Benzene and substituted derivatives
Filtered Search Results
4-Nitrobenzyl alcohol, 99%
CAS: 619-73-8 Molecular Formula: C7H7NO3 Molecular Weight (g/mol): 153.14 MDL Number: MFCD00007376 InChI Key: JKTYGPATCNUWKN-UHFFFAOYSA-N Synonym: 4-nitrobenzyl alcohol,4-nitrophenyl methanol,p-nitrobenzyl alcohol,benzenemethanol, 4-nitro,4-nitrobenzenemethanol,p-hydroxymethyl nitrobenzene,benzyl alcohol, p-nitro,paranitrobenzyl alcohol,4-nitrobenzylalcohol,unii-86btj68y9m PubChem CID: 69275 ChEBI: CHEBI:41214 IUPAC Name: (4-nitrophenyl)methanol SMILES: OCC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 69275 |
|---|---|
| CAS | 619-73-8 |
| Molecular Weight (g/mol) | 153.14 |
| ChEBI | CHEBI:41214 |
| MDL Number | MFCD00007376 |
| SMILES | OCC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | 4-nitrobenzyl alcohol,4-nitrophenyl methanol,p-nitrobenzyl alcohol,benzenemethanol, 4-nitro,4-nitrobenzenemethanol,p-hydroxymethyl nitrobenzene,benzyl alcohol, p-nitro,paranitrobenzyl alcohol,4-nitrobenzylalcohol,unii-86btj68y9m |
| IUPAC Name | (4-nitrophenyl)methanol |
| InChI Key | JKTYGPATCNUWKN-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO3 |
o-Dianisidine, 98+%
CAS: 119-90-4 Molecular Formula: C14H16N2O2 Molecular Weight (g/mol): 244.294 MDL Number: MFCD00008372 InChI Key: JRBJSXQPQWSCCF-UHFFFAOYSA-N Synonym: 3,3'-dimethoxybenzidine,o-dianisidine,dianisidine,cellitazol b,neutrosel navy bn,diacel navy dc,disperse black 6,blue base nb,blue bn base,blue base irga b PubChem CID: 8411 ChEBI: CHEBI:82321 IUPAC Name: 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline SMILES: COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N
| PubChem CID | 8411 |
|---|---|
| CAS | 119-90-4 |
| Molecular Weight (g/mol) | 244.294 |
| ChEBI | CHEBI:82321 |
| MDL Number | MFCD00008372 |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N |
| Synonym | 3,3'-dimethoxybenzidine,o-dianisidine,dianisidine,cellitazol b,neutrosel navy bn,diacel navy dc,disperse black 6,blue base nb,blue bn base,blue base irga b |
| IUPAC Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline |
| InChI Key | JRBJSXQPQWSCCF-UHFFFAOYSA-N |
| Molecular Formula | C14H16N2O2 |
DAPT
CAS: 208255-80-5 Molecular Formula: C23H26F2N2O4 Molecular Weight (g/mol): 432.468 MDL Number: MFCD04974585 InChI Key: DWJXYEABWRJFSP-XOBRGWDASA-N Synonym: dapt,dapt gsi-ix,gamma-secretase inhibitor ix,gsi-ix,insolution gamma-secretase inhibitor ix,s-tert-butyl 2-s-2-2-3,5-difluorophenyl acetamido propanamido-2-phenylacetate,n-n-3,5-difluorophenacetyl-l-alanyl-s-phenylglycine t-butyl ester,tert-butyl 2s-2-2s-2-2-3,5-difluorophenyl acetamido propanamido-2-phenylacetate,tert-butyl 2s-2-2s-2-2-3,5-difluorophenyl acetyl amino propanoyl amino-2-phenylacetate,gsiix PubChem CID: 5311272 ChEBI: CHEBI:86193 IUPAC Name: tert-butyl (2S)-2-[[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]amino]-2-phenylacetate SMILES: CC(C(=O)NC(C1=CC=CC=C1)C(=O)OC(C)(C)C)NC(=O)CC2=CC(=CC(=C2)F)F
| PubChem CID | 5311272 |
|---|---|
| CAS | 208255-80-5 |
| Molecular Weight (g/mol) | 432.468 |
| ChEBI | CHEBI:86193 |
| MDL Number | MFCD04974585 |
| SMILES | CC(C(=O)NC(C1=CC=CC=C1)C(=O)OC(C)(C)C)NC(=O)CC2=CC(=CC(=C2)F)F |
| Synonym | dapt,dapt gsi-ix,gamma-secretase inhibitor ix,gsi-ix,insolution gamma-secretase inhibitor ix,s-tert-butyl 2-s-2-2-3,5-difluorophenyl acetamido propanamido-2-phenylacetate,n-n-3,5-difluorophenacetyl-l-alanyl-s-phenylglycine t-butyl ester,tert-butyl 2s-2-2s-2-2-3,5-difluorophenyl acetamido propanamido-2-phenylacetate,tert-butyl 2s-2-2s-2-2-3,5-difluorophenyl acetyl amino propanoyl amino-2-phenylacetate,gsiix |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoyl]amino]-2-phenylacetate |
| InChI Key | DWJXYEABWRJFSP-XOBRGWDASA-N |
| Molecular Formula | C23H26F2N2O4 |
3-Fluorobenzyl bromide, 95%
CAS: 456-41-7 Molecular Formula: C7H6BrF Molecular Weight (g/mol): 189.027 MDL Number: MFCD00000340 InChI Key: SCBZBMXPJYMXRC-UHFFFAOYSA-N Synonym: 3-fluorobenzyl bromide,1-bromomethyl-3-fluorobenzene,3-fluorobenzylbromide,m-fluorobenzyl bromide,benzene, 1-bromomethyl-3-fluoro,m-fluorobenzylbromide,alpha-bromo-m-fluorotoluene,alpha-bromo-3-fluorotoluene,toluene, .alpha.-bromo-m-fluoro,1-bromobenzyl-3-fluorobenzene PubChem CID: 68007 IUPAC Name: 1-(bromomethyl)-3-fluorobenzene SMILES: C1=CC(=CC(=C1)F)CBr
| PubChem CID | 68007 |
|---|---|
| CAS | 456-41-7 |
| Molecular Weight (g/mol) | 189.027 |
| MDL Number | MFCD00000340 |
| SMILES | C1=CC(=CC(=C1)F)CBr |
| Synonym | 3-fluorobenzyl bromide,1-bromomethyl-3-fluorobenzene,3-fluorobenzylbromide,m-fluorobenzyl bromide,benzene, 1-bromomethyl-3-fluoro,m-fluorobenzylbromide,alpha-bromo-m-fluorotoluene,alpha-bromo-3-fluorotoluene,toluene, .alpha.-bromo-m-fluoro,1-bromobenzyl-3-fluorobenzene |
| IUPAC Name | 1-(bromomethyl)-3-fluorobenzene |
| InChI Key | SCBZBMXPJYMXRC-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrF |
4-Formylbenzeneboronic acid, 97%
CAS: 87199-17-5 Molecular Formula: C7H7BO3 Molecular Weight (g/mol): 149.94 MDL Number: MFCD00151823 InChI Key: VXWBQOJISHAKKM-UHFFFAOYSA-N Synonym: 4-formylphenyl boronic acid,4-formylbenzeneboronic acid,4-boronobenzaldehyde,boronic acid, 4-formylphenyl,boronic acid, b-4-formylphenyl,p-formylphenylboronic acid,4-dihydroxyboryl benzaldehyde,4-dihydroxyboranyl benzaldehyde,4-benzaldehyde boronic acid,4-formyl-phenylboronic acid PubChem CID: 591073 IUPAC Name: (4-formylphenyl)boronic acid SMILES: OB(O)C1=CC=C(C=O)C=C1
| PubChem CID | 591073 |
|---|---|
| CAS | 87199-17-5 |
| Molecular Weight (g/mol) | 149.94 |
| MDL Number | MFCD00151823 |
| SMILES | OB(O)C1=CC=C(C=O)C=C1 |
| Synonym | 4-formylphenyl boronic acid,4-formylbenzeneboronic acid,4-boronobenzaldehyde,boronic acid, 4-formylphenyl,boronic acid, b-4-formylphenyl,p-formylphenylboronic acid,4-dihydroxyboryl benzaldehyde,4-dihydroxyboranyl benzaldehyde,4-benzaldehyde boronic acid,4-formyl-phenylboronic acid |
| IUPAC Name | (4-formylphenyl)boronic acid |
| InChI Key | VXWBQOJISHAKKM-UHFFFAOYSA-N |
| Molecular Formula | C7H7BO3 |
Ethyl salicylate, 99%
CAS: 118-61-6 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00002215 InChI Key: GYCKQBWUSACYIF-UHFFFAOYSA-N Synonym: ethyl salicylate,sal ethyl,mesotol,salotan,salicylic ether,salicylic acid, ethyl ester,benzoic acid, 2-hydroxy-, ethyl ester,ethyl o-hydroxybenzoate,o-ethoxycarbonyl phenol,2-hydroxybenzoic acid ethyl ester PubChem CID: 8365 IUPAC Name: ethyl 2-hydroxybenzoate SMILES: CCOC(=O)C1=CC=CC=C1O
| PubChem CID | 8365 |
|---|---|
| CAS | 118-61-6 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00002215 |
| SMILES | CCOC(=O)C1=CC=CC=C1O |
| Synonym | ethyl salicylate,sal ethyl,mesotol,salotan,salicylic ether,salicylic acid, ethyl ester,benzoic acid, 2-hydroxy-, ethyl ester,ethyl o-hydroxybenzoate,o-ethoxycarbonyl phenol,2-hydroxybenzoic acid ethyl ester |
| IUPAC Name | ethyl 2-hydroxybenzoate |
| InChI Key | GYCKQBWUSACYIF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Dimethyl terephthalate, 99%
CAS: 120-61-6 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00008440 InChI Key: WOZVHXUHUFLZGK-UHFFFAOYSA-N Synonym: dimethyl terephthalate,dimethyl p-phthalate,1,4-benzenedicarboxylic acid, dimethyl ester,dimethyl p-benzenedicarboxylate,di-me terephthalate,dimethyl 4-phthalate,terephthalic acid, dimethyl ester,dimethyl 1,4-benzenedicarboxylate,terephthalic acid dimethyl ester,methyl p-methoxycarbonyl benzoate PubChem CID: 8441 SMILES: COC(=O)C1=CC=C(C=C1)C(=O)OC
| PubChem CID | 8441 |
|---|---|
| CAS | 120-61-6 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00008440 |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)OC |
| Synonym | dimethyl terephthalate,dimethyl p-phthalate,1,4-benzenedicarboxylic acid, dimethyl ester,dimethyl p-benzenedicarboxylate,di-me terephthalate,dimethyl 4-phthalate,terephthalic acid, dimethyl ester,dimethyl 1,4-benzenedicarboxylate,terephthalic acid dimethyl ester,methyl p-methoxycarbonyl benzoate |
| InChI Key | WOZVHXUHUFLZGK-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
4-Fluorobenzyl bromide, 97%
CAS: 459-46-1 Molecular Formula: C7H6BrF Molecular Weight (g/mol): 189.03 MDL Number: MFCD00000359 InChI Key: NVNPLEPBDPJYRZ-UHFFFAOYSA-N Synonym: 4-fluorobenzyl bromide,1-bromomethyl-4-fluorobenzene,p-fluorobenzyl bromide,4-fluorobenzylbromide,benzene, 1-bromomethyl-4-fluoro,alpha-bromo-p-fluorotoluene,alpha-bromo-4-fluorotoluene,1-bromomethyl-4-fluoro-benzene,4-bromomethyl-1-fluorobenzene,para-fluorobenzyl bromide PubChem CID: 68021 IUPAC Name: 1-(bromomethyl)-4-fluorobenzene SMILES: FC1=CC=C(CBr)C=C1
| PubChem CID | 68021 |
|---|---|
| CAS | 459-46-1 |
| Molecular Weight (g/mol) | 189.03 |
| MDL Number | MFCD00000359 |
| SMILES | FC1=CC=C(CBr)C=C1 |
| Synonym | 4-fluorobenzyl bromide,1-bromomethyl-4-fluorobenzene,p-fluorobenzyl bromide,4-fluorobenzylbromide,benzene, 1-bromomethyl-4-fluoro,alpha-bromo-p-fluorotoluene,alpha-bromo-4-fluorotoluene,1-bromomethyl-4-fluoro-benzene,4-bromomethyl-1-fluorobenzene,para-fluorobenzyl bromide |
| IUPAC Name | 1-(bromomethyl)-4-fluorobenzene |
| InChI Key | NVNPLEPBDPJYRZ-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrF |
2-Bromo-1,3,5-triisopropylbenzene 95.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 21524-34-5 Molecular Formula: C15H23Br Molecular Weight (g/mol): 283.253 MDL Number: MFCD00051547 InChI Key: FUMMYHVKFAHQST-UHFFFAOYSA-N Synonym: 2-bromo-1,3,5-triisopropylbenzene,1-bromo-2,4,6-triisopropylbenzene,2,4,6-triisopropylbromobenzene,1,3,5-triisopropyl-2-bromobenzene,2-bromo-1,3,5-tris propan-2-yl benzene,2-bromo-1,3,5-triisopropyl-benzene,2-bromo-1,3,5-tri propan-2-yl benzene,benzene, 2-bromo-1,3,5-tris 1-methylethyl,2-bromo-1,3,5-tris 1-methylethyl-benzene,acmc-209flf PubChem CID: 140846 IUPAC Name: 2-bromo-1,3,5-tri(propan-2-yl)benzene SMILES: CC(C)C1=CC(=C(C(=C1)C(C)C)Br)C(C)C
| PubChem CID | 140846 |
|---|---|
| CAS | 21524-34-5 |
| Molecular Weight (g/mol) | 283.253 |
| MDL Number | MFCD00051547 |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)Br)C(C)C |
| Synonym | 2-bromo-1,3,5-triisopropylbenzene,1-bromo-2,4,6-triisopropylbenzene,2,4,6-triisopropylbromobenzene,1,3,5-triisopropyl-2-bromobenzene,2-bromo-1,3,5-tris propan-2-yl benzene,2-bromo-1,3,5-triisopropyl-benzene,2-bromo-1,3,5-tri propan-2-yl benzene,benzene, 2-bromo-1,3,5-tris 1-methylethyl,2-bromo-1,3,5-tris 1-methylethyl-benzene,acmc-209flf |
| IUPAC Name | 2-bromo-1,3,5-tri(propan-2-yl)benzene |
| InChI Key | FUMMYHVKFAHQST-UHFFFAOYSA-N |
| Molecular Formula | C15H23Br |
4-Amino-2,3,5,6-tetrafluorobenzoic acid, 97%
CAS: 944-43-4 Molecular Formula: C7H3F4NO2 Molecular Weight (g/mol): 209.1 MDL Number: MFCD00007647 InChI Key: WTNSXWSOTDBWOR-UHFFFAOYSA-N Synonym: 2,3,5,6-tetrafluoro-4-aminobenzoic acid,acmc-209rrw,4-amino-2,3,5,6-tetrafluorobenzoicacid,2,3,5,6-tetrafluoro-4-amino-benzoic acid,4-amino-2,3,5,6-tetrafluoro-benzoic acid,benzoic acid,4-amino-2,3,5,6-tetrafluoro,benzoic acid, 4-amino-2,3,5,6-tetrafluoro,4-amino-2,3,5,6-tetrafluorobenzoic acid PubChem CID: 70345 IUPAC Name: 4-amino-2,3,5,6-tetrafluorobenzoic acid SMILES: C1(=C(C(=C(C(=C1F)F)N)F)F)C(=O)O
| PubChem CID | 70345 |
|---|---|
| CAS | 944-43-4 |
| Molecular Weight (g/mol) | 209.1 |
| MDL Number | MFCD00007647 |
| SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)C(=O)O |
| Synonym | 2,3,5,6-tetrafluoro-4-aminobenzoic acid,acmc-209rrw,4-amino-2,3,5,6-tetrafluorobenzoicacid,2,3,5,6-tetrafluoro-4-amino-benzoic acid,4-amino-2,3,5,6-tetrafluoro-benzoic acid,benzoic acid,4-amino-2,3,5,6-tetrafluoro,benzoic acid, 4-amino-2,3,5,6-tetrafluoro,4-amino-2,3,5,6-tetrafluorobenzoic acid |
| IUPAC Name | 4-amino-2,3,5,6-tetrafluorobenzoic acid |
| InChI Key | WTNSXWSOTDBWOR-UHFFFAOYSA-N |
| Molecular Formula | C7H3F4NO2 |
2-Amino-4-nitrobenzoic acid, 97+%
CAS: 619-17-0 Molecular Formula: C7H6N2O4 Molecular Weight (g/mol): 182.14 MDL Number: MFCD00007262 InChI Key: UEALKTCRMBVTFN-UHFFFAOYSA-N Synonym: 2-amino-4-nitrobenzoic acid,4-nitroanthranilic acid,benzoic acid, 2-amino-4-nitro,2-amino-4-nitrobenzoicacid,anthranilic acid, 4-nitro,ccris 441,2-amino-4-nitro-benzoic acid,4-nitro-2-aminobenzoic acid,dsstox_cid_963,dsstox_rid_75891 PubChem CID: 12076 ChEBI: CHEBI:75335 IUPAC Name: 2-amino-4-nitrobenzoic acid SMILES: NC1=CC(=CC=C1C(O)=O)[N+]([O-])=O
| PubChem CID | 12076 |
|---|---|
| CAS | 619-17-0 |
| Molecular Weight (g/mol) | 182.14 |
| ChEBI | CHEBI:75335 |
| MDL Number | MFCD00007262 |
| SMILES | NC1=CC(=CC=C1C(O)=O)[N+]([O-])=O |
| Synonym | 2-amino-4-nitrobenzoic acid,4-nitroanthranilic acid,benzoic acid, 2-amino-4-nitro,2-amino-4-nitrobenzoicacid,anthranilic acid, 4-nitro,ccris 441,2-amino-4-nitro-benzoic acid,4-nitro-2-aminobenzoic acid,dsstox_cid_963,dsstox_rid_75891 |
| IUPAC Name | 2-amino-4-nitrobenzoic acid |
| InChI Key | UEALKTCRMBVTFN-UHFFFAOYSA-N |
| Molecular Formula | C7H6N2O4 |
4-[(Trimethylsilyl)ethynyl]benzaldehyde, 97%
CAS: 77123-57-0 Molecular Formula: C12H14OSi Molecular Weight (g/mol): 202.33 MDL Number: MFCD02093765 InChI Key: UZQDUXAJFTWMDT-UHFFFAOYSA-N Synonym: 4-trimethylsilyl ethynyl benzaldehyde,4-trimethylsilyl ethynylbenzaldehyde,4-2-trimethylsilylethynyl benzaldehyde,4-2-trimethylsilyl ethynyl benzaldehyde,benzaldehyde, 4-trimethylsilyl ethynyl,acmc-1bios,p-trimethylsilylethynylbenzaldehyde,4-trimethylsilylethynylbenzaldehyde PubChem CID: 2771643 IUPAC Name: 4-(2-trimethylsilylethynyl)benzaldehyde SMILES: C[Si](C)(C)C#CC1=CC=C(C=O)C=C1
| PubChem CID | 2771643 |
|---|---|
| CAS | 77123-57-0 |
| Molecular Weight (g/mol) | 202.33 |
| MDL Number | MFCD02093765 |
| SMILES | C[Si](C)(C)C#CC1=CC=C(C=O)C=C1 |
| Synonym | 4-trimethylsilyl ethynyl benzaldehyde,4-trimethylsilyl ethynylbenzaldehyde,4-2-trimethylsilylethynyl benzaldehyde,4-2-trimethylsilyl ethynyl benzaldehyde,benzaldehyde, 4-trimethylsilyl ethynyl,acmc-1bios,p-trimethylsilylethynylbenzaldehyde,4-trimethylsilylethynylbenzaldehyde |
| IUPAC Name | 4-(2-trimethylsilylethynyl)benzaldehyde |
| InChI Key | UZQDUXAJFTWMDT-UHFFFAOYSA-N |
| Molecular Formula | C12H14OSi |
4-tert-Amylphenol, 99%
CAS: 80-46-6 Molecular Formula: C11H16O Molecular Weight (g/mol): 164.25 MDL Number: MFCD00002369 InChI Key: NRZWYNLTFLDQQX-UHFFFAOYSA-N Synonym: 4-tert-amylphenol,4-tert-pentylphenol,p-tert-amylphenol,p-tert-pentylphenol,4-t-amylphenol,4-1,1-dimethylpropyl phenol,amilphenol,amilfenol,pentaphen,tert-amylphenol PubChem CID: 6643 ChEBI: CHEBI:35096 IUPAC Name: 4-(2-methylbutan-2-yl)phenol SMILES: CCC(C)(C)C1=CC=C(C=C1)O
| PubChem CID | 6643 |
|---|---|
| CAS | 80-46-6 |
| Molecular Weight (g/mol) | 164.25 |
| ChEBI | CHEBI:35096 |
| MDL Number | MFCD00002369 |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)O |
| Synonym | 4-tert-amylphenol,4-tert-pentylphenol,p-tert-amylphenol,p-tert-pentylphenol,4-t-amylphenol,4-1,1-dimethylpropyl phenol,amilphenol,amilfenol,pentaphen,tert-amylphenol |
| IUPAC Name | 4-(2-methylbutan-2-yl)phenol |
| InChI Key | NRZWYNLTFLDQQX-UHFFFAOYSA-N |
| Molecular Formula | C11H16O |
2-Methyl-5-nitroaniline, 98+%
CAS: 99-55-8 Molecular Formula: C7H8N2O2 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00007741 InChI Key: DSBIJCMXAIKKKI-UHFFFAOYSA-N Synonym: 2-amino-4-nitrotoluene,5-nitro-o-toluidine,fast scarlet g,pnot,scarlet g base,2-methyl-5-nitrobenzenamine,4-nitro-2-aminotoluene,devol scarlet b,diabase scarlet g,scarlet base nsp PubChem CID: 7444 ChEBI: CHEBI:66891 IUPAC Name: 2-methyl-5-nitroaniline SMILES: CC1=CC=C(C=C1N)[N+]([O-])=O
| PubChem CID | 7444 |
|---|---|
| CAS | 99-55-8 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:66891 |
| MDL Number | MFCD00007741 |
| SMILES | CC1=CC=C(C=C1N)[N+]([O-])=O |
| Synonym | 2-amino-4-nitrotoluene,5-nitro-o-toluidine,fast scarlet g,pnot,scarlet g base,2-methyl-5-nitrobenzenamine,4-nitro-2-aminotoluene,devol scarlet b,diabase scarlet g,scarlet base nsp |
| IUPAC Name | 2-methyl-5-nitroaniline |
| InChI Key | DSBIJCMXAIKKKI-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O2 |
Celecoxib 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 169590-42-5 Molecular Formula: C17H14F3N3O2S Molecular Weight (g/mol): 381.373 MDL Number: MFCD00941298 InChI Key: RZEKVGVHFLEQIL-UHFFFAOYSA-N Synonym: celecoxib,celebrex,celebra,onsenal,celocoxib,celecox,xilebao,4-5-4-methylphenyl-3-trifluoromethyl-1h-pyrazol-1-yl benzenesulfonamide,celecoxib usan,celecoxib old rn PubChem CID: 2662 ChEBI: CHEBI:41423 IUPAC Name: 4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide SMILES: CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F
| PubChem CID | 2662 |
|---|---|
| CAS | 169590-42-5 |
| Molecular Weight (g/mol) | 381.373 |
| ChEBI | CHEBI:41423 |
| MDL Number | MFCD00941298 |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
| Synonym | celecoxib,celebrex,celebra,onsenal,celocoxib,celecox,xilebao,4-5-4-methylphenyl-3-trifluoromethyl-1h-pyrazol-1-yl benzenesulfonamide,celecoxib usan,celecoxib old rn |
| IUPAC Name | 4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| InChI Key | RZEKVGVHFLEQIL-UHFFFAOYSA-N |
| Molecular Formula | C17H14F3N3O2S |