Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Chloroform, Stabilized with Ethanol, Exceeds A.C.S. Specifications, HPLC Grade, 99.9%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N IUPAC Name: trichloromethane SMILES: ClC(Cl)Cl
| CAS | 67-66-3 |
|---|---|
| Molecular Weight (g/mol) | 119.37 |
| SMILES | ClC(Cl)Cl |
| IUPAC Name | trichloromethane |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
Chloroform-d, for NMR, 100.0 atom % D
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
4-Chlorophenylacetyl chloride, 96%
CAS: 25026-34-0 Molecular Formula: C8H6Cl2O Molecular Weight (g/mol): 189.04 MDL Number: MFCD00037111 InChI Key: UMQUIRYNOVNYPA-UHFFFAOYSA-N Synonym: 4-chlorophenylacetyl chloride,p-chlorophenylacetyl chloride,2-4-chlorophenyl acetyl chloride,4-chlorobenzeneacetyl chloride,benzeneacetyl chloride, 4-chloro,4-chlorophenylacetylchloride,acmc-1cch1,4-chlorobenzeneacetylchloride,4-chlorobenzenacetyl chloride,p-chlorophenyl-acetyl chloride PubChem CID: 90692 IUPAC Name: 2-(4-chlorophenyl)acetyl chloride SMILES: ClC(=O)CC1=CC=C(Cl)C=C1
| PubChem CID | 90692 |
|---|---|
| CAS | 25026-34-0 |
| Molecular Weight (g/mol) | 189.04 |
| MDL Number | MFCD00037111 |
| SMILES | ClC(=O)CC1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorophenylacetyl chloride,p-chlorophenylacetyl chloride,2-4-chlorophenyl acetyl chloride,4-chlorobenzeneacetyl chloride,benzeneacetyl chloride, 4-chloro,4-chlorophenylacetylchloride,acmc-1cch1,4-chlorobenzeneacetylchloride,4-chlorobenzenacetyl chloride,p-chlorophenyl-acetyl chloride |
| IUPAC Name | 2-(4-chlorophenyl)acetyl chloride |
| InChI Key | UMQUIRYNOVNYPA-UHFFFAOYSA-N |
| Molecular Formula | C8H6Cl2O |
Chlorobenzene, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 108-90-7 Molecular Formula: C6H5Cl Molecular Weight (g/mol): 112.556 InChI Key: MVPPADPHJFYWMZ-UHFFFAOYSA-N Synonym: monochlorobenzene,benzene chloride,phenyl chloride,benzene, chloro,chlorbenzene,chlorobenzol,monochlorbenzol,chlorbenzol,chlorobenzen,clorobenzene PubChem CID: 7964 ChEBI: CHEBI:28097 IUPAC Name: chlorobenzene SMILES: C1=CC=C(C=C1)Cl
| PubChem CID | 7964 |
|---|---|
| CAS | 108-90-7 |
| Molecular Weight (g/mol) | 112.556 |
| ChEBI | CHEBI:28097 |
| SMILES | C1=CC=C(C=C1)Cl |
| Synonym | monochlorobenzene,benzene chloride,phenyl chloride,benzene, chloro,chlorbenzene,chlorobenzol,monochlorbenzol,chlorbenzol,chlorobenzen,clorobenzene |
| IUPAC Name | chlorobenzene |
| InChI Key | MVPPADPHJFYWMZ-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl |
2-Bromo-m-xylene, 98%
CAS: 576-22-7 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.06 MDL Number: MFCD00000075 InChI Key: MYMYVYZLMUEVED-UHFFFAOYSA-N Synonym: 2,6-dimethylbromobenzene,2-bromo-m-xylene,1-bromo-2,6-dimethylbenzene,benzene, 2-bromo-1,3-dimethyl,2,6-dimethyl bromobenzene,m-xylene, 2-bromo,2,6-dimethylphenyl bromide,2-bromo-meta-xylene,2-bromo-1,3-dimethyl-benzene,pubchem3206 PubChem CID: 68471 IUPAC Name: 2-bromo-1,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)C)Br
| PubChem CID | 68471 |
|---|---|
| CAS | 576-22-7 |
| Molecular Weight (g/mol) | 185.06 |
| MDL Number | MFCD00000075 |
| SMILES | CC1=C(C(=CC=C1)C)Br |
| Synonym | 2,6-dimethylbromobenzene,2-bromo-m-xylene,1-bromo-2,6-dimethylbenzene,benzene, 2-bromo-1,3-dimethyl,2,6-dimethyl bromobenzene,m-xylene, 2-bromo,2,6-dimethylphenyl bromide,2-bromo-meta-xylene,2-bromo-1,3-dimethyl-benzene,pubchem3206 |
| IUPAC Name | 2-bromo-1,3-dimethylbenzene |
| InChI Key | MYMYVYZLMUEVED-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
3-Bromochlorobenzene, 99%
CAS: 108-37-2 Molecular Formula: C6H4BrCl Molecular Weight (g/mol): 191.45 MDL Number: MFCD00000568 InChI Key: JRGGUPZKKTVKOV-UHFFFAOYSA-N Synonym: 3-bromochlorobenzene,m-bromochlorobenzene,3-chlorobromobenzene,benzene, 1-bromo-3-chloro,m-chlorobromobenzene,1-chloro-3-bromobenzene,3-chlorophenyl bromide,m-chlorophenyl bromide,m-bromophenyl chloride,3-bromo-1-chlorobenzene PubChem CID: 7928 IUPAC Name: 1-bromo-3-chlorobenzene SMILES: ClC1=CC=CC(Br)=C1
| PubChem CID | 7928 |
|---|---|
| CAS | 108-37-2 |
| Molecular Weight (g/mol) | 191.45 |
| MDL Number | MFCD00000568 |
| SMILES | ClC1=CC=CC(Br)=C1 |
| Synonym | 3-bromochlorobenzene,m-bromochlorobenzene,3-chlorobromobenzene,benzene, 1-bromo-3-chloro,m-chlorobromobenzene,1-chloro-3-bromobenzene,3-chlorophenyl bromide,m-chlorophenyl bromide,m-bromophenyl chloride,3-bromo-1-chlorobenzene |
| IUPAC Name | 1-bromo-3-chlorobenzene |
| InChI Key | JRGGUPZKKTVKOV-UHFFFAOYSA-N |
| Molecular Formula | C6H4BrCl |
2,2'-O-Cyclouridine, 98%
CAS: 3736-77-4 Molecular Formula: C9H10N2O5 Molecular Weight (g/mol): 226.188 MDL Number: MFCD00004945 InChI Key: UUGITDASWNOAGG-CCXZUQQUSA-N Synonym: cyclouridine,2,2'-cyclouridine,o2,2'-cyclouridine,2,2'-anhydro-1 b-d-arabinofuranosyl uracil,2,2'-anhydrouridine,2,2'-anhydro-1 beta-d-arabinofuranosyl uracil,2,2'-o-cyclouridine,2,2-anhydro-1 b-d-arabinofuranosyl uracil,2,2;-cyclouridine,2,2'-anhydro-1-beta-d-arabinofuranosyl uracil PubChem CID: 806138 IUPAC Name: (2R,3R,3aS,9aR)-3-hydroxy-2-(hydroxymethyl)-2,3,3a,9a-tetrahydrofuro[1,2][1,3]oxazolo[3,4-a]pyrimidin-6-one SMILES: C1=CN2C3C(C(C(O3)CO)O)OC2=NC1=O
| PubChem CID | 806138 |
|---|---|
| CAS | 3736-77-4 |
| Molecular Weight (g/mol) | 226.188 |
| MDL Number | MFCD00004945 |
| SMILES | C1=CN2C3C(C(C(O3)CO)O)OC2=NC1=O |
| Synonym | cyclouridine,2,2'-cyclouridine,o2,2'-cyclouridine,2,2'-anhydro-1 b-d-arabinofuranosyl uracil,2,2'-anhydrouridine,2,2'-anhydro-1 beta-d-arabinofuranosyl uracil,2,2'-o-cyclouridine,2,2-anhydro-1 b-d-arabinofuranosyl uracil,2,2;-cyclouridine,2,2'-anhydro-1-beta-d-arabinofuranosyl uracil |
| IUPAC Name | (2R,3R,3aS,9aR)-3-hydroxy-2-(hydroxymethyl)-2,3,3a,9a-tetrahydrofuro[1,2][1,3]oxazolo[3,4-a]pyrimidin-6-one |
| InChI Key | UUGITDASWNOAGG-CCXZUQQUSA-N |
| Molecular Formula | C9H10N2O5 |
Toluene-d8, 99.6%(Isotopic), Thermo Scientific Chemicals
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 MDL Number: MFCD00044638 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene SMILES: CC1=CC=CC=C1
| PubChem CID | 74861 |
|---|---|
| CAS | 2037-26-5 |
| Molecular Weight (g/mol) | 100.19 |
| MDL Number | MFCD00044638 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |
Dichloromethane, 99.8+%, for analysis, stabilized with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
trans-4-(4-Chlorophenyl)cyclohexane-1-carboxylic acid, 98%
CAS: 49708-81-8 Molecular Formula: C13H15ClO2 Molecular Weight (g/mol): 238.711 MDL Number: MFCD06797626 InChI Key: NXXDIEYTMQYWJU-UHFFFAOYSA-N Synonym: 4-4-chlorophenyl cyclohexanecarboxylic acid,trans-4-4-chlorophenyl cyclohexanecarboxylic acid,4-4-chlorophenyl cyclohexane-1-carboxylic acid,e-4-4-chlorophenyl cyclohexanecarboxylic acid,4-4'-chlorophenyl cyclohexancarboxylic acid,cis-4-4-chlorophenyl cyclohexanecarboxylic acid,atovaquone related compound 1,cyclohexanecarboxylic acid, 4-4-chlorophenyl-, trans,1r,4r-4-4-chlorophenyl cyclohexane-1-carboxylic acid,cyclohexanecarboxylic acid, 4-4-chlorophenyl PubChem CID: 2735792 IUPAC Name: 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid SMILES: C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O
| PubChem CID | 2735792 |
|---|---|
| CAS | 49708-81-8 |
| Molecular Weight (g/mol) | 238.711 |
| MDL Number | MFCD06797626 |
| SMILES | C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O |
| Synonym | 4-4-chlorophenyl cyclohexanecarboxylic acid,trans-4-4-chlorophenyl cyclohexanecarboxylic acid,4-4-chlorophenyl cyclohexane-1-carboxylic acid,e-4-4-chlorophenyl cyclohexanecarboxylic acid,4-4'-chlorophenyl cyclohexancarboxylic acid,cis-4-4-chlorophenyl cyclohexanecarboxylic acid,atovaquone related compound 1,cyclohexanecarboxylic acid, 4-4-chlorophenyl-, trans,1r,4r-4-4-chlorophenyl cyclohexane-1-carboxylic acid,cyclohexanecarboxylic acid, 4-4-chlorophenyl |
| IUPAC Name | 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChI Key | NXXDIEYTMQYWJU-UHFFFAOYSA-N |
| Molecular Formula | C13H15ClO2 |
Ethyl Alcohol, 95% Denatured, 86.0 to 89.0%, MilliporeSigma™
CAS: 64-17-5 Molecular Formula: C2H6O Molecular Weight (g/mol): 46.069 InChI Key: LFQSCWFLJHTTHZ-UHFFFAOYSA-N Synonym: ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol PubChem CID: 702 ChEBI: CHEBI:16236 IUPAC Name: ethanol SMILES: CCO
| PubChem CID | 702 |
|---|---|
| CAS | 64-17-5 |
| Molecular Weight (g/mol) | 46.069 |
| ChEBI | CHEBI:16236 |
| SMILES | CCO |
| Synonym | ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol |
| IUPAC Name | ethanol |
| InChI Key | LFQSCWFLJHTTHZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6O |
Methanol, 99.8% min., ACS, MilliporeSigma™
CAS: 67-56-1 Molecular Formula: CH4O Molecular Weight (g/mol): 32.04 MDL Number: MFCD00004595 InChI Key: OKKJLVBELUTLKV-UHFFFAOYSA-N Synonym: methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit PubChem CID: 887 ChEBI: CHEBI:17790 IUPAC Name: methanol SMILES: CO
| PubChem CID | 887 |
|---|---|
| CAS | 67-56-1 |
| Molecular Weight (g/mol) | 32.04 |
| ChEBI | CHEBI:17790 |
| MDL Number | MFCD00004595 |
| SMILES | CO |
| Synonym | methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit |
| IUPAC Name | methanol |
| InChI Key | OKKJLVBELUTLKV-UHFFFAOYSA-N |
| Molecular Formula | CH4O |
Dichloromethane-d{2}, 99.9% (Isotopic)
CAS: 1665-00-5 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 86.939 MDL Number: MFCD00000882 InChI Key: YMWUJEATGCHHMB-DICFDUPASA-N Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d PubChem CID: 160586 IUPAC Name: dichloro(dideuterio)methane SMILES: C(Cl)Cl
| PubChem CID | 160586 |
|---|---|
| CAS | 1665-00-5 |
| Molecular Weight (g/mol) | 86.939 |
| MDL Number | MFCD00000882 |
| SMILES | C(Cl)Cl |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
| IUPAC Name | dichloro(dideuterio)methane |
| InChI Key | YMWUJEATGCHHMB-DICFDUPASA-N |
| Molecular Formula | CH2Cl2 |
Methyl iso-Butyl Ketone, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 108-10-1 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.161 InChI Key: NTIZESTWPVYFNL-UHFFFAOYSA-N Synonym: 4-methyl-2-pentanone,methyl isobutyl ketone,isopropylacetone,isobutyl methyl ketone,hexone,mibk,2-pentanone, 4-methyl,2-methyl-4-pentanone,4-methyl-2-oxopentane,methylisobutylketon PubChem CID: 7909 ChEBI: CHEBI:82344 IUPAC Name: 4-methylpentan-2-one SMILES: CC(C)CC(=O)C
| PubChem CID | 7909 |
|---|---|
| CAS | 108-10-1 |
| Molecular Weight (g/mol) | 100.161 |
| ChEBI | CHEBI:82344 |
| SMILES | CC(C)CC(=O)C |
| Synonym | 4-methyl-2-pentanone,methyl isobutyl ketone,isopropylacetone,isobutyl methyl ketone,hexone,mibk,2-pentanone, 4-methyl,2-methyl-4-pentanone,4-methyl-2-oxopentane,methylisobutylketon |
| IUPAC Name | 4-methylpentan-2-one |
| InChI Key | NTIZESTWPVYFNL-UHFFFAOYSA-N |
| Molecular Formula | C6H12O |