Pyrazines
eMolecules 1781864-38-7 | 5-Phenylpyrazine-2,3-dithiocarboxamide | Oakwood Chemicals | MFCD27978260 | 274.360 | C12H10N4S2 | 97.000 | NC(=S)c1ncc(nc1C(N)=S)-c1ccccc1 | 1g | 480147915
5-Phenylpyrazine-2,3-dithiocarboxamide | Oakwood Chemicals | 1781864-38-7 | MFCD27978260 | 274.360 | C12H10N4S2 | 97.000 | NC(=S)c1ncc(nc1C(N)=S)-c1ccccc1 | 1g | 480147915
Medchemexpress LLC 2-chloropyrazine | 14508-49-7 | MFCD00006124 | 99.7% | 114.53 | C4H3ClN2 | 50g
Chloropyrazine (Pyrazin-2-yl chloride) is a pyrazine-based compound that can be used for the synthesis of active compounds Additionally Chloropyrazine can be used as an electrolyte additive in the research of lithium-sulfur batteries[1][2]
eMolecules 95538-03-7 | 2,3-Dibromopyrazine | ChemScene | MFCD02684897 | 237.882 | C4H2Br2N2 | 97.000 | Brc1nccnc1Br | 1g | 536848909
2,3-Dibromopyrazine | ChemScene | 95538-03-7 | MFCD02684897 | 237.882 | C4H2Br2N2 | 97.000 | Brc1nccnc1Br | 1g | 536848909
eMolecules 95538-03-7 | 2,3-Dibromopyrazine | Combi-Blocks | MFCD02684897 | 237.882 | C4H2Br2N2 | 98.000 | Brc1nccnc1Br | 10g | 350781026
2,3-Dibromopyrazine | Combi-Blocks | 95538-03-7 | MFCD02684897 | 237.882 | C4H2Br2N2 | 98.000 | Brc1nccnc1Br | 10g | 350781026
Accela Chembio Inc MF: C4H3Br2N3 | MW: 252.89 | ?98% | Flash Point: 131.9 celsius | BP: 294.6 celsius at 760 mmHg.
MF: C4H3Br2N3 | MW: 252.89 | ?98% | Flash Point: 131.9 celsius | BP: 294.6 celsius at 760 mmHg.