Quaternary ammonium salts
Medchemexpress LLC Methanaminium, N,N,N-trimethyl-, iodide | 75-58-1 | MFCD00011629 | 98.0% | 201.05 g/mol | C4H12IN | 25 G
Tetramethylammonium iodide is a quaternary ammonium salt (CAS 75-58-1) used as a reagent in chemical synthesis and biochemical assays. It is described as a weak surfactant that reduces the surface tension of water and is supplied as a white to off-white powder. Typical analytical values include molecular formula C4H12IN, molecular weight 201.05 g/mol, and typical purity 98.0%.
- Quaternary ammonium salt for use in chemical synthesis and biochemical assays.
- Acts as a mild surfactant to reduce surface tension in aqueous solutions.
- Supplied as a white to off-white powder suitable for laboratory handling.
- Available in small-scale laboratory pack sizes for research applications.
- Characterized by molecular formula C4H12IN and molecular weight 201.05 g/mol.
- Typical purity is 98.0% as shown on the certificate of analysis.
eMolecules Oakwood Chemicals Tetrabutylammonium hydroxide 55% in water 3kg 480141245 079018 2052-49-5 MFCD28963519 277 493 C16H39NO2
Oakwood Chemicals Tetrabutylammonium hydroxide 55% in water 3kg 480141245 079018 2052-49-5 MFCD28963519 277 493 C16H39NO2
![eMolecules L-Carnitine hydrochloride | Combi-Blocks | 6645-46-1 | MFCD00066100 | 197.660 | C7H16ClNO3 | 98.000 | [Cl-].C[N+](C)(C)C[C@H](O)CC(O)=O | 5g | 205397247](https://assets.fishersci.com/TFS-Assets/CCG/product-images/NC1600933.jpg-250.jpg)
eMolecules L-Carnitine hydrochloride | Combi-Blocks | 6645-46-1 | MFCD00066100 | 197.660 | C7H16ClNO3 | 98.000 | [Cl-].C[N+](C)(C)C[C@H](O)CC(O)=O | 5g | 205397247
L-Carnitine hydrochloride | Combi-Blocks | 6645-46-1 | MFCD00066100 | 197.660 | C7H16ClNO3 | 98.000 | [Cl-].C[N+](C)(C)C[C@H](O)CC(O)=O | 5g | 205397247
Sigma Aldrich Fine Chemicals Biosciences Benzyldimethylhexadecylammonium chloride cationic detergent | 122-18-9 | MFCD00011625 | 100G
Benzyldimethylhexadecylammonium chloride cationic detergent | Mol Wt: 396.09 | 122-18-9 | MFCD00011625 | 100G
Sigma Aldrich Fine Chemicals Biosciences Acetylcholine chloride | 60-31-1 | MFCD00011698 | 10mg
Acetylcholine chloride | Purity: 99% | MW: 181.66 | 60-31-1 | MFCD00011698 | 10mg
Sigma Aldrich Fine Chemicals Biosciences Choline chloride >=99% | 67-48-1 | MFCD00011721 | 100G
Choline chloride >=99% | Purity: >=99% | Mol Wt: 139.62 | 67-48-1 | MFCD00011721 | 100G
Sigma Aldrich Fine Chemicals Biosciences Tetraethylammonium chloride BioUltra, for molecular biology, >=99.0% (AT) | 56-34-8 | MFCD00011828 | 25G
Tetraethylammonium chloride BioUltra, for molecular biology, >=99.0% (AT) | Purity: >=99.0% (AT) | Mol Wt: 165.7 | 56-34-8 | MFCD00011828 | 25G
eMolecules 95656-86-3 | tert-Butyl (2-hydroxypropyl)carbamate | MFCD02093569 | 1g
Ambeed | tert-Butyl (2-hydroxypropyl)carbamate | 1g | 490559072 | A385329 | 95656-86-3 | MFCD02093569 | 175.228 | C8H17NO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>