Benzene and substituted derivatives
Filtered Search Results
4-(Trifluoromethyl)benzaldehyde, 98%
CAS: 455-19-6 Molecular Formula: C8H5F3O Molecular Weight (g/mol): 174.12 MDL Number: MFCD00006952 InChI Key: BEOBZEOPTQQELP-UHFFFAOYSA-N Synonym: 4-trifluoromethyl benzaldehyde,benzaldehyde, 4-trifluoromethyl,p-trifluoromethylbenzaldehyde,p-trifluoromethyl benzaldehyde,alpha,alpha,alpha-trifluoro-p-tolualdehyde,4'-trifluoromethyl benzaldehyde,p-trifluoromethyl-benzaldhyde,4-trifluoromethyl-benzaldehyde PubChem CID: 67996 IUPAC Name: 4-(trifluoromethyl)benzaldehyde SMILES: C1=CC(=CC=C1C=O)C(F)(F)F
| PubChem CID | 67996 |
|---|---|
| CAS | 455-19-6 |
| Molecular Weight (g/mol) | 174.12 |
| MDL Number | MFCD00006952 |
| SMILES | C1=CC(=CC=C1C=O)C(F)(F)F |
| Synonym | 4-trifluoromethyl benzaldehyde,benzaldehyde, 4-trifluoromethyl,p-trifluoromethylbenzaldehyde,p-trifluoromethyl benzaldehyde,alpha,alpha,alpha-trifluoro-p-tolualdehyde,4'-trifluoromethyl benzaldehyde,p-trifluoromethyl-benzaldhyde,4-trifluoromethyl-benzaldehyde |
| IUPAC Name | 4-(trifluoromethyl)benzaldehyde |
| InChI Key | BEOBZEOPTQQELP-UHFFFAOYSA-N |
| Molecular Formula | C8H5F3O |
5-Phenyl-2,4-pentadienoic acid, 98+%
CAS: 1552-94-9 Molecular Formula: C11H10O2 Molecular Weight (g/mol): 174.199 MDL Number: MFCD00014018 InChI Key: FEIQOMCWGDNMHM-KBXRYBNXSA-N Synonym: 5-phenylpenta-2,4-dienoic acid,2e,4e-5-phenylpenta-2,4-dienoic acid,5-phenyl-2,4-pentadienoic acid,2,4-pentadienoic acid, 5-phenyl,e,e-cinnamylideneacetic acid,2e,4e-5-phenyl-2,4-pentadienoic acid,2,4-pentadienoicacid, 5-phenyl-, 2e,4e,4-phenyl-1,3-butadiene-1-carboxylic acid,juarezic acid,cinnamylidene acetic acid PubChem CID: 1549512 IUPAC Name: (2E,4E)-5-phenylpenta-2,4-dienoic acid SMILES: C1=CC=C(C=C1)C=CC=CC(=O)O
| PubChem CID | 1549512 |
|---|---|
| CAS | 1552-94-9 |
| Molecular Weight (g/mol) | 174.199 |
| MDL Number | MFCD00014018 |
| SMILES | C1=CC=C(C=C1)C=CC=CC(=O)O |
| Synonym | 5-phenylpenta-2,4-dienoic acid,2e,4e-5-phenylpenta-2,4-dienoic acid,5-phenyl-2,4-pentadienoic acid,2,4-pentadienoic acid, 5-phenyl,e,e-cinnamylideneacetic acid,2e,4e-5-phenyl-2,4-pentadienoic acid,2,4-pentadienoicacid, 5-phenyl-, 2e,4e,4-phenyl-1,3-butadiene-1-carboxylic acid,juarezic acid,cinnamylidene acetic acid |
| IUPAC Name | (2E,4E)-5-phenylpenta-2,4-dienoic acid |
| InChI Key | FEIQOMCWGDNMHM-KBXRYBNXSA-N |
| Molecular Formula | C11H10O2 |
3,5-Dimethoxyaniline, 98%
CAS: 10272-07-8 Molecular Formula: C8H11NO2 Molecular Weight (g/mol): 153.18 MDL Number: MFCD00008392 InChI Key: WNRGWPVJGDABME-UHFFFAOYSA-N Synonym: benzenamine, 3,5-dimethoxy,3,5-dimethoxybenzeneamine,5-aminoresorcinol dimethyl ether,3,5-dimethoxy-phenylamine,3,5-dimethoxyanaline,3,5-dimethoxy aniline,5-aminoresorcinol dimethylether,3,5-dimethoxybenzenamine,3,5-dimethoxyphenylamine,pubchem4423 PubChem CID: 66301 IUPAC Name: 3,5-dimethoxyaniline SMILES: COC1=CC(OC)=CC(N)=C1
| PubChem CID | 66301 |
|---|---|
| CAS | 10272-07-8 |
| Molecular Weight (g/mol) | 153.18 |
| MDL Number | MFCD00008392 |
| SMILES | COC1=CC(OC)=CC(N)=C1 |
| Synonym | benzenamine, 3,5-dimethoxy,3,5-dimethoxybenzeneamine,5-aminoresorcinol dimethyl ether,3,5-dimethoxy-phenylamine,3,5-dimethoxyanaline,3,5-dimethoxy aniline,5-aminoresorcinol dimethylether,3,5-dimethoxybenzenamine,3,5-dimethoxyphenylamine,pubchem4423 |
| IUPAC Name | 3,5-dimethoxyaniline |
| InChI Key | WNRGWPVJGDABME-UHFFFAOYSA-N |
| Molecular Formula | C8H11NO2 |
2-Chloro-4-nitrobenzoyl chloride, 98%
CAS: 7073-36-1 Molecular Formula: C7H3Cl2NO3 Molecular Weight (g/mol): 220.01 MDL Number: MFCD00051515 InChI Key: KTHNITVDTYAHFF-UHFFFAOYSA-N PubChem CID: 81522 IUPAC Name: 2-chloro-4-nitrobenzoyl chloride SMILES: [O-][N+](=O)C1=CC=C(C(Cl)=O)C(Cl)=C1
| PubChem CID | 81522 |
|---|---|
| CAS | 7073-36-1 |
| Molecular Weight (g/mol) | 220.01 |
| MDL Number | MFCD00051515 |
| SMILES | [O-][N+](=O)C1=CC=C(C(Cl)=O)C(Cl)=C1 |
| IUPAC Name | 2-chloro-4-nitrobenzoyl chloride |
| InChI Key | KTHNITVDTYAHFF-UHFFFAOYSA-N |
| Molecular Formula | C7H3Cl2NO3 |
4-Hydrazinobenzenesulfonic acid, hemihydrate, 98%
CAS: 854689-07-9 Molecular Formula: C6H8N2O3S·1/2H2O Molecular Weight (g/mol): 197.21 MDL Number: MFCD00480958 InChI Key: OSOMMFVBTYFMBI-UHFFFAOYSA-N Synonym: 4-hydrazinylbenzenesulfonic acid hydrate,4-hydrazinobenzenesulfonic acid hydrate,phenylhydrazine-4-sulfonic acid hemihydrate,benzenesulfonic acid, 4-hydrazino-, monohydrate 9ci PubChem CID: 2849446 IUPAC Name: 4-hydrazinylbenzenesulfonic acid;hydrate SMILES: C1=CC(=CC=C1NN)S(=O)(=O)O.O
| PubChem CID | 2849446 |
|---|---|
| CAS | 854689-07-9 |
| Molecular Weight (g/mol) | 197.21 |
| MDL Number | MFCD00480958 |
| SMILES | C1=CC(=CC=C1NN)S(=O)(=O)O.O |
| Synonym | 4-hydrazinylbenzenesulfonic acid hydrate,4-hydrazinobenzenesulfonic acid hydrate,phenylhydrazine-4-sulfonic acid hemihydrate,benzenesulfonic acid, 4-hydrazino-, monohydrate 9ci |
| IUPAC Name | 4-hydrazinylbenzenesulfonic acid;hydrate |
| InChI Key | OSOMMFVBTYFMBI-UHFFFAOYSA-N |
| Molecular Formula | C6H8N2O3S·1/2H2O |
3,5-Bis(trifluoromethyl)benzyl alcohol, 98%
CAS: 32707-89-4 Molecular Formula: C9H6F6O Molecular Weight (g/mol): 244.136 MDL Number: MFCD00009907 InChI Key: BJTWPJOGDWRYDD-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl benzyl alcohol,3,5-bis trifluoromethyl phenyl methanol,3,5-bis-trifluoromethyl-phenyl-methanol,3,5-ditrifluoromethylbenzyl alcohol,benzenemethanol, 3,5-bis trifluoromethyl,3,5-bis trifluoromethyl benzylalcohol,3,5-di trifluoromethyl benzyl alcohol,3,5-di trifluoromethyl phenyl methanol,3,5-bis-trifluoromethyl benzyl alcohol PubChem CID: 122933 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]methanol SMILES: C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CO
| PubChem CID | 122933 |
|---|---|
| CAS | 32707-89-4 |
| Molecular Weight (g/mol) | 244.136 |
| MDL Number | MFCD00009907 |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CO |
| Synonym | 3,5-bis trifluoromethyl benzyl alcohol,3,5-bis trifluoromethyl phenyl methanol,3,5-bis-trifluoromethyl-phenyl-methanol,3,5-ditrifluoromethylbenzyl alcohol,benzenemethanol, 3,5-bis trifluoromethyl,3,5-bis trifluoromethyl benzylalcohol,3,5-di trifluoromethyl benzyl alcohol,3,5-di trifluoromethyl phenyl methanol,3,5-bis-trifluoromethyl benzyl alcohol |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methanol |
| InChI Key | BJTWPJOGDWRYDD-UHFFFAOYSA-N |
| Molecular Formula | C9H6F6O |
4-(tert-Butyl)-o-phenylenediamine, 97%
CAS: 68176-57-8 Molecular Formula: C10H16N2 Molecular Weight (g/mol): 164.252 MDL Number: MFCD00052695 InChI Key: WLOSFXSXVXTKBU-UHFFFAOYSA-N PubChem CID: 432708 IUPAC Name: 4-tert-butylbenzene-1,2-diamine SMILES: CC(C)(C)C1=CC(=C(C=C1)N)N
| PubChem CID | 432708 |
|---|---|
| CAS | 68176-57-8 |
| Molecular Weight (g/mol) | 164.252 |
| MDL Number | MFCD00052695 |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)N)N |
| IUPAC Name | 4-tert-butylbenzene-1,2-diamine |
| InChI Key | WLOSFXSXVXTKBU-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2 |
2-Amino-6-fluorobenzoic acid, 98%
CAS: 434-76-4 Molecular Formula: C7H5FNO2 Molecular Weight (g/mol): 154.12 MDL Number: MFCD00067781 InChI Key: RWSFZKWMVWPDGZ-UHFFFAOYSA-M Synonym: 6-fluoroanthranilic acid,anthralic acid, 6-fluoro,benzoic acid, 2-amino-6-fluoro,6-amino-2-fluorobenzoic acid,2-amino-6-fluoro-benzoic acid,2,amino-6-fluorobenzoic acid,4owo,pubchem1324,6-fluoroanthanilic acid,acmc-209jun PubChem CID: 521142 SMILES: NC1=CC=CC(F)=C1C([O-])=O
| PubChem CID | 521142 |
|---|---|
| CAS | 434-76-4 |
| Molecular Weight (g/mol) | 154.12 |
| MDL Number | MFCD00067781 |
| SMILES | NC1=CC=CC(F)=C1C([O-])=O |
| Synonym | 6-fluoroanthranilic acid,anthralic acid, 6-fluoro,benzoic acid, 2-amino-6-fluoro,6-amino-2-fluorobenzoic acid,2-amino-6-fluoro-benzoic acid,2,amino-6-fluorobenzoic acid,4owo,pubchem1324,6-fluoroanthanilic acid,acmc-209jun |
| InChI Key | RWSFZKWMVWPDGZ-UHFFFAOYSA-M |
| Molecular Formula | C7H5FNO2 |
4-Methoxy-2-methylbenzaldehyde, 97%, Thermo Scientific Chemicals
CAS: 52289-54-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD02261771 InChI Key: WICYVKGMEJSDAO-UHFFFAOYSA-N Synonym: 2-methyl-4-methoxybenzaldehyde,4-methoxy-2-methyl-benzaldehyde,benzaldehyde, 4-methoxy-2-methyl,2-methyl-p-anisaldehyde,2-methyl-anisaldehyde,acmc-1aoyo,4-methoxy-2-methylbenzaldehyd,4-methoxy-2-methylbenzaldehyde,3-furane-2-amido benzoic acid PubChem CID: 283285 IUPAC Name: 4-methoxy-2-methylbenzaldehyde SMILES: CC1=C(C=CC(=C1)OC)C=O
| PubChem CID | 283285 |
|---|---|
| CAS | 52289-54-0 |
| Molecular Weight (g/mol) | 150.18 |
| MDL Number | MFCD02261771 |
| SMILES | CC1=C(C=CC(=C1)OC)C=O |
| Synonym | 2-methyl-4-methoxybenzaldehyde,4-methoxy-2-methyl-benzaldehyde,benzaldehyde, 4-methoxy-2-methyl,2-methyl-p-anisaldehyde,2-methyl-anisaldehyde,acmc-1aoyo,4-methoxy-2-methylbenzaldehyd,4-methoxy-2-methylbenzaldehyde,3-furane-2-amido benzoic acid |
| IUPAC Name | 4-methoxy-2-methylbenzaldehyde |
| InChI Key | WICYVKGMEJSDAO-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Methyl 2-chloro-4-fluorophenylacetate, 98%
CAS: 214262-88-1 Molecular Formula: C9H8ClFO2 Molecular Weight (g/mol): 202.61 MDL Number: MFCD00800611 InChI Key: DFTYYBRLWCAUHP-UHFFFAOYSA-N Synonym: methyl 2-2-chloro-4-fluorophenyl acetate,methyl 2-chloro-4-fluorophenylacetate,benzeneacetic acid, 2-chloro-4-fluoro-, methyl ester,methyl-2-chloro-4-fluorophenylacetate,pubchem16488,methyl 2-chloro-4-fluorophenyl acetate,methyl2-2-chloro-4-fluorophenyl acetate,2-chloro-4-fluorophenyl-acetic acid methyl ester,2-chloro-4-fluorophenyl acetic acid methyl ester,methyl 2-chloro-4-fluorophenylacetate 98 PubChem CID: 736123 IUPAC Name: methyl 2-(2-chloro-4-fluorophenyl)acetate SMILES: COC(=O)CC1=CC=C(F)C=C1Cl
| PubChem CID | 736123 |
|---|---|
| CAS | 214262-88-1 |
| Molecular Weight (g/mol) | 202.61 |
| MDL Number | MFCD00800611 |
| SMILES | COC(=O)CC1=CC=C(F)C=C1Cl |
| Synonym | methyl 2-2-chloro-4-fluorophenyl acetate,methyl 2-chloro-4-fluorophenylacetate,benzeneacetic acid, 2-chloro-4-fluoro-, methyl ester,methyl-2-chloro-4-fluorophenylacetate,pubchem16488,methyl 2-chloro-4-fluorophenyl acetate,methyl2-2-chloro-4-fluorophenyl acetate,2-chloro-4-fluorophenyl-acetic acid methyl ester,2-chloro-4-fluorophenyl acetic acid methyl ester,methyl 2-chloro-4-fluorophenylacetate 98 |
| IUPAC Name | methyl 2-(2-chloro-4-fluorophenyl)acetate |
| InChI Key | DFTYYBRLWCAUHP-UHFFFAOYSA-N |
| Molecular Formula | C9H8ClFO2 |
Benzyl Methyl Ether, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 538-86-3
| CAS | 538-86-3 |
|---|
2-Chloro-1-iodo-4-nitrobenzene, 98%
CAS: 41252-96-4 Molecular Formula: C6H3ClINO2 Molecular Weight (g/mol): 283.449 MDL Number: MFCD00024589 InChI Key: FQXFHRSYMORXKN-UHFFFAOYSA-N Synonym: 3-chloro-4-iodonitrobenzene,3-chloro-4-iodo-nitrobenzene,3-chloro-4-iodo-nitro-benzene,benzene, 2-chloro-1-iodo-4-nitro,2-chlor-1-iod-4-nitrobenzol,acmc-20a36k,3-chloro-4-iodonitro benzene,1-iodo-2-chloro-4-nitrobenzene,2-chloro-1-iodo-4-nitro-benzene,1-chloro-2-iodo-5-nitrobenzene PubChem CID: 96640 IUPAC Name: 2-chloro-1-iodo-4-nitrobenzene SMILES: C1=CC(=C(C=C1[N+](=O)[O-])Cl)I
| PubChem CID | 96640 |
|---|---|
| CAS | 41252-96-4 |
| Molecular Weight (g/mol) | 283.449 |
| MDL Number | MFCD00024589 |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)I |
| Synonym | 3-chloro-4-iodonitrobenzene,3-chloro-4-iodo-nitrobenzene,3-chloro-4-iodo-nitro-benzene,benzene, 2-chloro-1-iodo-4-nitro,2-chlor-1-iod-4-nitrobenzol,acmc-20a36k,3-chloro-4-iodonitro benzene,1-iodo-2-chloro-4-nitrobenzene,2-chloro-1-iodo-4-nitro-benzene,1-chloro-2-iodo-5-nitrobenzene |
| IUPAC Name | 2-chloro-1-iodo-4-nitrobenzene |
| InChI Key | FQXFHRSYMORXKN-UHFFFAOYSA-N |
| Molecular Formula | C6H3ClINO2 |
[4-(tert-Butyl)phenyl]methanesulfonyl chloride, Tech., Thermo Scientific™
CAS: 519056-61-2 Molecular Formula: C11H15ClO2S Molecular Weight (g/mol): 246.749 MDL Number: MFCD04115413 InChI Key: NEJDUPGGBSPJLG-UHFFFAOYSA-N Synonym: 4-tert-butylphenyl methanesulfonyl chloride,4-tert-butyl phenyl methanesulfonyl chloride,4-tert-butyl phenyl methanesulfonylchloride,4-tert-butylphenyl methanesulphonyl chloride,4-1-butyl phenylmethanesulfonyl chloride,4-tert-butyl phenyl methyl chlorosulfone PubChem CID: 2794645 IUPAC Name: (4-tert-butylphenyl)methanesulfonyl chloride SMILES: CC(C)(C)C1=CC=C(C=C1)CS(=O)(=O)Cl
| PubChem CID | 2794645 |
|---|---|
| CAS | 519056-61-2 |
| Molecular Weight (g/mol) | 246.749 |
| MDL Number | MFCD04115413 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CS(=O)(=O)Cl |
| Synonym | 4-tert-butylphenyl methanesulfonyl chloride,4-tert-butyl phenyl methanesulfonyl chloride,4-tert-butyl phenyl methanesulfonylchloride,4-tert-butylphenyl methanesulphonyl chloride,4-1-butyl phenylmethanesulfonyl chloride,4-tert-butyl phenyl methyl chlorosulfone |
| IUPAC Name | (4-tert-butylphenyl)methanesulfonyl chloride |
| InChI Key | NEJDUPGGBSPJLG-UHFFFAOYSA-N |
| Molecular Formula | C11H15ClO2S |
2,4-Dinitroaniline, 99% (dry wt.), cont. up to 15% water
CAS: 97-02-9 Molecular Formula: C6H5N3O4 Molecular Weight (g/mol): 183.12 MDL Number: MFCD00007151 InChI Key: LXQOQPGNCGEELI-UHFFFAOYSA-N Synonym: benzenamine, 2,4-dinitro,1-amino-2,4-dinitrobenzene,2,4-dinitroanilin,2,4-dinitrobenzenamine,2,4-dinitroanilina,2,4-dinitraniline,2,4-dinitrophenylamine,aniline, 2,4-dinitro,2,4-dinitroaminobenzene,2,4-nitroaniline PubChem CID: 7321 ChEBI: CHEBI:34242 IUPAC Name: 2,4-dinitroaniline SMILES: NC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O
| PubChem CID | 7321 |
|---|---|
| CAS | 97-02-9 |
| Molecular Weight (g/mol) | 183.12 |
| ChEBI | CHEBI:34242 |
| MDL Number | MFCD00007151 |
| SMILES | NC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O |
| Synonym | benzenamine, 2,4-dinitro,1-amino-2,4-dinitrobenzene,2,4-dinitroanilin,2,4-dinitrobenzenamine,2,4-dinitroanilina,2,4-dinitraniline,2,4-dinitrophenylamine,aniline, 2,4-dinitro,2,4-dinitroaminobenzene,2,4-nitroaniline |
| IUPAC Name | 2,4-dinitroaniline |
| InChI Key | LXQOQPGNCGEELI-UHFFFAOYSA-N |
| Molecular Formula | C6H5N3O4 |
2,6-Dichlorobenzoic Acid, 98+%
CAS: 50-30-6 Molecular Formula: C7H4Cl2O2 Molecular Weight (g/mol): 191.01 MDL Number: MFCD00002418 InChI Key: MRUDNSFOFOQZDA-UHFFFAOYSA-N Synonym: benzoic acid, 2,6-dichloro,2,6-dichloro-benzoic acid,unii-634ri764qt,2,6 dichlorobenzoic acid,2,6-dichlorobenzoicacid,2,6-dichloro-benzoicacid,ccris 8610,pubchem20028,acmc-1auop,2.6-dichlorobenzoic acid PubChem CID: 5758 ChEBI: CHEBI:48623 IUPAC Name: 2,6-dichlorobenzoic acid SMILES: OC(=O)C1=C(Cl)C=CC=C1Cl
| PubChem CID | 5758 |
|---|---|
| CAS | 50-30-6 |
| Molecular Weight (g/mol) | 191.01 |
| ChEBI | CHEBI:48623 |
| MDL Number | MFCD00002418 |
| SMILES | OC(=O)C1=C(Cl)C=CC=C1Cl |
| Synonym | benzoic acid, 2,6-dichloro,2,6-dichloro-benzoic acid,unii-634ri764qt,2,6 dichlorobenzoic acid,2,6-dichlorobenzoicacid,2,6-dichloro-benzoicacid,ccris 8610,pubchem20028,acmc-1auop,2.6-dichlorobenzoic acid |
| IUPAC Name | 2,6-dichlorobenzoic acid |
| InChI Key | MRUDNSFOFOQZDA-UHFFFAOYSA-N |
| Molecular Formula | C7H4Cl2O2 |