclabendazole, 98%
CAS: 68786-66-3 Molecular Formula: C14H9Cl3N2OS Molecular Weight (g/mol): 359.66 InChI Key: NQPDXQQQCQDHHW-UHFFFAOYSA-N Synonym: triclabendazole,fasinex,6-chloro-5-2,3-dichlorophenoxy-2-methylthio-1h-benzo d imidazole,triclabendazol inn-spanish,triclabendazolum inn-latin,ccris 8988,5-chloro-6-2,3-dichlorophenoxy-2-methylthio-1h-benzimidazole,6-chloro-5-2,3-dichlorophenoxy-2-methylthio-benzimidazole,5-chloro-6-2,3-dichlorophenoxy-2-methylthio benzimidazole,6-chloro-5-2,3-dichlorophenoxy-2-methylthio-1h-benzimidazole PubChem CID: 50248 IUPAC Name: 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfanyl-1H-benzimidazole SMILES: CSC1=NC2=CC(=C(C=C2N1)Cl)OC3=C(C(=CC=C3)Cl)Cl
| PubChem CID | 50248 |
|---|---|
| CAS | 68786-66-3 |
| Molecular Weight (g/mol) | 359.66 |
| SMILES | CSC1=NC2=CC(=C(C=C2N1)Cl)OC3=C(C(=CC=C3)Cl)Cl |
| Synonym | triclabendazole,fasinex,6-chloro-5-2,3-dichlorophenoxy-2-methylthio-1h-benzo d imidazole,triclabendazol inn-spanish,triclabendazolum inn-latin,ccris 8988,5-chloro-6-2,3-dichlorophenoxy-2-methylthio-1h-benzimidazole,6-chloro-5-2,3-dichlorophenoxy-2-methylthio-benzimidazole,5-chloro-6-2,3-dichlorophenoxy-2-methylthio benzimidazole,6-chloro-5-2,3-dichlorophenoxy-2-methylthio-1h-benzimidazole |
| IUPAC Name | 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfanyl-1H-benzimidazole |
| InChI Key | NQPDXQQQCQDHHW-UHFFFAOYSA-N |
| Molecular Formula | C14H9Cl3N2OS |
Thermo Scientific Chemicals 2-Imidazolidinethione, 98%
CAS: 96-45-7 Molecular Formula: C3H6N2S Molecular Weight (g/mol): 102.16 MDL Number: MFCD00005276 InChI Key: PDQAZBWRQCGBEV-UHFFFAOYSA-N Synonym: 2-imidazolidinethione,ethylenethiourea,ethylene thiourea,2-mercaptoimidazoline,imidazolidinethione,n,n'-ethylenethiourea,mercazin i,warecure c,rhenogran etu,mercaptoimidazoline PubChem CID: 2723650 ChEBI: CHEBI:34750 IUPAC Name: imidazolidine-2-thione SMILES: S=C1NCCN1
| PubChem CID | 2723650 |
|---|---|
| CAS | 96-45-7 |
| Molecular Weight (g/mol) | 102.16 |
| ChEBI | CHEBI:34750 |
| MDL Number | MFCD00005276 |
| SMILES | S=C1NCCN1 |
| Synonym | 2-imidazolidinethione,ethylenethiourea,ethylene thiourea,2-mercaptoimidazoline,imidazolidinethione,n,n'-ethylenethiourea,mercazin i,warecure c,rhenogran etu,mercaptoimidazoline |
| IUPAC Name | imidazolidine-2-thione |
| InChI Key | PDQAZBWRQCGBEV-UHFFFAOYSA-N |
| Molecular Formula | C3H6N2S |
Thermo Scientific Chemicals 2-Mercaptoethyl sulfide, 90%
CAS: 3570-55-6 Molecular Formula: C4H10S3 Molecular Weight (g/mol): 154.30 MDL Number: MFCD00004893 InChI Key: KSJBMDCFYZKAFH-UHFFFAOYSA-N Synonym: 2,2'-thiodiethanethiol,bis 2-mercaptoethyl sulfide,2-mercaptoethyl sulfide,ethanethiol, 2,2'-thiobis,bis mercaptoethyl sulfide,3-thia-1,5-pentanedithiol,2-mercaptoethylsulfide,2,2'-dimercaptodiethyl sulfide,unii-oeu4azc07s,ethanethiol, 2,2'-thiodi PubChem CID: 77117 IUPAC Name: 2-(2-sulfanylethylsulfanyl)ethanethiol SMILES: SCCSCCS
| PubChem CID | 77117 |
|---|---|
| CAS | 3570-55-6 |
| Molecular Weight (g/mol) | 154.30 |
| MDL Number | MFCD00004893 |
| SMILES | SCCSCCS |
| Synonym | 2,2'-thiodiethanethiol,bis 2-mercaptoethyl sulfide,2-mercaptoethyl sulfide,ethanethiol, 2,2'-thiobis,bis mercaptoethyl sulfide,3-thia-1,5-pentanedithiol,2-mercaptoethylsulfide,2,2'-dimercaptodiethyl sulfide,unii-oeu4azc07s,ethanethiol, 2,2'-thiodi |
| IUPAC Name | 2-(2-sulfanylethylsulfanyl)ethanethiol |
| InChI Key | KSJBMDCFYZKAFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10S3 |
2-Thiouracil, 99%, Thermo Scientific Chemicals
CAS: 141-90-2 Molecular Formula: C4H4N2OS Molecular Weight (g/mol): 128.15 MDL Number: MFCD00006039 InChI Key: ZEMGGZBWXRYJHK-UHFFFAOYSA-N Synonym: 2-thiouracil,thiouracil,4-hydroxy-2-mercaptopyrimidine,antagothyroid,antagothyroil,deracil,nobilen,2-thioxo-2,3-dihydropyrimidin-4 1h-one,2-mercaptopyrimidin-4-ol,2-mercapto-4-hydroxypyrimidine PubChem CID: 1269845 ChEBI: CHEBI:348530 IUPAC Name: 2-sulfanylidene-1H-pyrimidin-4-one SMILES: O=C1NC(=S)NC=C1
| PubChem CID | 1269845 |
|---|---|
| CAS | 141-90-2 |
| Molecular Weight (g/mol) | 128.15 |
| ChEBI | CHEBI:348530 |
| MDL Number | MFCD00006039 |
| SMILES | O=C1NC(=S)NC=C1 |
| Synonym | 2-thiouracil,thiouracil,4-hydroxy-2-mercaptopyrimidine,antagothyroid,antagothyroil,deracil,nobilen,2-thioxo-2,3-dihydropyrimidin-4 1h-one,2-mercaptopyrimidin-4-ol,2-mercapto-4-hydroxypyrimidine |
| IUPAC Name | 2-sulfanylidene-1H-pyrimidin-4-one |
| InChI Key | ZEMGGZBWXRYJHK-UHFFFAOYSA-N |
| Molecular Formula | C4H4N2OS |
Thermo Scientific Chemicals S-Methyl methanethiolsulfonate, 97%
CAS: 2949-92-0 Molecular Formula: C2H6O2S2 Molecular Weight (g/mol): 126.19 MDL Number: MFCD00007565 InChI Key: XYONNSVDNIRXKZ-UHFFFAOYSA-N Synonym: s-methyl methanethiosulfonate,methyl methanethiolsulfonate,methyl methanethiosulfonate,s-methyl methanesulfonothioate,methanesulfonothioic acid, s-methyl ester,methyl methanesulfonothioate,s-methyl methanethiolsulfonate,methanethiosulfonic acid s-methyl ester,s-methyl methanethiosulphonate,methanesulfonylsulfanyl methane PubChem CID: 18064 ChEBI: CHEBI:74357 IUPAC Name: methylsulfonylsulfanylmethane SMILES: CSS(=O)(=O)C
| PubChem CID | 18064 |
|---|---|
| CAS | 2949-92-0 |
| Molecular Weight (g/mol) | 126.19 |
| ChEBI | CHEBI:74357 |
| MDL Number | MFCD00007565 |
| SMILES | CSS(=O)(=O)C |
| Synonym | s-methyl methanethiosulfonate,methyl methanethiolsulfonate,methyl methanethiosulfonate,s-methyl methanesulfonothioate,methanesulfonothioic acid, s-methyl ester,methyl methanesulfonothioate,s-methyl methanethiolsulfonate,methanethiosulfonic acid s-methyl ester,s-methyl methanethiosulphonate,methanesulfonylsulfanyl methane |
| IUPAC Name | methylsulfonylsulfanylmethane |
| InChI Key | XYONNSVDNIRXKZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2S2 |