Cyclohexylphenols
Aobchem 2-Bromo-4-fluoro-3-methylphenol | ≥97% | CAS 220901-60-0 | C7H6BrFO | 5g
2-Bromo-4-fluoro-3-methylphenol | ≥97% | CAS 220901-60-0 | C7H6BrFO | 5g
Aobchem 4-Bromo-2-chloro-5-methylphenol | ≥97% | CAS 319473-24-0 | C7H6BrClO | 1g
4-Bromo-2-chloro-5-methylphenol | ≥97% | CAS 319473-24-0 | C7H6BrClO | 1g
Aobchem 4-Bromo-2-chloro-5-methylphenol | ≥97% | CAS 319473-24-0 | C7H6BrClO | 250mg
4-Bromo-2-chloro-5-methylphenol | ≥97% | CAS 319473-24-0 | C7H6BrClO | 250mg
Aobchem 4-Bromo-2-chloro-5-methylphenol | ≥97% | CAS 319473-24-0 | C7H6BrClO | 5g
4-Bromo-2-chloro-5-methylphenol | ≥97% | CAS 319473-24-0 | C7H6BrClO | 5g
Aobchem 3-Bromo-2-fluoro-5-methylphenol | ≥97% | CAS 1026796-51-9 | C7H6BrFO | 1g
3-Bromo-2-fluoro-5-methylphenol | ≥97% | CAS 1026796-51-9 | C7H6BrFO | 1g
Aobchem 3-Bromo-5-fluoro-2-methylphenol | ≥95% | CAS 1784522-73-1 | C7H6BrFO | 250mg
3-Bromo-5-fluoro-2-methylphenol | ≥95% | CAS 1784522-73-1 | C7H6BrFO | 250mg
Aobchem 3-Bromo-2-fluoro-5-methylphenol | ≥97% | CAS 1026796-51-9 | C7H6BrFO | 5g
3-Bromo-2-fluoro-5-methylphenol | ≥97% | CAS 1026796-51-9 | C7H6BrFO | 5g
Aobchem 5-Bromo-4-fluoro-2-methylphenol | ≥95% | CAS 1701766-35-9 | C7H6BrFO | 500mg
5-Bromo-4-fluoro-2-methylphenol | ≥95% | CAS 1701766-35-9 | C7H6BrFO | 500mg
Aobchem 5-Bromo-4-fluoro-2-methylphenol | ≥95% | CAS 1701766-35-9 | C7H6BrFO | 250mg
5-Bromo-4-fluoro-2-methylphenol | ≥95% | CAS 1701766-35-9 | C7H6BrFO | 250mg
Aobchem 4-Bromo-5-fluoro-2-methylphenol | ≥97% | CAS 1600166-21-9 | C7H6BrFO | 1g
4-Bromo-5-fluoro-2-methylphenol | ≥97% | CAS 1600166-21-9 | C7H6BrFO | 1g
Aobchem 3-Bromo-5-fluoro-2-methylphenol | ≥95% | CAS 1784522-73-1 | C7H6BrFO | 500mg
3-Bromo-5-fluoro-2-methylphenol | ≥95% | CAS 1784522-73-1 | C7H6BrFO | 500mg
Aobchem 4-Bromo-5-fluoro-2-methylphenol | ≥97% | CAS 1600166-21-9 | C7H6BrFO | 250mg
4-Bromo-5-fluoro-2-methylphenol | ≥97% | CAS 1600166-21-9 | C7H6BrFO | 250mg
eMolecules 61798-24-1 | N,N??-Dimethyl-1,2-cyclohexanediamine | Ambeed | MFCD05664382 | 142.246 | C8H18N2 | 96.000 | CNC1CCCCC1NC | 25g | 552735054
N,N??-Dimethyl-1,2-cyclohexanediamine | Ambeed | 61798-24-1 | MFCD05664382 | 142.246 | C8H18N2 | 96.000 | CNC1CCCCC1NC | 25g | 552735054
NC(=O)OCC1c2ccccc2-c2ccccc12 | 25g | 771325099](https://assets.fishersci.com/TFS-Assets/CCG/product-images/default.jpg-250.jpg)
eMolecules 269078-73-1 | Fmoc-(S)-2-amino-4-cyclohexylbutanoic acid | Acrotein ChemBio Inc. | MFCD02179645 | 407.510 | C25H29NO4 | 97.000 | OC(=O)[C@H](CCC1CCCCC1)NC(=O)OCC1c2ccccc2-c2ccccc12 | 25g | 771325099
Fmoc-(S)-2-amino-4-cyclohexylbutanoic acid | Acrotein ChemBio Inc. | 269078-73-1 | MFCD02179645 | 407.510 | C25H29NO4 | 97.000 | OC(=O)[C@H](CCC1CCCCC1)NC(=O)OCC1c2ccccc2-c2ccccc12 | 25g | 771325099
![Medchemexpress LLC 5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine | 40045-50-9 | MFCD01927019 | 98.9% | 261.30 g/mol | C5H3N5O2S3 | 50 MG](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000240184.png-250.jpg)
Medchemexpress LLC 5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine | 40045-50-9 | MFCD01927019 | 98.9% | 261.30 g/mol | C5H3N5O2S3 | 50 MG
Halicin is a small-molecule JNK inhibitor intended for laboratory research. It exhibits biochemical activity against JNK (IC50 0.7 μM) and disrupts the JNK-JIP protein-protein interaction (IC50 239 nM). The compound is provided as a solid and as a DMSO solution for flexible assay preparation.