Spectroscopy
ANGSTROM INC Handy-Kaps. 1000/pk
Angstrom Handy-Kaps are thin-walled aluminum sample cups that are useful for preparing many types of samples prior to XRF or OE analysis. Cups are loaded with powder, then pressed to produce a reinforced sample that can be easily marked for sample identification.
Sklar Instruments Steelware Sklar Microscopy Surgical 12/PK
Steelware Sklar Microscopy Surgical 12/PK
eMolecules 49844-90-8 | 4-Chloro-2-(methylthio)pyrimidine | Ambeed | MFCD00006083 | 160.620 | C5H5ClN2S | 98.000 | CSc1nccc(Cl)n1 | 5g | 525118904
4-Chloro-2-(methylthio)pyrimidine | Ambeed | 49844-90-8 | MFCD00006083 | 160.620 | C5H5ClN2S | 98.000 | CSc1nccc(Cl)n1 | 5g | 525118904
eMolecules 72605-86-8 | methyl 2-chloro-1,3-thiazole-5-carboxylate | Pharmablock | MFCD09265500 | 177.600 | C5H4ClNO2S | 97.000 | COC(=O)c1cnc(Cl)s1 | 25mg | 703157468
methyl 2-chloro-1,3-thiazole-5-carboxylate | Pharmablock | 72605-86-8 | MFCD09265500 | 177.600 | C5H4ClNO2S | 97.000 | COC(=O)c1cnc(Cl)s1 | 25mg | 703157468
eMolecules 51940-64-8 | Ethyl 2,4-Dichloro-5-pyrimidinecarboxylate | Ambeed | MFCD09910281 | 221.040 | C7H6Cl2N2O2 | 97.000 | CCOC(=O)c1cnc(Cl)nc1Cl | 1g | 525194792
Ethyl 2,4-Dichloro-5-pyrimidinecarboxylate | Ambeed | 51940-64-8 | MFCD09910281 | 221.040 | C7H6Cl2N2O2 | 97.000 | CCOC(=O)c1cnc(Cl)nc1Cl | 1g | 525194792
eMolecules 1072944-22-9 | (6-bromo-2-methylpyridin-3-yl)boronic acid | Pharmablock | MFCD09037490 | 215.840 | C6H7BBrNO2 | 97.000 | Cc1nc(Br)ccc1B(O)O | 25mg | 784546031
(6-bromo-2-methylpyridin-3-yl)boronic acid | Pharmablock | 1072944-22-9 | MFCD09037490 | 215.840 | C6H7BBrNO2 | 97.000 | Cc1nc(Br)ccc1B(O)O | 25mg | 784546031
eMolecules 2231098-99-8 | Medchem Express | NCT-506 | 5mg | 713704343 | HY-112278 | 478.54 | C25H23FN4O3S
Ambeed | 3-Aminopicolinamide | 5g | 490514545 | A152128 | 50608-99-6 | MFCD06658329 | 137.142 | C6H7N3O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 300851-88-1 | 3-IODO-5-(TRIFLUOROMETHYL)PYRIDIN-2-OL | AstaTech | MFCD02691200 | 288.996 | C6H3F3INO | 95.000 | Oc1ncc(cc1I)C(F)(F)F | 0.25g | 587336533
3-IODO-5-(TRIFLUOROMETHYL)PYRIDIN-2-OL | AstaTech | 300851-88-1 | MFCD02691200 | 288.996 | C6H3F3INO | 95.000 | Oc1ncc(cc1I)C(F)(F)F | 0.25g | 587336533
eMolecules 1785259-87-1 | ChemScene | Methyl 5-amino-2-fluoro-4-methoxybenzoate | 100mg | 632303593 | CS-0160731 | MFCD23378835 | 199.181 | C9H10FNO3
Medchem Express | JH-XVI-178 | 5mg | 721310181 | HY-139875 | 2648453-53-4 | 435.920 | C22H22ClN7O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 2177258-32-9 | 3-FLUOROQUINOLINE-6-CARBONITRILE | AstaTech172.162 | C10H5FN2 | 95.000 | Fc1cnc2ccc(cc2c1)C#N | 0.1g | 713697532
3-FLUOROQUINOLINE-6-CARBONITRILE | AstaTech | 2177258-32-9172.162 | C10H5FN2 | 95.000 | Fc1cnc2ccc(cc2c1)C#N | 0.1g | 713697532
![eMolecules 1638767-60-8 | methyl 7-(benzenesulfonyl)-2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate | Pharmablock | MFCD27987430 | 386.200 | C14H9Cl2N3O4S | 97.000 | COC(=O)c1cc2c(Cl)nc(Cl)nc2n1S(=O)(=O)c1ccccc1 | 25mg | 713709358](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502438028.JPG-250.jpg)
eMolecules 1638767-60-8 | methyl 7-(benzenesulfonyl)-2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate | Pharmablock | MFCD27987430 | 386.200 | C14H9Cl2N3O4S | 97.000 | COC(=O)c1cc2c(Cl)nc(Cl)nc2n1S(=O)(=O)c1ccccc1 | 25mg | 713709358
methyl 7-(benzenesulfonyl)-2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate | Pharmablock | 1638767-60-8 | MFCD27987430 | 386.200 | C14H9Cl2N3O4S | 97.000 | COC(=O)c1cc2c(Cl)nc(Cl)nc2n1S(=O)(=O)c1ccccc1 | 25mg | 713709358
Perkin Elmer US LLC Sodium Spectral Lamp - 20 W
This replacement lamp is for PerkinElmer's older Polarimeter models. We recommend a service visit to replace and align this lamps, to ensure optimal operation.