Phenylpropanoic acids
Aobchem 2-Bromo-1-ethoxy-4-(2-phenylpropan-2-yl)benzene | 97% | C17H19BrO | 500mg
2-Bromo-1-ethoxy-4-(2-phenylpropan-2-yl)benzene | 97% | C17H19BrO | 500mg
Aobchem 2-Bromo-1-ethoxy-4-(2-phenylpropan-2-yl)benzene | 97% | C17H19BrO | 1g
2-Bromo-1-ethoxy-4-(2-phenylpropan-2-yl)benzene | 97% | C17H19BrO | 1g
Aobchem Isopropyl 3-hydroxy-3-phenylpropanoate | 97% | CAS 27751-80-0 | C12H16O3 | 500mg
Isopropyl 3-hydroxy-3-phenylpropanoate | 97% | CAS 27751-80-0 | C12H16O3 | 500mg
Aobchem 3-(3-Methoxyphenyl)-1-phenylprop-2-yn-1-ol | 95% | CAS 1786443-11-5 | C16H14O2 | 500mg
3-(3-Methoxyphenyl)-1-phenylprop-2-yn-1-ol | 95% | CAS 1786443-11-5 | C16H14O2 | 500mg
Chem-Impex International, Inc. 3-Phenylpropionic acid | MFCD00002771 | 100G
3-Phenylpropionic acid, MFCD00002771, 100G
eMolecules 459-31-4 | 3-(4-Fluorophenyl)propanoic acid | Ambeed | MFCD00060327 | 168.167 | C9H9FO2 | 97.000 | OC(=O)CCc1ccc(F)cc1 | 25g | 528567885
3-(4-Fluorophenyl)propanoic acid | Ambeed | 459-31-4 | MFCD00060327 | 168.167 | C9H9FO2 | 97.000 | OC(=O)CCc1ccc(F)cc1 | 25g | 528567885
eMolecules 2096333-95-6 | 2-(Methanesulfonyl(N-methoxymethyl)amino)pyrimidine-5-boronic acid, pinacol ester | Combi-Blocks | MFCD19684127 | 343.210 | C13H22BN3O5S | 96.000 | COCN(c1ncc(cn1)B1OC(C)(C)C(C)(C)O1)S(C)(=O)=O | 1g | 117545104
2-(Methanesulfonyl(N-methoxymethyl)amino)pyrimidine-5-boronic acid, pinacol ester | Combi-Blocks | 2096333-95-6 | MFCD19684127 | 343.210 | C13H22BN3O5S | 96.000 | COCN(c1ncc(cn1)B1OC(C)(C)C(C)(C)O1)S(C)(=O)=O | 1g | 117545104
eMolecules 21307-97-1 | Ambeed | (R)-2-Benzylsuccinic acid | 250mg | 600844115 | A611528 | MFCD08282615 | 208.213 | C11H12O4
Ambeed | 4-Bromo-N-(4-chloro-3-(trifluoromethyl)phenyl)benzenesulfonamide | 1g | 660582746 | A1219520 | 425646-41-9 | MFCD02136903 | 414.620 | C13H8BrClF3NO2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Medchemexpress LLC Hydrocinnamic acid-d9 (3-phenylpropionic acid-d9) | 93131-15-8 | MFCD01075426 | 99.7% | 159.23 | C9HD9O2 | 50mg
Hydrocinnamic acid-d9 is the deuterium labeled Hydrocinnamic acid[1] Hydrocinnamic acid is the major rhizospheric compound with known growth regulatory activitie[2]s
Medchemexpress LLC 2-phenylpropionic acid | 492-37-5 | MFCD00002650 | 99.7% | 150.18 g/mol | C9H10O2 | 5 G
2-Phenylpropionic acid is a small-molecule organic acid used as an analytical standard and research intermediate. It is a colorless to light-yellow liquid (C9H10O2) with a molecular weight of 150.18 g/mol and documented physical properties, making it suitable for analytical and synthetic applications.
Medchemexpress LLC Hydrocinnamic acid-d9 | 93131-15-8 | 99.7% | 159.23 | C9HD9O2 | 100mg
Hydrocinnamic acid-d9 is the deuterium labeled Hydrocinnamic acid[1] Hydrocinnamic acid is the major rhizospheric compound with known growth regulatory activitie[2]s
Aobchem 2-Bromo-1-ethoxy-4-(2-phenylpropan-2-yl)benzene | 97% | C17H19BrO | 25g
2-Bromo-1-ethoxy-4-(2-phenylpropan-2-yl)benzene | 97% | C17H19BrO | 25g
Aobchem 3-(3-Methoxyphenyl)-1-phenylprop-2-yn-1-ol | 95% | CAS 1786443-11-5 | C16H14O2 | 250mg
3-(3-Methoxyphenyl)-1-phenylprop-2-yn-1-ol | 95% | CAS 1786443-11-5 | C16H14O2 | 250mg
Aobchem Isopropyl 3-hydroxy-3-phenylpropanoate | 97% | CAS 27751-80-0 | C12H16O3 | 1g
Isopropyl 3-hydroxy-3-phenylpropanoate | 97% | CAS 27751-80-0 | C12H16O3 | 1g
Sigma Aldrich Fine Chemicals Biosciences Tesaglitazar >=98% (HPLC) | 251565-85-2 | MFCD07784004 | 5MG
Tesaglitazar >=98% (HPLC) | Purity: >=98% (HPLC) | Mol Wt: 408.47 | 251565-85-2 | MFCD07784004 | 5MG
