Benzene and substituted derivatives
Filtered Search Results
2,3,6-Trimethoxybenzoic Acid 98.0+%, TCI America™
CAS: 60241-74-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.201 MDL Number: MFCD00092587 InChI Key: NSKSXYUOXAQHCH-UHFFFAOYSA-N PubChem CID: 611400 IUPAC Name: 2,3,6-trimethoxybenzoic acid SMILES: COC1=C(C(=C(C=C1)OC)OC)C(=O)O
| PubChem CID | 611400 |
|---|---|
| CAS | 60241-74-9 |
| Molecular Weight (g/mol) | 212.201 |
| MDL Number | MFCD00092587 |
| SMILES | COC1=C(C(=C(C=C1)OC)OC)C(=O)O |
| IUPAC Name | 2,3,6-trimethoxybenzoic acid |
| InChI Key | NSKSXYUOXAQHCH-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
2,3,4,5,6-Pentafluorobenzyl Cyanide 97.0+%, TCI America™
CAS: 653-30-5 Molecular Formula: C8H2F5N Molecular Weight (g/mol): 207.103 MDL Number: MFCD00013814 InChI Key: YDNOJUAQBFXZCR-UHFFFAOYSA-N Synonym: 2,3,4,5,6-pentafluorophenylacetonitrile,pentafluorophenylacetonitrile,pentafluorophenyl acetonitrile,2-2,3,4,5,6-pentafluorophenyl acetonitrile,2,3,4,5,6-pentafluorobenzyl cyanide,2-perfluorophenyl acetonitrile,benzeneacetonitrile, 2,3,4,5,6-pentafluoro,2-2,3,4,5,6-pentafluorophenyl ethanenitrile,acmc-1ay9x,2-pentafluorophenyl acetonitrile PubChem CID: 69554 IUPAC Name: 2-(2,3,4,5,6-pentafluorophenyl)acetonitrile SMILES: C(C#N)C1=C(C(=C(C(=C1F)F)F)F)F
| PubChem CID | 69554 |
|---|---|
| CAS | 653-30-5 |
| Molecular Weight (g/mol) | 207.103 |
| MDL Number | MFCD00013814 |
| SMILES | C(C#N)C1=C(C(=C(C(=C1F)F)F)F)F |
| Synonym | 2,3,4,5,6-pentafluorophenylacetonitrile,pentafluorophenylacetonitrile,pentafluorophenyl acetonitrile,2-2,3,4,5,6-pentafluorophenyl acetonitrile,2,3,4,5,6-pentafluorobenzyl cyanide,2-perfluorophenyl acetonitrile,benzeneacetonitrile, 2,3,4,5,6-pentafluoro,2-2,3,4,5,6-pentafluorophenyl ethanenitrile,acmc-1ay9x,2-pentafluorophenyl acetonitrile |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)acetonitrile |
| InChI Key | YDNOJUAQBFXZCR-UHFFFAOYSA-N |
| Molecular Formula | C8H2F5N |
3-Iodophenylacetic Acid 98.0+%, TCI America™
CAS: 1878-69-9 Molecular Formula: C8H7IO2 Molecular Weight (g/mol): 262.05 MDL Number: MFCD00046548 InChI Key: MRSWWBAFGGGWRH-UHFFFAOYSA-N Synonym: 3-iodophenylacetic acid,2-3-iodophenyl acetic acid,3-iodophenyl acetic acid,m-iodophenylacetic acid,m-iodobenzeneacetic acid,benzeneacetic acid, 3-iodo,pubchem4195,3-iodophenylaceticacid,acmc-1cfam,3-iodobenzeneacetic acid PubChem CID: 3870220 IUPAC Name: 2-(3-iodophenyl)acetic acid SMILES: OC(=O)CC1=CC(I)=CC=C1
| PubChem CID | 3870220 |
|---|---|
| CAS | 1878-69-9 |
| Molecular Weight (g/mol) | 262.05 |
| MDL Number | MFCD00046548 |
| SMILES | OC(=O)CC1=CC(I)=CC=C1 |
| Synonym | 3-iodophenylacetic acid,2-3-iodophenyl acetic acid,3-iodophenyl acetic acid,m-iodophenylacetic acid,m-iodobenzeneacetic acid,benzeneacetic acid, 3-iodo,pubchem4195,3-iodophenylaceticacid,acmc-1cfam,3-iodobenzeneacetic acid |
| IUPAC Name | 2-(3-iodophenyl)acetic acid |
| InChI Key | MRSWWBAFGGGWRH-UHFFFAOYSA-N |
| Molecular Formula | C8H7IO2 |
2-Methoxy-4-nitroaniline 99.0+%, TCI America™
CAS: 97-52-9 Molecular Formula: C7H8N2O3 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00007363 InChI Key: GVBHRNIWBGTNQA-UHFFFAOYSA-N Synonym: fast red b base,benzenamine, 2-methoxy-4-nitro,4-nitro-o-anisidine,fast red base b,fast red b,red b base,diazo fast red b,2-amino-5-nitroanisole,azoamine pink o,fast red 5na base PubChem CID: 7337 IUPAC Name: 2-methoxy-4-nitroaniline SMILES: COC1=CC(=CC=C1N)[N+]([O-])=O
| PubChem CID | 7337 |
|---|---|
| CAS | 97-52-9 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00007363 |
| SMILES | COC1=CC(=CC=C1N)[N+]([O-])=O |
| Synonym | fast red b base,benzenamine, 2-methoxy-4-nitro,4-nitro-o-anisidine,fast red base b,fast red b,red b base,diazo fast red b,2-amino-5-nitroanisole,azoamine pink o,fast red 5na base |
| IUPAC Name | 2-methoxy-4-nitroaniline |
| InChI Key | GVBHRNIWBGTNQA-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O3 |
4,4″-Dibromo-1,1':2',1″-terphenyl 98.0+%, TCI America™
CAS: 24253-43-8 Molecular Formula: C18H12Br2 Molecular Weight (g/mol): 388.102 MDL Number: MFCD28138092 InChI Key: CJNMHWJZCGSVQG-UHFFFAOYSA-N Synonym: 4,4′C′C-Dibromo-o-terphenyl PubChem CID: 12715106 IUPAC Name: 1,2-bis(4-bromophenyl)benzene SMILES: C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br
| PubChem CID | 12715106 |
|---|---|
| CAS | 24253-43-8 |
| Molecular Weight (g/mol) | 388.102 |
| MDL Number | MFCD28138092 |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br |
| Synonym | 4,4′C′C-Dibromo-o-terphenyl |
| IUPAC Name | 1,2-bis(4-bromophenyl)benzene |
| InChI Key | CJNMHWJZCGSVQG-UHFFFAOYSA-N |
| Molecular Formula | C18H12Br2 |
3,4-Difluorobenzophenone 98.0+%, TCI America™
CAS: 85118-07-6 Molecular Formula: C13H8F2O Molecular Weight (g/mol): 218.203 MDL Number: MFCD00009892 InChI Key: ZJTYHSBOZAQQGF-UHFFFAOYSA-N Synonym: 3,4-difluorobenzophenone,3,4-difluorophenyl phenyl methanone,methanone, 3,4-difluorophenyl phenyl,3,4-difluoro-phenyl-phenyl-methanone,3,4-difluorophenyl phenyl ketone,fr bf dvr,pubchem4220,acmc-209q4q,timtec-bb sbb016583 PubChem CID: 569908 IUPAC Name: (3,4-difluorophenyl)-phenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)F)F
| PubChem CID | 569908 |
|---|---|
| CAS | 85118-07-6 |
| Molecular Weight (g/mol) | 218.203 |
| MDL Number | MFCD00009892 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)F)F |
| Synonym | 3,4-difluorobenzophenone,3,4-difluorophenyl phenyl methanone,methanone, 3,4-difluorophenyl phenyl,3,4-difluoro-phenyl-phenyl-methanone,3,4-difluorophenyl phenyl ketone,fr bf dvr,pubchem4220,acmc-209q4q,timtec-bb sbb016583 |
| IUPAC Name | (3,4-difluorophenyl)-phenylmethanone |
| InChI Key | ZJTYHSBOZAQQGF-UHFFFAOYSA-N |
| Molecular Formula | C13H8F2O |
4-tert-Butylbenzonitrile 98.0+%, TCI America™
CAS: 4210-32-6 Molecular Formula: C11H13N Molecular Weight (g/mol): 159.232 MDL Number: MFCD00075840 InChI Key: IIZURLNRIMKEDL-UHFFFAOYSA-N Synonym: 4-tert-butyl benzonitrile,4-t-butylbenzonitrile,benzonitrile, 4-1,1-dimethylethyl,4-tert-butylcyanobenzene,4-tert-butyl-benzonitrile,p-t-butylbenzonitrile,acmc-209jnk,p-tert-butylbenzonitrile,benzonitrile, p-tert-butyl,ksc219k6d PubChem CID: 77883 IUPAC Name: 4-tert-butylbenzonitrile SMILES: CC(C)(C)C1=CC=C(C=C1)C#N
| PubChem CID | 77883 |
|---|---|
| CAS | 4210-32-6 |
| Molecular Weight (g/mol) | 159.232 |
| MDL Number | MFCD00075840 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C#N |
| Synonym | 4-tert-butyl benzonitrile,4-t-butylbenzonitrile,benzonitrile, 4-1,1-dimethylethyl,4-tert-butylcyanobenzene,4-tert-butyl-benzonitrile,p-t-butylbenzonitrile,acmc-209jnk,p-tert-butylbenzonitrile,benzonitrile, p-tert-butyl,ksc219k6d |
| IUPAC Name | 4-tert-butylbenzonitrile |
| InChI Key | IIZURLNRIMKEDL-UHFFFAOYSA-N |
| Molecular Formula | C11H13N |
Tris(4-methylphenyl)phosphine Oxide 98.0+%, TCI America™
CAS: 797-70-6 Molecular Formula: C21H21OP Molecular Weight (g/mol): 320.37 MDL Number: MFCD00059321 InChI Key: SPKBYIYIZQARNX-UHFFFAOYSA-N Synonym: Tri-p-tolylphosphine Oxide PubChem CID: 120383 IUPAC Name: 1-[bis(4-methylphenyl)phosphoroso]-4-methylbenzene SMILES: CC1=CC=C(C=C1)P(=O)(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1
| PubChem CID | 120383 |
|---|---|
| CAS | 797-70-6 |
| Molecular Weight (g/mol) | 320.37 |
| MDL Number | MFCD00059321 |
| SMILES | CC1=CC=C(C=C1)P(=O)(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1 |
| Synonym | Tri-p-tolylphosphine Oxide |
| IUPAC Name | 1-[bis(4-methylphenyl)phosphoroso]-4-methylbenzene |
| InChI Key | SPKBYIYIZQARNX-UHFFFAOYSA-N |
| Molecular Formula | C21H21OP |
4-Methoxy-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 149507-36-8 Molecular Formula: C8H8BF3O3 Molecular Weight (g/mol): 219.954 MDL Number: MFCD07363790 InChI Key: BUSMBMGODABSIN-UHFFFAOYSA-N Synonym: 4-methoxy-3-trifluoromethyl phenyl boronic acid,4-methoxy-3-trifluoromethylphenylboronic acid,3-trifluoromethyl-4-methoxy-phenylboronic acid,4-methoxy-3-trifluoromethylphenyl boronic acid,4-methoxy-3-trifluoromethyl benzeneboronic acid,4-methoxy-3-trifluoromethyl phenylboronic acid,boronic acid, 4-methoxy-3-trifluoromethyl phenyl,acmc-1c5ik PubChem CID: 17750052 IUPAC Name: [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid SMILES: B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O
| PubChem CID | 17750052 |
|---|---|
| CAS | 149507-36-8 |
| Molecular Weight (g/mol) | 219.954 |
| MDL Number | MFCD07363790 |
| SMILES | B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O |
| Synonym | 4-methoxy-3-trifluoromethyl phenyl boronic acid,4-methoxy-3-trifluoromethylphenylboronic acid,3-trifluoromethyl-4-methoxy-phenylboronic acid,4-methoxy-3-trifluoromethylphenyl boronic acid,4-methoxy-3-trifluoromethyl benzeneboronic acid,4-methoxy-3-trifluoromethyl phenylboronic acid,boronic acid, 4-methoxy-3-trifluoromethyl phenyl,acmc-1c5ik |
| IUPAC Name | [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid |
| InChI Key | BUSMBMGODABSIN-UHFFFAOYSA-N |
| Molecular Formula | C8H8BF3O3 |
1,4-Dibromotetrafluorobenzene 98.0+%, TCI America™
CAS: 344-03-6 Molecular Formula: C6Br2F4 Molecular Weight (g/mol): 307.87 MDL Number: MFCD00000309 InChI Key: QFTZULJNRAHOIY-UHFFFAOYSA-N Synonym: 1,4-dibromotetrafluorobenzene,p-dibromotetrafluorobenzene,benzene, 1,4-dibromo-2,3,5,6-tetrafluoro,benzene, 1,4-dibromotetrafluoro,1,3,5,6-tetrafluorobenzene,benzene,4-dibromotetrafluoro,emolecules 536967,tetrafluoro-1,4-dibromo benzene,perfluoro-1,4-dibromobenzene PubChem CID: 67653 IUPAC Name: 1,4-dibromo-2,3,5,6-tetrafluorobenzene SMILES: FC1=C(F)C(Br)=C(F)C(F)=C1Br
| PubChem CID | 67653 |
|---|---|
| CAS | 344-03-6 |
| Molecular Weight (g/mol) | 307.87 |
| MDL Number | MFCD00000309 |
| SMILES | FC1=C(F)C(Br)=C(F)C(F)=C1Br |
| Synonym | 1,4-dibromotetrafluorobenzene,p-dibromotetrafluorobenzene,benzene, 1,4-dibromo-2,3,5,6-tetrafluoro,benzene, 1,4-dibromotetrafluoro,1,3,5,6-tetrafluorobenzene,benzene,4-dibromotetrafluoro,emolecules 536967,tetrafluoro-1,4-dibromo benzene,perfluoro-1,4-dibromobenzene |
| IUPAC Name | 1,4-dibromo-2,3,5,6-tetrafluorobenzene |
| InChI Key | QFTZULJNRAHOIY-UHFFFAOYSA-N |
| Molecular Formula | C6Br2F4 |
2-(4-Chloro-3-nitrobenzoyl)benzoic Acid 97.0+%, TCI America™
CAS: 85-54-1 Molecular Formula: C14H8ClNO5 Molecular Weight (g/mol): 305.67 MDL Number: MFCD00007082 InChI Key: RITAQDHCJBLSSL-UHFFFAOYSA-N Synonym: 2-4-chloro-3-nitrobenzoyl benzoic acid,benzoic acid, 2-4-chloro-3-nitrobenzoyl,3'-nitro-4'-chlorobenzoylbenzoic acid,benzoic acid, o-4-chloro-3-nitrobenzoyl,2-4-chloro-3-nitrophenyl carbonyl benzoic acid,acmc-209q6m,ksc496o4t,o-4-chloro-3-nitrobenzoyl benzoic acid,2-4-chloro-3-nitro-benzoyl benzoic acid,2-4'-chloro-3'-nitrobenzoyl benzoic acid PubChem CID: 66562 IUPAC Name: 2-(4-chloro-3-nitrobenzoyl)benzoic acid SMILES: OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(Cl)C(=C1)[N+]([O-])=O
| PubChem CID | 66562 |
|---|---|
| CAS | 85-54-1 |
| Molecular Weight (g/mol) | 305.67 |
| MDL Number | MFCD00007082 |
| SMILES | OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(Cl)C(=C1)[N+]([O-])=O |
| Synonym | 2-4-chloro-3-nitrobenzoyl benzoic acid,benzoic acid, 2-4-chloro-3-nitrobenzoyl,3'-nitro-4'-chlorobenzoylbenzoic acid,benzoic acid, o-4-chloro-3-nitrobenzoyl,2-4-chloro-3-nitrophenyl carbonyl benzoic acid,acmc-209q6m,ksc496o4t,o-4-chloro-3-nitrobenzoyl benzoic acid,2-4-chloro-3-nitro-benzoyl benzoic acid,2-4'-chloro-3'-nitrobenzoyl benzoic acid |
| IUPAC Name | 2-(4-chloro-3-nitrobenzoyl)benzoic acid |
| InChI Key | RITAQDHCJBLSSL-UHFFFAOYSA-N |
| Molecular Formula | C14H8ClNO5 |
1,3,5-Tris(bromomethyl)-2,4,6-trimethylbenzene 98.0+%, TCI America™
CAS: 21988-87-4 Molecular Formula: C12H15Br3 Molecular Weight (g/mol): 398.964 MDL Number: MFCD00192554 InChI Key: BHIFXIATEXVOQA-UHFFFAOYSA-N Synonym: 2,4,6-Tris(bromomethyl)mesitylene PubChem CID: 89140 IUPAC Name: 1,3,5-tris(bromomethyl)-2,4,6-trimethylbenzene SMILES: CC1=C(C(=C(C(=C1CBr)C)CBr)C)CBr
| PubChem CID | 89140 |
|---|---|
| CAS | 21988-87-4 |
| Molecular Weight (g/mol) | 398.964 |
| MDL Number | MFCD00192554 |
| SMILES | CC1=C(C(=C(C(=C1CBr)C)CBr)C)CBr |
| Synonym | 2,4,6-Tris(bromomethyl)mesitylene |
| IUPAC Name | 1,3,5-tris(bromomethyl)-2,4,6-trimethylbenzene |
| InChI Key | BHIFXIATEXVOQA-UHFFFAOYSA-N |
| Molecular Formula | C12H15Br3 |
2-(2-Fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane 98.0+%, TCI America™
CAS: 346656-39-1 Molecular Formula: C11H14BFO2 Molecular Weight (g/mol): 208.039 InChI Key: ZNFBLQHZFSLYQB-UHFFFAOYSA-N Synonym: 1-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorobenzene, 2-Fluorophenylboronic Acid Neopentyl Glycol Ester PubChem CID: 10398127 IUPAC Name: 2-(2-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane SMILES: B1(OCC(CO1)(C)C)C2=CC=CC=C2F
| PubChem CID | 10398127 |
|---|---|
| CAS | 346656-39-1 |
| Molecular Weight (g/mol) | 208.039 |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2F |
| Synonym | 1-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorobenzene, 2-Fluorophenylboronic Acid Neopentyl Glycol Ester |
| IUPAC Name | 2-(2-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChI Key | ZNFBLQHZFSLYQB-UHFFFAOYSA-N |
| Molecular Formula | C11H14BFO2 |
4-Chloro-3-methylbenzoic Acid 98.0+%, TCI America™
CAS: 7697-29-2 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.59 MDL Number: MFCD00045853 InChI Key: MRUKIIWRMSYKML-UHFFFAOYSA-N Synonym: 4-chloro-m-toluic acid,4-chloro-3-methyl-benzoic acid,4-chloro-3-methyl benzoic acid,benzoic acid, 4-chloro-3-methyl,m-toluic acid, 4-chloro,pubchem3666,5-carboxy-2-chlorotoluene,acmc-1bg77,ksc497q5r,4-chloranyl-3-methyl-benzoic acid PubChem CID: 282989 IUPAC Name: 4-chloro-3-methylbenzoic acid SMILES: CC1=CC(=CC=C1Cl)C(O)=O
| PubChem CID | 282989 |
|---|---|
| CAS | 7697-29-2 |
| Molecular Weight (g/mol) | 170.59 |
| MDL Number | MFCD00045853 |
| SMILES | CC1=CC(=CC=C1Cl)C(O)=O |
| Synonym | 4-chloro-m-toluic acid,4-chloro-3-methyl-benzoic acid,4-chloro-3-methyl benzoic acid,benzoic acid, 4-chloro-3-methyl,m-toluic acid, 4-chloro,pubchem3666,5-carboxy-2-chlorotoluene,acmc-1bg77,ksc497q5r,4-chloranyl-3-methyl-benzoic acid |
| IUPAC Name | 4-chloro-3-methylbenzoic acid |
| InChI Key | MRUKIIWRMSYKML-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
3-Chlorobenzotrifluoride 90.0+%, TCI America™
CAS: 98-15-7 Molecular Formula: C7H4ClF3 Molecular Weight (g/mol): 180.554 MDL Number: MFCD00000594 InChI Key: YTCGOUNVIAWCMG-UHFFFAOYSA-N Synonym: 3-chlorobenzotrifluoride,1-chloro-3-trifluoromethyl benzene,m-chlorobenzotrifluoride,benzene, 1-chloro-3-trifluoromethyl,3-chloro-alpha,alpha,alpha-trifluorotoluene,3-chlorotrifluoromethylbenzene,m-trifluoromethylphenyl chloride,meta trifluoromethyl chlorobenzene,3-chlorotrifluorotoluene,ccris 2810 PubChem CID: 7374 IUPAC Name: 1-chloro-3-(trifluoromethyl)benzene SMILES: C1=CC(=CC(=C1)Cl)C(F)(F)F
| PubChem CID | 7374 |
|---|---|
| CAS | 98-15-7 |
| Molecular Weight (g/mol) | 180.554 |
| MDL Number | MFCD00000594 |
| SMILES | C1=CC(=CC(=C1)Cl)C(F)(F)F |
| Synonym | 3-chlorobenzotrifluoride,1-chloro-3-trifluoromethyl benzene,m-chlorobenzotrifluoride,benzene, 1-chloro-3-trifluoromethyl,3-chloro-alpha,alpha,alpha-trifluorotoluene,3-chlorotrifluoromethylbenzene,m-trifluoromethylphenyl chloride,meta trifluoromethyl chlorobenzene,3-chlorotrifluorotoluene,ccris 2810 |
| IUPAC Name | 1-chloro-3-(trifluoromethyl)benzene |
| InChI Key | YTCGOUNVIAWCMG-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClF3 |