Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Neopentylamine, 97%
CAS: 5813-64-9 Molecular Formula: C5H13N Molecular Weight (g/mol): 87.17 MDL Number: MFCD00008134 InChI Key: XDIAMRVROCPPBK-UHFFFAOYSA-N Synonym: neopentylamine,2,2-dimethylpropylamine,1-propanamine, 2,2-dimethyl,2,2-dimethyl-1-propylamine,1-amino-2,2-dimethylpropane,neo-c5h11nh2,2,2-dimethyl-1-propylamin,neo-pentylamine,neopentyl amine,2,2-dimethylpropanamine PubChem CID: 79882 IUPAC Name: 2,2-dimethylpropan-1-amine SMILES: CC(C)(C)CN
| PubChem CID | 79882 |
|---|---|
| CAS | 5813-64-9 |
| Molecular Weight (g/mol) | 87.17 |
| MDL Number | MFCD00008134 |
| SMILES | CC(C)(C)CN |
| Synonym | neopentylamine,2,2-dimethylpropylamine,1-propanamine, 2,2-dimethyl,2,2-dimethyl-1-propylamine,1-amino-2,2-dimethylpropane,neo-c5h11nh2,2,2-dimethyl-1-propylamin,neo-pentylamine,neopentyl amine,2,2-dimethylpropanamine |
| IUPAC Name | 2,2-dimethylpropan-1-amine |
| InChI Key | XDIAMRVROCPPBK-UHFFFAOYSA-N |
| Molecular Formula | C5H13N |
Methyl 3-fluoro-4-nitrobenzoate, 97%
CAS: 185629-31-6 Molecular Formula: C8H6FNO4 Molecular Weight (g/mol): 199.137 MDL Number: MFCD08444027 InChI Key: FKMZNQQOPCCUTD-UHFFFAOYSA-N PubChem CID: 592761 IUPAC Name: methyl 3-fluoro-4-nitrobenzoate SMILES: COC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F
| PubChem CID | 592761 |
|---|---|
| CAS | 185629-31-6 |
| Molecular Weight (g/mol) | 199.137 |
| MDL Number | MFCD08444027 |
| SMILES | COC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F |
| IUPAC Name | methyl 3-fluoro-4-nitrobenzoate |
| InChI Key | FKMZNQQOPCCUTD-UHFFFAOYSA-N |
| Molecular Formula | C8H6FNO4 |
2-Sulfobenzoic acid cyclic anhydride, 95%
CAS: 81-08-3 Molecular Formula: C7H4O4S Molecular Weight (g/mol): 184.17 MDL Number: MFCD00005879 InChI Key: NCYNKWQXFADUOZ-UHFFFAOYSA-N Synonym: 2-sulfobenzoic anhydride,2-sulfobenzoic acid cyclic anhydride,sulfobenzoic anhydride,o-sulfobenzoic acid anhydride,3h-2,1-benzoxathiol-3-one, 1,1-dioxide,3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide,unii-0swh68iq5w,o-sulfobenzoic acid, cyclic anhydride,2,1-benzoxathiol-3-one-1,1-dioxide,0swh68iq5w PubChem CID: 65729 IUPAC Name: 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one SMILES: C1=CC=C2C(=C1)C(=O)OS2(=O)=O
| PubChem CID | 65729 |
|---|---|
| CAS | 81-08-3 |
| Molecular Weight (g/mol) | 184.17 |
| MDL Number | MFCD00005879 |
| SMILES | C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
| Synonym | 2-sulfobenzoic anhydride,2-sulfobenzoic acid cyclic anhydride,sulfobenzoic anhydride,o-sulfobenzoic acid anhydride,3h-2,1-benzoxathiol-3-one, 1,1-dioxide,3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide,unii-0swh68iq5w,o-sulfobenzoic acid, cyclic anhydride,2,1-benzoxathiol-3-one-1,1-dioxide,0swh68iq5w |
| IUPAC Name | 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one |
| InChI Key | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| Molecular Formula | C7H4O4S |
Thermo Scientific Chemicals D-Mannosamine hydrochloride, 98%
CAS: 5505-63-5 Molecular Formula: C6H14ClNO5 Molecular Weight (g/mol): 215.63 MDL Number: MFCD00064557 InChI Key: CBOJBBMQJBVCMW-DEZHIRTDSA-N Synonym: 2-amino-2-deoxy-d-mannosehydrochloride PubChem CID: 133109008 IUPAC Name: (2R,3S,4R,5S)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride SMILES: C(C(C(C(C(C=O)N)O)O)O)O.Cl
| PubChem CID | 133109008 |
|---|---|
| CAS | 5505-63-5 |
| Molecular Weight (g/mol) | 215.63 |
| MDL Number | MFCD00064557 |
| SMILES | C(C(C(C(C(C=O)N)O)O)O)O.Cl |
| Synonym | 2-amino-2-deoxy-d-mannosehydrochloride |
| IUPAC Name | (2R,3S,4R,5S)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChI Key | CBOJBBMQJBVCMW-DEZHIRTDSA-N |
| Molecular Formula | C6H14ClNO5 |
tert-Butyl (S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride, 98%
CAS: 77497-74-6 Molecular Formula: C14H19NO2 Molecular Weight (g/mol): 233.311 MDL Number: MFCD04114841 InChI Key: KRSUDBIZXKOKGA-LBPRGKRZSA-N Synonym: s-tert-butyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate,s-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid t-butyl ester,tert-butyl 3s-1,2,3,4-tetrahydroisoquinoline-3-carboxylate,tert-butyl s-1,2,3,4-tetrahydro-isoquinoline-3-carboxylate,s-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid tert-butyl ester,tic-obut,s-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic ac,tert-butyl s-1,2,3,4-tetrahydroisoquinoline-3-carboxylate,tert.-butyl 3s-1,2,3,4-tetrahydroisoquinoline-3-carboxylate,s-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid tert-butyl ester hydrochloride PubChem CID: 9209323 IUPAC Name: tert-butyl (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate SMILES: CC(C)(C)OC(=O)C1CC2=CC=CC=C2CN1
| PubChem CID | 9209323 |
|---|---|
| CAS | 77497-74-6 |
| Molecular Weight (g/mol) | 233.311 |
| MDL Number | MFCD04114841 |
| SMILES | CC(C)(C)OC(=O)C1CC2=CC=CC=C2CN1 |
| Synonym | s-tert-butyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate,s-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid t-butyl ester,tert-butyl 3s-1,2,3,4-tetrahydroisoquinoline-3-carboxylate,tert-butyl s-1,2,3,4-tetrahydro-isoquinoline-3-carboxylate,s-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid tert-butyl ester,tic-obut,s-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic ac,tert-butyl s-1,2,3,4-tetrahydroisoquinoline-3-carboxylate,tert.-butyl 3s-1,2,3,4-tetrahydroisoquinoline-3-carboxylate,s-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid tert-butyl ester hydrochloride |
| IUPAC Name | tert-butyl (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| InChI Key | KRSUDBIZXKOKGA-LBPRGKRZSA-N |
| Molecular Formula | C14H19NO2 |
Glycidyl (S)-(+)-3-nitrobenzenesulfonate, 98%
CAS: 115314-14-2 Molecular Formula: C9H9NO6S Molecular Weight (g/mol): 259.23 MDL Number: MFCD00064582 InChI Key: AIHIHVZYAAMDPM-QMMMGPOBSA-N Synonym: s-+-glycidyl nosylate,s-glycidyl nosylate,s-glycidyl 3-nitrobenzenesulfonate,s-oxiran-2-ylmethyl 3-nitrobenzenesulfonate,s-+-glycidyl 3-nitrobenzenesulfonate,glycidyl 3-nitrobenzenesulfonate,ccris 6394,2s-+-glycidyl-3-nitrobenzenesulfonate,oxiranylmethyl s-3-nitrobenzenesulfonate,2s-oxiran-2-yl methyl 3-nitrobenzenesulfonate PubChem CID: 146490 IUPAC Name: [(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate SMILES: [O-][N+](=O)C1=CC=CC(=C1)S(=O)(=O)OC[C@@H]1CO1
| PubChem CID | 146490 |
|---|---|
| CAS | 115314-14-2 |
| Molecular Weight (g/mol) | 259.23 |
| MDL Number | MFCD00064582 |
| SMILES | [O-][N+](=O)C1=CC=CC(=C1)S(=O)(=O)OC[C@@H]1CO1 |
| Synonym | s-+-glycidyl nosylate,s-glycidyl nosylate,s-glycidyl 3-nitrobenzenesulfonate,s-oxiran-2-ylmethyl 3-nitrobenzenesulfonate,s-+-glycidyl 3-nitrobenzenesulfonate,glycidyl 3-nitrobenzenesulfonate,ccris 6394,2s-+-glycidyl-3-nitrobenzenesulfonate,oxiranylmethyl s-3-nitrobenzenesulfonate,2s-oxiran-2-yl methyl 3-nitrobenzenesulfonate |
| IUPAC Name | [(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate |
| InChI Key | AIHIHVZYAAMDPM-QMMMGPOBSA-N |
| Molecular Formula | C9H9NO6S |
2,4-Dichloro-6-methylpyridine, 97+%
CAS: 42779-56-6 Molecular Formula: C6H5Cl2N Molecular Weight (g/mol): 162.013 MDL Number: MFCD08669834 InChI Key: WUGTXQVNSRFDNV-UHFFFAOYSA-N Synonym: 2,4-dichloro-6-picoline,2,4-dichloro-6-methyl-pyridine,pubchem5465,d0ri6l,2-methyl-4,6-dichloropyridine,pyridine,2,4-dichloro-6-methyl PubChem CID: 11959083 IUPAC Name: 2,4-dichloro-6-methylpyridine SMILES: CC1=NC(=CC(=C1)Cl)Cl
| PubChem CID | 11959083 |
|---|---|
| CAS | 42779-56-6 |
| Molecular Weight (g/mol) | 162.013 |
| MDL Number | MFCD08669834 |
| SMILES | CC1=NC(=CC(=C1)Cl)Cl |
| Synonym | 2,4-dichloro-6-picoline,2,4-dichloro-6-methyl-pyridine,pubchem5465,d0ri6l,2-methyl-4,6-dichloropyridine,pyridine,2,4-dichloro-6-methyl |
| IUPAC Name | 2,4-dichloro-6-methylpyridine |
| InChI Key | WUGTXQVNSRFDNV-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl2N |
3-Amino-2-methoxypyridine-4-carboxylic acid, 95%, Thermo Scientific Chemicals
CAS: 870997-81-2 Molecular Formula: C7H8N2O3 Molecular Weight (g/mol): 168.15 MDL Number: MFCD18262266 InChI Key: ABVDQGNEDSKBLA-UHFFFAOYSA-N Synonym: 3-amino-2-methoxyisonicotinic acid,3-amino-2-methoxy-4-pyridinecarboxylic acid,3-amino-2-methoxyisonicotinicacid,3-amino-2-methoxy-isonicotinic acid PubChem CID: 53634618 IUPAC Name: 3-amino-2-methoxypyridine-4-carboxylic acid SMILES: COC1=NC=CC(C(O)=O)=C1N
| PubChem CID | 53634618 |
|---|---|
| CAS | 870997-81-2 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD18262266 |
| SMILES | COC1=NC=CC(C(O)=O)=C1N |
| Synonym | 3-amino-2-methoxyisonicotinic acid,3-amino-2-methoxy-4-pyridinecarboxylic acid,3-amino-2-methoxyisonicotinicacid,3-amino-2-methoxy-isonicotinic acid |
| IUPAC Name | 3-amino-2-methoxypyridine-4-carboxylic acid |
| InChI Key | ABVDQGNEDSKBLA-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O3 |
Dimethyl pyridine-2,3-dicarboxylate, 95%
CAS: 605-38-9 Molecular Formula: C9H9NO4 Molecular Weight (g/mol): 195.17 MDL Number: MFCD00186549 InChI Key: YLGIBCYHQZTFQL-UHFFFAOYSA-N Synonym: 2,3-pyridinedicarboxylic acid dimethyl ester,dimethyl quinolinate,dimethyl 2,3-pyridinedicarboxylate,2,3-bis methoxycarbonyl pyridine,2,3-pyridinedicarboxylic acid, dimethyl ester,methylquinolinic acid, 2,3-dimethyl ester,2,3-dimethyl pyridine-2,3-dicarboxylate,pyridine-2,3-dicarboxylic acid dimethyl ester,mqdme,2,3-dimethyl methylquinolinate PubChem CID: 69058 IUPAC Name: dimethyl pyridine-2,3-dicarboxylate SMILES: COC(=O)C1=CC=CN=C1C(=O)OC
| PubChem CID | 69058 |
|---|---|
| CAS | 605-38-9 |
| Molecular Weight (g/mol) | 195.17 |
| MDL Number | MFCD00186549 |
| SMILES | COC(=O)C1=CC=CN=C1C(=O)OC |
| Synonym | 2,3-pyridinedicarboxylic acid dimethyl ester,dimethyl quinolinate,dimethyl 2,3-pyridinedicarboxylate,2,3-bis methoxycarbonyl pyridine,2,3-pyridinedicarboxylic acid, dimethyl ester,methylquinolinic acid, 2,3-dimethyl ester,2,3-dimethyl pyridine-2,3-dicarboxylate,pyridine-2,3-dicarboxylic acid dimethyl ester,mqdme,2,3-dimethyl methylquinolinate |
| IUPAC Name | dimethyl pyridine-2,3-dicarboxylate |
| InChI Key | YLGIBCYHQZTFQL-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO4 |
Bis(acetonitrile)(1,5-cyclooctadiene)iridium(I) tetrafluoroborate, 97%
CAS: 32679-03-1 Molecular Formula: C12H18BF4IrN2 Molecular Weight (g/mol): 469.31 MDL Number: MFCD28144566 InChI Key: VEAARGXUKIPMQB-SUESZSCISA-N IUPAC Name: iridium(1+) (1Z,5Z)-cycloocta-1,5-diene bis(acetonitrile) tetrafluoroboranuide SMILES: [Ir+].CC#N.CC#N.F[B-](F)(F)F.C1C\C=C/CC\C=C/1
| CAS | 32679-03-1 |
|---|---|
| Molecular Weight (g/mol) | 469.31 |
| MDL Number | MFCD28144566 |
| SMILES | [Ir+].CC#N.CC#N.F[B-](F)(F)F.C1C\C=C/CC\C=C/1 |
| IUPAC Name | iridium(1+) (1Z,5Z)-cycloocta-1,5-diene bis(acetonitrile) tetrafluoroboranuide |
| InChI Key | VEAARGXUKIPMQB-SUESZSCISA-N |
| Molecular Formula | C12H18BF4IrN2 |
1-(Trifluoroacetyl)imidazole, 98+%
CAS: 1546-79-8 Molecular Formula: C5H3F3N2O Molecular Weight (g/mol): 164.087 MDL Number: MFCD00014501 InChI Key: SINBGNJPYWNUQI-UHFFFAOYSA-N Synonym: 1-trifluoroacetyl imidazole,n-trifluoroacetylimidazole,1-trifluoroacetyl-1h-imidazole,1h-imidazole, 1-trifluoroacetyl,unii-8c6041ow3i,tfai,2,2,2-trifluoro-1-1h-imidazol-1-yl ethanone,n-trifluoroacetyl imidazole,2,2,2-trifluoro-1-imidazol-1-yl ethanone,2,2,2-trifluoro-1-1h-imidazol-1-yl ethan-1-one PubChem CID: 73767 IUPAC Name: 2,2,2-trifluoro-1-imidazol-1-ylethanone SMILES: C1=CN(C=N1)C(=O)C(F)(F)F
| PubChem CID | 73767 |
|---|---|
| CAS | 1546-79-8 |
| Molecular Weight (g/mol) | 164.087 |
| MDL Number | MFCD00014501 |
| SMILES | C1=CN(C=N1)C(=O)C(F)(F)F |
| Synonym | 1-trifluoroacetyl imidazole,n-trifluoroacetylimidazole,1-trifluoroacetyl-1h-imidazole,1h-imidazole, 1-trifluoroacetyl,unii-8c6041ow3i,tfai,2,2,2-trifluoro-1-1h-imidazol-1-yl ethanone,n-trifluoroacetyl imidazole,2,2,2-trifluoro-1-imidazol-1-yl ethanone,2,2,2-trifluoro-1-1h-imidazol-1-yl ethan-1-one |
| IUPAC Name | 2,2,2-trifluoro-1-imidazol-1-ylethanone |
| InChI Key | SINBGNJPYWNUQI-UHFFFAOYSA-N |
| Molecular Formula | C5H3F3N2O |
(2-Hydroxyethyl)triphenylphosphonium bromide, 98+%
CAS: 7237-34-5 Molecular Formula: C20H20BrOP Molecular Weight (g/mol): 387.26 MDL Number: MFCD00011901 InChI Key: QZJOQNHOOVSESC-UHFFFAOYSA-M Synonym: 2-hydroxyethyl triphenylphosphonium bromide,2-hydroxyethyl triphenylphosphanium bromide,acmc-20appe,2-hydroxyethyltriphenylphosphonium bromide,2-hydroxyethyl triphenyphosphonium bromide,2-hydroxyethyl triphenyl phosphanium bromide,2-hydroxy ethyl triphenylphosphonium bromide,phosphonium, 2-hydroxyethyl triphenyl-,bromide 1:1,phosphonium, 2-hydroxyethyl triphenyl-, bromide 1:1 PubChem CID: 2733550 IUPAC Name: 2-hydroxyethyl(triphenyl)phosphanium;bromide SMILES: [Br-].OCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2733550 |
|---|---|
| CAS | 7237-34-5 |
| Molecular Weight (g/mol) | 387.26 |
| MDL Number | MFCD00011901 |
| SMILES | [Br-].OCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-hydroxyethyl triphenylphosphonium bromide,2-hydroxyethyl triphenylphosphanium bromide,acmc-20appe,2-hydroxyethyltriphenylphosphonium bromide,2-hydroxyethyl triphenyphosphonium bromide,2-hydroxyethyl triphenyl phosphanium bromide,2-hydroxy ethyl triphenylphosphonium bromide,phosphonium, 2-hydroxyethyl triphenyl-,bromide 1:1,phosphonium, 2-hydroxyethyl triphenyl-, bromide 1:1 |
| IUPAC Name | 2-hydroxyethyl(triphenyl)phosphanium;bromide |
| InChI Key | QZJOQNHOOVSESC-UHFFFAOYSA-M |
| Molecular Formula | C20H20BrOP |
2-Chloroacrylic acid, 96%, stab. with ca 0.3% BHT
CAS: 598-79-8 Molecular Formula: C3H3ClO2 Molecular Weight (g/mol): 106.51 MDL Number: MFCD00014336 InChI Key: SZTBMYHIYNGYIA-UHFFFAOYSA-N Synonym: 2-chloroacrylic acid,chloroacrylic acid,2-propenoic acid, 2-chloro,alpha-chloroacrylic acid,acrylic acid, 2-chloro,2-chloro-2-propenoic acid,.alpha.-chloroacrylic acid,acmc-1aqt3 PubChem CID: 11735 ChEBI: CHEBI:73963 IUPAC Name: 2-chloroprop-2-enoic acid SMILES: OC(=O)C(Cl)=C
| PubChem CID | 11735 |
|---|---|
| CAS | 598-79-8 |
| Molecular Weight (g/mol) | 106.51 |
| ChEBI | CHEBI:73963 |
| MDL Number | MFCD00014336 |
| SMILES | OC(=O)C(Cl)=C |
| Synonym | 2-chloroacrylic acid,chloroacrylic acid,2-propenoic acid, 2-chloro,alpha-chloroacrylic acid,acrylic acid, 2-chloro,2-chloro-2-propenoic acid,.alpha.-chloroacrylic acid,acmc-1aqt3 |
| IUPAC Name | 2-chloroprop-2-enoic acid |
| InChI Key | SZTBMYHIYNGYIA-UHFFFAOYSA-N |
| Molecular Formula | C3H3ClO2 |
alpha-Methylcinnamic acid, 99%
CAS: 1199-77-5 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00002652 InChI Key: XNCRUNXWPDJHGV-BQYQJAHWSA-N Synonym: alpha-methylcinnamic acid,2-methyl-3-phenylacrylic acid,2e-2-methyl-3-phenylprop-2-enoic acid,a-methylcinnamic acid,2e-2-methyl-3-phenylacrylic acid,.alpha.-methylcinnamic acid,e-2-methyl-3-phenylacrylic acid,2-propenoic acid, 2-methyl-3-phenyl,alpha-methyl cinnamic acid,e-2-methyl-3-phenylprop-2-enoic acid PubChem CID: 637817 IUPAC Name: (E)-2-methyl-3-phenylprop-2-enoic acid SMILES: C\C(=C/C1=CC=CC=C1)C(O)=O
| PubChem CID | 637817 |
|---|---|
| CAS | 1199-77-5 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD00002652 |
| SMILES | C\C(=C/C1=CC=CC=C1)C(O)=O |
| Synonym | alpha-methylcinnamic acid,2-methyl-3-phenylacrylic acid,2e-2-methyl-3-phenylprop-2-enoic acid,a-methylcinnamic acid,2e-2-methyl-3-phenylacrylic acid,.alpha.-methylcinnamic acid,e-2-methyl-3-phenylacrylic acid,2-propenoic acid, 2-methyl-3-phenyl,alpha-methyl cinnamic acid,e-2-methyl-3-phenylprop-2-enoic acid |
| IUPAC Name | (E)-2-methyl-3-phenylprop-2-enoic acid |
| InChI Key | XNCRUNXWPDJHGV-BQYQJAHWSA-N |
| Molecular Formula | C10H10O2 |
Ethyl o-toluate, 98+%
CAS: 87-24-1 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.204 MDL Number: MFCD00009112 InChI Key: SOUAXOGPALPTTC-UHFFFAOYSA-N Synonym: ethyl o-toluate,ethyl o-methylbenzoate,ethyl orthotoluate,2-methylbenzoic acid ethyl ester,benzoic acid, 2-methyl-, ethyl ester,ethyl-o-toluate,2-methyl-benzoic acid ethyl ester,o-toluic acid ethyl ester,ethyl-2-methylbenzoate,ethylo-toluate PubChem CID: 66598 IUPAC Name: ethyl 2-methylbenzoate SMILES: CCOC(=O)C1=CC=CC=C1C
| PubChem CID | 66598 |
|---|---|
| CAS | 87-24-1 |
| Molecular Weight (g/mol) | 164.204 |
| MDL Number | MFCD00009112 |
| SMILES | CCOC(=O)C1=CC=CC=C1C |
| Synonym | ethyl o-toluate,ethyl o-methylbenzoate,ethyl orthotoluate,2-methylbenzoic acid ethyl ester,benzoic acid, 2-methyl-, ethyl ester,ethyl-o-toluate,2-methyl-benzoic acid ethyl ester,o-toluic acid ethyl ester,ethyl-2-methylbenzoate,ethylo-toluate |
| IUPAC Name | ethyl 2-methylbenzoate |
| InChI Key | SOUAXOGPALPTTC-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |