Benzene and substituted derivatives
Filtered Search Results
4-Bromo-3-nitrobenzoic acid, 95%
CAS: 6319-40-0 Molecular Formula: C7H4BrNO4 Molecular Weight (g/mol): 246.016 MDL Number: MFCD00272137 InChI Key: RVCTZJVBWNFYRU-UHFFFAOYSA-N Synonym: 4-bromo-3-nitrobenzoic acid,3-nitro-4-bromobenzoic acid,benzoic acid, 4-bromo-3-nitro,4-bromo-3-nitro-benzoic acid,zlchem 531,pubchem2194,acmc-209ndq,ksc353s1b,4-bromo-3-nitrobenzoic acid # PubChem CID: 232986 SMILES: C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])Br
| PubChem CID | 232986 |
|---|---|
| CAS | 6319-40-0 |
| Molecular Weight (g/mol) | 246.016 |
| MDL Number | MFCD00272137 |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])Br |
| Synonym | 4-bromo-3-nitrobenzoic acid,3-nitro-4-bromobenzoic acid,benzoic acid, 4-bromo-3-nitro,4-bromo-3-nitro-benzoic acid,zlchem 531,pubchem2194,acmc-209ndq,ksc353s1b,4-bromo-3-nitrobenzoic acid # |
| InChI Key | RVCTZJVBWNFYRU-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrNO4 |
1,4-Bis[alpha-(4-chlorophenyl)benzyl]piperazine dihydrochloride, 97%
CAS: 346451-15-8 Molecular Formula: C30H30Cl4N2 Molecular Weight (g/mol): 560.384 MDL Number: MFCD03844641 InChI Key: DLEQNCKNBPYHEY-UHFFFAOYSA-N Synonym: 1,4-bis 4-chlorophenyl phenylmethyl piperazine dihydrochloride,cetirizine impurity d,1,4-bis 4-chlorophenyl phenylmethyl-piperazine dihydrochloride,1,4-bis 4-chlorophenyl phenyl methyl piperazine dihydrochloride,1,4-bis 4-chlorophenyl-phenylmethyl piperazine;dihydrochloride PubChem CID: 24720891 IUPAC Name: 1,4-bis[(4-chlorophenyl)-phenylmethyl]piperazine;dihydrochloride SMILES: C1CN(CCN1C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)C(C4=CC=CC=C4)C5=CC=C(C=C5)Cl.Cl.Cl
| PubChem CID | 24720891 |
|---|---|
| CAS | 346451-15-8 |
| Molecular Weight (g/mol) | 560.384 |
| MDL Number | MFCD03844641 |
| SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)C(C4=CC=CC=C4)C5=CC=C(C=C5)Cl.Cl.Cl |
| Synonym | 1,4-bis 4-chlorophenyl phenylmethyl piperazine dihydrochloride,cetirizine impurity d,1,4-bis 4-chlorophenyl phenylmethyl-piperazine dihydrochloride,1,4-bis 4-chlorophenyl phenyl methyl piperazine dihydrochloride,1,4-bis 4-chlorophenyl-phenylmethyl piperazine;dihydrochloride |
| IUPAC Name | 1,4-bis[(4-chlorophenyl)-phenylmethyl]piperazine;dihydrochloride |
| InChI Key | DLEQNCKNBPYHEY-UHFFFAOYSA-N |
| Molecular Formula | C30H30Cl4N2 |
Tetraphenylphosphonium Bromide, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 2751-90-8
| CAS | 2751-90-8 |
|---|
Trimesoyl Chloride, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
alpha,4-Dimethylstyrene, stab. with 4-tert-butylcatechol
CAS: 1195-32-0 Molecular Formula: C10H12 Molecular Weight (g/mol): 132.21 MDL Number: MFCD00036510 InChI Key: MMSLOZQEMPDGPI-UHFFFAOYSA-N Synonym: 1-methyl-4-prop-1-en-2-yl benzene,dehydro-p-cymene,2-p-tolylpropene,4-isopropenyltoluene,4-methylisopropenylbenzene,2-p-methylphenyl propene,p-cymenene,p,alpha-dimethylstyrene,p-alpha-dimethylstyrene,1-isopropenyl-4-methylbenzene PubChem CID: 62385 SMILES: CC(=C)C1=CC=C(C)C=C1
| PubChem CID | 62385 |
|---|---|
| CAS | 1195-32-0 |
| Molecular Weight (g/mol) | 132.21 |
| MDL Number | MFCD00036510 |
| SMILES | CC(=C)C1=CC=C(C)C=C1 |
| Synonym | 1-methyl-4-prop-1-en-2-yl benzene,dehydro-p-cymene,2-p-tolylpropene,4-isopropenyltoluene,4-methylisopropenylbenzene,2-p-methylphenyl propene,p-cymenene,p,alpha-dimethylstyrene,p-alpha-dimethylstyrene,1-isopropenyl-4-methylbenzene |
| InChI Key | MMSLOZQEMPDGPI-UHFFFAOYSA-N |
| Molecular Formula | C10H12 |
Diphenyl carbonate, 99%
CAS: 102-09-0 Molecular Formula: C13H10O3 Molecular Weight (g/mol): 214.22 InChI Key: ROORDVPLFPIABK-UHFFFAOYSA-N Synonym: carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate PubChem CID: 7597 ChEBI: CHEBI:34722 IUPAC Name: diphenyl carbonate SMILES: C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2
| PubChem CID | 7597 |
|---|---|
| CAS | 102-09-0 |
| Molecular Weight (g/mol) | 214.22 |
| ChEBI | CHEBI:34722 |
| SMILES | C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| Synonym | carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate |
| IUPAC Name | diphenyl carbonate |
| InChI Key | ROORDVPLFPIABK-UHFFFAOYSA-N |
| Molecular Formula | C13H10O3 |
4,4″-Diamino-p-terphenyl, 95%
CAS: 3365-85-3 Molecular Formula: C18H16N2 Molecular Weight (g/mol): 260.34 MDL Number: MFCD00051532 InChI Key: QBSMHWVGUPQNJJ-UHFFFAOYSA-N Synonym: 4,4-diamino-p-terphenyl,4,4-diaminoterphenyl,4-4-4-aminophenyl phenyl aniline,ccris 4965,p-terphenyl, 4,4-diamine,1,1':4',1-terphenyl-4,4-diamine,4'-4-aminophenyl-1,1'-biphenyl-4-amine,4,4-diamino-4-terphenyl PubChem CID: 104949 IUPAC Name: 4-[4-(4-aminophenyl)phenyl]aniline SMILES: C1=CC(=CC=C1C2=CC=C(C=C2)N)C3=CC=C(C=C3)N
| PubChem CID | 104949 |
|---|---|
| CAS | 3365-85-3 |
| Molecular Weight (g/mol) | 260.34 |
| MDL Number | MFCD00051532 |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N)C3=CC=C(C=C3)N |
| Synonym | 4,4-diamino-p-terphenyl,4,4-diaminoterphenyl,4-4-4-aminophenyl phenyl aniline,ccris 4965,p-terphenyl, 4,4-diamine,1,1':4',1-terphenyl-4,4-diamine,4'-4-aminophenyl-1,1'-biphenyl-4-amine,4,4-diamino-4-terphenyl |
| IUPAC Name | 4-[4-(4-aminophenyl)phenyl]aniline |
| InChI Key | QBSMHWVGUPQNJJ-UHFFFAOYSA-N |
| Molecular Formula | C18H16N2 |
Methyl 2-amino-3-bromo-5-methoxybenzoate, 96%, Thermo Scientific Chemicals
CAS: 1378874-22-6 Molecular Formula: C9H10BrNO3 Molecular Weight (g/mol): 260.087 MDL Number: MFCD20527215 InChI Key: WPRSGBOUSTUNEC-UHFFFAOYSA-N Synonym: 2-amino-3-bromo-5-methoxybenzoic acid methyl ester PubChem CID: 73995991 IUPAC Name: methyl 2-amino-3-bromo-5-methoxybenzoate SMILES: COC1=CC(=C(C(=C1)C(=O)OC)N)Br
| PubChem CID | 73995991 |
|---|---|
| CAS | 1378874-22-6 |
| Molecular Weight (g/mol) | 260.087 |
| MDL Number | MFCD20527215 |
| SMILES | COC1=CC(=C(C(=C1)C(=O)OC)N)Br |
| Synonym | 2-amino-3-bromo-5-methoxybenzoic acid methyl ester |
| IUPAC Name | methyl 2-amino-3-bromo-5-methoxybenzoate |
| InChI Key | WPRSGBOUSTUNEC-UHFFFAOYSA-N |
| Molecular Formula | C9H10BrNO3 |
1,4-Dibromobenzene, 99%
CAS: 106-37-6 Molecular Formula: C6H4Br2 Molecular Weight (g/mol): 235.91 MDL Number: MFCD00000089 InChI Key: SWJPEBQEEAHIGZ-UHFFFAOYSA-N Synonym: p-dibromobenzene,p-bromophenyl bromide,benzene, 1,4-dibromo,benzene, p-dibromo,p-benzene dibromide,1,4-dibromo benzene,1,4-dibromo-benzene,unii-9991w3m5hz,dibromobenzene, 1,4,labotest-bb ltbb002071 PubChem CID: 7804 ChEBI: CHEBI:37150 IUPAC Name: 1,4-dibromobenzene SMILES: BrC1=CC=C(Br)C=C1
| PubChem CID | 7804 |
|---|---|
| CAS | 106-37-6 |
| Molecular Weight (g/mol) | 235.91 |
| ChEBI | CHEBI:37150 |
| MDL Number | MFCD00000089 |
| SMILES | BrC1=CC=C(Br)C=C1 |
| Synonym | p-dibromobenzene,p-bromophenyl bromide,benzene, 1,4-dibromo,benzene, p-dibromo,p-benzene dibromide,1,4-dibromo benzene,1,4-dibromo-benzene,unii-9991w3m5hz,dibromobenzene, 1,4,labotest-bb ltbb002071 |
| IUPAC Name | 1,4-dibromobenzene |
| InChI Key | SWJPEBQEEAHIGZ-UHFFFAOYSA-N |
| Molecular Formula | C6H4Br2 |
2-Bromo-5-fluorophenyl acetic acid, 96%, Thermo Scientific Chemicals
CAS: 739336-26-6 Molecular Formula: C8H6BrFO2 Molecular Weight (g/mol): 233.036 MDL Number: MFCD03094440 InChI Key: BPNWLZNAKZSBHH-UHFFFAOYSA-N Synonym: 2-bromo-5-fluorophenylacetic acid,2-2-bromo-5-fluorophenyl acetic acid,2-bromo-5-fluorophenyl acetic acid,2-bromo-5-fluorophenylaceticacid,2-bromo-5-fulorophenylacetic acid,benzeneacetic acid, 2-bromo-5-fluoro,2-bromo-5-fluoro-phenyl-acetic acid,pubchem16327,2-2-bromo-5-fluoro-phenyl acetic acid,acmc-209osx PubChem CID: 2773927 IUPAC Name: 2-(2-bromo-5-fluorophenyl)acetic acid SMILES: C1=CC(=C(C=C1F)CC(=O)O)Br
| PubChem CID | 2773927 |
|---|---|
| CAS | 739336-26-6 |
| Molecular Weight (g/mol) | 233.036 |
| MDL Number | MFCD03094440 |
| SMILES | C1=CC(=C(C=C1F)CC(=O)O)Br |
| Synonym | 2-bromo-5-fluorophenylacetic acid,2-2-bromo-5-fluorophenyl acetic acid,2-bromo-5-fluorophenyl acetic acid,2-bromo-5-fluorophenylaceticacid,2-bromo-5-fulorophenylacetic acid,benzeneacetic acid, 2-bromo-5-fluoro,2-bromo-5-fluoro-phenyl-acetic acid,pubchem16327,2-2-bromo-5-fluoro-phenyl acetic acid,acmc-209osx |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)acetic acid |
| InChI Key | BPNWLZNAKZSBHH-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrFO2 |
2-Chloro-4-fluoro-5-nitrotoluene, 97%, Thermo Scientific Chemicals
CAS: 112108-73-3 Molecular Formula: C7H5ClFNO2 Molecular Weight (g/mol): 189.57 MDL Number: MFCD11110549 InChI Key: YXVJHZWHPLOEAP-UHFFFAOYSA-N Synonym: 2-chloro-4-fluoro-5-nitrotoluene,1-chloro-5-fluoro-2-methyl-4-nitro-benzene,benzene, 1-chloro-5-fluoro-2-methyl-4-nitro,acmc-2099cn,ksc682i1p,2-chloro-4fluoro-5-nitrotoluene,1-chloranyl-5-fluoranyl-2-methyl-4-nitro-benzene PubChem CID: 10103979 IUPAC Name: 1-chloro-5-fluoro-2-methyl-4-nitrobenzene SMILES: CC1=CC(=C(C=C1Cl)F)[N+](=O)[O-]
| PubChem CID | 10103979 |
|---|---|
| CAS | 112108-73-3 |
| Molecular Weight (g/mol) | 189.57 |
| MDL Number | MFCD11110549 |
| SMILES | CC1=CC(=C(C=C1Cl)F)[N+](=O)[O-] |
| Synonym | 2-chloro-4-fluoro-5-nitrotoluene,1-chloro-5-fluoro-2-methyl-4-nitro-benzene,benzene, 1-chloro-5-fluoro-2-methyl-4-nitro,acmc-2099cn,ksc682i1p,2-chloro-4fluoro-5-nitrotoluene,1-chloranyl-5-fluoranyl-2-methyl-4-nitro-benzene |
| IUPAC Name | 1-chloro-5-fluoro-2-methyl-4-nitrobenzene |
| InChI Key | YXVJHZWHPLOEAP-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClFNO2 |
2-Amino-3,6-dichlorobenzoic acid, 95%, Thermo Scientific Chemicals
CAS: 3032-32-4 Molecular Formula: C7H5Cl2NO2 Molecular Weight (g/mol): 206.02 MDL Number: MFCD00052390 InChI Key: MMIREQFMYZQWLU-UHFFFAOYSA-N PubChem CID: 604542 IUPAC Name: 2-amino-3,6-dichlorobenzoic acid SMILES: NC1=C(Cl)C=CC(Cl)=C1C(O)=O
| PubChem CID | 604542 |
|---|---|
| CAS | 3032-32-4 |
| Molecular Weight (g/mol) | 206.02 |
| MDL Number | MFCD00052390 |
| SMILES | NC1=C(Cl)C=CC(Cl)=C1C(O)=O |
| IUPAC Name | 2-amino-3,6-dichlorobenzoic acid |
| InChI Key | MMIREQFMYZQWLU-UHFFFAOYSA-N |
| Molecular Formula | C7H5Cl2NO2 |
4-Bromo-3,5-difluorobenzoic acid, 96%, Thermo Scientific Chemicals
CAS: 651027-00-8 Molecular Formula: C7H3BrF2O2 Molecular Weight (g/mol): 237.00 MDL Number: MFCD18917156 InChI Key: NLLRAEQVOZOSBB-UHFFFAOYSA-N Synonym: benzoic acid, 4-bromo-3,5-difluoro,4-bromo-3,5-difluorobenzoicacid,3,5-difluoro-4-bromobenzoic acid PubChem CID: 11424897 IUPAC Name: 4-bromo-3,5-difluorobenzoic acid SMILES: OC(=O)C1=CC(F)=C(Br)C(F)=C1
| PubChem CID | 11424897 |
|---|---|
| CAS | 651027-00-8 |
| Molecular Weight (g/mol) | 237.00 |
| MDL Number | MFCD18917156 |
| SMILES | OC(=O)C1=CC(F)=C(Br)C(F)=C1 |
| Synonym | benzoic acid, 4-bromo-3,5-difluoro,4-bromo-3,5-difluorobenzoicacid,3,5-difluoro-4-bromobenzoic acid |
| IUPAC Name | 4-bromo-3,5-difluorobenzoic acid |
| InChI Key | NLLRAEQVOZOSBB-UHFFFAOYSA-N |
| Molecular Formula | C7H3BrF2O2 |
2-Fluoro-4-methylbenzeneboronic acid pinacol ester, 96%, Thermo Scientific™
CAS: 1165936-03-7 Molecular Formula: C13H18BFO2 Molecular Weight (g/mol): 236.093 MDL Number: MFCD18779806 InChI Key: MKWDECBHRFNFGY-UHFFFAOYSA-N Synonym: 2-2-fluoro-4-methylphenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-fluoro-4-methylphenylboronic acid pinacol ester,2-fluoro-4-methylbenzeneboronic acid pinacol ester,2-fluoro-4-methylphenyl boronic acid pinacol ester PubChem CID: 69672435 IUPAC Name: 2-(2-fluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)F
| PubChem CID | 69672435 |
|---|---|
| CAS | 1165936-03-7 |
| Molecular Weight (g/mol) | 236.093 |
| MDL Number | MFCD18779806 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)F |
| Synonym | 2-2-fluoro-4-methylphenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-fluoro-4-methylphenylboronic acid pinacol ester,2-fluoro-4-methylbenzeneboronic acid pinacol ester,2-fluoro-4-methylphenyl boronic acid pinacol ester |
| IUPAC Name | 2-(2-fluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | MKWDECBHRFNFGY-UHFFFAOYSA-N |
| Molecular Formula | C13H18BFO2 |
2-Chloro-3-nitrobenzotrifluoride, 98%
CAS: 39974-35-1 Molecular Formula: C7H3ClF3NO2 Molecular Weight (g/mol): 225.55 MDL Number: MFCD14525509 InChI Key: TWABRHQBRWLSSE-UHFFFAOYSA-N PubChem CID: 3016126 IUPAC Name: 2-chloro-1-nitro-3-(trifluoromethyl)benzene SMILES: [O-][N+](=O)C1=CC=CC(=C1Cl)C(F)(F)F
| PubChem CID | 3016126 |
|---|---|
| CAS | 39974-35-1 |
| Molecular Weight (g/mol) | 225.55 |
| MDL Number | MFCD14525509 |
| SMILES | [O-][N+](=O)C1=CC=CC(=C1Cl)C(F)(F)F |
| IUPAC Name | 2-chloro-1-nitro-3-(trifluoromethyl)benzene |
| InChI Key | TWABRHQBRWLSSE-UHFFFAOYSA-N |
| Molecular Formula | C7H3ClF3NO2 |