Benzene and substituted derivatives
Filtered Search Results
5-Chloro-2-(2,4-dichlorophenoxy)phenol, 99%
CAS: 3380-34-5 Molecular Formula: C12H7Cl3O2 Molecular Weight (g/mol): 289.536 MDL Number: MFCD00800992 InChI Key: XEFQLINVKFYRCS-UHFFFAOYSA-N Synonym: triclosan,5-chloro-2-2,4-dichlorophenoxy phenol,irgasan,2,4,4'-trichloro-2'-hydroxydiphenyl ether,cloxifenolum,triclosanum,irgasan dp300,stri-dex face wash,aquasept,sapoderm PubChem CID: 5564 ChEBI: CHEBI:164200 IUPAC Name: 5-chloro-2-(2,4-dichlorophenoxy)phenol SMILES: C1=CC(=C(C=C1Cl)O)OC2=C(C=C(C=C2)Cl)Cl
| PubChem CID | 5564 |
|---|---|
| CAS | 3380-34-5 |
| Molecular Weight (g/mol) | 289.536 |
| ChEBI | CHEBI:164200 |
| MDL Number | MFCD00800992 |
| SMILES | C1=CC(=C(C=C1Cl)O)OC2=C(C=C(C=C2)Cl)Cl |
| Synonym | triclosan,5-chloro-2-2,4-dichlorophenoxy phenol,irgasan,2,4,4'-trichloro-2'-hydroxydiphenyl ether,cloxifenolum,triclosanum,irgasan dp300,stri-dex face wash,aquasept,sapoderm |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol |
| InChI Key | XEFQLINVKFYRCS-UHFFFAOYSA-N |
| Molecular Formula | C12H7Cl3O2 |
4-(2-Chloro-6-nitrophenoxy)benzene-1-sulfonyl chloride, 97%, Thermo Scientific™
CAS: 175135-00-9 Molecular Formula: C12H7Cl2NO5S Molecular Weight (g/mol): 348.15 MDL Number: MFCD00052679 InChI Key: CRTUVOFOPIFTQS-UHFFFAOYSA-N Synonym: 4-2-chloro-6-nitrophenoxy benzene-1-sulfonyl chloride,4-2-chloro-6-nitrophenoxy benzenesulfonyl chloride,4-6-nitro-2-chlorophenoxy-benzenesulfonyl chloride,4-2-chloro-6-nitrophenoxy benzene-1-sulphonyl chloride PubChem CID: 2774276 IUPAC Name: 4-(2-chloro-6-nitrophenoxy)benzenesulfonyl chloride SMILES: C1=CC(=C(C(=C1)Cl)OC2=CC=C(C=C2)S(=O)(=O)Cl)[N+](=O)[O-]
| PubChem CID | 2774276 |
|---|---|
| CAS | 175135-00-9 |
| Molecular Weight (g/mol) | 348.15 |
| MDL Number | MFCD00052679 |
| SMILES | C1=CC(=C(C(=C1)Cl)OC2=CC=C(C=C2)S(=O)(=O)Cl)[N+](=O)[O-] |
| Synonym | 4-2-chloro-6-nitrophenoxy benzene-1-sulfonyl chloride,4-2-chloro-6-nitrophenoxy benzenesulfonyl chloride,4-6-nitro-2-chlorophenoxy-benzenesulfonyl chloride,4-2-chloro-6-nitrophenoxy benzene-1-sulphonyl chloride |
| IUPAC Name | 4-(2-chloro-6-nitrophenoxy)benzenesulfonyl chloride |
| InChI Key | CRTUVOFOPIFTQS-UHFFFAOYSA-N |
| Molecular Formula | C12H7Cl2NO5S |
2,4-Dichloro-1-(2-iodophenoxy)benzene, ≥95%, Thermo Scientific™
CAS: 175136-78-4 Molecular Formula: C12H7Cl2IO Molecular Weight (g/mol): 364.99 MDL Number: MFCD00052444 InChI Key: ULAWXTPGHWKSDY-UHFFFAOYSA-N Synonym: 2,4-dichloro-1-2-iodophenoxy benzene,2,4-dichloro-1 2-iodophenoxy benzene,benzene,2,4-dichloro-1-2-iodophenoxy PubChem CID: 2776994 IUPAC Name: 2,4-dichloro-1-(2-iodophenoxy)benzene SMILES: ClC1=CC(Cl)=C(OC2=CC=CC=C2I)C=C1
| PubChem CID | 2776994 |
|---|---|
| CAS | 175136-78-4 |
| Molecular Weight (g/mol) | 364.99 |
| MDL Number | MFCD00052444 |
| SMILES | ClC1=CC(Cl)=C(OC2=CC=CC=C2I)C=C1 |
| Synonym | 2,4-dichloro-1-2-iodophenoxy benzene,2,4-dichloro-1 2-iodophenoxy benzene,benzene,2,4-dichloro-1-2-iodophenoxy |
| IUPAC Name | 2,4-dichloro-1-(2-iodophenoxy)benzene |
| InChI Key | ULAWXTPGHWKSDY-UHFFFAOYSA-N |
| Molecular Formula | C12H7Cl2IO |
2-Amino-3-methoxybenzoic acid, 98%
CAS: 3177-80-8 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.17 InChI Key: SXOPCLUOUFQBJV-UHFFFAOYSA-N Synonym: 3-methoxyanthranilic acid,benzoic acid, 2-amino-3-methoxy,3-methoxyanthranilate,m-anisic acid, 2-amino,3-methoxy-2-aminobenzoic acid,2-amino-3-methoxy-benzoic acid,2-amino-3-methoxy benzoic acid,2-amino-3-methyloxy benzoic acid,2-amino-3-methoxybenzoicacid PubChem CID: 255720 ChEBI: CHEBI:27440 IUPAC Name: 2-amino-3-methoxybenzoic acid SMILES: COC1=CC=CC(=C1N)C(=O)O
| PubChem CID | 255720 |
|---|---|
| CAS | 3177-80-8 |
| Molecular Weight (g/mol) | 167.17 |
| ChEBI | CHEBI:27440 |
| SMILES | COC1=CC=CC(=C1N)C(=O)O |
| Synonym | 3-methoxyanthranilic acid,benzoic acid, 2-amino-3-methoxy,3-methoxyanthranilate,m-anisic acid, 2-amino,3-methoxy-2-aminobenzoic acid,2-amino-3-methoxy-benzoic acid,2-amino-3-methoxy benzoic acid,2-amino-3-methyloxy benzoic acid,2-amino-3-methoxybenzoicacid |
| IUPAC Name | 2-amino-3-methoxybenzoic acid |
| InChI Key | SXOPCLUOUFQBJV-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
p-Anisic Acid, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 100-09-4
| CAS | 100-09-4 |
|---|
2-Fluorobenzophenone, 98+%
CAS: 342-24-5 Molecular Formula: C13H9FO Molecular Weight (g/mol): 200.212 MDL Number: MFCD00000318 InChI Key: DWFDQVMFSLLMPE-UHFFFAOYSA-N Synonym: 2-fluorobenzophenone,2-fluorophenyl phenyl methanone,o-fluorobenzophenone,fluorobenzophenone,2-fluorophenyl-phenylmethanone,2-fluoro-phenyl-phenylmethanone,2-fluorophenyl phenyl ketone,methanone, 2-fluorophenyl phenyl,pubchem4228,acmc-1ckt6 PubChem CID: 67650 IUPAC Name: (2-fluorophenyl)-phenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2F
| PubChem CID | 67650 |
|---|---|
| CAS | 342-24-5 |
| Molecular Weight (g/mol) | 200.212 |
| MDL Number | MFCD00000318 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2F |
| Synonym | 2-fluorobenzophenone,2-fluorophenyl phenyl methanone,o-fluorobenzophenone,fluorobenzophenone,2-fluorophenyl-phenylmethanone,2-fluoro-phenyl-phenylmethanone,2-fluorophenyl phenyl ketone,methanone, 2-fluorophenyl phenyl,pubchem4228,acmc-1ckt6 |
| IUPAC Name | (2-fluorophenyl)-phenylmethanone |
| InChI Key | DWFDQVMFSLLMPE-UHFFFAOYSA-N |
| Molecular Formula | C13H9FO |
2,2'-Dichlorobenzophenone, 98+%
CAS: 5293-97-0 Molecular Formula: C13H8Cl2O Molecular Weight (g/mol): 251.106 MDL Number: MFCD00039303 InChI Key: DRDRZHJTTDSOPK-UHFFFAOYSA-N Synonym: 2,2'-dichlorobenzophenone,bis 2-chlorophenyl methanone,methanone, bis 2-chlorophenyl,unii-5y7f5u8ant,5y7f5u8ant,benzophenone, 2,2'-dichloro,bis 2-chlorophenyl ketone,acmc-1ao0c,benzophenone,2'-dichloro,2,2-dichlorobenzophenone PubChem CID: 347097 IUPAC Name: bis(2-chlorophenyl)methanone SMILES: C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2Cl)Cl
| PubChem CID | 347097 |
|---|---|
| CAS | 5293-97-0 |
| Molecular Weight (g/mol) | 251.106 |
| MDL Number | MFCD00039303 |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2Cl)Cl |
| Synonym | 2,2'-dichlorobenzophenone,bis 2-chlorophenyl methanone,methanone, bis 2-chlorophenyl,unii-5y7f5u8ant,5y7f5u8ant,benzophenone, 2,2'-dichloro,bis 2-chlorophenyl ketone,acmc-1ao0c,benzophenone,2'-dichloro,2,2-dichlorobenzophenone |
| IUPAC Name | bis(2-chlorophenyl)methanone |
| InChI Key | DRDRZHJTTDSOPK-UHFFFAOYSA-N |
| Molecular Formula | C13H8Cl2O |
2,2',4,4'-Tetrahydroxybenzophenone, 98+%
CAS: 131-55-5 Molecular Formula: C13H10O5 Molecular Weight (g/mol): 246.218 MDL Number: MFCD00002278 InChI Key: WXNRYSGJLQFHBR-UHFFFAOYSA-N Synonym: 2,2',4,4'-tetrahydroxybenzophenone,bis 2,4-dihydroxyphenyl methanone,benzophenone-2,uvinol d-50,uvinul d-50,methanone, bis 2,4-dihydroxyphenyl,2,4,2',4'-tetrahydroxybenzophenone,unii-prr8k3h9vn,2,2',4,4'-tetrehydroxybenzophenone,prr8k3h9vn PubChem CID: 8571 IUPAC Name: bis(2,4-dihydroxyphenyl)methanone SMILES: C1=CC(=C(C=C1O)O)C(=O)C2=C(C=C(C=C2)O)O
| PubChem CID | 8571 |
|---|---|
| CAS | 131-55-5 |
| Molecular Weight (g/mol) | 246.218 |
| MDL Number | MFCD00002278 |
| SMILES | C1=CC(=C(C=C1O)O)C(=O)C2=C(C=C(C=C2)O)O |
| Synonym | 2,2',4,4'-tetrahydroxybenzophenone,bis 2,4-dihydroxyphenyl methanone,benzophenone-2,uvinol d-50,uvinul d-50,methanone, bis 2,4-dihydroxyphenyl,2,4,2',4'-tetrahydroxybenzophenone,unii-prr8k3h9vn,2,2',4,4'-tetrehydroxybenzophenone,prr8k3h9vn |
| IUPAC Name | bis(2,4-dihydroxyphenyl)methanone |
| InChI Key | WXNRYSGJLQFHBR-UHFFFAOYSA-N |
| Molecular Formula | C13H10O5 |
Decafluorobenzophenone, 97%
CAS: 853-39-4 Molecular Formula: C13F10O Molecular Weight (g/mol): 362.126 MDL Number: MFCD00000295 InChI Key: WWQLXRAKBJVNCC-UHFFFAOYSA-N Synonym: decafluorobenzophenone,benzophenone, decafluoro,perfluorobenzophenone,methanone, bis pentafluorophenyl,bis perfluorophenyl methanone,bis pentafluorophenyl methanone,bis 2,3,4,5,6-pentafluorophenyl methanone,di2,3,4,5,6-pentafluorophenyl ketone,acmc-209q5n PubChem CID: 70068 IUPAC Name: bis(2,3,4,5,6-pentafluorophenyl)methanone SMILES: C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)C2=C(C(=C(C(=C2F)F)F)F)F
| PubChem CID | 70068 |
|---|---|
| CAS | 853-39-4 |
| Molecular Weight (g/mol) | 362.126 |
| MDL Number | MFCD00000295 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)C2=C(C(=C(C(=C2F)F)F)F)F |
| Synonym | decafluorobenzophenone,benzophenone, decafluoro,perfluorobenzophenone,methanone, bis pentafluorophenyl,bis perfluorophenyl methanone,bis pentafluorophenyl methanone,bis 2,3,4,5,6-pentafluorophenyl methanone,di2,3,4,5,6-pentafluorophenyl ketone,acmc-209q5n |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)methanone |
| InChI Key | WWQLXRAKBJVNCC-UHFFFAOYSA-N |
| Molecular Formula | C13F10O |
3,3'-Diaminobenzophenone, 90%
CAS: 611-79-0 Molecular Formula: C13H12N2O Molecular Weight (g/mol): 212.25 MDL Number: MFCD00014774 InChI Key: TUQQUUXMCKXGDI-UHFFFAOYSA-N Synonym: 3,3'-diaminobenzophenone,bis 3-aminophenyl methanone,methanone, bis 3-aminophenyl,di3-aminophenyl ketone,3,3'-diaminodiphenyl ketone,pubchem3381,acmc-1awhc,cbmicro_014188,3,3'-diamino benzophenone,3-3-aminobenzoyl aniline PubChem CID: 69145 IUPAC Name: bis(3-aminophenyl)methanone SMILES: NC1=CC(=CC=C1)C(=O)C1=CC(N)=CC=C1
| PubChem CID | 69145 |
|---|---|
| CAS | 611-79-0 |
| Molecular Weight (g/mol) | 212.25 |
| MDL Number | MFCD00014774 |
| SMILES | NC1=CC(=CC=C1)C(=O)C1=CC(N)=CC=C1 |
| Synonym | 3,3'-diaminobenzophenone,bis 3-aminophenyl methanone,methanone, bis 3-aminophenyl,di3-aminophenyl ketone,3,3'-diaminodiphenyl ketone,pubchem3381,acmc-1awhc,cbmicro_014188,3,3'-diamino benzophenone,3-3-aminobenzoyl aniline |
| IUPAC Name | bis(3-aminophenyl)methanone |
| InChI Key | TUQQUUXMCKXGDI-UHFFFAOYSA-N |
| Molecular Formula | C13H12N2O |
Methyl 3-methoxy-4-methylbenzoate, 98%
CAS: 3556-83-0 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00082710 InChI Key: LLEXCSBUSVRBCA-UHFFFAOYSA-N Synonym: 3-methoxy-4-methylbenzoic acid methyl ester,methyl 3-methoxy-p-toluate,4-methyl-m-anisic acid methyl ester,benzoic acid, 3-methoxy-4-methyl-, methyl ester,pubchem13650,methyl 4-methyl-m-anisate,acmc-1cs22,methyl3-methoxy-4-methylbenzoate,methyl 3-methoxy-4-methyl-benzoate,3-methoxy-p-toluic acid methyl ester PubChem CID: 591123 IUPAC Name: methyl 3-methoxy-4-methylbenzoate SMILES: CC1=C(C=C(C=C1)C(=O)OC)OC
| PubChem CID | 591123 |
|---|---|
| CAS | 3556-83-0 |
| Molecular Weight (g/mol) | 180.203 |
| MDL Number | MFCD00082710 |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)OC |
| Synonym | 3-methoxy-4-methylbenzoic acid methyl ester,methyl 3-methoxy-p-toluate,4-methyl-m-anisic acid methyl ester,benzoic acid, 3-methoxy-4-methyl-, methyl ester,pubchem13650,methyl 4-methyl-m-anisate,acmc-1cs22,methyl3-methoxy-4-methylbenzoate,methyl 3-methoxy-4-methyl-benzoate,3-methoxy-p-toluic acid methyl ester |
| IUPAC Name | methyl 3-methoxy-4-methylbenzoate |
| InChI Key | LLEXCSBUSVRBCA-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
2-Amino-4-methoxybenzoic acid, 94%
CAS: 4294-95-5 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.164 MDL Number: MFCD00667729 InChI Key: HHNWXQCVWVVVQZ-UHFFFAOYSA-N Synonym: 4-methoxyanthranilic acid,2-amino-4-methoxy-benzoic acid,2-amino-p-anisic acid,benzoic acid, 2-amino-4-methoxy,3-amino-4-carboxyanisole,2-carboxy-5-methoxyaniline,4-methoxyanthranilicacid,2-amine-4-methoxybenzoic acid,pubchem11856,acmc-1aerh PubChem CID: 351010 IUPAC Name: 2-amino-4-methoxybenzoic acid SMILES: COC1=CC(=C(C=C1)C(=O)O)N
| PubChem CID | 351010 |
|---|---|
| CAS | 4294-95-5 |
| Molecular Weight (g/mol) | 167.164 |
| MDL Number | MFCD00667729 |
| SMILES | COC1=CC(=C(C=C1)C(=O)O)N |
| Synonym | 4-methoxyanthranilic acid,2-amino-4-methoxy-benzoic acid,2-amino-p-anisic acid,benzoic acid, 2-amino-4-methoxy,3-amino-4-carboxyanisole,2-carboxy-5-methoxyaniline,4-methoxyanthranilicacid,2-amine-4-methoxybenzoic acid,pubchem11856,acmc-1aerh |
| IUPAC Name | 2-amino-4-methoxybenzoic acid |
| InChI Key | HHNWXQCVWVVVQZ-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
3,5-Dimethoxybenzoic acid, 99%
CAS: 1132-21-4 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD00002502 InChI Key: IWPZKOJSYQZABD-UHFFFAOYSA-N Synonym: benzoic acid, 3,5-dimethoxy,unii-38my78eckk,3,5-dimethoxy benzoic acid,38my78eckk,pubchem3121,3,5-dimethoxybenzoicacid,acmc-1c4zl,3,5-dimethoxy-benzoic acid,ksc176m0p,benzoicacid, 3,5-dimethoxy PubChem CID: 14332 IUPAC Name: 3,5-dimethoxybenzoic acid SMILES: COC1=CC(=CC(OC)=C1)C(O)=O
| PubChem CID | 14332 |
|---|---|
| CAS | 1132-21-4 |
| Molecular Weight (g/mol) | 182.18 |
| MDL Number | MFCD00002502 |
| SMILES | COC1=CC(=CC(OC)=C1)C(O)=O |
| Synonym | benzoic acid, 3,5-dimethoxy,unii-38my78eckk,3,5-dimethoxy benzoic acid,38my78eckk,pubchem3121,3,5-dimethoxybenzoicacid,acmc-1c4zl,3,5-dimethoxy-benzoic acid,ksc176m0p,benzoicacid, 3,5-dimethoxy |
| IUPAC Name | 3,5-dimethoxybenzoic acid |
| InChI Key | IWPZKOJSYQZABD-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
3-Bromo-5-methoxybenzoic acid, 98%
CAS: 157893-14-6 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.045 MDL Number: MFCD00266858 InChI Key: DMXJBCHYVUGXEH-UHFFFAOYSA-N Synonym: 3-bromo-5-carboxyanisole,3-bromo-5-methoxybenzoicacid,3-bromo-5-methoxy-benzoic acid,benzoic acid, 3-bromo-5-methoxy,5-bromo-3-methoxybenzoic acid,pubchem16435,acmc-1bx98,ksc529k1f,3-bromo-5-methyloxy benzoic acid PubChem CID: 4060048 IUPAC Name: 3-bromo-5-methoxybenzoic acid SMILES: COC1=CC(=CC(=C1)C(=O)O)Br
| PubChem CID | 4060048 |
|---|---|
| CAS | 157893-14-6 |
| Molecular Weight (g/mol) | 231.045 |
| MDL Number | MFCD00266858 |
| SMILES | COC1=CC(=CC(=C1)C(=O)O)Br |
| Synonym | 3-bromo-5-carboxyanisole,3-bromo-5-methoxybenzoicacid,3-bromo-5-methoxy-benzoic acid,benzoic acid, 3-bromo-5-methoxy,5-bromo-3-methoxybenzoic acid,pubchem16435,acmc-1bx98,ksc529k1f,3-bromo-5-methyloxy benzoic acid |
| IUPAC Name | 3-bromo-5-methoxybenzoic acid |
| InChI Key | DMXJBCHYVUGXEH-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
4,4'-Bis(diethylamino)benzophenone, 99+%
CAS: 90-93-7 Molecular Formula: C21H28N2O Molecular Weight (g/mol): 324.47 MDL Number: MFCD00009044 InChI Key: VYHBFRJRBHMIQZ-UHFFFAOYSA-N Synonym: 4,4'-bis diethylamino benzophenone,michler's ethyl ketone,bis 4-diethylamino phenyl methanone,methanone, bis 4-diethylamino phenyl,4,4'-tetraethyldiamino benzophenone,p,p'-bis diethylamino benzophenone,p,p'-tetraethyldiamino benzophenone,ethyl michler ketone PubChem CID: 66663 IUPAC Name: bis[4-(diethylamino)phenyl]methanone SMILES: CCN(CC)C1=CC=C(C=C1)C(=O)C1=CC=C(C=C1)N(CC)CC
| PubChem CID | 66663 |
|---|---|
| CAS | 90-93-7 |
| Molecular Weight (g/mol) | 324.47 |
| MDL Number | MFCD00009044 |
| SMILES | CCN(CC)C1=CC=C(C=C1)C(=O)C1=CC=C(C=C1)N(CC)CC |
| Synonym | 4,4'-bis diethylamino benzophenone,michler's ethyl ketone,bis 4-diethylamino phenyl methanone,methanone, bis 4-diethylamino phenyl,4,4'-tetraethyldiamino benzophenone,p,p'-bis diethylamino benzophenone,p,p'-tetraethyldiamino benzophenone,ethyl michler ketone |
| IUPAC Name | bis[4-(diethylamino)phenyl]methanone |
| InChI Key | VYHBFRJRBHMIQZ-UHFFFAOYSA-N |
| Molecular Formula | C21H28N2O |