Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Probucol, MP Biomedicals™
CAS: 23288-49-5 Molecular Formula: C31H48O2S2 Molecular Weight (g/mol): 516.843 InChI Key: FYPMFJGVHOHGLL-UHFFFAOYSA-N Synonym: probucol,lorelco,biphenabid,bisphenabid,lurselle,bisbid,lesterol,lursell,panavir,probucolum PubChem CID: 4912 ChEBI: CHEBI:8427 IUPAC Name: 2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenol SMILES: CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)SC(C)(C)SC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C
| PubChem CID | 4912 |
|---|---|
| CAS | 23288-49-5 |
| Molecular Weight (g/mol) | 516.843 |
| ChEBI | CHEBI:8427 |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)SC(C)(C)SC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |
| Synonym | probucol,lorelco,biphenabid,bisphenabid,lurselle,bisbid,lesterol,lursell,panavir,probucolum |
| IUPAC Name | 2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenol |
| InChI Key | FYPMFJGVHOHGLL-UHFFFAOYSA-N |
| Molecular Formula | C31H48O2S2 |
D-Penicillamine, MP Biomedicals™
CAS: 52-67-5 Molecular Formula: C5H11NO2S Molecular Weight (g/mol): 149.208 InChI Key: VVNCNSJFMMFHPL-VKHMYHEASA-N Synonym: d-penicillamine,penicillamine,cuprimine,d---penicillamine,depen,3-mercapto-d-valine,cuprenil,d-penamine,--penicillamine,d-mercaptovaline PubChem CID: 5852 ChEBI: CHEBI:7959 IUPAC Name: (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid SMILES: CC(C)(C(C(=O)O)N)S
| PubChem CID | 5852 |
|---|---|
| CAS | 52-67-5 |
| Molecular Weight (g/mol) | 149.208 |
| ChEBI | CHEBI:7959 |
| SMILES | CC(C)(C(C(=O)O)N)S |
| Synonym | d-penicillamine,penicillamine,cuprimine,d---penicillamine,depen,3-mercapto-d-valine,cuprenil,d-penamine,--penicillamine,d-mercaptovaline |
| IUPAC Name | (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid |
| InChI Key | VVNCNSJFMMFHPL-VKHMYHEASA-N |
| Molecular Formula | C5H11NO2S |
4-(Methylsulfonyl)phenylhydrazine Hydrochloride, 95%
CAS: 17852-67-4 Molecular Formula: C7H10N2O2S·HCl Molecular Weight (g/mol): 222.69 MDL Number: MFCD00216494 InChI Key: QVCMFSJTNVQJFG-UHFFFAOYSA-N Synonym: 4-methylsulfonyl phenyl hydrazine hydrochloride,4-methylsulfonyl phenylhydrazine hydrochloride,4-methylsulphonyl phenylhydrazine hydrochloride,4-methylsulphonylphenylhydrazine hydrochloride,4-methanesulfonylphenyl hydrazine hydrochloride,4-methylsulfonylphenylhydrazine hydrochloride,hydrazine, 4-methylsulfonyl phenyl-, monohydrochloride,4-methylsulfonyl phenylhydrazine, chloride,4-methylsulfonyl phenylhydrazine hydrochloric acid PubChem CID: 2735181 IUPAC Name: (4-methylsulfonylphenyl)hydrazine;hydrochloride SMILES: CS(=O)(=O)C1=CC=C(C=C1)NN.Cl
| PubChem CID | 2735181 |
|---|---|
| CAS | 17852-67-4 |
| Molecular Weight (g/mol) | 222.69 |
| MDL Number | MFCD00216494 |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)NN.Cl |
| Synonym | 4-methylsulfonyl phenyl hydrazine hydrochloride,4-methylsulfonyl phenylhydrazine hydrochloride,4-methylsulphonyl phenylhydrazine hydrochloride,4-methylsulphonylphenylhydrazine hydrochloride,4-methanesulfonylphenyl hydrazine hydrochloride,4-methylsulfonylphenylhydrazine hydrochloride,hydrazine, 4-methylsulfonyl phenyl-, monohydrochloride,4-methylsulfonyl phenylhydrazine, chloride,4-methylsulfonyl phenylhydrazine hydrochloric acid |
| IUPAC Name | (4-methylsulfonylphenyl)hydrazine;hydrochloride |
| InChI Key | QVCMFSJTNVQJFG-UHFFFAOYSA-N |
| Molecular Formula | C7H10N2O2S·HCl |
2-Nitroimidazole, 98%
CAS: 527-73-1 Molecular Formula: C3H3N3O2 Molecular Weight (g/mol): 113.08 MDL Number: MFCD00005185 InChI Key: YZEUHQHUFTYLPH-UHFFFAOYSA-N Synonym: 2-nitroimidazole,azomycin,amicin,nitroimidazole,1h-imidazole, 2-nitro,imidazole, 2-nitro,2-nitroimidazol,2-nitro-imidazole,unii-k8e96xl55d,azomycin 2-nitroimidazole PubChem CID: 10701 ChEBI: CHEBI:67135 IUPAC Name: 2-nitro-1H-imidazole SMILES: [O-][N+](=O)C1=NC=CN1
| PubChem CID | 10701 |
|---|---|
| CAS | 527-73-1 |
| Molecular Weight (g/mol) | 113.08 |
| ChEBI | CHEBI:67135 |
| MDL Number | MFCD00005185 |
| SMILES | [O-][N+](=O)C1=NC=CN1 |
| Synonym | 2-nitroimidazole,azomycin,amicin,nitroimidazole,1h-imidazole, 2-nitro,imidazole, 2-nitro,2-nitroimidazol,2-nitro-imidazole,unii-k8e96xl55d,azomycin 2-nitroimidazole |
| IUPAC Name | 2-nitro-1H-imidazole |
| InChI Key | YZEUHQHUFTYLPH-UHFFFAOYSA-N |
| Molecular Formula | C3H3N3O2 |
4-Bromo-3-chloroaniline, 96%
CAS: 21402-26-6 Molecular Formula: C6H5BrClN Molecular Weight (g/mol): 206.467 MDL Number: MFCD00041311 InChI Key: QLYHPNUFNZJXOQ-UHFFFAOYSA-N Synonym: benzenamine, 4-bromo-3-chloro,3-chloro-4-bromoaniline,unii-2gtm4sw4oh,2gtm4sw4oh,4-bromo-3-chloro-aniline,4-bromo-3-chlorophenyl amine,pubchem3579,zlchem 1051,4-bromo-3-chloro aniline,4-bromo-3-chlorophenylamine PubChem CID: 88888 IUPAC Name: 4-bromo-3-chloroaniline SMILES: C1=CC(=C(C=C1N)Cl)Br
| PubChem CID | 88888 |
|---|---|
| CAS | 21402-26-6 |
| Molecular Weight (g/mol) | 206.467 |
| MDL Number | MFCD00041311 |
| SMILES | C1=CC(=C(C=C1N)Cl)Br |
| Synonym | benzenamine, 4-bromo-3-chloro,3-chloro-4-bromoaniline,unii-2gtm4sw4oh,2gtm4sw4oh,4-bromo-3-chloro-aniline,4-bromo-3-chlorophenyl amine,pubchem3579,zlchem 1051,4-bromo-3-chloro aniline,4-bromo-3-chlorophenylamine |
| IUPAC Name | 4-bromo-3-chloroaniline |
| InChI Key | QLYHPNUFNZJXOQ-UHFFFAOYSA-N |
| Molecular Formula | C6H5BrClN |
2-Naphthoic acid, 98+%
CAS: 93-09-4 Molecular Formula: C11H8O2 Molecular Weight (g/mol): 172.183 MDL Number: MFCD00004101 InChI Key: UOBYKYZJUGYBDK-UHFFFAOYSA-N Synonym: 2-naphthoic acid,2-naphthalenecarboxylic acid,isonaphthoic acid,2-carboxynaphthalene,2-maythic acid,beta-naphthoic acid,ne-2-carboxylic acid,unii-qlg01v0w2l,naphthalene-beta-carboxylic acid,.beta.-naphthoic acid PubChem CID: 7123 ChEBI: CHEBI:36106 IUPAC Name: naphthalene-2-carboxylic acid SMILES: C1=CC=C2C=C(C=CC2=C1)C(=O)O
| PubChem CID | 7123 |
|---|---|
| CAS | 93-09-4 |
| Molecular Weight (g/mol) | 172.183 |
| ChEBI | CHEBI:36106 |
| MDL Number | MFCD00004101 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)O |
| Synonym | 2-naphthoic acid,2-naphthalenecarboxylic acid,isonaphthoic acid,2-carboxynaphthalene,2-maythic acid,beta-naphthoic acid,ne-2-carboxylic acid,unii-qlg01v0w2l,naphthalene-beta-carboxylic acid,.beta.-naphthoic acid |
| IUPAC Name | naphthalene-2-carboxylic acid |
| InChI Key | UOBYKYZJUGYBDK-UHFFFAOYSA-N |
| Molecular Formula | C11H8O2 |
4,4'-cis-Stilbenedicarboxylic acid, 95%
CAS: 133005-88-6 Molecular Formula: C16H12O4 Molecular Weight (g/mol): 268.268 MDL Number: MFCD00013994 InChI Key: SBBQDUFLZGOASY-UPHRSURJSA-N Synonym: 4-z-2-4-carboxyphenyl ethenyl benzoic acid,cis-stilbene-4,4'-dicarboxylic acid,z-4,4'-ethene-1,2-diyl dibenzoic acid,cis-4,4'-dicarboxystilbene,z-4,4'-stilbene dicarboxylic acid,z-stilbene-4,4'-dicarboxylic acid,4,4'-cis-stilbenedicarboxylic acid PubChem CID: 18647961 IUPAC Name: 4-[(Z)-2-(4-carboxyphenyl)ethenyl]benzoic acid SMILES: C1=CC(=CC=C1C=CC2=CC=C(C=C2)C(=O)O)C(=O)O
| PubChem CID | 18647961 |
|---|---|
| CAS | 133005-88-6 |
| Molecular Weight (g/mol) | 268.268 |
| MDL Number | MFCD00013994 |
| SMILES | C1=CC(=CC=C1C=CC2=CC=C(C=C2)C(=O)O)C(=O)O |
| Synonym | 4-z-2-4-carboxyphenyl ethenyl benzoic acid,cis-stilbene-4,4'-dicarboxylic acid,z-4,4'-ethene-1,2-diyl dibenzoic acid,cis-4,4'-dicarboxystilbene,z-4,4'-stilbene dicarboxylic acid,z-stilbene-4,4'-dicarboxylic acid,4,4'-cis-stilbenedicarboxylic acid |
| IUPAC Name | 4-[(Z)-2-(4-carboxyphenyl)ethenyl]benzoic acid |
| InChI Key | SBBQDUFLZGOASY-UPHRSURJSA-N |
| Molecular Formula | C16H12O4 |
Ethyl 3-chlorobenzoate, 98+%
CAS: 1128-76-3 Molecular Formula: C9H9ClO2 Molecular Weight (g/mol): 184.619 MDL Number: MFCD00013634 InChI Key: LVFRSNCBCHABAM-UHFFFAOYSA-N Synonym: benzoic acid, 3-chloro-, ethyl ester,3-chlorobenzoic acid ethyl ester,ethyl m-chlorobenzoate,benzoic acid, m-chloro-, ethyl ester,3-chloro-benzoic acid ethyl ester,pubchem3704,acmc-1bt4u,ethyl3-chlorobenzoate,ksc495m6f,rarechem al bi 0056 PubChem CID: 70785 IUPAC Name: ethyl 3-chlorobenzoate SMILES: CCOC(=O)C1=CC(=CC=C1)Cl
| PubChem CID | 70785 |
|---|---|
| CAS | 1128-76-3 |
| Molecular Weight (g/mol) | 184.619 |
| MDL Number | MFCD00013634 |
| SMILES | CCOC(=O)C1=CC(=CC=C1)Cl |
| Synonym | benzoic acid, 3-chloro-, ethyl ester,3-chlorobenzoic acid ethyl ester,ethyl m-chlorobenzoate,benzoic acid, m-chloro-, ethyl ester,3-chloro-benzoic acid ethyl ester,pubchem3704,acmc-1bt4u,ethyl3-chlorobenzoate,ksc495m6f,rarechem al bi 0056 |
| IUPAC Name | ethyl 3-chlorobenzoate |
| InChI Key | LVFRSNCBCHABAM-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO2 |
2-(2-Thienyl)pyridine, 97%
CAS: 3319-99-1 Molecular Formula: C9H7NS Molecular Weight (g/mol): 161.22 MDL Number: MFCD00044441 InChI Key: QLPKTAFPRRIFQX-UHFFFAOYSA-N Synonym: 2-2-thienyl pyridine,2-thiophen-2-yl pyridine,2-thien-2-ylpyridine,2-2-pyridyl thiophene,pyridine, 2-2-thienyl,thienyl pyridine,2-thienylpyridine,2-pyrid-2-ylthiophene,acmc-1cknd,2-thien-2-yl pyridine PubChem CID: 76832 IUPAC Name: 2-thiophen-2-ylpyridine SMILES: S1C=CC=C1C1=CC=CC=N1
| PubChem CID | 76832 |
|---|---|
| CAS | 3319-99-1 |
| Molecular Weight (g/mol) | 161.22 |
| MDL Number | MFCD00044441 |
| SMILES | S1C=CC=C1C1=CC=CC=N1 |
| Synonym | 2-2-thienyl pyridine,2-thiophen-2-yl pyridine,2-thien-2-ylpyridine,2-2-pyridyl thiophene,pyridine, 2-2-thienyl,thienyl pyridine,2-thienylpyridine,2-pyrid-2-ylthiophene,acmc-1cknd,2-thien-2-yl pyridine |
| IUPAC Name | 2-thiophen-2-ylpyridine |
| InChI Key | QLPKTAFPRRIFQX-UHFFFAOYSA-N |
| Molecular Formula | C9H7NS |
Perylene, 98+%
CAS: 198-55-0 Molecular Formula: C20H12 Molecular Weight (g/mol): 252.316 MDL Number: MFCD00004142 InChI Key: CSHWQDPOILHKBI-UHFFFAOYSA-N Synonym: peri-dinaphthalene,perilene,dibenz de,kl anthracene,alpha-perylene,perylen,unii-5qd5427un7,ccris 1231,perylen-1-yl,perylen-2-yl PubChem CID: 9142 ChEBI: CHEBI:29861 IUPAC Name: perylene SMILES: C1=CC2=C3C(=C1)C4=CC=CC5=C4C(=CC=C5)C3=CC=C2
| PubChem CID | 9142 |
|---|---|
| CAS | 198-55-0 |
| Molecular Weight (g/mol) | 252.316 |
| ChEBI | CHEBI:29861 |
| MDL Number | MFCD00004142 |
| SMILES | C1=CC2=C3C(=C1)C4=CC=CC5=C4C(=CC=C5)C3=CC=C2 |
| Synonym | peri-dinaphthalene,perilene,dibenz de,kl anthracene,alpha-perylene,perylen,unii-5qd5427un7,ccris 1231,perylen-1-yl,perylen-2-yl |
| IUPAC Name | perylene |
| InChI Key | CSHWQDPOILHKBI-UHFFFAOYSA-N |
| Molecular Formula | C20H12 |
Cinnamyl bromide, predominantly trans, 95%
CAS: 4392-24-9 Molecular Formula: C9H9Br Molecular Weight (g/mol): 197.075 MDL Number: MFCD00000245 InChI Key: RUROFEVDCUGKHD-QPJJXVBHSA-N Synonym: cinnamyl bromide,3-bromoprop-1-en-1-yl benzene,e-3-bromoprop-1-en-1-yl benzene,3-bromo-1-phenyl-1-propene,3-bromo-1-phenyl propene-1,e-3-bromoprop-1-enyl benzene,3-bromo-propenyl-benzene,e-cinnamyl bromide,trans-cinnamyl bromide PubChem CID: 5357478 IUPAC Name: [(E)-3-bromoprop-1-enyl]benzene SMILES: C1=CC=C(C=C1)C=CCBr
| PubChem CID | 5357478 |
|---|---|
| CAS | 4392-24-9 |
| Molecular Weight (g/mol) | 197.075 |
| MDL Number | MFCD00000245 |
| SMILES | C1=CC=C(C=C1)C=CCBr |
| Synonym | cinnamyl bromide,3-bromoprop-1-en-1-yl benzene,e-3-bromoprop-1-en-1-yl benzene,3-bromo-1-phenyl-1-propene,3-bromo-1-phenyl propene-1,e-3-bromoprop-1-enyl benzene,3-bromo-propenyl-benzene,e-cinnamyl bromide,trans-cinnamyl bromide |
| IUPAC Name | [(E)-3-bromoprop-1-enyl]benzene |
| InChI Key | RUROFEVDCUGKHD-QPJJXVBHSA-N |
| Molecular Formula | C9H9Br |
3,4,5-Trihydroxybenzaldehyde hydrate, 97%
CAS: 13677-79-7 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.12 MDL Number: MFCD00003371 InChI Key: RGZHEOWNTDJLAQ-UHFFFAOYSA-N Synonym: gallaldehyde,benzaldehyde, 3,4,5-trihydroxy,pyrogallol-5-carboxaldehyde,3,4,5-trihydroxy benzaldehyde,pubchem21300,3,4,5-trihydroxybenz,acmc-209c9s,3,4,5-trihydroxybenzaldhyde,3,4,5-trihydroxy-benzaldehyde,3,4,5-tris oxidanyl benzaldehyde PubChem CID: 83651 IUPAC Name: 3,4,5-trihydroxybenzaldehyde SMILES: OC1=CC(C=O)=CC(O)=C1O
| PubChem CID | 83651 |
|---|---|
| CAS | 13677-79-7 |
| Molecular Weight (g/mol) | 154.12 |
| MDL Number | MFCD00003371 |
| SMILES | OC1=CC(C=O)=CC(O)=C1O |
| Synonym | gallaldehyde,benzaldehyde, 3,4,5-trihydroxy,pyrogallol-5-carboxaldehyde,3,4,5-trihydroxy benzaldehyde,pubchem21300,3,4,5-trihydroxybenz,acmc-209c9s,3,4,5-trihydroxybenzaldhyde,3,4,5-trihydroxy-benzaldehyde,3,4,5-tris oxidanyl benzaldehyde |
| IUPAC Name | 3,4,5-trihydroxybenzaldehyde |
| InChI Key | RGZHEOWNTDJLAQ-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
6-Azathymine, 98%
CAS: 932-53-6 Molecular Formula: C4H5N3O2 Molecular Weight (g/mol): 127.10 MDL Number: MFCD00006457,MFCD00127802 InChI Key: XZWMZFQOHTWGQE-UHFFFAOYSA-N Synonym: 6-azathymine,6-methyl-1,2,4-triazine-3,5 2h,4h-dione,5-methyl-6-azauracil,azathymine,usaf cb-28,1,2,4-triazine-3,5 2h,4h-dione, 6-methyl,6-methyl-1,2,4-triazine-3,5-diol,6-methyl-1,2,4-triazine-3,5-dione,unii-zwx58t58za,azathymine, 6 PubChem CID: 70269 SMILES: CC1=NNC(=O)NC1=O
| PubChem CID | 70269 |
|---|---|
| CAS | 932-53-6 |
| Molecular Weight (g/mol) | 127.10 |
| MDL Number | MFCD00006457,MFCD00127802 |
| SMILES | CC1=NNC(=O)NC1=O |
| Synonym | 6-azathymine,6-methyl-1,2,4-triazine-3,5 2h,4h-dione,5-methyl-6-azauracil,azathymine,usaf cb-28,1,2,4-triazine-3,5 2h,4h-dione, 6-methyl,6-methyl-1,2,4-triazine-3,5-diol,6-methyl-1,2,4-triazine-3,5-dione,unii-zwx58t58za,azathymine, 6 |
| InChI Key | XZWMZFQOHTWGQE-UHFFFAOYSA-N |
| Molecular Formula | C4H5N3O2 |
Triphenyl phosphate, 98%
CAS: 115-86-6 Molecular Formula: C18H15O4P Molecular Weight (g/mol): 326.29 MDL Number: MFCD00003031 InChI Key: XZZNDPSIHUTMOC-UHFFFAOYSA-N Synonym: triphenylphosphate,phosphoric acid, triphenyl ester,disflamoll tp,triphenoxyphosphine oxide,celluflex tpp,phosflex tpp,trifenylfosfat,phenyl phosphate pho 3po,phosphoric acid triphenyl ester,trifenylfosfat czech PubChem CID: 8289 ChEBI: CHEBI:35033 IUPAC Name: triphenyl phosphate SMILES: O=P(OC1=CC=CC=C1)(OC1=CC=CC=C1)OC1=CC=CC=C1
| PubChem CID | 8289 |
|---|---|
| CAS | 115-86-6 |
| Molecular Weight (g/mol) | 326.29 |
| ChEBI | CHEBI:35033 |
| MDL Number | MFCD00003031 |
| SMILES | O=P(OC1=CC=CC=C1)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| Synonym | triphenylphosphate,phosphoric acid, triphenyl ester,disflamoll tp,triphenoxyphosphine oxide,celluflex tpp,phosflex tpp,trifenylfosfat,phenyl phosphate pho 3po,phosphoric acid triphenyl ester,trifenylfosfat czech |
| IUPAC Name | triphenyl phosphate |
| InChI Key | XZZNDPSIHUTMOC-UHFFFAOYSA-N |
| Molecular Formula | C18H15O4P |
2,4,5-Trihydroxybenzaldehyde, 99%
CAS: 35094-87-2 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.12 MDL Number: MFCD00016592 InChI Key: WNCNWLVQSHZVKV-UHFFFAOYSA-N PubChem CID: 643387 IUPAC Name: 2,4,5-trihydroxybenzaldehyde SMILES: OC1=CC(O)=C(C=O)C=C1O
| PubChem CID | 643387 |
|---|---|
| CAS | 35094-87-2 |
| Molecular Weight (g/mol) | 154.12 |
| MDL Number | MFCD00016592 |
| SMILES | OC1=CC(O)=C(C=O)C=C1O |
| IUPAC Name | 2,4,5-trihydroxybenzaldehyde |
| InChI Key | WNCNWLVQSHZVKV-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |