Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Ethyl butyrylacetate, 98%
CAS: 3249-68-1 Molecular Formula: C8H14O3 Molecular Weight (g/mol): 158.20 MDL Number: MFCD00009401 InChI Key: KQWWVLVLVYYYDT-UHFFFAOYSA-N Synonym: ethyl butyrylacetate,ethyl butyroacetate,hexanoic acid, 3-oxo-, ethyl ester,ethyl beta-ketohexanoate,ethyl alpha-butyrylacetate,3-ketohexanoic acid ethyl ester,ethyl-3-oxohexanoate,unii-8q1ahg710e,ethyl .alpha.-butyrylacetate,fema no. 3683 PubChem CID: 238498 ChEBI: CHEBI:18119 IUPAC Name: ethyl 3-oxohexanoate SMILES: CCCC(=O)CC(=O)OCC
| PubChem CID | 238498 |
|---|---|
| CAS | 3249-68-1 |
| Molecular Weight (g/mol) | 158.20 |
| ChEBI | CHEBI:18119 |
| MDL Number | MFCD00009401 |
| SMILES | CCCC(=O)CC(=O)OCC |
| Synonym | ethyl butyrylacetate,ethyl butyroacetate,hexanoic acid, 3-oxo-, ethyl ester,ethyl beta-ketohexanoate,ethyl alpha-butyrylacetate,3-ketohexanoic acid ethyl ester,ethyl-3-oxohexanoate,unii-8q1ahg710e,ethyl .alpha.-butyrylacetate,fema no. 3683 |
| IUPAC Name | ethyl 3-oxohexanoate |
| InChI Key | KQWWVLVLVYYYDT-UHFFFAOYSA-N |
| Molecular Formula | C8H14O3 |
Benzyl tert-butyl malonate, 95%
CAS: 72594-86-6 Molecular Formula: C14H18O4 Molecular Weight (g/mol): 250.294 MDL Number: MFCD01075175 InChI Key: XKXXXODAXXAFNP-UHFFFAOYSA-N Synonym: benzyl tert-butyl malonate,benzyltert-butylmalonate,tert-butyl benzyl malonate,1-benzyl 3-tert-butyl propanedioate,tert-butyl 2-benzyloxycarbonyl acetate,propanedioic acid, 1,1-dimethylethyl phenylmethyl ester,tert-butyl phenylmethyl propane-1,3-dioate,pubchem3938,t-butyl benzyl malonate,ksc493q0n PubChem CID: 2736712 IUPAC Name: 1-O-benzyl 3-O-tert-butyl propanedioate SMILES: CC(C)(C)OC(=O)CC(=O)OCC1=CC=CC=C1
| PubChem CID | 2736712 |
|---|---|
| CAS | 72594-86-6 |
| Molecular Weight (g/mol) | 250.294 |
| MDL Number | MFCD01075175 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OCC1=CC=CC=C1 |
| Synonym | benzyl tert-butyl malonate,benzyltert-butylmalonate,tert-butyl benzyl malonate,1-benzyl 3-tert-butyl propanedioate,tert-butyl 2-benzyloxycarbonyl acetate,propanedioic acid, 1,1-dimethylethyl phenylmethyl ester,tert-butyl phenylmethyl propane-1,3-dioate,pubchem3938,t-butyl benzyl malonate,ksc493q0n |
| IUPAC Name | 1-O-benzyl 3-O-tert-butyl propanedioate |
| InChI Key | XKXXXODAXXAFNP-UHFFFAOYSA-N |
| Molecular Formula | C14H18O4 |
Mono-benzyl malonate, 95%
CAS: 40204-26-0 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00138132 InChI Key: CFLAHQSWDKNWPW-UHFFFAOYSA-N Synonym: mono-benzyl malonate,monobenzyl malonate,3-benzyloxy-3-oxopropanoic acid,benzyl hemimalonate,benzyl hydrogen malonate,monobenzylmalonate,2-benzyloxy carbonyl acetic acid,malonic acid monobenzyl ester,3-benzyl-oxy-3-oxopropanoic acid,propanedioic acid, 1-phenylmethyl ester PubChem CID: 181659 ChEBI: CHEBI:84093 IUPAC Name: 3-oxo-3-phenylmethoxypropanoic acid SMILES: OC(=O)CC(=O)OCC1=CC=CC=C1
| PubChem CID | 181659 |
|---|---|
| CAS | 40204-26-0 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:84093 |
| MDL Number | MFCD00138132 |
| SMILES | OC(=O)CC(=O)OCC1=CC=CC=C1 |
| Synonym | mono-benzyl malonate,monobenzyl malonate,3-benzyloxy-3-oxopropanoic acid,benzyl hemimalonate,benzyl hydrogen malonate,monobenzylmalonate,2-benzyloxy carbonyl acetic acid,malonic acid monobenzyl ester,3-benzyl-oxy-3-oxopropanoic acid,propanedioic acid, 1-phenylmethyl ester |
| IUPAC Name | 3-oxo-3-phenylmethoxypropanoic acid |
| InChI Key | CFLAHQSWDKNWPW-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
Ethyl 2-oxocyclohexanecarboxylate, 95%
CAS: 1655-07-8 Molecular Formula: C9H14O3 Molecular Weight (g/mol): 170.21 MDL Number: MFCD00001631 InChI Key: FGSGHBPKHFDJOP-UHFFFAOYNA-N Synonym: ethyl 2-oxocyclohexanecarboxylate,ethyl 2-cyclohexanonecarboxylate,2-carbethoxycyclohexanone,ethyl cyclohexanone-2-carboxylate,cyclohexanecarboxylic acid, 2-oxo-, ethyl ester,2-ethoxycarbonyl cyclohexanone,2-cyclohexanonecarboxylic acid ethyl ester,2-oxocyclohexanecarboxylic acid ethyl ester,ethyl 2-oxo-1-cyclohexanecarboxylate,ethyl 2-oxocylohexanecarboxylate PubChem CID: 95543 IUPAC Name: ethyl 2-oxocyclohexane-1-carboxylate SMILES: CCOC(=O)C1CCCCC1=O
| PubChem CID | 95543 |
|---|---|
| CAS | 1655-07-8 |
| Molecular Weight (g/mol) | 170.21 |
| MDL Number | MFCD00001631 |
| SMILES | CCOC(=O)C1CCCCC1=O |
| Synonym | ethyl 2-oxocyclohexanecarboxylate,ethyl 2-cyclohexanonecarboxylate,2-carbethoxycyclohexanone,ethyl cyclohexanone-2-carboxylate,cyclohexanecarboxylic acid, 2-oxo-, ethyl ester,2-ethoxycarbonyl cyclohexanone,2-cyclohexanonecarboxylic acid ethyl ester,2-oxocyclohexanecarboxylic acid ethyl ester,ethyl 2-oxo-1-cyclohexanecarboxylate,ethyl 2-oxocylohexanecarboxylate |
| IUPAC Name | ethyl 2-oxocyclohexane-1-carboxylate |
| InChI Key | FGSGHBPKHFDJOP-UHFFFAOYNA-N |
| Molecular Formula | C9H14O3 |
3-Furoic acid, 99%
CAS: 488-93-7 Molecular Formula: C5H4O3 Molecular Weight (g/mol): 112.08 MDL Number: MFCD00005350 InChI Key: IHCCAYCGZOLTEU-UHFFFAOYSA-N Synonym: 3-furoic acid,3-furancarboxylic acid,3-carboxyfuran,3-furanoic acid,unii-88a3s7rg98,3-furoate,3-furans,3-furanoate,pubchem6945,acmc-209kee PubChem CID: 10268 ChEBI: CHEBI:30846 IUPAC Name: furan-3-carboxylic acid SMILES: OC(=O)C1=COC=C1
| PubChem CID | 10268 |
|---|---|
| CAS | 488-93-7 |
| Molecular Weight (g/mol) | 112.08 |
| ChEBI | CHEBI:30846 |
| MDL Number | MFCD00005350 |
| SMILES | OC(=O)C1=COC=C1 |
| Synonym | 3-furoic acid,3-furancarboxylic acid,3-carboxyfuran,3-furanoic acid,unii-88a3s7rg98,3-furoate,3-furans,3-furanoate,pubchem6945,acmc-209kee |
| IUPAC Name | furan-3-carboxylic acid |
| InChI Key | IHCCAYCGZOLTEU-UHFFFAOYSA-N |
| Molecular Formula | C5H4O3 |
Dimethyl malonate, 99+%
CAS: 108-59-8 Molecular Formula: C5H8O4 Molecular Weight (g/mol): 132.12 MDL Number: MFCD00008460 InChI Key: BEPAFCGSDWSTEL-UHFFFAOYSA-N Synonym: dimethyl malonate,methyl malonate,propanedioic acid, dimethyl ester,malonic acid dimethyl ester,1,3-dimethyl propanedioate,dimethyl 1,3-propanedioate,malonic acid, dimethyl ester,unii-em8y79998c,ccris 8981,propanedioic acid dimethyl ester PubChem CID: 7943 IUPAC Name: dimethyl propanedioate SMILES: COC(=O)CC(=O)OC
| PubChem CID | 7943 |
|---|---|
| CAS | 108-59-8 |
| Molecular Weight (g/mol) | 132.12 |
| MDL Number | MFCD00008460 |
| SMILES | COC(=O)CC(=O)OC |
| Synonym | dimethyl malonate,methyl malonate,propanedioic acid, dimethyl ester,malonic acid dimethyl ester,1,3-dimethyl propanedioate,dimethyl 1,3-propanedioate,malonic acid, dimethyl ester,unii-em8y79998c,ccris 8981,propanedioic acid dimethyl ester |
| IUPAC Name | dimethyl propanedioate |
| InChI Key | BEPAFCGSDWSTEL-UHFFFAOYSA-N |
| Molecular Formula | C5H8O4 |
Diethyl ethylmalonate, 99%
CAS: 133-13-1 Molecular Formula: C9H16O4 Molecular Weight (g/mol): 188.22 MDL Number: MFCD00009167 InChI Key: VQAZCUCWHIIFGE-UHFFFAOYSA-N Synonym: diethyl ethylmalonate,diethyl 2-ethylmalonate,propanedioic acid, ethyl-, diethyl ester,ethylmalonic acid diethyl ester,1,3-diethyl 2-ethylpropanedioate,unii-69g92oyr3m,propanedioic acid, 2-ethyl-, 1,3-diethyl ester,malonic acid, ethyl-, diethyl ester,diethyl ethylpropanedioate,diethyl 2-ethylpropane-1,3-dioate PubChem CID: 8610 IUPAC Name: diethyl 2-ethylpropanedioate SMILES: CCC(C(=O)OCC)C(=O)OCC
| PubChem CID | 8610 |
|---|---|
| CAS | 133-13-1 |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00009167 |
| SMILES | CCC(C(=O)OCC)C(=O)OCC |
| Synonym | diethyl ethylmalonate,diethyl 2-ethylmalonate,propanedioic acid, ethyl-, diethyl ester,ethylmalonic acid diethyl ester,1,3-diethyl 2-ethylpropanedioate,unii-69g92oyr3m,propanedioic acid, 2-ethyl-, 1,3-diethyl ester,malonic acid, ethyl-, diethyl ester,diethyl ethylpropanedioate,diethyl 2-ethylpropane-1,3-dioate |
| IUPAC Name | diethyl 2-ethylpropanedioate |
| InChI Key | VQAZCUCWHIIFGE-UHFFFAOYSA-N |
| Molecular Formula | C9H16O4 |
3-Methyl-2-furoic acid, 98+%
CAS: 4412-96-8 Molecular Formula: C6H6O3 Molecular Weight (g/mol): 126.11 MDL Number: MFCD00014111 InChI Key: BNYIQEFWGSXIKQ-UHFFFAOYSA-N Synonym: 3-methyl-2-furoic acid,2-furancarboxylic acid, 3-methyl,3-methyl-2-furancarboxylic acid,unii-5jp68392hm,3-methyl-furan-2-carboxylic acid,3-methyl-2-furoicacid,methylpyromucic acid,3-methyl furoic acid,3-methylpyromucic acid,acmc-20a5im PubChem CID: 78127 IUPAC Name: 3-methylfuran-2-carboxylic acid SMILES: CC1=C(OC=C1)C(O)=O
| PubChem CID | 78127 |
|---|---|
| CAS | 4412-96-8 |
| Molecular Weight (g/mol) | 126.11 |
| MDL Number | MFCD00014111 |
| SMILES | CC1=C(OC=C1)C(O)=O |
| Synonym | 3-methyl-2-furoic acid,2-furancarboxylic acid, 3-methyl,3-methyl-2-furancarboxylic acid,unii-5jp68392hm,3-methyl-furan-2-carboxylic acid,3-methyl-2-furoicacid,methylpyromucic acid,3-methyl furoic acid,3-methylpyromucic acid,acmc-20a5im |
| IUPAC Name | 3-methylfuran-2-carboxylic acid |
| InChI Key | BNYIQEFWGSXIKQ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O3 |
Malonic acid dihydrazide, 99%
CAS: 3815-86-9 Molecular Formula: C3H8N4O2 Molecular Weight (g/mol): 132.12 MDL Number: MFCD00041268 InChI Key: PSIKPHJLTVSQFO-UHFFFAOYSA-N Synonym: malonic acid dihydrazide,malonohydrazide,malonic dihydrazide,propanedioic acid, dihydrazide,malonhydrazide,malonyl dihydrazide,malonic acid, dihydrazide,malonyl hydrazide,malonic acid hydrazide,malonoyldihydrazine PubChem CID: 77433 IUPAC Name: propanedihydrazide SMILES: NNC(=O)CC(=O)NN
| PubChem CID | 77433 |
|---|---|
| CAS | 3815-86-9 |
| Molecular Weight (g/mol) | 132.12 |
| MDL Number | MFCD00041268 |
| SMILES | NNC(=O)CC(=O)NN |
| Synonym | malonic acid dihydrazide,malonohydrazide,malonic dihydrazide,propanedioic acid, dihydrazide,malonhydrazide,malonyl dihydrazide,malonic acid, dihydrazide,malonyl hydrazide,malonic acid hydrazide,malonoyldihydrazine |
| IUPAC Name | propanedihydrazide |
| InChI Key | PSIKPHJLTVSQFO-UHFFFAOYSA-N |
| Molecular Formula | C3H8N4O2 |
Diethyl 3,4-furandicarboxylate, 95%
CAS: 30614-77-8 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.20 MDL Number: MFCD00005349 InChI Key: ZODFWNHYQARJLC-UHFFFAOYSA-N Synonym: diethyl 3,4-furandicarboxylate,3,4-furandicarboxylic acid, diethyl ester,3,4-diethyl furan-3,4-dicarboxylate,furan-3,4-dicarboxylic acid diethyl ester,5-18-07-00053 beilstein handbook reference,zodfwnhyqarjlc-uhfffaoysa,3,4-furandicarboxylicacid, 3,4-diethyl ester PubChem CID: 35399 IUPAC Name: diethyl furan-3,4-dicarboxylate SMILES: CCOC(=O)C1=COC=C1C(=O)OCC
| PubChem CID | 35399 |
|---|---|
| CAS | 30614-77-8 |
| Molecular Weight (g/mol) | 212.20 |
| MDL Number | MFCD00005349 |
| SMILES | CCOC(=O)C1=COC=C1C(=O)OCC |
| Synonym | diethyl 3,4-furandicarboxylate,3,4-furandicarboxylic acid, diethyl ester,3,4-diethyl furan-3,4-dicarboxylate,furan-3,4-dicarboxylic acid diethyl ester,5-18-07-00053 beilstein handbook reference,zodfwnhyqarjlc-uhfffaoysa,3,4-furandicarboxylicacid, 3,4-diethyl ester |
| IUPAC Name | diethyl furan-3,4-dicarboxylate |
| InChI Key | ZODFWNHYQARJLC-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
Isopropylmalonic acid, 98+%
CAS: 601-79-6 Molecular Formula: C6H10O4 Molecular Weight (g/mol): 146.14 MDL Number: MFCD00021717 InChI Key: DQEUFPARIOFOAI-UHFFFAOYSA-N Synonym: isopropylmalonic acid,2-isopropylmalonic acid,malonic acid, isopropyl,2-isopropylpropanedioic acid,propanedioic acid, 1-methylethyl,.alpha.-carboxyisovaleric acid,2-propan-2-yl propanedioic acid,isopropylmalonsaure,isopropyl malonic acid,iso-propyl malonic acid PubChem CID: 69037 IUPAC Name: 2-propan-2-ylpropanedioic acid SMILES: CC(C)C(C(O)=O)C(O)=O
| PubChem CID | 69037 |
|---|---|
| CAS | 601-79-6 |
| Molecular Weight (g/mol) | 146.14 |
| MDL Number | MFCD00021717 |
| SMILES | CC(C)C(C(O)=O)C(O)=O |
| Synonym | isopropylmalonic acid,2-isopropylmalonic acid,malonic acid, isopropyl,2-isopropylpropanedioic acid,propanedioic acid, 1-methylethyl,.alpha.-carboxyisovaleric acid,2-propan-2-yl propanedioic acid,isopropylmalonsaure,isopropyl malonic acid,iso-propyl malonic acid |
| IUPAC Name | 2-propan-2-ylpropanedioic acid |
| InChI Key | DQEUFPARIOFOAI-UHFFFAOYSA-N |
| Molecular Formula | C6H10O4 |
Methyl 2-methyl-3-furoate, 97%
CAS: 6141-58-8 Molecular Formula: C7H8O3 Molecular Weight (g/mol): 140.138 MDL Number: MFCD00003249 InChI Key: UVRRIABXNIGUJZ-UHFFFAOYSA-N PubChem CID: 80237 IUPAC Name: methyl 2-methylfuran-3-carboxylate SMILES: CC1=C(C=CO1)C(=O)OC
| PubChem CID | 80237 |
|---|---|
| CAS | 6141-58-8 |
| Molecular Weight (g/mol) | 140.138 |
| MDL Number | MFCD00003249 |
| SMILES | CC1=C(C=CO1)C(=O)OC |
| IUPAC Name | methyl 2-methylfuran-3-carboxylate |
| InChI Key | UVRRIABXNIGUJZ-UHFFFAOYSA-N |
| Molecular Formula | C7H8O3 |
Malonic acid disodium salt, 99%
CAS: 141-95-7 Molecular Formula: C3H2Na2O4 Molecular Weight (g/mol): 148.025 MDL Number: MFCD00002708 InChI Key: PRWXGRGLHYDWPS-UHFFFAOYSA-L Synonym: sodium malonate,disodium malonate,propanedioic acid, disodium salt,malonic acid disodium salt,disodium propanedioate,malonic acid, sodium salt,unii-9qwe64m39h,propanedioic acid, sodium salt 1:2,malonic acid, disodium salt,dicarboxymethane disodium salt PubChem CID: 8865 ChEBI: CHEBI:62983 IUPAC Name: disodium;propanedioate SMILES: C(C(=O)[O-])C(=O)[O-].[Na+].[Na+]
| PubChem CID | 8865 |
|---|---|
| CAS | 141-95-7 |
| Molecular Weight (g/mol) | 148.025 |
| ChEBI | CHEBI:62983 |
| MDL Number | MFCD00002708 |
| SMILES | C(C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Synonym | sodium malonate,disodium malonate,propanedioic acid, disodium salt,malonic acid disodium salt,disodium propanedioate,malonic acid, sodium salt,unii-9qwe64m39h,propanedioic acid, sodium salt 1:2,malonic acid, disodium salt,dicarboxymethane disodium salt |
| IUPAC Name | disodium;propanedioate |
| InChI Key | PRWXGRGLHYDWPS-UHFFFAOYSA-L |
| Molecular Formula | C3H2Na2O4 |
Furazolidone, MP Biomedicals™
CAS: 67-45-8 Molecular Formula: C8H7N3O5 Molecular Weight (g/mol): 225.16 InChI Key: PLHJDBGFXBMTGZ-WEVVVXLNSA-N Synonym: furazolidone,furoxone,nitrofurazolidone,furazolidine,nitrofuroxon,furazolidon,diafuron,furaxone,furazol,furazon PubChem CID: 5323714 IUPAC Name: 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one SMILES: C1COC(=O)N1N=CC2=CC=C(O2)[N+](=O)[O-]
| PubChem CID | 5323714 |
|---|---|
| CAS | 67-45-8 |
| Molecular Weight (g/mol) | 225.16 |
| SMILES | C1COC(=O)N1N=CC2=CC=C(O2)[N+](=O)[O-] |
| Synonym | furazolidone,furoxone,nitrofurazolidone,furazolidine,nitrofuroxon,furazolidon,diafuron,furaxone,furazol,furazon |
| IUPAC Name | 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one |
| InChI Key | PLHJDBGFXBMTGZ-WEVVVXLNSA-N |
| Molecular Formula | C8H7N3O5 |
Methyl 5-methyl-2-furoate, 97%
CAS: 2527-96-0 Molecular Formula: C7H8O3 Molecular Weight (g/mol): 140.138 MDL Number: MFCD04116374 InChI Key: XBYZJUMTKHUJIY-UHFFFAOYSA-N Synonym: methyl 5-methyl-2-furoate,2-furancarboxylic acid, 5-methyl-, methyl ester,5-methylfuran-2-carboxylic acid methyl ester,zlchem 1125,acmc-20akg0,methyl5-methylfuran-2-carboxylate,methyl 5-methyl-2-furancarboxylate,2-furancarboxylic acid,5-methyl-, methyl ester PubChem CID: 137628 IUPAC Name: methyl 5-methylfuran-2-carboxylate SMILES: CC1=CC=C(O1)C(=O)OC
| PubChem CID | 137628 |
|---|---|
| CAS | 2527-96-0 |
| Molecular Weight (g/mol) | 140.138 |
| MDL Number | MFCD04116374 |
| SMILES | CC1=CC=C(O1)C(=O)OC |
| Synonym | methyl 5-methyl-2-furoate,2-furancarboxylic acid, 5-methyl-, methyl ester,5-methylfuran-2-carboxylic acid methyl ester,zlchem 1125,acmc-20akg0,methyl5-methylfuran-2-carboxylate,methyl 5-methyl-2-furancarboxylate,2-furancarboxylic acid,5-methyl-, methyl ester |
| IUPAC Name | methyl 5-methylfuran-2-carboxylate |
| InChI Key | XBYZJUMTKHUJIY-UHFFFAOYSA-N |
| Molecular Formula | C7H8O3 |