Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Diethyl carbonate, 99%
CAS: 105-58-8 Molecular Formula: C5H10O3 Molecular Weight (g/mol): 118.13 MDL Number: MFCD00009107 InChI Key: OIFBSDVPJOWBCH-UHFFFAOYSA-N Synonym: ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co PubChem CID: 7766 IUPAC Name: diethyl carbonate SMILES: CCOC(=O)OCC
| PubChem CID | 7766 |
|---|---|
| CAS | 105-58-8 |
| Molecular Weight (g/mol) | 118.13 |
| MDL Number | MFCD00009107 |
| SMILES | CCOC(=O)OCC |
| Synonym | ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co |
| IUPAC Name | diethyl carbonate |
| InChI Key | OIFBSDVPJOWBCH-UHFFFAOYSA-N |
| Molecular Formula | C5H10O3 |
1,4-Diethoxybenzene, 98%
CAS: 122-95-2 Molecular Formula: C10H14O2 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00015146 InChI Key: VWGNFIQXBYRDCH-UHFFFAOYSA-N Synonym: benzene, 1,4-diethoxy,p-diethoxybenzene,hydroquinone diethyl ether,benzene, p-diethoxy,diethoxybenzene,1,4-diethoxy-benzen,benzene,4-diethoxy,1,4-diethoxybenzol,hydroquinonedlethylether,acmc-209ans PubChem CID: 67150 IUPAC Name: 1,4-diethoxybenzene SMILES: CCOC1=CC=C(OCC)C=C1
| PubChem CID | 67150 |
|---|---|
| CAS | 122-95-2 |
| Molecular Weight (g/mol) | 166.22 |
| MDL Number | MFCD00015146 |
| SMILES | CCOC1=CC=C(OCC)C=C1 |
| Synonym | benzene, 1,4-diethoxy,p-diethoxybenzene,hydroquinone diethyl ether,benzene, p-diethoxy,diethoxybenzene,1,4-diethoxy-benzen,benzene,4-diethoxy,1,4-diethoxybenzol,hydroquinonedlethylether,acmc-209ans |
| IUPAC Name | 1,4-diethoxybenzene |
| InChI Key | VWGNFIQXBYRDCH-UHFFFAOYSA-N |
| Molecular Formula | C10H14O2 |
Diphenyliodonium hexafluorophosphate, 98%
CAS: 58109-40-3 Molecular Formula: C12H10I Molecular Weight (g/mol): 281.12 MDL Number: MFCD00061398 InChI Key: OZLBDYMWFAHSOQ-UHFFFAOYSA-N Synonym: diphenyliodonium hexafluorophosphate,diphenyliodanium hexafluorophosphate,diphenyliodonium hexafluorophosphate v,iodonium, diphenyl-, hexafluorophosphate 1-,iodonium, diphenyl-, hexafluorophosphate 1-1:1,diphenyliodonium pf6,dpihfp,acmc-209m2o,phi + pf6-,diphenyliodanium; hexafluoro-$l^ 5-phosphanuide PubChem CID: 2737136 IUPAC Name: diphenyliodanium SMILES: [I+](C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2737136 |
|---|---|
| CAS | 58109-40-3 |
| Molecular Weight (g/mol) | 281.12 |
| MDL Number | MFCD00061398 |
| SMILES | [I+](C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyliodonium hexafluorophosphate,diphenyliodanium hexafluorophosphate,diphenyliodonium hexafluorophosphate v,iodonium, diphenyl-, hexafluorophosphate 1-,iodonium, diphenyl-, hexafluorophosphate 1-1:1,diphenyliodonium pf6,dpihfp,acmc-209m2o,phi + pf6-,diphenyliodanium; hexafluoro-$l^ 5-phosphanuide |
| IUPAC Name | diphenyliodanium |
| InChI Key | OZLBDYMWFAHSOQ-UHFFFAOYSA-N |
| Molecular Formula | C12H10I |
Iodoacetic acid, 97%
CAS: 64-69-7 Molecular Formula: C2H3IO2 Molecular Weight (g/mol): 185.95 MDL Number: MFCD00002685 InChI Key: JDNTWHVOXJZDSN-UHFFFAOYSA-N Synonym: iodoacetic acid,acetic acid, iodo,iodoacetate,monoiodoacetic acid,monoiodoacetate,monoiodine acetate,iodoaceticacid,iodoethanoic acid,acetic acid, 2-iodo,kyselina jodoctova PubChem CID: 5240 ChEBI: CHEBI:74571 IUPAC Name: 2-iodoacetic acid SMILES: C(C(=O)O)I
| PubChem CID | 5240 |
|---|---|
| CAS | 64-69-7 |
| Molecular Weight (g/mol) | 185.95 |
| ChEBI | CHEBI:74571 |
| MDL Number | MFCD00002685 |
| SMILES | C(C(=O)O)I |
| Synonym | iodoacetic acid,acetic acid, iodo,iodoacetate,monoiodoacetic acid,monoiodoacetate,monoiodine acetate,iodoaceticacid,iodoethanoic acid,acetic acid, 2-iodo,kyselina jodoctova |
| IUPAC Name | 2-iodoacetic acid |
| InChI Key | JDNTWHVOXJZDSN-UHFFFAOYSA-N |
| Molecular Formula | C2H3IO2 |
Quinoline, 99%
CAS: 91-22-5 Molecular Formula: C9H7N Molecular Weight (g/mol): 129.16 MDL Number: MFCD00006736,MFCD06637409,MFCD31699982,MFCD31699983,MFCD31699984,MFCD31699985,MFCD31699986,MFCD31699987 InChI Key: SMWDFEZZVXVKRB-UHFFFAOYSA-N Synonym: chinolin,chinoline,1-benzazine,quinolin,1-azanaphthalene,chinoleine,leucol,benzo b pyridine,benzopyridine,leukol PubChem CID: 7047 ChEBI: CHEBI:17362 IUPAC Name: quinoline SMILES: C1=CC=C2N=CC=CC2=C1
| PubChem CID | 7047 |
|---|---|
| CAS | 91-22-5 |
| Molecular Weight (g/mol) | 129.16 |
| ChEBI | CHEBI:17362 |
| MDL Number | MFCD00006736,MFCD06637409,MFCD31699982,MFCD31699983,MFCD31699984,MFCD31699985,MFCD31699986,MFCD31699987 |
| SMILES | C1=CC=C2N=CC=CC2=C1 |
| Synonym | chinolin,chinoline,1-benzazine,quinolin,1-azanaphthalene,chinoleine,leucol,benzo b pyridine,benzopyridine,leukol |
| IUPAC Name | quinoline |
| InChI Key | SMWDFEZZVXVKRB-UHFFFAOYSA-N |
| Molecular Formula | C9H7N |
Phenylarsine Oxide, (1mL = 0.2mg Cl), Certified, 0.00564N ±0.00005N (0.00282M), LabChem™
CAS: 637-03-6 Molecular Formula: C6H5AsO Molecular Weight (g/mol): 168.03 MDL Number: MFCD00001990 InChI Key: BQVCCPGCDUSGOE-UHFFFAOYSA-N Synonym: phenylarsine oxide,oxophenylarsine,arzene,phenylarsenoxide,arsenosobenzene,arsine, oxophenyl,phenyl arsine oxide,benzene, arsenoso,fenylarsinoxid,caswell no. 060 PubChem CID: 4778 ChEBI: CHEBI:75253 IUPAC Name: arsorosobenzene SMILES: O=[As]C1=CC=CC=C1
| PubChem CID | 4778 |
|---|---|
| CAS | 637-03-6 |
| Molecular Weight (g/mol) | 168.03 |
| ChEBI | CHEBI:75253 |
| MDL Number | MFCD00001990 |
| SMILES | O=[As]C1=CC=CC=C1 |
| Synonym | phenylarsine oxide,oxophenylarsine,arzene,phenylarsenoxide,arsenosobenzene,arsine, oxophenyl,phenyl arsine oxide,benzene, arsenoso,fenylarsinoxid,caswell no. 060 |
| IUPAC Name | arsorosobenzene |
| InChI Key | BQVCCPGCDUSGOE-UHFFFAOYSA-N |
| Molecular Formula | C6H5AsO |
(Methoxycarbonylmethylene)triphenylphosphorane, 98%
CAS: 2605-67-6 Molecular Formula: C21H19O2P Molecular Weight (g/mol): 334.36 MDL Number: MFCD00008455 InChI Key: NTNUDYROPUKXNA-UHFFFAOYSA-N Synonym: methyl triphenylphosphoranylidene acetate,carbomethoxymethylene triphenylphosphorane,methyl 2-triphenylphosphoranylidene acetate,acetic acid, triphenylphosphoranylidene-, methyl ester,methyl triphenylphosphoranylideneacetate,triphenylphosphoranylidene acetic acid methyl ester,triphenyl carbomethoxymethylene phosphorane,methoxycarbonylmethylene triphenylphosphorane,acetic acid, 2-triphenylphosphoranylidene-, methyl ester PubChem CID: 17453 IUPAC Name: methyl 2-(triphenyl-$l^{5}-phosphanylidene)acetate SMILES: COC(=O)C=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 17453 |
|---|---|
| CAS | 2605-67-6 |
| Molecular Weight (g/mol) | 334.36 |
| MDL Number | MFCD00008455 |
| SMILES | COC(=O)C=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | methyl triphenylphosphoranylidene acetate,carbomethoxymethylene triphenylphosphorane,methyl 2-triphenylphosphoranylidene acetate,acetic acid, triphenylphosphoranylidene-, methyl ester,methyl triphenylphosphoranylideneacetate,triphenylphosphoranylidene acetic acid methyl ester,triphenyl carbomethoxymethylene phosphorane,methoxycarbonylmethylene triphenylphosphorane,acetic acid, 2-triphenylphosphoranylidene-, methyl ester |
| IUPAC Name | methyl 2-(triphenyl-$l^{5}-phosphanylidene)acetate |
| InChI Key | NTNUDYROPUKXNA-UHFFFAOYSA-N |
| Molecular Formula | C21H19O2P |
N,N-Dimethylacrylamide, 99%, stabilized with 500 ppm MEHQ
CAS: 2680-03-7 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.13 InChI Key: YLGYACDQVQQZSW-UHFFFAOYSA-N Synonym: n,n-dimethylacrylamide,2-propenamide, n,n-dimethyl,acrylamide, n,n-dimethyl,acylamide, n,n-dimethyl,n,n-dimethyl-acrylamide,n,n-dimethyl-2-propenamide,dimethylamid kyseliny akrylove,nn-dimethylacrylamide,unii-as46jk7q6i,propenamide, n,n-dimethyl PubChem CID: 17587 IUPAC Name: N,N-dimethylprop-2-enamide SMILES: CN(C)C(=O)C=C
| PubChem CID | 17587 |
|---|---|
| CAS | 2680-03-7 |
| Molecular Weight (g/mol) | 99.13 |
| SMILES | CN(C)C(=O)C=C |
| Synonym | n,n-dimethylacrylamide,2-propenamide, n,n-dimethyl,acrylamide, n,n-dimethyl,acylamide, n,n-dimethyl,n,n-dimethyl-acrylamide,n,n-dimethyl-2-propenamide,dimethylamid kyseliny akrylove,nn-dimethylacrylamide,unii-as46jk7q6i,propenamide, n,n-dimethyl |
| IUPAC Name | N,N-dimethylprop-2-enamide |
| InChI Key | YLGYACDQVQQZSW-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Trimethylamine hydrochloride, 98%
CAS: 593-81-7 Molecular Formula: C3H10ClN Molecular Weight (g/mol): 95.57 MDL Number: MFCD00012478 InChI Key: SZYJELPVAFJOGJ-UHFFFAOYSA-N Synonym: trimethylamine hydrochloride,trimethylammonium chloride,trimethylamine hcl,n,n-dimethylmethanamine hydrochloride,trimethylamine monohydrochloride,methanamine, n,n-dimethyl-, hydrochloride,trimethylaminehydrochloride,unii-uw38srm77k,uw38srm77k,trimethyl ammonium chloride PubChem CID: 10313079 ChEBI: CHEBI:64700 IUPAC Name: N,N-dimethylmethanamine;hydrochloride SMILES: [H+].[Cl-].CN(C)C
| PubChem CID | 10313079 |
|---|---|
| CAS | 593-81-7 |
| Molecular Weight (g/mol) | 95.57 |
| ChEBI | CHEBI:64700 |
| MDL Number | MFCD00012478 |
| SMILES | [H+].[Cl-].CN(C)C |
| Synonym | trimethylamine hydrochloride,trimethylammonium chloride,trimethylamine hcl,n,n-dimethylmethanamine hydrochloride,trimethylamine monohydrochloride,methanamine, n,n-dimethyl-, hydrochloride,trimethylaminehydrochloride,unii-uw38srm77k,uw38srm77k,trimethyl ammonium chloride |
| IUPAC Name | N,N-dimethylmethanamine;hydrochloride |
| InChI Key | SZYJELPVAFJOGJ-UHFFFAOYSA-N |
| Molecular Formula | C3H10ClN |
3-Methyl-1-phenyl-2-phospholene 1-oxide, 94%
CAS: 707-61-9 Molecular Formula: C11H13OP Molecular Weight (g/mol): 192.198 MDL Number: MFCD00014518 InChI Key: YMKWWHFRGALXLE-UHFFFAOYSA-N Synonym: 3-methyl-1-phenyl-2-phospholene 1-oxide,3-methyl-1-phenyl-2-phospholene-1-oxide,2,3-dihydro-4-methyl-1-phenyl-1h-phosphole 1-oxide,1h-phosphole, 2,3-dihydro-4-methyl-1-phenyl-, 1-oxide,4-methyl-1-phenyl-2,3-dihydro-1h-phosphole 1-oxide,2-phospholene, 3-methyl-1-phenyl-, 1-oxide,2,3-dihydro-4-methyl-1-phenyl-1h-phosphole, 1-oxide,4-methyl-1-phenyl-2,3-dihydro-1$l^ 5-phosphole 1-oxide,3-methyl-1-phenyl-4,5-dihydro-1??-phosphol-1-one,2-phospholene, 1-oxide PubChem CID: 69722 IUPAC Name: 4-methyl-1-phenyl-2,3-dihydro-1$l^{5}-phosphole 1-oxide SMILES: CC1=CP(=O)(CC1)C2=CC=CC=C2
| PubChem CID | 69722 |
|---|---|
| CAS | 707-61-9 |
| Molecular Weight (g/mol) | 192.198 |
| MDL Number | MFCD00014518 |
| SMILES | CC1=CP(=O)(CC1)C2=CC=CC=C2 |
| Synonym | 3-methyl-1-phenyl-2-phospholene 1-oxide,3-methyl-1-phenyl-2-phospholene-1-oxide,2,3-dihydro-4-methyl-1-phenyl-1h-phosphole 1-oxide,1h-phosphole, 2,3-dihydro-4-methyl-1-phenyl-, 1-oxide,4-methyl-1-phenyl-2,3-dihydro-1h-phosphole 1-oxide,2-phospholene, 3-methyl-1-phenyl-, 1-oxide,2,3-dihydro-4-methyl-1-phenyl-1h-phosphole, 1-oxide,4-methyl-1-phenyl-2,3-dihydro-1$l^ 5-phosphole 1-oxide,3-methyl-1-phenyl-4,5-dihydro-1??-phosphol-1-one,2-phospholene, 1-oxide |
| IUPAC Name | 4-methyl-1-phenyl-2,3-dihydro-1$l^{5}-phosphole 1-oxide |
| InChI Key | YMKWWHFRGALXLE-UHFFFAOYSA-N |
| Molecular Formula | C11H13OP |
Nitrobenzene, 99%, Extra Pure
CAS: 98-95-3 Molecular Formula: C6H5NO2 Molecular Weight (g/mol): 123.11 MDL Number: MFCD00007043 InChI Key: LQNUZADURLCDLV-UHFFFAOYSA-N Synonym: nitrobenzol,benzene, nitro,oil of mirbane,mirbane oil,essence of mirbane,nitro-benzene,nitrobenzeen,oil of myrbane,nitrobenzen,mononitrobenzene PubChem CID: 7416 ChEBI: CHEBI:27798 IUPAC Name: nitrobenzene SMILES: C1=CC=C(C=C1)[N+](=O)[O-]
| PubChem CID | 7416 |
|---|---|
| CAS | 98-95-3 |
| Molecular Weight (g/mol) | 123.11 |
| ChEBI | CHEBI:27798 |
| MDL Number | MFCD00007043 |
| SMILES | C1=CC=C(C=C1)[N+](=O)[O-] |
| Synonym | nitrobenzol,benzene, nitro,oil of mirbane,mirbane oil,essence of mirbane,nitro-benzene,nitrobenzeen,oil of myrbane,nitrobenzen,mononitrobenzene |
| IUPAC Name | nitrobenzene |
| InChI Key | LQNUZADURLCDLV-UHFFFAOYSA-N |
| Molecular Formula | C6H5NO2 |
Mineral oil, MP Biomedicals™
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
1,2-Dimethyl-3-hydroxy-4-pyridone, 98+%
CAS: 30652-11-0 Molecular Formula: C7H9NO2 Molecular Weight (g/mol): 139.15 MDL Number: MFCD00134497 InChI Key: TZXKOCQBRNJULO-UHFFFAOYSA-N Synonym: deferiprone,ferriprox,3-hydroxy-1,2-dimethyl-4 1h-pyridone,3-hydroxy-1,2-dimethylpyridin-4 1h-one,1,2-dimethyl-3-hydroxy-4-pyridone,1,2-dimethyl-3-hydroxypyrid-4-one,1,2-dimethyl-3-hydroxypyridine-4-one,cp20 chelating agent,unii-2bty8kh53l,ferriprox tn PubChem CID: 2972 ChEBI: CHEBI:68554 IUPAC Name: 3-hydroxy-1,2-dimethylpyridin-4-one SMILES: CC1=C(C(=O)C=CN1C)O
| PubChem CID | 2972 |
|---|---|
| CAS | 30652-11-0 |
| Molecular Weight (g/mol) | 139.15 |
| ChEBI | CHEBI:68554 |
| MDL Number | MFCD00134497 |
| SMILES | CC1=C(C(=O)C=CN1C)O |
| Synonym | deferiprone,ferriprox,3-hydroxy-1,2-dimethyl-4 1h-pyridone,3-hydroxy-1,2-dimethylpyridin-4 1h-one,1,2-dimethyl-3-hydroxy-4-pyridone,1,2-dimethyl-3-hydroxypyrid-4-one,1,2-dimethyl-3-hydroxypyridine-4-one,cp20 chelating agent,unii-2bty8kh53l,ferriprox tn |
| IUPAC Name | 3-hydroxy-1,2-dimethylpyridin-4-one |
| InChI Key | TZXKOCQBRNJULO-UHFFFAOYSA-N |
| Molecular Formula | C7H9NO2 |
Phenyl chloroformate, 99%
CAS: 1885-14-9 Molecular Formula: C7H5ClO2 Molecular Weight (g/mol): 156.57 MDL Number: MFCD00000637 InChI Key: AHWALFGBDFAJAI-UHFFFAOYSA-N Synonym: phenyl chloroformate,chloroformic acid phenyl ester,phenyl chlorocarbonate,carbonochloridic acid, phenyl ester,phenoxycarbonyl chloride,formic acid, chloro-, phenyl ester,fenylester kyseliny chlormravenci,phenylchloroformate,unii-6tnd0d6d3y,6tnd0d6d3y PubChem CID: 15891 IUPAC Name: phenyl carbonochloridate SMILES: ClC(=O)OC1=CC=CC=C1
| PubChem CID | 15891 |
|---|---|
| CAS | 1885-14-9 |
| Molecular Weight (g/mol) | 156.57 |
| MDL Number | MFCD00000637 |
| SMILES | ClC(=O)OC1=CC=CC=C1 |
| Synonym | phenyl chloroformate,chloroformic acid phenyl ester,phenyl chlorocarbonate,carbonochloridic acid, phenyl ester,phenoxycarbonyl chloride,formic acid, chloro-, phenyl ester,fenylester kyseliny chlormravenci,phenylchloroformate,unii-6tnd0d6d3y,6tnd0d6d3y |
| IUPAC Name | phenyl carbonochloridate |
| InChI Key | AHWALFGBDFAJAI-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClO2 |
Sucrose, For ACS analysis, MP Biomedicals™
CAS: 57-50-1 Molecular Formula: C12H22O11 Molecular Weight (g/mol): 342.30 MDL Number: MFCD00006626 InChI Key: CZMRCDWAGMRECN-PWPRYFECNA-N Synonym: sucrose,saccharose,cane sugar,sugar,table sugar,white sugar,d-sucrose,saccharum,rohrzucker,amerfand PubChem CID: 5988 ChEBI: CHEBI:17992 IUPAC Name: (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol SMILES: OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O
| PubChem CID | 5988 |
|---|---|
| CAS | 57-50-1 |
| Molecular Weight (g/mol) | 342.30 |
| ChEBI | CHEBI:17992 |
| MDL Number | MFCD00006626 |
| SMILES | OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| Synonym | sucrose,saccharose,cane sugar,sugar,table sugar,white sugar,d-sucrose,saccharum,rohrzucker,amerfand |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI Key | CZMRCDWAGMRECN-PWPRYFECNA-N |
| Molecular Formula | C12H22O11 |