Filtered Search Results
Thermo Scientific Chemicals Dimethyl-beta-cyclodextrin, methylated beta-cyclodextrins, 96%
CAS: 51166-71-3 Molecular Formula: C56H98O35 Molecular Weight (g/mol): 1331.4 MDL Number: MFCD00011616 InChI Key: QGKBSGBYSPTPKJ-UZMKXNTCSA-N Synonym: 2,6-di-o-methyl-beta-cyclodextrin,unii-5fjp73e35o,dimethyl-beta-cyclodextrin,heptakis 2,6-o-dimethyl beta-cyclodextrin,heptakis-2,6-di-o-methyl-beta-cyclodextrin,heptakis 2,6-di-o-methyl-beta-cyclodextrin,dm-beta-cyd,dimethyl,a-cyclodextrin,2,6-dme-beta-cyclodextrin,2,6-di-o-methyl-beta-cd PubChem CID: 10171019 SMILES: COCC1C2C(C(C(O1)OC3C(OC(C(C3O)OC)OC4C(OC(C(C4O)OC)OC5C(OC(C(C5O)OC)OC6C(OC(C(C6O)OC)OC7C(OC(C(C7O)OC)OC8C(OC(O2)C(C8O)OC)COC)COC)COC)COC)COC)COC)OC)O
| PubChem CID | 10171019 |
|---|---|
| CAS | 51166-71-3 |
| Molecular Weight (g/mol) | 1331.4 |
| MDL Number | MFCD00011616 |
| SMILES | COCC1C2C(C(C(O1)OC3C(OC(C(C3O)OC)OC4C(OC(C(C4O)OC)OC5C(OC(C(C5O)OC)OC6C(OC(C(C6O)OC)OC7C(OC(C(C7O)OC)OC8C(OC(O2)C(C8O)OC)COC)COC)COC)COC)COC)COC)OC)O |
| Synonym | 2,6-di-o-methyl-beta-cyclodextrin,unii-5fjp73e35o,dimethyl-beta-cyclodextrin,heptakis 2,6-o-dimethyl beta-cyclodextrin,heptakis-2,6-di-o-methyl-beta-cyclodextrin,heptakis 2,6-di-o-methyl-beta-cyclodextrin,dm-beta-cyd,dimethyl,a-cyclodextrin,2,6-dme-beta-cyclodextrin,2,6-di-o-methyl-beta-cd |
| InChI Key | QGKBSGBYSPTPKJ-UZMKXNTCSA-N |
| Molecular Formula | C56H98O35 |
Thermo Scientific Chemicals Tri-tert-butylphosphonium tetrafluoroborate, 97+%
CAS: 131274-22-1 Molecular Formula: C12H28BF4P Molecular Weight (g/mol): 290.13 MDL Number: MFCD04039975 InChI Key: YTJUCJAUJCXFTN-UHFFFAOYSA-O Synonym: tri-tert-butylphosphonium tetrafluoroborate,t-bu 3ph bf4,tri-t-butylphosphonium tetrafluoroborate,fluoroboric acid tri-tert-butylphosphine adduct,tri-tert-butylphosphanium tetrafluoroborate,tbu3p hbf4,ttbp hbf4,t-bu3p hbf4,tbu 3p hbf4,acmc-20a4f9 PubChem CID: 2734635 SMILES: F[B-](F)(F)F.CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C
| PubChem CID | 2734635 |
|---|---|
| CAS | 131274-22-1 |
| Molecular Weight (g/mol) | 290.13 |
| MDL Number | MFCD04039975 |
| SMILES | F[B-](F)(F)F.CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C |
| Synonym | tri-tert-butylphosphonium tetrafluoroborate,t-bu 3ph bf4,tri-t-butylphosphonium tetrafluoroborate,fluoroboric acid tri-tert-butylphosphine adduct,tri-tert-butylphosphanium tetrafluoroborate,tbu3p hbf4,ttbp hbf4,t-bu3p hbf4,tbu 3p hbf4,acmc-20a4f9 |
| InChI Key | YTJUCJAUJCXFTN-UHFFFAOYSA-O |
| Molecular Formula | C12H28BF4P |
Thermo Scientific Chemicals Bis(2-diphenylphosphinoethyl)phenylphosphine, 97%
CAS: 23582-02-7 Molecular Formula: C34H33P3 Molecular Weight (g/mol): 534.56 MDL Number: MFCD00003048 InChI Key: AXVOAMVQOCBPQT-UHFFFAOYSA-N Synonym: bis 2-diphenylphosphinoethyl phenylphosphine,phenylphosphinediyl bis ethane-2,1-diyl bis diphenylphosphine,bis 2-diphenylphosphino ethyl phenylphosphine,phosphine, bis 2-diphenylphosphino ethyl phenyl,phenylbis diphenylphosphinoethyl phosphine,pubchem6540,acmc-20alo6,chembl69711,bis 2-biphenylphosphinoethyl phenylphosphine PubChem CID: 90192 IUPAC Name: bis(2-diphenylphosphanylethyl)-phenylphosphane SMILES: C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 90192 |
|---|---|
| CAS | 23582-02-7 |
| Molecular Weight (g/mol) | 534.56 |
| MDL Number | MFCD00003048 |
| SMILES | C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | bis 2-diphenylphosphinoethyl phenylphosphine,phenylphosphinediyl bis ethane-2,1-diyl bis diphenylphosphine,bis 2-diphenylphosphino ethyl phenylphosphine,phosphine, bis 2-diphenylphosphino ethyl phenyl,phenylbis diphenylphosphinoethyl phosphine,pubchem6540,acmc-20alo6,chembl69711,bis 2-biphenylphosphinoethyl phenylphosphine |
| IUPAC Name | bis(2-diphenylphosphanylethyl)-phenylphosphane |
| InChI Key | AXVOAMVQOCBPQT-UHFFFAOYSA-N |
| Molecular Formula | C34H33P3 |
Thermo Scientific Chemicals Di-μ-hydroxo-bis-[(N,N,N',N'-tetramethylethylenediamine)copper(II)]chloride, 98%
CAS: 30698-64-7 Molecular Formula: C12H36Cl2Cu2N4O2 Molecular Weight (g/mol): 466.44 MDL Number: MFCD01321163 InChI Key: VVXKYYDFGPZSOZ-UHFFFAOYSA-L Synonym: cu-tmeda catalyst,di-mu-hydroxo-bis n,n,n'.n'-tetramethylethylenediamine copper ii chloride,cu-tmedacatalyst,bis chlorocopperol ; bis temed,di-hydroxo-bis n,n,n',n'-tetramethylethylenediamine copper ii chloride,chlorohydroxo n,n,n inverted exclamation marka,n inverted exclamation marka-tetrametylethylenediamine copper ii,copper ii chloride hydroxide n,n,n inverted exclamation marka,n inverted exclamation marka-tetrametylethylenediamine complex dimer,di-,i-hydroxo-bis n,n,n inverted exclamation marka,n inverted exclamation marka-tetramethylethylenediamine copper ii chloride,i-hydroxo-bis n,n,n inverted exclamation marka.n inverted exclamation marka-tetramethylethylenediamine copper ii chloride PubChem CID: 11190467 IUPAC Name: chlorocopper;N,N,N',N'-tetramethylethane-1,2-diamine;dihydrate SMILES: O.O.Cl[Cu].Cl[Cu].CN(C)CCN(C)C.CN(C)CCN(C)C
| PubChem CID | 11190467 |
|---|---|
| CAS | 30698-64-7 |
| Molecular Weight (g/mol) | 466.44 |
| MDL Number | MFCD01321163 |
| SMILES | O.O.Cl[Cu].Cl[Cu].CN(C)CCN(C)C.CN(C)CCN(C)C |
| Synonym | cu-tmeda catalyst,di-mu-hydroxo-bis n,n,n'.n'-tetramethylethylenediamine copper ii chloride,cu-tmedacatalyst,bis chlorocopperol ; bis temed,di-hydroxo-bis n,n,n',n'-tetramethylethylenediamine copper ii chloride,chlorohydroxo n,n,n inverted exclamation marka,n inverted exclamation marka-tetrametylethylenediamine copper ii,copper ii chloride hydroxide n,n,n inverted exclamation marka,n inverted exclamation marka-tetrametylethylenediamine complex dimer,di-,i-hydroxo-bis n,n,n inverted exclamation marka,n inverted exclamation marka-tetramethylethylenediamine copper ii chloride,i-hydroxo-bis n,n,n inverted exclamation marka.n inverted exclamation marka-tetramethylethylenediamine copper ii chloride |
| IUPAC Name | chlorocopper;N,N,N',N'-tetramethylethane-1,2-diamine;dihydrate |
| InChI Key | VVXKYYDFGPZSOZ-UHFFFAOYSA-L |
| Molecular Formula | C12H36Cl2Cu2N4O2 |
Thermo Scientific Chemicals 1,2-Bis(diphenylphosphino)ethane, 98+%
CAS: 1663-45-2 Molecular Formula: C26H24P2 Molecular Weight (g/mol): 398.43 MDL Number: MFCD00003047 InChI Key: QFMZQPDHXULLKC-UHFFFAOYSA-N Synonym: 1,2-bis diphenylphosphino ethane,diphos,ethylenebis diphenylphosphine,bis diphenylphosphine ethane,bis 1,2-diphenylphosphino ethane,phosphine, 1,2-ethanediylbis diphenyl,phosphine, ethylenebis diphenyl,1,2-bis diphenylphosphine ethane,1,2-bis diphenylphosphino-ethane,unii-kl33qe52i4 PubChem CID: 74267 ChEBI: CHEBI:30669 IUPAC Name: 2-diphenylphosphanylethyl(diphenyl)phosphane SMILES: C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 74267 |
|---|---|
| CAS | 1663-45-2 |
| Molecular Weight (g/mol) | 398.43 |
| ChEBI | CHEBI:30669 |
| MDL Number | MFCD00003047 |
| SMILES | C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 1,2-bis diphenylphosphino ethane,diphos,ethylenebis diphenylphosphine,bis diphenylphosphine ethane,bis 1,2-diphenylphosphino ethane,phosphine, 1,2-ethanediylbis diphenyl,phosphine, ethylenebis diphenyl,1,2-bis diphenylphosphine ethane,1,2-bis diphenylphosphino-ethane,unii-kl33qe52i4 |
| IUPAC Name | 2-diphenylphosphanylethyl(diphenyl)phosphane |
| InChI Key | QFMZQPDHXULLKC-UHFFFAOYSA-N |
| Molecular Formula | C26H24P2 |
Thermo Scientific Chemicals Dimethylphenylphosphine, 96%
CAS: 672-66-2 Molecular Formula: C8H11P Molecular Weight (g/mol): 138.15 MDL Number: MFCD00008509 InChI Key: HASCQPSFPAKVEK-UHFFFAOYSA-N Synonym: dimethylphenylphosphine,dimethyl phenyl phosphine,dimethyl phenyl phosphane,me2pph,phenyldimethylphosphine,pme2ph,phosphine, dimethylphenyl,pubchem6420,dimethyl phenylphosphine PubChem CID: 69597 ChEBI: CHEBI:30671 IUPAC Name: dimethyl(phenyl)phosphane SMILES: CP(C)C1=CC=CC=C1
| PubChem CID | 69597 |
|---|---|
| CAS | 672-66-2 |
| Molecular Weight (g/mol) | 138.15 |
| ChEBI | CHEBI:30671 |
| MDL Number | MFCD00008509 |
| SMILES | CP(C)C1=CC=CC=C1 |
| Synonym | dimethylphenylphosphine,dimethyl phenyl phosphine,dimethyl phenyl phosphane,me2pph,phenyldimethylphosphine,pme2ph,phosphine, dimethylphenyl,pubchem6420,dimethyl phenylphosphine |
| IUPAC Name | dimethyl(phenyl)phosphane |
| InChI Key | HASCQPSFPAKVEK-UHFFFAOYSA-N |
| Molecular Formula | C8H11P |
Thermo Scientific Chemicals 2-(Diphenylphosphino)benzoic Acid, 98%
CAS: 17261-28-8 Molecular Formula: C19H15O2P Molecular Weight (g/mol): 306.30 MDL Number: MFCD00674024 InChI Key: UYRPRYSDOVYCOU-UHFFFAOYSA-N Synonym: 2-diphenylphosphino benzoic acid,2-diphenylphosphinobenzoic acid,benzoic acid, 2-diphenylphosphino,o-diphenylphosphinobenozic acid,2-carboxyphenyl diphenylphosphine,2-diphenylphosphanyl benzoic acid,benzoic acid, diphenylphosphino,o-diphenylphosphino benzoic acid,dppbac,acmc-1bt7u PubChem CID: 87021 IUPAC Name: 2-diphenylphosphanylbenzoic acid SMILES: OC(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 87021 |
|---|---|
| CAS | 17261-28-8 |
| Molecular Weight (g/mol) | 306.30 |
| MDL Number | MFCD00674024 |
| SMILES | OC(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-diphenylphosphino benzoic acid,2-diphenylphosphinobenzoic acid,benzoic acid, 2-diphenylphosphino,o-diphenylphosphinobenozic acid,2-carboxyphenyl diphenylphosphine,2-diphenylphosphanyl benzoic acid,benzoic acid, diphenylphosphino,o-diphenylphosphino benzoic acid,dppbac,acmc-1bt7u |
| IUPAC Name | 2-diphenylphosphanylbenzoic acid |
| InChI Key | UYRPRYSDOVYCOU-UHFFFAOYSA-N |
| Molecular Formula | C19H15O2P |
Thermo Scientific Chemicals Tris(2-methoxyphenyl)phosphine, 97+%
CAS: 4731-65-1 Molecular Formula: C21H21O3P Molecular Weight (g/mol): 352.37 MDL Number: MFCD00014892 InChI Key: IIOSDXGZLBPOHD-UHFFFAOYSA-N Synonym: tris 2-methoxyphenyl phosphine,tris o-methoxyphenyl phosphine,tris 2-methoxyphenyl phosphane,phosphine, tris methoxyphenyl,tris-2-methoxyphenyl-phosphine,tris o-anisyl phosphine,tri-2-methoxyphenyl phosphine,pubchem19707,tri 2-methoxyphenyl phosphine,ksc286k3b PubChem CID: 78464 IUPAC Name: tris(2-methoxyphenyl)phosphane SMILES: COC1=CC=CC=C1P(C2=CC=CC=C2OC)C3=CC=CC=C3OC
| PubChem CID | 78464 |
|---|---|
| CAS | 4731-65-1 |
| Molecular Weight (g/mol) | 352.37 |
| MDL Number | MFCD00014892 |
| SMILES | COC1=CC=CC=C1P(C2=CC=CC=C2OC)C3=CC=CC=C3OC |
| Synonym | tris 2-methoxyphenyl phosphine,tris o-methoxyphenyl phosphine,tris 2-methoxyphenyl phosphane,phosphine, tris methoxyphenyl,tris-2-methoxyphenyl-phosphine,tris o-anisyl phosphine,tri-2-methoxyphenyl phosphine,pubchem19707,tri 2-methoxyphenyl phosphine,ksc286k3b |
| IUPAC Name | tris(2-methoxyphenyl)phosphane |
| InChI Key | IIOSDXGZLBPOHD-UHFFFAOYSA-N |
| Molecular Formula | C21H21O3P |
Thermo Scientific Chemicals Tricyclohexylphosphonium tetrafluoroborate, 99%
CAS: 58656-04-5 Molecular Formula: C18H34BF4P Molecular Weight (g/mol): 368.25 MDL Number: MFCD03840580 InChI Key: MYSMMEUXKHJYKH-UHFFFAOYSA-O Synonym: tricyclohexylphosphonium tetrafluoroborate,tricyclohexylphosphine tetrafluoroborate,tricyclohexylphosphine tetrafluroborate,tricyclohexylphosphoniumtetrafluoroborate,pcy3.hbf4,ksc269e4n,tricyclohexylphosphine tetrofluroborate,tricyclohexyl phosphonium tetrafluoroborate,tetrafluoroboranuide tricyclohexylphosphanium,tricyclohexyl-phosphonium tetrafluoro borate PubChem CID: 11710396 SMILES: F[B-](F)(F)F.C1CCC(CC1)[PH+](C1CCCCC1)C1CCCCC1
| PubChem CID | 11710396 |
|---|---|
| CAS | 58656-04-5 |
| Molecular Weight (g/mol) | 368.25 |
| MDL Number | MFCD03840580 |
| SMILES | F[B-](F)(F)F.C1CCC(CC1)[PH+](C1CCCCC1)C1CCCCC1 |
| Synonym | tricyclohexylphosphonium tetrafluoroborate,tricyclohexylphosphine tetrafluoroborate,tricyclohexylphosphine tetrafluroborate,tricyclohexylphosphoniumtetrafluoroborate,pcy3.hbf4,ksc269e4n,tricyclohexylphosphine tetrofluroborate,tricyclohexyl phosphonium tetrafluoroborate,tetrafluoroboranuide tricyclohexylphosphanium,tricyclohexyl-phosphonium tetrafluoro borate |
| InChI Key | MYSMMEUXKHJYKH-UHFFFAOYSA-O |
| Molecular Formula | C18H34BF4P |
Thermo Scientific Chemicals Tri-(2-furyl)phosphine, 98%
CAS: 5518-52-5 Molecular Formula: C12H9O3P Molecular Weight (g/mol): 232.18 MDL Number: MFCD00151857 InChI Key: DLQYXUGCCKQSRJ-UHFFFAOYSA-N Synonym: tri 2-furyl phosphine,tri furan-2-yl phosphine,tri-2-furyl phosphine,tris furan-2-yl phosphane,tri-2-furylphosphine,tris 2-furyl phosphine,tri furan-2-yl phosphane,trifurylphosphine,tri fur-2-yl phosphane,tris 2-furanyl phosphine PubChem CID: 521585 IUPAC Name: tris(furan-2-yl)phosphane SMILES: O1C=CC=C1P(C1=CC=CO1)C1=CC=CO1
| PubChem CID | 521585 |
|---|---|
| CAS | 5518-52-5 |
| Molecular Weight (g/mol) | 232.18 |
| MDL Number | MFCD00151857 |
| SMILES | O1C=CC=C1P(C1=CC=CO1)C1=CC=CO1 |
| Synonym | tri 2-furyl phosphine,tri furan-2-yl phosphine,tri-2-furyl phosphine,tris furan-2-yl phosphane,tri-2-furylphosphine,tris 2-furyl phosphine,tri furan-2-yl phosphane,trifurylphosphine,tri fur-2-yl phosphane,tris 2-furanyl phosphine |
| IUPAC Name | tris(furan-2-yl)phosphane |
| InChI Key | DLQYXUGCCKQSRJ-UHFFFAOYSA-N |
| Molecular Formula | C12H9O3P |
Thermo Scientific Chemicals (S)-(-)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl, 99+%
CAS: 76189-56-5 Molecular Formula: C44H32P2 Molecular Weight (g/mol): 622.69 MDL Number: MFCD00010805 InChI Key: MUALRAIOVNYAIW-UHFFFAOYSA-N Synonym: binap,r-+-2,2'-bis diphenylphosphino-1,1'-binaphthyl,2,2'-bis diphenylphosphino-1,1'-binaphthyl,s-binap,s---binap,s---2,2'-bis diphenylphosphino-1,1'-binaphthyl,r-+-binap,r-binap,rac-binap,2,2'-bis diphenylphosphino-1,1'-binaphthalene PubChem CID: 634876 IUPAC Name: [1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=C2C=CC=CC2=C1C1=C(C=CC2=CC=CC=C12)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 634876 |
|---|---|
| CAS | 76189-56-5 |
| Molecular Weight (g/mol) | 622.69 |
| MDL Number | MFCD00010805 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=C2C=CC=CC2=C1C1=C(C=CC2=CC=CC=C12)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | binap,r-+-2,2'-bis diphenylphosphino-1,1'-binaphthyl,2,2'-bis diphenylphosphino-1,1'-binaphthyl,s-binap,s---binap,s---2,2'-bis diphenylphosphino-1,1'-binaphthyl,r-+-binap,r-binap,rac-binap,2,2'-bis diphenylphosphino-1,1'-binaphthalene |
| IUPAC Name | [1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane |
| InChI Key | MUALRAIOVNYAIW-UHFFFAOYSA-N |
| Molecular Formula | C44H32P2 |
Thermo Scientific Chemicals Dextran sulfate sodium salt, approx. M.W. 6,500 - 10,000
CAS: 9011-18-1 Molecular Formula: (C6H7O5)m(C6H7O5)n Molecular Weight (g/mol): 40,000 MDL Number: MFCD00081551 InChI Key: BLFLLBZGZJTVJG-UHFFFAOYSA-N Synonym: benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin PubChem CID: 2337 ChEBI: CHEBI:116735 SMILES: *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*]
| PubChem CID | 2337 |
|---|---|
| CAS | 9011-18-1 |
| Molecular Weight (g/mol) | 40,000 |
| ChEBI | CHEBI:116735 |
| MDL Number | MFCD00081551 |
| SMILES | *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*] |
| Synonym | benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin |
| InChI Key | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Molecular Formula | (C6H7O5)m(C6H7O5)n |
Thermo Scientific Chemicals Triphenylphosphine oxide, 99%
CAS: 791-28-6 Molecular Formula: C18H15OP Molecular Weight (g/mol): 278.29 MDL Number: MFCD00002080 MFCD03458802 InChI Key: FIQMHBFVRAXMOP-UHFFFAOYSA-N Synonym: triphenylphosphine oxide,phosphine oxide, triphenyl,triphenyl phosphorus oxide,triphenyl phosphine oxide,triphenylphosphane oxide,tppo,triphenylphosphineoxide,ph3po,diphenylphosphoroso benzene,triphenylphosphanoxid PubChem CID: 13097 ChEBI: CHEBI:36601 IUPAC Name: diphenylphosphorylbenzene SMILES: O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 13097 |
|---|---|
| CAS | 791-28-6 |
| Molecular Weight (g/mol) | 278.29 |
| ChEBI | CHEBI:36601 |
| MDL Number | MFCD00002080 MFCD03458802 |
| SMILES | O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine oxide,phosphine oxide, triphenyl,triphenyl phosphorus oxide,triphenyl phosphine oxide,triphenylphosphane oxide,tppo,triphenylphosphineoxide,ph3po,diphenylphosphoroso benzene,triphenylphosphanoxid |
| IUPAC Name | diphenylphosphorylbenzene |
| InChI Key | FIQMHBFVRAXMOP-UHFFFAOYSA-N |
| Molecular Formula | C18H15OP |
Thermo Scientific Chemicals Cobaltocene, 98%
CAS: 1277-43-6 Molecular Formula: C10H10Co Molecular Weight (g/mol): 189.12 MDL Number: MFCD00013749 InChI Key: SNBRJOIYNQIWSZ-UHFFFAOYSA-N Synonym: Bis(cyclopentadienyl)cobalt PubChem CID: 24942376 IUPAC Name: cobalt(2+);cyclopenta-1,3-diene SMILES: C1C=CC=[C-]1.C1C=CC=[C-]1.[Co+2]
| PubChem CID | 24942376 |
|---|---|
| CAS | 1277-43-6 |
| Molecular Weight (g/mol) | 189.12 |
| MDL Number | MFCD00013749 |
| SMILES | C1C=CC=[C-]1.C1C=CC=[C-]1.[Co+2] |
| Synonym | Bis(cyclopentadienyl)cobalt |
| IUPAC Name | cobalt(2+);cyclopenta-1,3-diene |
| InChI Key | SNBRJOIYNQIWSZ-UHFFFAOYSA-N |
| Molecular Formula | C10H10Co |
Thermo Scientific Chemicals Methyldiphenylphosphine, 99%
CAS: 1486-28-8 Molecular Formula: C13H13P Molecular Weight (g/mol): 200.22 MDL Number: MFCD00008508 InChI Key: UJNZOIKQAUQOCN-UHFFFAOYSA-N Synonym: methyldiphenylphosphine,diphenylmethylphosphine,methyl diphenyl phosphine,phosphine, methyldiphenyl,methyldiphenylphsphine,diphenylphosphinomethane,methyldiphenylphoshine,pubchem6421,methyl diphenylphosphine,methyldi-phenylphosphine PubChem CID: 73879 IUPAC Name: methyl(diphenyl)phosphane SMILES: CP(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 73879 |
|---|---|
| CAS | 1486-28-8 |
| Molecular Weight (g/mol) | 200.22 |
| MDL Number | MFCD00008508 |
| SMILES | CP(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | methyldiphenylphosphine,diphenylmethylphosphine,methyl diphenyl phosphine,phosphine, methyldiphenyl,methyldiphenylphsphine,diphenylphosphinomethane,methyldiphenylphoshine,pubchem6421,methyl diphenylphosphine,methyldi-phenylphosphine |
| IUPAC Name | methyl(diphenyl)phosphane |
| InChI Key | UJNZOIKQAUQOCN-UHFFFAOYSA-N |
| Molecular Formula | C13H13P |