Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Hexanes, mixed isomers, Environmental Grade
CAS: 92112-69-1 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD00009520 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 92112-69-1 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD00009520 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
2,2,2-Trifluoroethanol-d{2}, 98% (Isotopic), Thermo Scientific Chemicals
CAS: 132248-58-9 Molecular Formula: C2H3F3O Molecular Weight (g/mol): 102.052 MDL Number: MFCD00082609 InChI Key: RHQDFWAXVIIEBN-DICFDUPASA-N Synonym: 2,2,2-trifluoroethanol-1,1-d2,trifluoroethanol-d2,2,2,2-trifluoroethanol-d2,trifluoro 2 h? ethanol,2,2,2-trifluoroethyl-1,1-d2 alcohol,2 2 2-trifluoroethyl-1 1-d2 alcohol,2,2,2-trifluoroethanol-1,1-d2 99.5 atom % d,2,2,2-trifluoroethanol-1,1-d2, 99.5 atom % d,2 2 2-trifluoroethyl-1 1-d2 alcohol 99.5 PubChem CID: 12255976 IUPAC Name: 1,1-dideuterio-2,2,2-trifluoroethanol SMILES: C(C(F)(F)F)O
| PubChem CID | 12255976 |
|---|---|
| CAS | 132248-58-9 |
| Molecular Weight (g/mol) | 102.052 |
| MDL Number | MFCD00082609 |
| SMILES | C(C(F)(F)F)O |
| Synonym | 2,2,2-trifluoroethanol-1,1-d2,trifluoroethanol-d2,2,2,2-trifluoroethanol-d2,trifluoro 2 h? ethanol,2,2,2-trifluoroethyl-1,1-d2 alcohol,2 2 2-trifluoroethyl-1 1-d2 alcohol,2,2,2-trifluoroethanol-1,1-d2 99.5 atom % d,2,2,2-trifluoroethanol-1,1-d2, 99.5 atom % d,2 2 2-trifluoroethyl-1 1-d2 alcohol 99.5 |
| IUPAC Name | 1,1-dideuterio-2,2,2-trifluoroethanol |
| InChI Key | RHQDFWAXVIIEBN-DICFDUPASA-N |
| Molecular Formula | C2H3F3O |
| Molecular Weight (g/mol) | 32.04 |
|---|
(+/-)-Tetrahydrofurfurylamine, 97%
CAS: 4795-29-3 Molecular Formula: C5H11NO Molecular Weight (g/mol): 101.15 MDL Number: MFCD00005373 InChI Key: YNOGYQAEJGADFJ-UHFFFAOYNA-N Synonym: tetrahydrofurfurylamine,2-aminomethyltetrahydrofuran,2-tetrahydrofurfurylamine,tetrahydrofuran-2-yl methanamine,2-furanmethanamine, tetrahydro,furfurylamine, tetrahydro,2-aminomethyl tetrahydrofuran,usaf q-2,tetrahydro-2-furanmethanamine,oxolan-2-yl-methanamine PubChem CID: 253298 IUPAC Name: oxolan-2-ylmethanamine SMILES: NCC1CCCO1
| PubChem CID | 253298 |
|---|---|
| CAS | 4795-29-3 |
| Molecular Weight (g/mol) | 101.15 |
| MDL Number | MFCD00005373 |
| SMILES | NCC1CCCO1 |
| Synonym | tetrahydrofurfurylamine,2-aminomethyltetrahydrofuran,2-tetrahydrofurfurylamine,tetrahydrofuran-2-yl methanamine,2-furanmethanamine, tetrahydro,furfurylamine, tetrahydro,2-aminomethyl tetrahydrofuran,usaf q-2,tetrahydro-2-furanmethanamine,oxolan-2-yl-methanamine |
| IUPAC Name | oxolan-2-ylmethanamine |
| InChI Key | YNOGYQAEJGADFJ-UHFFFAOYNA-N |
| Molecular Formula | C5H11NO |
Dimethyl sulfoxide - D6, deuteration deg. min. 99.96% for NMR spectroscopy, MagniSolv™, MilliporeSigma™
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | (²H₃)methanesulfinyl(²H₃)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
Cyclohexane-d{12}, 99.5%(Isotopic)
CAS: 1735-17-7 Molecular Formula: C6H12 Molecular Weight (g/mol): 96.24 MDL Number: MFCD00044212 InChI Key: XDTMQSROBMDMFD-LBTWDOQPSA-N Synonym: cyclohexane-d12,2h12 cyclohexane,cyclohexane d,cyclohexane, d12,2 h?? cyclohexane,cyclohexane-d12, ≥99.6 atom % d,cyclohexane #,cyclohexane-d12, 99.5 atom % d PubChem CID: 123129 SMILES: [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H]
| PubChem CID | 123129 |
|---|---|
| CAS | 1735-17-7 |
| Molecular Weight (g/mol) | 96.24 |
| MDL Number | MFCD00044212 |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| Synonym | cyclohexane-d12,2h12 cyclohexane,cyclohexane d,cyclohexane, d12,2 h?? cyclohexane,cyclohexane-d12, ≥99.6 atom % d,cyclohexane #,cyclohexane-d12, 99.5 atom % d |
| InChI Key | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| Molecular Formula | C6H12 |
4-Chloromandelic acid, 98%
CAS: 492-86-4 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.591 MDL Number: MFCD00042724 InChI Key: BWSFWXSSALIZAU-UHFFFAOYSA-N Synonym: 4-chloromandelic acid,2-4-chlorophenyl-2-hydroxyacetic acid,p-chloromandelic acid,p-chloro mandelic acid,4-chloro-dl-mandelic acid,4-chloromandelic acid, pract.,benzeneacetic acid, 4-chloro-.alpha.-hydroxy,dl-4-chloromandelic acid,mandelic acid, p-chloro,4-chlorophenyl hydroxy acetic acid PubChem CID: 10299 IUPAC Name: 2-(4-chlorophenyl)-2-hydroxyacetic acid SMILES: C1=CC(=CC=C1C(C(=O)O)O)Cl
| PubChem CID | 10299 |
|---|---|
| CAS | 492-86-4 |
| Molecular Weight (g/mol) | 186.591 |
| MDL Number | MFCD00042724 |
| SMILES | C1=CC(=CC=C1C(C(=O)O)O)Cl |
| Synonym | 4-chloromandelic acid,2-4-chlorophenyl-2-hydroxyacetic acid,p-chloromandelic acid,p-chloro mandelic acid,4-chloro-dl-mandelic acid,4-chloromandelic acid, pract.,benzeneacetic acid, 4-chloro-.alpha.-hydroxy,dl-4-chloromandelic acid,mandelic acid, p-chloro,4-chlorophenyl hydroxy acetic acid |
| IUPAC Name | 2-(4-chlorophenyl)-2-hydroxyacetic acid |
| InChI Key | BWSFWXSSALIZAU-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |
3-Chloro-2,6-dimethylaniline, 99%
CAS: 26829-77-6 Molecular Formula: C8H10ClN Molecular Weight (g/mol): 155.625 MDL Number: MFCD02683086 InChI Key: FGMXFOTYCHZCLA-UHFFFAOYSA-N Synonym: 3-chloro-2,6-dimethyl-phenylamine,acmc-20an7h,3-chloro-2,6-xylidine,3-chloro-2,6-dimethylphenylamine,3-chloranyl-2,6-dimethyl-aniline,benzenamine,3-chloro-2,6-dimethyl PubChem CID: 7023016 IUPAC Name: 3-chloro-2,6-dimethylaniline SMILES: CC1=C(C(=C(C=C1)Cl)C)N
| PubChem CID | 7023016 |
|---|---|
| CAS | 26829-77-6 |
| Molecular Weight (g/mol) | 155.625 |
| MDL Number | MFCD02683086 |
| SMILES | CC1=C(C(=C(C=C1)Cl)C)N |
| Synonym | 3-chloro-2,6-dimethyl-phenylamine,acmc-20an7h,3-chloro-2,6-xylidine,3-chloro-2,6-dimethylphenylamine,3-chloranyl-2,6-dimethyl-aniline,benzenamine,3-chloro-2,6-dimethyl |
| IUPAC Name | 3-chloro-2,6-dimethylaniline |
| InChI Key | FGMXFOTYCHZCLA-UHFFFAOYSA-N |
| Molecular Formula | C8H10ClN |
2,4-Dimethyl-6-nitrophenol, 98%
CAS: 14452-34-7 Molecular Formula: C8H9NO3 Molecular Weight (g/mol): 167.16 MDL Number: MFCD00191633 InChI Key: KJRCHILWKQLEBC-UHFFFAOYSA-N PubChem CID: 84450 IUPAC Name: 2,4-dimethyl-6-nitrophenol SMILES: CC1=CC(C)=C(O)C(=C1)[N+]([O-])=O
| PubChem CID | 84450 |
|---|---|
| CAS | 14452-34-7 |
| Molecular Weight (g/mol) | 167.16 |
| MDL Number | MFCD00191633 |
| SMILES | CC1=CC(C)=C(O)C(=C1)[N+]([O-])=O |
| IUPAC Name | 2,4-dimethyl-6-nitrophenol |
| InChI Key | KJRCHILWKQLEBC-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO3 |
Pyridine-d{5}, 99.5% (Isotopic)
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
2-Chlorobenzonitrile, 98%
CAS: 873-32-5 Molecular Formula: C7H4ClN Molecular Weight (g/mol): 137.566 MDL Number: MFCD00001779 InChI Key: NHWQMJMIYICNBP-UHFFFAOYSA-N Synonym: benzonitrile, 2-chloro,o-chlorobenzonitrile,o-chlorocyanobenzene,o-cyanochlorobenzene,benzonitrile, o-chloro,o-chlorbenzonitril,chlorobenzonitrile,2-chloro-benzonitrile,nitril kyseliny o-chlorbenzoove,o-chlorbenzonitril czech PubChem CID: 13391 IUPAC Name: 2-chlorobenzonitrile SMILES: C1=CC=C(C(=C1)C#N)Cl
| PubChem CID | 13391 |
|---|---|
| CAS | 873-32-5 |
| Molecular Weight (g/mol) | 137.566 |
| MDL Number | MFCD00001779 |
| SMILES | C1=CC=C(C(=C1)C#N)Cl |
| Synonym | benzonitrile, 2-chloro,o-chlorobenzonitrile,o-chlorocyanobenzene,o-cyanochlorobenzene,benzonitrile, o-chloro,o-chlorbenzonitril,chlorobenzonitrile,2-chloro-benzonitrile,nitril kyseliny o-chlorbenzoove,o-chlorbenzonitril czech |
| IUPAC Name | 2-chlorobenzonitrile |
| InChI Key | NHWQMJMIYICNBP-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClN |
Acetone - D6, deuteration degree min. 99.9% for NMR spectroscopy MagniSolv™, MilliporeSigma™
CAS: 666-52-4 Molecular Formula: C3H6O Molecular Weight (g/mol): 64.117 InChI Key: CSCPPACGZOOCGX-WFGJKAKNSA-N Synonym: acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone PubChem CID: 522220 ChEBI: CHEBI:78217 IUPAC Name: 1,1,1,3,3,3-hexadeuteriopropan-2-one SMILES: CC(=O)C
| PubChem CID | 522220 |
|---|---|
| CAS | 666-52-4 |
| Molecular Weight (g/mol) | 64.117 |
| ChEBI | CHEBI:78217 |
| SMILES | CC(=O)C |
| Synonym | acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone |
| IUPAC Name | 1,1,1,3,3,3-hexadeuteriopropan-2-one |
| InChI Key | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| Molecular Formula | C3H6O |
4-Chlorobenzonitrile, 99%
CAS: 623-03-0 Molecular Formula: C7H4ClN Molecular Weight (g/mol): 137.57 MDL Number: MFCD00001813 InChI Key: GJNGXPDXRVXSEH-UHFFFAOYSA-N Synonym: p-chlorobenzonitrile,benzonitrile, 4-chloro,p-cyanochlorobenzene,benzonitrile, p-chloro,4-cyanochlorobenzene,nitril kyseliny p-chlorbenzoove,p-chlorbenzonitrile,unii-4z0hgp3a8a,pcbn,4-chloro benzonitrile PubChem CID: 12163 IUPAC Name: 4-chlorobenzonitrile SMILES: ClC1=CC=C(C=C1)C#N
| PubChem CID | 12163 |
|---|---|
| CAS | 623-03-0 |
| Molecular Weight (g/mol) | 137.57 |
| MDL Number | MFCD00001813 |
| SMILES | ClC1=CC=C(C=C1)C#N |
| Synonym | p-chlorobenzonitrile,benzonitrile, 4-chloro,p-cyanochlorobenzene,benzonitrile, p-chloro,4-cyanochlorobenzene,nitril kyseliny p-chlorbenzoove,p-chlorbenzonitrile,unii-4z0hgp3a8a,pcbn,4-chloro benzonitrile |
| IUPAC Name | 4-chlorobenzonitrile |
| InChI Key | GJNGXPDXRVXSEH-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClN |
2-Chlorophenylacetic acid, 98%
CAS: 2444-36-2 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.592 MDL Number: MFCD00004317 InChI Key: IUJAAIZKRJJZGQ-UHFFFAOYSA-N Synonym: 2-chlorophenylacetic acid,o-chlorophenylacetic acid,2-2-chlorophenyl acetic acid,2-chlorophenyl acetic acid,2-chlorophenylaceticacid,benzeneacetic acid, 2-chloro,o-chlorophenyl acetic acid,acetic acid, o-chlorophenyl,2-chloro-benzeneacetic acid PubChem CID: 17124 IUPAC Name: 2-(2-chlorophenyl)acetic acid SMILES: C1=CC=C(C(=C1)CC(=O)O)Cl
| PubChem CID | 17124 |
|---|---|
| CAS | 2444-36-2 |
| Molecular Weight (g/mol) | 170.592 |
| MDL Number | MFCD00004317 |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)Cl |
| Synonym | 2-chlorophenylacetic acid,o-chlorophenylacetic acid,2-2-chlorophenyl acetic acid,2-chlorophenyl acetic acid,2-chlorophenylaceticacid,benzeneacetic acid, 2-chloro,o-chlorophenyl acetic acid,acetic acid, o-chlorophenyl,2-chloro-benzeneacetic acid |
| IUPAC Name | 2-(2-chlorophenyl)acetic acid |
| InChI Key | IUJAAIZKRJJZGQ-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
Toluene-d{8}, 100% (Isotopic), Thermo Scientific Chemicals
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 MDL Number: MFCD00044638 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene SMILES: CC1=CC=CC=C1
| PubChem CID | 74861 |
|---|---|
| CAS | 2037-26-5 |
| Molecular Weight (g/mol) | 100.19 |
| MDL Number | MFCD00044638 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |