Benzene and substituted derivatives
Filtered Search Results
Benzyl alcohol, for analysis
CAS: 100-51-6 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00004599,MFCD03792087 InChI Key: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC Name: phenylmethanol SMILES: OCC1=CC=CC=C1
| PubChem CID | 244 |
|---|---|
| CAS | 100-51-6 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17987 |
| MDL Number | MFCD00004599,MFCD03792087 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| IUPAC Name | phenylmethanol |
| InChI Key | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
N-Phenylthiourea, 97%
CAS: 103-85-5 Molecular Formula: C7H8N2S Molecular Weight (g/mol): 152.22 MDL Number: MFCD00004933 InChI Key: FULZLIGZKMKICU-UHFFFAOYSA-N Synonym: n-phenylthiourea,1-phenylthiourea,1-phenyl-2-thiourea,phenylthiocarbamide,thiourea, phenyl,phenyl-2-thiourea,fenylthiomocovina,urea, 1-phenyl-2-thio,rcra waste number p093,phenyl-thiourea PubChem CID: 676454 ChEBI: CHEBI:46261 IUPAC Name: phenylthiourea SMILES: NC(=S)NC1=CC=CC=C1
| PubChem CID | 676454 |
|---|---|
| CAS | 103-85-5 |
| Molecular Weight (g/mol) | 152.22 |
| ChEBI | CHEBI:46261 |
| MDL Number | MFCD00004933 |
| SMILES | NC(=S)NC1=CC=CC=C1 |
| Synonym | n-phenylthiourea,1-phenylthiourea,1-phenyl-2-thiourea,phenylthiocarbamide,thiourea, phenyl,phenyl-2-thiourea,fenylthiomocovina,urea, 1-phenyl-2-thio,rcra waste number p093,phenyl-thiourea |
| IUPAC Name | phenylthiourea |
| InChI Key | FULZLIGZKMKICU-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2S |
2,2'-Bis(trifluoromethyl)benzidine, 97%
CAS: 341-58-2 Molecular Formula: C14H10F6N2 Molecular Weight (g/mol): 320.24 MDL Number: MFCD00190155 InChI Key: NVKGJHAQGWCWDI-UHFFFAOYSA-N Synonym: 2,2'-bis trifluoromethyl benzidine,2,2'-bis trifluoromethyl-1,1'-biphenyl-4,4'-diamine,4-4-amino-2-trifluoromethyl phenyl-3-trifluoromethyl aniline,2,2'-bis trifluoromethyl-4,4'-diaminobiphenyl,2,2'-bis-trifluoromethyl-biphenyl-4,4'-diamine,tfmb,2,2'-bis trifluoromethyl-4,4'-biphenyldiamine,4,4'-diamino-2,2'-bis trifluoromethyl biphenyl,1,1'-biphenyl-4,4'-diamine, 2,2'-bis trifluoromethyl,4-4-azanyl-2-trifluoromethyl phenyl-3-trifluoromethyl aniline PubChem CID: 629349 IUPAC Name: 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline SMILES: NC1=CC(=C(C=C1)C1=C(C=C(N)C=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 629349 |
|---|---|
| CAS | 341-58-2 |
| Molecular Weight (g/mol) | 320.24 |
| MDL Number | MFCD00190155 |
| SMILES | NC1=CC(=C(C=C1)C1=C(C=C(N)C=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 2,2'-bis trifluoromethyl benzidine,2,2'-bis trifluoromethyl-1,1'-biphenyl-4,4'-diamine,4-4-amino-2-trifluoromethyl phenyl-3-trifluoromethyl aniline,2,2'-bis trifluoromethyl-4,4'-diaminobiphenyl,2,2'-bis-trifluoromethyl-biphenyl-4,4'-diamine,tfmb,2,2'-bis trifluoromethyl-4,4'-biphenyldiamine,4,4'-diamino-2,2'-bis trifluoromethyl biphenyl,1,1'-biphenyl-4,4'-diamine, 2,2'-bis trifluoromethyl,4-4-azanyl-2-trifluoromethyl phenyl-3-trifluoromethyl aniline |
| IUPAC Name | 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
| InChI Key | NVKGJHAQGWCWDI-UHFFFAOYSA-N |
| Molecular Formula | C14H10F6N2 |
3,5-Bis(trifluoromethyl)thiobenzamide, 97%
CAS: 317319-15-6 Molecular Formula: C9H5F6NS Molecular Weight (g/mol): 273.20 MDL Number: MFCD00278692 InChI Key: OWYYZIVORPIBPZ-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl thiobenzamide,3,5-di trifluoromethyl benzene-1-carbothioamide,3,5-bis trifluoromethyl benzenecarbothioamide,3,5-bis trifluoromethyl benzothioamide,benzenecarbothioamide,3,5-bis trifluoromethyl,acmc-20ands,maybridge1_003450,3,5-bis-trifluoromethyl-thiobenzamide,3,5-bis trifluoromethyl benzene-1-carbothioamide PubChem CID: 2806924 IUPAC Name: 3,5-bis(trifluoromethyl)benzenecarbothioamide SMILES: NC(=S)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 2806924 |
|---|---|
| CAS | 317319-15-6 |
| Molecular Weight (g/mol) | 273.20 |
| MDL Number | MFCD00278692 |
| SMILES | NC(=S)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl thiobenzamide,3,5-di trifluoromethyl benzene-1-carbothioamide,3,5-bis trifluoromethyl benzenecarbothioamide,3,5-bis trifluoromethyl benzothioamide,benzenecarbothioamide,3,5-bis trifluoromethyl,acmc-20ands,maybridge1_003450,3,5-bis-trifluoromethyl-thiobenzamide,3,5-bis trifluoromethyl benzene-1-carbothioamide |
| IUPAC Name | 3,5-bis(trifluoromethyl)benzenecarbothioamide |
| InChI Key | OWYYZIVORPIBPZ-UHFFFAOYSA-N |
| Molecular Formula | C9H5F6NS |
3-(Methylthio)benzoic acid, 97%
CAS: 825-99-0 Molecular Formula: C8H8O2S Molecular Weight (g/mol): 168.21 MDL Number: MFCD00156993 InChI Key: PZGADOOBMVLBJE-UHFFFAOYSA-N Synonym: 3-methylthio benzoic acid,3-methylsulfanyl benzoic acid,benzoic acid, 3-methylthio,benzoic acid, m-methylthio,3-mercaptobenzoic acid s-methyl ether,3-methylsulfanyl-benzoic acid,3-carboxythioanisole,pubchem10679 PubChem CID: 220329 IUPAC Name: 3-methylsulfanylbenzoic acid SMILES: CSC1=CC=CC(=C1)C(=O)O
| PubChem CID | 220329 |
|---|---|
| CAS | 825-99-0 |
| Molecular Weight (g/mol) | 168.21 |
| MDL Number | MFCD00156993 |
| SMILES | CSC1=CC=CC(=C1)C(=O)O |
| Synonym | 3-methylthio benzoic acid,3-methylsulfanyl benzoic acid,benzoic acid, 3-methylthio,benzoic acid, m-methylthio,3-mercaptobenzoic acid s-methyl ether,3-methylsulfanyl-benzoic acid,3-carboxythioanisole,pubchem10679 |
| IUPAC Name | 3-methylsulfanylbenzoic acid |
| InChI Key | PZGADOOBMVLBJE-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2S |
Methyl 4-fluoro-2-methylbenzoate, 98%
CAS: 174403-69-1 Molecular Formula: C9H9FO2 Molecular Weight (g/mol): 168.17 MDL Number: MFCD06203790 InChI Key: ZQFCTCYDRQFPBU-UHFFFAOYSA-N Synonym: benzoic acid, 4-fluoro-2-methyl-, methyl ester,4-fluoro-2-methylbenzoic acid methyl ester,rarechem al bf 0506,methyl=4-fluoro-2-methylbenzoate,4-fluoro-2-methyl benzoic acid methyl ester,4-fluoro-2-methyl-benzoic acid methyl ester,benzoic acid,4-fluoro-2-methyl-,methyl ester PubChem CID: 2782181 IUPAC Name: methyl 4-fluoro-2-methylbenzoate SMILES: COC(=O)C1=C(C)C=C(F)C=C1
| PubChem CID | 2782181 |
|---|---|
| CAS | 174403-69-1 |
| Molecular Weight (g/mol) | 168.17 |
| MDL Number | MFCD06203790 |
| SMILES | COC(=O)C1=C(C)C=C(F)C=C1 |
| Synonym | benzoic acid, 4-fluoro-2-methyl-, methyl ester,4-fluoro-2-methylbenzoic acid methyl ester,rarechem al bf 0506,methyl=4-fluoro-2-methylbenzoate,4-fluoro-2-methyl benzoic acid methyl ester,4-fluoro-2-methyl-benzoic acid methyl ester,benzoic acid,4-fluoro-2-methyl-,methyl ester |
| IUPAC Name | methyl 4-fluoro-2-methylbenzoate |
| InChI Key | ZQFCTCYDRQFPBU-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO2 |
2,5-Di-tert-butylhydroquinone, 99%
CAS: 88-58-4 Molecular Formula: C14H22O2 Molecular Weight (g/mol): 222.33 MDL Number: MFCD00008825 InChI Key: JZODKRWQWUWGCD-UHFFFAOYSA-N Synonym: 2,5-di-tert-butylhydroquinone,2,5-di-tert-butylbenzene-1,4-diol,dibug,dtbhq,dybug,santovar o,di-t-butylhydroquinone,2,5-di-tert-butylquinol,nonflex alba,2,5-di-t-butylhydroquinone PubChem CID: 2374 ChEBI: CHEBI:41094 IUPAC Name: 2,5-ditert-butylbenzene-1,4-diol SMILES: CC(C)(C)C1=CC(O)=C(C=C1O)C(C)(C)C
| PubChem CID | 2374 |
|---|---|
| CAS | 88-58-4 |
| Molecular Weight (g/mol) | 222.33 |
| ChEBI | CHEBI:41094 |
| MDL Number | MFCD00008825 |
| SMILES | CC(C)(C)C1=CC(O)=C(C=C1O)C(C)(C)C |
| Synonym | 2,5-di-tert-butylhydroquinone,2,5-di-tert-butylbenzene-1,4-diol,dibug,dtbhq,dybug,santovar o,di-t-butylhydroquinone,2,5-di-tert-butylquinol,nonflex alba,2,5-di-t-butylhydroquinone |
| IUPAC Name | 2,5-ditert-butylbenzene-1,4-diol |
| InChI Key | JZODKRWQWUWGCD-UHFFFAOYSA-N |
| Molecular Formula | C14H22O2 |
| CAS | 3288-04-8 |
|---|---|
| MDL Number | MFCD00011675 |
3,5-Bis(trifluoromethyl)benzeneboronic acid, 97+%
CAS: 73852-19-4 Molecular Formula: C8H5BF6O2 Molecular Weight (g/mol): 257.93 MDL Number: MFCD00051850 InChI Key: BPTABBGLHGBJQR-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenylboronic acid,3,5-bis trifluoromethyl benzeneboronic acid,3,5-bis trifluoromethyl phenyl boronic acid,3,5-bis-trifluoromethylphenylboronic acid,3,5-bis trifluoromethylphenyl boronic acid,3,5-bis trifluoromethyl phenylboroic acid,btfpba,3,5-bis trifluoromethyl phenyl boranediol PubChem CID: 156265 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]boronic acid SMILES: OB(O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 156265 |
|---|---|
| CAS | 73852-19-4 |
| Molecular Weight (g/mol) | 257.93 |
| MDL Number | MFCD00051850 |
| SMILES | OB(O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl phenylboronic acid,3,5-bis trifluoromethyl benzeneboronic acid,3,5-bis trifluoromethyl phenyl boronic acid,3,5-bis-trifluoromethylphenylboronic acid,3,5-bis trifluoromethylphenyl boronic acid,3,5-bis trifluoromethyl phenylboroic acid,btfpba,3,5-bis trifluoromethyl phenyl boranediol |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]boronic acid |
| InChI Key | BPTABBGLHGBJQR-UHFFFAOYSA-N |
| Molecular Formula | C8H5BF6O2 |
3-Chlorobenzoyl chloride, 99+%
CAS: 618-46-2 Molecular Formula: C7H4Cl2O Molecular Weight (g/mol): 175.01 MDL Number: MFCD00000671 InChI Key: WHIHIKVIWVIIER-UHFFFAOYSA-N Synonym: m-chlorobenzoyl chloride,benzoyl chloride, 3-chloro,benzoyl chloride, m-chloro,m-chlorobenzoylchloride,3-chlorobenzoylchloride,benzoylchloride, 3-chloro,mcoc,3-chlorobenzoic acid chloride,ccris 8615,3chlorobenzoyl chloride PubChem CID: 69252 IUPAC Name: 3-chlorobenzoyl chloride SMILES: ClC(=O)C1=CC=CC(Cl)=C1
| PubChem CID | 69252 |
|---|---|
| CAS | 618-46-2 |
| Molecular Weight (g/mol) | 175.01 |
| MDL Number | MFCD00000671 |
| SMILES | ClC(=O)C1=CC=CC(Cl)=C1 |
| Synonym | m-chlorobenzoyl chloride,benzoyl chloride, 3-chloro,benzoyl chloride, m-chloro,m-chlorobenzoylchloride,3-chlorobenzoylchloride,benzoylchloride, 3-chloro,mcoc,3-chlorobenzoic acid chloride,ccris 8615,3chlorobenzoyl chloride |
| IUPAC Name | 3-chlorobenzoyl chloride |
| InChI Key | WHIHIKVIWVIIER-UHFFFAOYSA-N |
| Molecular Formula | C7H4Cl2O |
2-chloro-6-fluorobenzaldehyde, 95%
CAS: 387-45-1 Molecular Formula: C7H4ClFO Molecular Weight (g/mol): 158.56 MDL Number: MFCD00003306 InChI Key: OACPOWYLLGHGCR-UHFFFAOYSA-N Synonym: benzaldehyde, 2-chloro-6-fluoro,2,6-cfad,2-chloro-6-fluoro-benzaldehyd,unii-51yj9bw8w7,2-chloro-6-fluoro benzaldehyde,2-chloro-6-fluoro-benzaldehyde,2-fluoro-6-chloro benzaldehyde,6-chloro-2-fluorobenzaldehyde,pubchem1434,acmc-209j1r PubChem CID: 67847 IUPAC Name: 2-chloro-6-fluorobenzaldehyde SMILES: FC1=CC=CC(Cl)=C1C=O
| PubChem CID | 67847 |
|---|---|
| CAS | 387-45-1 |
| Molecular Weight (g/mol) | 158.56 |
| MDL Number | MFCD00003306 |
| SMILES | FC1=CC=CC(Cl)=C1C=O |
| Synonym | benzaldehyde, 2-chloro-6-fluoro,2,6-cfad,2-chloro-6-fluoro-benzaldehyd,unii-51yj9bw8w7,2-chloro-6-fluoro benzaldehyde,2-chloro-6-fluoro-benzaldehyde,2-fluoro-6-chloro benzaldehyde,6-chloro-2-fluorobenzaldehyde,pubchem1434,acmc-209j1r |
| IUPAC Name | 2-chloro-6-fluorobenzaldehyde |
| InChI Key | OACPOWYLLGHGCR-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClFO |
2-(4-Fluorophenoxy)benzaldehyde, 97%
CAS: 320423-61-8 Molecular Formula: C13H9FO2 Molecular Weight (g/mol): 216.211 MDL Number: MFCD01568770 InChI Key: RZJFZXRBXCJPTA-UHFFFAOYSA-N Synonym: 2-4-fluorophenoxy benzaldehyde,2-4-fluorophenoxy benzenecarbaldehyde,4-fluorophenoxybenzaldehyde,fluorophenoxybenzenecarbaldehyde,benzaldehyde,2-4-fluorophenoxy PubChem CID: 2782988 IUPAC Name: 2-(4-fluorophenoxy)benzaldehyde SMILES: C1=CC=C(C(=C1)C=O)OC2=CC=C(C=C2)F
| PubChem CID | 2782988 |
|---|---|
| CAS | 320423-61-8 |
| Molecular Weight (g/mol) | 216.211 |
| MDL Number | MFCD01568770 |
| SMILES | C1=CC=C(C(=C1)C=O)OC2=CC=C(C=C2)F |
| Synonym | 2-4-fluorophenoxy benzaldehyde,2-4-fluorophenoxy benzenecarbaldehyde,4-fluorophenoxybenzaldehyde,fluorophenoxybenzenecarbaldehyde,benzaldehyde,2-4-fluorophenoxy |
| IUPAC Name | 2-(4-fluorophenoxy)benzaldehyde |
| InChI Key | RZJFZXRBXCJPTA-UHFFFAOYSA-N |
| Molecular Formula | C13H9FO2 |
Benzoic Acid, Crystal, EP, BP, JP, USP, 99.5-100.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 65-85-0 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.12 InChI Key: WPYMKLBDIGXBTP-UHFFFAOYSA-N IUPAC Name: benzoic acid SMILES: OC(=O)C1=CC=CC=C1
| CAS | 65-85-0 |
|---|---|
| Molecular Weight (g/mol) | 122.12 |
| SMILES | OC(=O)C1=CC=CC=C1 |
| IUPAC Name | benzoic acid |
| InChI Key | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
4-Hydroxyphenoxyacetic acid, 98+%
CAS: 1878-84-8 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.148 MDL Number: MFCD00014362 InChI Key: PKGWLCZTTHWKIZ-UHFFFAOYSA-N Synonym: 4-hydroxyphenoxyacetic acid,4-hydroxyphenoxy acetic acid,2-4-hydroxyphenoxy acetic acid,4-hydroxypheoxyacetate,acetic acid, 4-hydroxyphenoxy,4-hydroxy-phenoxy-acetic acid,p-hydroxyphenoxyacetic acid,acetic acid, 2-4-hydroxyphenoxy,acetic acid, p-hydroxyphenoxy,4-carboxymethoxy phenol PubChem CID: 15881 ChEBI: CHEBI:1881 IUPAC Name: 2-(4-hydroxyphenoxy)acetic acid SMILES: C1=CC(=CC=C1O)OCC(=O)O
| PubChem CID | 15881 |
|---|---|
| CAS | 1878-84-8 |
| Molecular Weight (g/mol) | 168.148 |
| ChEBI | CHEBI:1881 |
| MDL Number | MFCD00014362 |
| SMILES | C1=CC(=CC=C1O)OCC(=O)O |
| Synonym | 4-hydroxyphenoxyacetic acid,4-hydroxyphenoxy acetic acid,2-4-hydroxyphenoxy acetic acid,4-hydroxypheoxyacetate,acetic acid, 4-hydroxyphenoxy,4-hydroxy-phenoxy-acetic acid,p-hydroxyphenoxyacetic acid,acetic acid, 2-4-hydroxyphenoxy,acetic acid, p-hydroxyphenoxy,4-carboxymethoxy phenol |
| IUPAC Name | 2-(4-hydroxyphenoxy)acetic acid |
| InChI Key | PKGWLCZTTHWKIZ-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
4-[(4-Aminophenyl)azo]-2-chlorophenol, 95%
CAS: 669092-47-1 Molecular Formula: C12H10ClN3O Molecular Weight (g/mol): 247.682 MDL Number: MFCD26401540 InChI Key: NWMGUTQRHABSPF-UHFFFAOYSA-N Synonym: e-4-4-aminophenyl diazenyl-2-chlorophenol,4-e-2-4-aminophenyl diazen-1-yl-2-chlorophenol PubChem CID: 86339119 IUPAC Name: 4-[(4-aminophenyl)hydrazinylidene]-2-chlorocyclohexa-2,5-dien-1-one SMILES: C1=CC(=CC=C1N)NN=C2C=CC(=O)C(=C2)Cl
| PubChem CID | 86339119 |
|---|---|
| CAS | 669092-47-1 |
| Molecular Weight (g/mol) | 247.682 |
| MDL Number | MFCD26401540 |
| SMILES | C1=CC(=CC=C1N)NN=C2C=CC(=O)C(=C2)Cl |
| Synonym | e-4-4-aminophenyl diazenyl-2-chlorophenol,4-e-2-4-aminophenyl diazen-1-yl-2-chlorophenol |
| IUPAC Name | 4-[(4-aminophenyl)hydrazinylidene]-2-chlorocyclohexa-2,5-dien-1-one |
| InChI Key | NWMGUTQRHABSPF-UHFFFAOYSA-N |
| Molecular Formula | C12H10ClN3O |