Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
1-Propanol, 99.5%, for analysis
CAS: 71-23-8 Molecular Formula: C3H8O Molecular Weight (g/mol): 60.10 MDL Number: MFCD00002941 InChI Key: BDERNNFJNOPAEC-UHFFFAOYSA-N Synonym: 1-propanol,propanol,propyl alcohol,n-propanol,n-propyl alcohol,ethylcarbinol,1-hydroxypropane,optal,osmosol extra,propylic alcohol PubChem CID: 1031 ChEBI: CHEBI:28831 IUPAC Name: propan-1-ol SMILES: CCCO
| PubChem CID | 1031 |
|---|---|
| CAS | 71-23-8 |
| Molecular Weight (g/mol) | 60.10 |
| ChEBI | CHEBI:28831 |
| MDL Number | MFCD00002941 |
| SMILES | CCCO |
| Synonym | 1-propanol,propanol,propyl alcohol,n-propanol,n-propyl alcohol,ethylcarbinol,1-hydroxypropane,optal,osmosol extra,propylic alcohol |
| IUPAC Name | propan-1-ol |
| InChI Key | BDERNNFJNOPAEC-UHFFFAOYSA-N |
| Molecular Formula | C3H8O |
Pyridine, 99+%, extra pure
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
Pyridine, 99.5%, Extra Dry, AcroSeal™
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
Pyridine, 99.5%, Extra Dry over Molecular Sieve, AcroSeal™
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
Tetrahydrofuran, 99.9%, extra pure, anhydrous, stabilized with BHT
CAS: 109-99-9 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00005356 InChI Key: WYURNTSHIVDZCO-UHFFFAOYSA-N Synonym: tetrahydrofuran,furan, tetrahydro,butylene oxide,furanidine,hydrofuran,tetramethylene oxide,oxacyclopentane,1,4-epoxybutane,tetrahydrofuranne,tetraidrofurano PubChem CID: 8028 ChEBI: CHEBI:26911 IUPAC Name: oxolane SMILES: C1CCOC1
| PubChem CID | 8028 |
|---|---|
| CAS | 109-99-9 |
| Molecular Weight (g/mol) | 72.11 |
| ChEBI | CHEBI:26911 |
| MDL Number | MFCD00005356 |
| SMILES | C1CCOC1 |
| Synonym | tetrahydrofuran,furan, tetrahydro,butylene oxide,furanidine,hydrofuran,tetramethylene oxide,oxacyclopentane,1,4-epoxybutane,tetrahydrofuranne,tetraidrofurano |
| IUPAC Name | oxolane |
| InChI Key | WYURNTSHIVDZCO-UHFFFAOYSA-N |
| Molecular Formula | C4H8O |
Toluene, 99.5%, ACS reagent, meets the requirements of Reag. Ph.Eur.
CAS: 108-88-3 Molecular Formula: C7H8 Molecular Weight (g/mol): 92.14 MDL Number: MFCD00008512 InChI Key: YXFVVABEGXRONW-UHFFFAOYSA-N Synonym: methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene PubChem CID: 1140 ChEBI: CHEBI:17578 IUPAC Name: toluene SMILES: CC1=CC=CC=C1
| PubChem CID | 1140 |
|---|---|
| CAS | 108-88-3 |
| Molecular Weight (g/mol) | 92.14 |
| ChEBI | CHEBI:17578 |
| MDL Number | MFCD00008512 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene |
| IUPAC Name | toluene |
| InChI Key | YXFVVABEGXRONW-UHFFFAOYSA-N |
| Molecular Formula | C7H8 |
p-Xylene, 99%, pure
CAS: 106-42-3 Molecular Formula: C8H10 Molecular Weight (g/mol): 106.17 MDL Number: MFCD00008556 InChI Key: URLKBWYHVLBVBO-UHFFFAOYSA-N Synonym: p-xylene,para-xylene,1,4-dimethylbenzene,p-methyltoluene,p-dimethylbenzene,p-xylol,benzene, 1,4-dimethyl,4-xylene,chromar,4-methyltoluene PubChem CID: 7809 ChEBI: CHEBI:27417 IUPAC Name: 1,4-xylene SMILES: CC1=CC=C(C)C=C1
| PubChem CID | 7809 |
|---|---|
| CAS | 106-42-3 |
| Molecular Weight (g/mol) | 106.17 |
| ChEBI | CHEBI:27417 |
| MDL Number | MFCD00008556 |
| SMILES | CC1=CC=C(C)C=C1 |
| Synonym | p-xylene,para-xylene,1,4-dimethylbenzene,p-methyltoluene,p-dimethylbenzene,p-xylol,benzene, 1,4-dimethyl,4-xylene,chromar,4-methyltoluene |
| IUPAC Name | 1,4-xylene |
| InChI Key | URLKBWYHVLBVBO-UHFFFAOYSA-N |
| Molecular Formula | C8H10 |
| Water | 0.1% max. (K.F.) |
|---|---|
| Viscosity | 1.1 mPa.s (20°C) |
| Linear Formula | CH3OCH2CH2OCH3 |
| Density | 0.8670g/mL |
| Name Note | Stabilized with BHT |
| Percent Purity | ≥99% |
| Fieser | 01,267; 02,143; 16,229 |
| Infrared Spectrum | Authentic |
| pH | 6 to 7.5 (1:9) |
| Formula Weight | 90.12 |
| Melting Point | -69.0°C |
| Boiling Point | 84.0°C to 86.0°C |
| Physical Form | Liquid |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Pure |
| Merck Index | 15, 3245 |
| Assay Percent Range | 99+% |
| CAS | 128-37-0 |
| Health Hazard 3 | GHS P Statement: Obtain special instructions before use. IF exposed or concerned: Get medical advice/attention. Keep container tightly closed. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Health Hazard 2 | GHS H Statement: Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. May form explosive peroxides. |
| Flash Point | −6°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3785 to 1.3805 |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| Beilstein | 01, 467 |
| Specific Gravity | 0.867 |
Thermo Scientific Chemicals 1,2-Dichlorobenzene-d4, for NMR, 98 atom% D
CAS: 2199-69-1 Molecular Formula: C6H4Cl2 Molecular Weight (g/mol): 151.02 MDL Number: MFCD00037106 InChI Key: RFFLAFLAYFXFSW-RHQRLBAQSA-N Synonym: 1,2-dichlorobenzene-d4,1,2-dichlorobenzene d4,benzene-1,2,3,4-d4-, 5,6-dichloro,o-dichloro 2h4 benzene,deuterated 1,2-dichlorobenzene,tetradeutero-1,2-dichlorobenzene,1,2-dichlorobenzene-d4, 98 atom % d,1,2-dichlorobenzene-d4,98atom%d,benzene-1,2,3,4-d4, 5,6-dichloro,1,2-dichloro-3,4,5,6-tetradeuterobenzene PubChem CID: 519913 IUPAC Name: 1,2-dichloro-3,4,5,6-tetradeuteriobenzene SMILES: [2H]C1=C([2H])C([2H])=C(Cl)C(Cl)=C1[2H]
| PubChem CID | 519913 |
|---|---|
| CAS | 2199-69-1 |
| Molecular Weight (g/mol) | 151.02 |
| MDL Number | MFCD00037106 |
| SMILES | [2H]C1=C([2H])C([2H])=C(Cl)C(Cl)=C1[2H] |
| Synonym | 1,2-dichlorobenzene-d4,1,2-dichlorobenzene d4,benzene-1,2,3,4-d4-, 5,6-dichloro,o-dichloro 2h4 benzene,deuterated 1,2-dichlorobenzene,tetradeutero-1,2-dichlorobenzene,1,2-dichlorobenzene-d4, 98 atom % d,1,2-dichlorobenzene-d4,98atom%d,benzene-1,2,3,4-d4, 5,6-dichloro,1,2-dichloro-3,4,5,6-tetradeuterobenzene |
| IUPAC Name | 1,2-dichloro-3,4,5,6-tetradeuteriobenzene |
| InChI Key | RFFLAFLAYFXFSW-RHQRLBAQSA-N |
| Molecular Formula | C6H4Cl2 |
CytoScint ES, MP Biomedicals™
Liquid Scintillation Cocktails; CytoScint ES; MP Biomedical; 4 x 1 gal.; Biodegradable
| Chemical Name or Material | Liquid Scintillation Cocktails |
|---|
Isobutanol, ACS, 99+%
CAS: 78-83-1 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00004740 InChI Key: ZXEKIIBDNHEJCQ-UHFFFAOYSA-N Synonym: 2-methyl-1-propanol,isobutanol,isobutyl alcohol,1-propanol, 2-methyl,1-hydroxymethylpropane,isopropylcarbinol,iso-butyl alcohol,2-methylpropyl alcohol,isobutylalkohol,i-butyl alcohol PubChem CID: 6560 ChEBI: CHEBI:46645 IUPAC Name: 2-methylpropan-1-ol SMILES: CC(C)CO
| PubChem CID | 6560 |
|---|---|
| CAS | 78-83-1 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:46645 |
| MDL Number | MFCD00004740 |
| SMILES | CC(C)CO |
| Synonym | 2-methyl-1-propanol,isobutanol,isobutyl alcohol,1-propanol, 2-methyl,1-hydroxymethylpropane,isopropylcarbinol,iso-butyl alcohol,2-methylpropyl alcohol,isobutylalkohol,i-butyl alcohol |
| IUPAC Name | 2-methylpropan-1-ol |
| InChI Key | ZXEKIIBDNHEJCQ-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Thermo Scientific Chemicals Methyl sulfoxide-d6, for NMR, 99+ atom % D
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
2-Chlorobenzyl mercaptan, 98%, Thermo Scientific™
CAS: 39718-00-8 Molecular Formula: C7H7ClS Molecular Weight (g/mol): 158.65 MDL Number: MFCD00004868 InChI Key: WWFIIZLHSNBNTC-UHFFFAOYSA-N Synonym: 2-chlorobenzenemethanethiol,2-chlorophenyl methanethiol,2-chlorobenzyl mercaptan,2-chlorobenzylmercaptan,2-chloro benzyl mercaptan,benzenemethanethiol, 2-chloro,o-chlorobenzylmercaptan,pubchem6836,2-chlorophenyl-methanethiol,d0p3xw PubChem CID: 580759 IUPAC Name: (2-chlorophenyl)methanethiol SMILES: C1=CC=C(C(=C1)CS)Cl
| PubChem CID | 580759 |
|---|---|
| CAS | 39718-00-8 |
| Molecular Weight (g/mol) | 158.65 |
| MDL Number | MFCD00004868 |
| SMILES | C1=CC=C(C(=C1)CS)Cl |
| Synonym | 2-chlorobenzenemethanethiol,2-chlorophenyl methanethiol,2-chlorobenzyl mercaptan,2-chlorobenzylmercaptan,2-chloro benzyl mercaptan,benzenemethanethiol, 2-chloro,o-chlorobenzylmercaptan,pubchem6836,2-chlorophenyl-methanethiol,d0p3xw |
| IUPAC Name | (2-chlorophenyl)methanethiol |
| InChI Key | WWFIIZLHSNBNTC-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClS |
5-(4-Chlorophenyl)furfural, 95+%, Thermo Scientific™
CAS: 34035-03-5 Molecular Formula: C11H7ClO2 Molecular Weight (g/mol): 206.63 MDL Number: MFCD00195947 InChI Key: ROJGJNINTRCMBL-UHFFFAOYSA-N Synonym: 5-4-chlorophenyl furan-2-carbaldehyde,5-4-chlorophenyl-2-furaldehyde,5-4-chlorophenyl furfural,5-4-chloro-phenyl-furan-2-carbaldehyde,2-formyl-5-4-chlorophenyl furan,2-furancarboxaldehyde, 5-4-chlorophenyl,5-4-chlorophenyl-2-furancarboxaldehyde,5-4-chlorophenyl furan-2-carboxaldehyde,pubchem4001,cambridge id 7179578 PubChem CID: 676184 IUPAC Name: 5-(4-chlorophenyl)furan-2-carbaldehyde SMILES: ClC1=CC=C(C=C1)C1=CC=C(O1)C=O
| PubChem CID | 676184 |
|---|---|
| CAS | 34035-03-5 |
| Molecular Weight (g/mol) | 206.63 |
| MDL Number | MFCD00195947 |
| SMILES | ClC1=CC=C(C=C1)C1=CC=C(O1)C=O |
| Synonym | 5-4-chlorophenyl furan-2-carbaldehyde,5-4-chlorophenyl-2-furaldehyde,5-4-chlorophenyl furfural,5-4-chloro-phenyl-furan-2-carbaldehyde,2-formyl-5-4-chlorophenyl furan,2-furancarboxaldehyde, 5-4-chlorophenyl,5-4-chlorophenyl-2-furancarboxaldehyde,5-4-chlorophenyl furan-2-carboxaldehyde,pubchem4001,cambridge id 7179578 |
| IUPAC Name | 5-(4-chlorophenyl)furan-2-carbaldehyde |
| InChI Key | ROJGJNINTRCMBL-UHFFFAOYSA-N |
| Molecular Formula | C11H7ClO2 |
Chloroform, 99+%, for analysis, stabilized with ethanol
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 IUPAC Name: chloroform SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| IUPAC Name | chloroform |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |