Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
tert-Butylhydroquinone, 97%
CAS: 1948-33-0 Molecular Formula: C10H14O2 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00002344 InChI Key: BGNXCDMCOKJUMV-UHFFFAOYSA-N Synonym: tert-butylhydroquinone,tbhq,2-tert-butylhydroquinone,t-butylhydroquinone,mtbhq,t-butyl hydroquinone,2-tert-butyl-1,4-benzenediol,2-t-butylhydroquinone,mono-tert-butylhydroquinone,sustane PubChem CID: 16043 ChEBI: CHEBI:78886 IUPAC Name: 2-tert-butylbenzene-1,4-diol SMILES: CC(C)(C)C1=C(C=CC(=C1)O)O
| PubChem CID | 16043 |
|---|---|
| CAS | 1948-33-0 |
| Molecular Weight (g/mol) | 166.22 |
| ChEBI | CHEBI:78886 |
| MDL Number | MFCD00002344 |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)O)O |
| Synonym | tert-butylhydroquinone,tbhq,2-tert-butylhydroquinone,t-butylhydroquinone,mtbhq,t-butyl hydroquinone,2-tert-butyl-1,4-benzenediol,2-t-butylhydroquinone,mono-tert-butylhydroquinone,sustane |
| IUPAC Name | 2-tert-butylbenzene-1,4-diol |
| InChI Key | BGNXCDMCOKJUMV-UHFFFAOYSA-N |
| Molecular Formula | C10H14O2 |
2,5-Dihydroxy-1,4-benzoquinone, 98%
CAS: 615-94-1 Molecular Formula: C6H4O4 Molecular Weight (g/mol): 140.09 MDL Number: MFCD00001598 InChI Key: QFSYADJLNBHAKO-UHFFFAOYSA-N Synonym: 2,5-dihydroxy-1,4-benzoquinone,2,5-dihydroxy-p-benzoquinone,2,5-cyclohexadiene-1,4-dione, 2,5-dihydroxy,p-benzoquinone, 2,5-dihydroxy,2,5-dihydroxybenzoquinone,4lbp,2,5-dihydroxy-p-quinone,2,5-dihydroxy benzoquinone,2,5-dhbqop PubChem CID: 69213 IUPAC Name: 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione SMILES: OC1=CC(=O)C(O)=CC1=O
| PubChem CID | 69213 |
|---|---|
| CAS | 615-94-1 |
| Molecular Weight (g/mol) | 140.09 |
| MDL Number | MFCD00001598 |
| SMILES | OC1=CC(=O)C(O)=CC1=O |
| Synonym | 2,5-dihydroxy-1,4-benzoquinone,2,5-dihydroxy-p-benzoquinone,2,5-cyclohexadiene-1,4-dione, 2,5-dihydroxy,p-benzoquinone, 2,5-dihydroxy,2,5-dihydroxybenzoquinone,4lbp,2,5-dihydroxy-p-quinone,2,5-dihydroxy benzoquinone,2,5-dhbqop |
| IUPAC Name | 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| InChI Key | QFSYADJLNBHAKO-UHFFFAOYSA-N |
| Molecular Formula | C6H4O4 |
2-Ethyl-5,5-dimethyl-1,3-dioxane, 99%
CAS: 768-58-1 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.214 MDL Number: MFCD16622268 InChI Key: QSHOOPIYPOINNH-UHFFFAOYSA-N Synonym: solution in acetonitrile 1000mg/l,1,3-dioxane, 2-ethyl-5,5-dimethyl PubChem CID: 69852 IUPAC Name: 2-ethyl-5,5-dimethyl-1,3-dioxane SMILES: CCC1OCC(CO1)(C)C
| PubChem CID | 69852 |
|---|---|
| CAS | 768-58-1 |
| Molecular Weight (g/mol) | 144.214 |
| MDL Number | MFCD16622268 |
| SMILES | CCC1OCC(CO1)(C)C |
| Synonym | solution in acetonitrile 1000mg/l,1,3-dioxane, 2-ethyl-5,5-dimethyl |
| IUPAC Name | 2-ethyl-5,5-dimethyl-1,3-dioxane |
| InChI Key | QSHOOPIYPOINNH-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
Harmaline, 98+%
CAS: 304-21-2 Molecular Formula: C13H14N2O Molecular Weight (g/mol): 214.268 MDL Number: MFCD00004955 InChI Key: QJOZJXNKVMFAET-UHFFFAOYSA-N Synonym: harmaline,dihydroharmine,harmidine,armalin,harmalol methyl ether,o-methylharmalol,3,4-dihydroharmine,harmine, dihydro,harmalin,1-methyl-7-methoxy-3,4-dihydro-beta-carboline PubChem CID: 5280951 IUPAC Name: 7-methoxy-1-methyl-3,4-dihydro-2H-pyrido[3,4-b]indole SMILES: CC1=C2C(=C3C=CC(=CC3=N2)OC)CCN1
| PubChem CID | 5280951 |
|---|---|
| CAS | 304-21-2 |
| Molecular Weight (g/mol) | 214.268 |
| MDL Number | MFCD00004955 |
| SMILES | CC1=C2C(=C3C=CC(=CC3=N2)OC)CCN1 |
| Synonym | harmaline,dihydroharmine,harmidine,armalin,harmalol methyl ether,o-methylharmalol,3,4-dihydroharmine,harmine, dihydro,harmalin,1-methyl-7-methoxy-3,4-dihydro-beta-carboline |
| IUPAC Name | 7-methoxy-1-methyl-3,4-dihydro-2H-pyrido[3,4-b]indole |
| InChI Key | QJOZJXNKVMFAET-UHFFFAOYSA-N |
| Molecular Formula | C13H14N2O |
p-Anisidine hydrochloride, 99%
CAS: 20265-97-8 Molecular Formula: C7H9NO·HCl Molecular Weight (g/mol): 159.61 MDL Number: MFCD00036388 InChI Key: VQYJLACQFYZHCO-UHFFFAOYSA-N Synonym: p-anisidine hydrochloride,4-methoxyaniline hydrochloride,unii-7c4r75n8vg,benzenamine, 4-methoxy-, hydrochloride,p-anisidine.hcl,p-anisidine hcl,p-anisidinium chloride,4-anisidine hydrochloride,p-anisylamine hydrochloride,p-aminoanisole hydrochloride PubChem CID: 2734956 IUPAC Name: 4-methoxyaniline;hydrochloride SMILES: COC1=CC=C(C=C1)N.Cl
| PubChem CID | 2734956 |
|---|---|
| CAS | 20265-97-8 |
| Molecular Weight (g/mol) | 159.61 |
| MDL Number | MFCD00036388 |
| SMILES | COC1=CC=C(C=C1)N.Cl |
| Synonym | p-anisidine hydrochloride,4-methoxyaniline hydrochloride,unii-7c4r75n8vg,benzenamine, 4-methoxy-, hydrochloride,p-anisidine.hcl,p-anisidine hcl,p-anisidinium chloride,4-anisidine hydrochloride,p-anisylamine hydrochloride,p-aminoanisole hydrochloride |
| IUPAC Name | 4-methoxyaniline;hydrochloride |
| InChI Key | VQYJLACQFYZHCO-UHFFFAOYSA-N |
| Molecular Formula | C7H9NO·HCl |
3-Acetyl-2,4-dimethylpyrrole, 98%, Thermo Scientific Chemicals
CAS: 2386-25-6 Molecular Formula: C8H11NO Molecular Weight (g/mol): 137.18 InChI Key: VGZCKCJMYREIKA-UHFFFAOYSA-N Synonym: 3-acetyl-2,4-dimethylpyrrole,2,4-dimethyl-3-acetylpyrrole,1-2,4-dimethyl-1h-pyrrol-3-yl ethanone,2,4-dimethylpyrrol-3-yl methyl ketone,ethanone, 1-2,4-dimethyl-1h-pyrrol-3-yl,ketone, 2,4-dimethylpyrrol-3-yl methyl,1-2,4-dimethyl-1h-pyrrol-3-yl ethan-1-one,2,4-dimethyl-3-acetyl-pyrrole,3-acetyl-2,5-dimethyl-pyrrole,1-2,4-dimethyl-1h-pyrrol-3-yl-ethanone PubChem CID: 15163 IUPAC Name: 1-(2,4-dimethyl-1H-pyrrol-3-yl)ethanone SMILES: CC1=CNC(=C1C(=O)C)C
| PubChem CID | 15163 |
|---|---|
| CAS | 2386-25-6 |
| Molecular Weight (g/mol) | 137.18 |
| SMILES | CC1=CNC(=C1C(=O)C)C |
| Synonym | 3-acetyl-2,4-dimethylpyrrole,2,4-dimethyl-3-acetylpyrrole,1-2,4-dimethyl-1h-pyrrol-3-yl ethanone,2,4-dimethylpyrrol-3-yl methyl ketone,ethanone, 1-2,4-dimethyl-1h-pyrrol-3-yl,ketone, 2,4-dimethylpyrrol-3-yl methyl,1-2,4-dimethyl-1h-pyrrol-3-yl ethan-1-one,2,4-dimethyl-3-acetyl-pyrrole,3-acetyl-2,5-dimethyl-pyrrole,1-2,4-dimethyl-1h-pyrrol-3-yl-ethanone |
| IUPAC Name | 1-(2,4-dimethyl-1H-pyrrol-3-yl)ethanone |
| InChI Key | VGZCKCJMYREIKA-UHFFFAOYSA-N |
| Molecular Formula | C8H11NO |
Ethylene carbonate, 99+%
CAS: 96-49-1 Molecular Formula: C3H4O3 Molecular Weight (g/mol): 88.06 MDL Number: MFCD00005382 InChI Key: KMTRUDSVKNLOMY-UHFFFAOYSA-N Synonym: ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec PubChem CID: 7303 IUPAC Name: 1,3-dioxolan-2-one SMILES: C1COC(=O)O1
| PubChem CID | 7303 |
|---|---|
| CAS | 96-49-1 |
| Molecular Weight (g/mol) | 88.06 |
| MDL Number | MFCD00005382 |
| SMILES | C1COC(=O)O1 |
| Synonym | ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec |
| IUPAC Name | 1,3-dioxolan-2-one |
| InChI Key | KMTRUDSVKNLOMY-UHFFFAOYSA-N |
| Molecular Formula | C3H4O3 |
Di-n-butyl sulfide, 98%
CAS: 544-40-1 Molecular Formula: C8H18S Molecular Weight (g/mol): 146.29 MDL Number: MFCD00009468 InChI Key: HTIRHQRTDBPHNZ-UHFFFAOYSA-N Synonym: dibutyl sulfide,butyl sulfide,n-butyl sulfide,butylthiobutane,di-n-butyl sulfide,butane, 1,1'-thiobis,butyl monosulfide,dibutyl thioether,thiononane-5,n-dibutyl sulfide PubChem CID: 11002 IUPAC Name: 1-butylsulfanylbutane SMILES: CCCCSCCCC
| PubChem CID | 11002 |
|---|---|
| CAS | 544-40-1 |
| Molecular Weight (g/mol) | 146.29 |
| MDL Number | MFCD00009468 |
| SMILES | CCCCSCCCC |
| Synonym | dibutyl sulfide,butyl sulfide,n-butyl sulfide,butylthiobutane,di-n-butyl sulfide,butane, 1,1'-thiobis,butyl monosulfide,dibutyl thioether,thiononane-5,n-dibutyl sulfide |
| IUPAC Name | 1-butylsulfanylbutane |
| InChI Key | HTIRHQRTDBPHNZ-UHFFFAOYSA-N |
| Molecular Formula | C8H18S |
N,N-Diethyl-p-phenylenediamine sulfate, 99%
CAS: 6283-63-2 Molecular Formula: C10H16N2·H2SO4 Molecular Weight (g/mol): 262.33 MDL Number: MFCD00012993 InChI Key: AYLDJQABCMPYEN-UHFFFAOYSA-N Synonym: n,n-diethyl-p-phenylenediamine sulfate,n1,n1-diethylbenzene-1,4-diamine sulfate,4-amino-n,n-diethylaniline sulfate,diethyl-p-phenylenediamine sulfate,n,n-diethyl-1,4-phenylenediamine sulfate,unii-usp19t3gda,1,4-benzenediamine, n,n-diethyl-, sulfate 1:1,1,4-benzenediamine, n,n-diethyl-, sulfate,n,n-diethyl-1,4-benzenediamine sulfate,p-phenylenediamine, n,n-diethyl-, sulfate 1:1 PubChem CID: 80166 IUPAC Name: 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid SMILES: CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O
| PubChem CID | 80166 |
|---|---|
| CAS | 6283-63-2 |
| Molecular Weight (g/mol) | 262.33 |
| MDL Number | MFCD00012993 |
| SMILES | CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O |
| Synonym | n,n-diethyl-p-phenylenediamine sulfate,n1,n1-diethylbenzene-1,4-diamine sulfate,4-amino-n,n-diethylaniline sulfate,diethyl-p-phenylenediamine sulfate,n,n-diethyl-1,4-phenylenediamine sulfate,unii-usp19t3gda,1,4-benzenediamine, n,n-diethyl-, sulfate 1:1,1,4-benzenediamine, n,n-diethyl-, sulfate,n,n-diethyl-1,4-benzenediamine sulfate,p-phenylenediamine, n,n-diethyl-, sulfate 1:1 |
| IUPAC Name | 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid |
| InChI Key | AYLDJQABCMPYEN-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2·H2SO4 |
Hexafluorobenzene, 99%
CAS: 392-56-3 Molecular Formula: C6F6 Molecular Weight (g/mol): 186.056 MDL Number: MFCD00000288 InChI Key: ZQBFAOFFOQMSGJ-UHFFFAOYSA-N Synonym: hexafluorobenzene,perfluorobenzene,benzene, hexafluoro,hexafluorbenzol,unii-cmc18t611k,benzene, 1,2,3,4,5,6-hexafluoro,hexa fluorobenzene,hexafluoro benzene,pubchem18879,acmc-1bmus PubChem CID: 9805 ChEBI: CHEBI:38589 IUPAC Name: 1,2,3,4,5,6-hexafluorobenzene SMILES: C1(=C(C(=C(C(=C1F)F)F)F)F)F
| PubChem CID | 9805 |
|---|---|
| CAS | 392-56-3 |
| Molecular Weight (g/mol) | 186.056 |
| ChEBI | CHEBI:38589 |
| MDL Number | MFCD00000288 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)F |
| Synonym | hexafluorobenzene,perfluorobenzene,benzene, hexafluoro,hexafluorbenzol,unii-cmc18t611k,benzene, 1,2,3,4,5,6-hexafluoro,hexa fluorobenzene,hexafluoro benzene,pubchem18879,acmc-1bmus |
| IUPAC Name | 1,2,3,4,5,6-hexafluorobenzene |
| InChI Key | ZQBFAOFFOQMSGJ-UHFFFAOYSA-N |
| Molecular Formula | C6F6 |
2-Methylimidazole, 97%
CAS: 693-98-1 Molecular Formula: C4H6N2 Molecular Weight (g/mol): 82.11 MDL Number: MFCD00005190 InChI Key: LXBGSDVWAMZHDD-UHFFFAOYSA-N Synonym: 2-methylimidazole,1h-imidazole, 2-methyl,imidazole, 2-methyl,2-methyl imidazole,2-methylglyoxaline,unii-t0049z45lz,ccris 2459,dsstox_cid_2107,dsstox_rid_76489,dsstox_gsid_22107 PubChem CID: 12749 IUPAC Name: 2-methyl-1H-imidazole SMILES: CC1=NC=CN1
| PubChem CID | 12749 |
|---|---|
| CAS | 693-98-1 |
| Molecular Weight (g/mol) | 82.11 |
| MDL Number | MFCD00005190 |
| SMILES | CC1=NC=CN1 |
| Synonym | 2-methylimidazole,1h-imidazole, 2-methyl,imidazole, 2-methyl,2-methyl imidazole,2-methylglyoxaline,unii-t0049z45lz,ccris 2459,dsstox_cid_2107,dsstox_rid_76489,dsstox_gsid_22107 |
| IUPAC Name | 2-methyl-1H-imidazole |
| InChI Key | LXBGSDVWAMZHDD-UHFFFAOYSA-N |
| Molecular Formula | C4H6N2 |
Benzo[b]thiophene-3-carboxylic acid, 96%
CAS: 5381-25-9 Molecular Formula: C9H6O2S Molecular Weight (g/mol): 178.205 MDL Number: MFCD01846406 InChI Key: DRBLTQNCQJXSNU-UHFFFAOYSA-N Synonym: benzo b thiophene-3-carboxylic acid,benzothiophene-3-carboxylic acid,benzothiophene-3-carboxylicacid,pubchem13463,acmc-20a10z,ksc178m8d,1-benzo b thiophene-3-carboxylic acid,#,thianaphthene-3-carboxylic acid PubChem CID: 601280 IUPAC Name: 1-benzothiophene-3-carboxylic acid SMILES: C1=CC=C2C(=C1)C(=CS2)C(=O)O
| PubChem CID | 601280 |
|---|---|
| CAS | 5381-25-9 |
| Molecular Weight (g/mol) | 178.205 |
| MDL Number | MFCD01846406 |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C(=O)O |
| Synonym | benzo b thiophene-3-carboxylic acid,benzothiophene-3-carboxylic acid,benzothiophene-3-carboxylicacid,pubchem13463,acmc-20a10z,ksc178m8d,1-benzo b thiophene-3-carboxylic acid,#,thianaphthene-3-carboxylic acid |
| IUPAC Name | 1-benzothiophene-3-carboxylic acid |
| InChI Key | DRBLTQNCQJXSNU-UHFFFAOYSA-N |
| Molecular Formula | C9H6O2S |
Polyethylene glycol monomethylether, 350
CAS: 9004-74-4 Molecular Formula: (C2H4O)nCH4O Molecular Weight (g/mol): 76.10 MDL Number: MFCD00084416 InChI Key: XNWFRZJHXBZDAG-UHFFFAOYSA-N Synonym: methyl cellosolve,ethanol, 2-methoxy,ethylene glycol monomethyl ether,methyl oxitol,2-methoxy-1-ethanol,methoxyethanol,3-oxa-1-butanol,egme,monomethyl glycol,dowanol em PubChem CID: 8019 ChEBI: CHEBI:46790 IUPAC Name: 2-methoxyethanol SMILES: COCCO
| PubChem CID | 8019 |
|---|---|
| CAS | 9004-74-4 |
| Molecular Weight (g/mol) | 76.10 |
| ChEBI | CHEBI:46790 |
| MDL Number | MFCD00084416 |
| SMILES | COCCO |
| Synonym | methyl cellosolve,ethanol, 2-methoxy,ethylene glycol monomethyl ether,methyl oxitol,2-methoxy-1-ethanol,methoxyethanol,3-oxa-1-butanol,egme,monomethyl glycol,dowanol em |
| IUPAC Name | 2-methoxyethanol |
| InChI Key | XNWFRZJHXBZDAG-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)nCH4O |
4-Nitrobenzoic acid, 99%
CAS: 62-23-7 Molecular Formula: C7H5NO4 Molecular Weight (g/mol): 167.12 MDL Number: MFCD00007352 InChI Key: OTLNPYWUJOZPPA-UHFFFAOYSA-N Synonym: 4-nitrobenzoic acid,p-nitrobenzoic acid,benzoic acid, 4-nitro,nitrodracylic acid,4-nitrodracylic acid,1-carboxy-4-nitrobenzene,benzoic acid, p-nitro,p-nitrobenzoicacid,p-nitrobenzenecarboxylic acid,kyselina p-nitrobenzoova PubChem CID: 6108 ChEBI: CHEBI:262350 SMILES: C1=CC(=CC=C1C(=O)O)[N+](=O)[O-]
| PubChem CID | 6108 |
|---|---|
| CAS | 62-23-7 |
| Molecular Weight (g/mol) | 167.12 |
| ChEBI | CHEBI:262350 |
| MDL Number | MFCD00007352 |
| SMILES | C1=CC(=CC=C1C(=O)O)[N+](=O)[O-] |
| Synonym | 4-nitrobenzoic acid,p-nitrobenzoic acid,benzoic acid, 4-nitro,nitrodracylic acid,4-nitrodracylic acid,1-carboxy-4-nitrobenzene,benzoic acid, p-nitro,p-nitrobenzoicacid,p-nitrobenzenecarboxylic acid,kyselina p-nitrobenzoova |
| InChI Key | OTLNPYWUJOZPPA-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO4 |
2,3-Dimethyl-1,3-butadiene, 98%, stab. with 100ppm BHT
CAS: 513-81-5 Molecular Formula: C6H10 Molecular Weight (g/mol): 82.15 MDL Number: MFCD00008595 InChI Key: SDJHPPZKZZWAKF-UHFFFAOYSA-N Synonym: 2,3-dimethyl-1,3-butadiene,biisopropenyl,2,3-dimethylbutadiene,diisopropenyl,2,3-dimethylenebutane,1,3-butadiene, 2,3-dimethyl,unii-61tuu25hco,61tuu25hco,2,3-dimethyl-buta-1,3-diene,2,3-diene PubChem CID: 10566 IUPAC Name: 2,3-dimethylbuta-1,3-diene SMILES: CC(=C)C(C)=C
| PubChem CID | 10566 |
|---|---|
| CAS | 513-81-5 |
| Molecular Weight (g/mol) | 82.15 |
| MDL Number | MFCD00008595 |
| SMILES | CC(=C)C(C)=C |
| Synonym | 2,3-dimethyl-1,3-butadiene,biisopropenyl,2,3-dimethylbutadiene,diisopropenyl,2,3-dimethylenebutane,1,3-butadiene, 2,3-dimethyl,unii-61tuu25hco,61tuu25hco,2,3-dimethyl-buta-1,3-diene,2,3-diene |
| IUPAC Name | 2,3-dimethylbuta-1,3-diene |
| InChI Key | SDJHPPZKZZWAKF-UHFFFAOYSA-N |
| Molecular Formula | C6H10 |