Organic acids and derivatives
Filtered Search Results
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic acid monohydrate, 98%
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 IUPAC Name: 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| IUPAC Name | 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl isothiocyanate, ≥98.0% (HPLC), MilliporeSigma™ Supelco™
MDL Number: MFCD00043085 Synonym: GITC
| MDL Number | MFCD00043085 |
|---|---|
| Synonym | GITC |
Biphenyl-3,3',5,5'-tetracarboxylic acid, Thermo Scientific Chemicals
CAS: 4371-28-2 Molecular Formula: C16H10O8 Molecular Weight (g/mol): 330.25 MDL Number: MFCD16621475 InChI Key: QURGMSIQFRADOZ-UHFFFAOYSA-N IUPAC Name: [1,1'-biphenyl]-3,3',5,5'-tetracarboxylic acid SMILES: OC(=O)C1=CC(=CC(=C1)C(O)=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O
| CAS | 4371-28-2 |
|---|---|
| Molecular Weight (g/mol) | 330.25 |
| MDL Number | MFCD16621475 |
| SMILES | OC(=O)C1=CC(=CC(=C1)C(O)=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O |
| IUPAC Name | [1,1'-biphenyl]-3,3',5,5'-tetracarboxylic acid |
| InChI Key | QURGMSIQFRADOZ-UHFFFAOYSA-N |
| Molecular Formula | C16H10O8 |
Titriplex™ II, Ethylenedinitrilotetraacetic acid, ACS, MilliporeSigma™
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate, 99.5%, for molecular biology, DNAse, RNAse and Protease free
CAS: 13235-36-4 Molecular Formula: C10H20N2Na4O12 Molecular Weight (g/mol): 452.23 MDL Number: MFCD00150027 InChI Key: XFLNVMPCPRLYBE-UHFFFAOYSA-J Synonym: tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 PubChem CID: 23287279 IUPAC Name: tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrahydrate SMILES: O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 23287279 |
|---|---|
| CAS | 13235-36-4 |
| Molecular Weight (g/mol) | 452.23 |
| MDL Number | MFCD00150027 |
| SMILES | O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 |
| IUPAC Name | tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrahydrate |
| InChI Key | XFLNVMPCPRLYBE-UHFFFAOYSA-J |
| Molecular Formula | C10H20N2Na4O12 |
1-Thio-beta-D-glucose tetraacetate, 98+%
CAS: 19879-84-6 Molecular Formula: C14H20O9S Molecular Weight (g/mol): 364.37 MDL Number: MFCD00063271 InChI Key: SFOZKJGZNOBSHF-UHFFFAOYNA-N Synonym: 1-thio-beta-d-glucose tetraacetate,2r,3r,4s,5r,6s-2-acetoxymethyl-6-mercaptotetrahydro-2h-pyran-3,4,5-triyl triacetate,1-thio-b-d-glucose tetraacetate,1-thio-beta-d-glucose 2,3,4,6-tetraacetate,2,3,4,6-tetra-o-acetyl-1-thio-beta-d-glucopyranose,1-thio-,a-d-glucose tetraacetate,2r,3r,4s,5r,6s-3,4,5-tris acetyloxy-6-sulfanyloxan-2-yl methyl acetate,2,3,4,6-tetra-o-acetyl-1-thio-,a-d-glucopyranose,beta-d-thioglucose tetraacetate,1-thio-ss-d-glucose tetraacetate PubChem CID: 88293 IUPAC Name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfanyloxan-2-yl]methyl acetate SMILES: CC(=O)OCC1OC(S)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
| PubChem CID | 88293 |
|---|---|
| CAS | 19879-84-6 |
| Molecular Weight (g/mol) | 364.37 |
| MDL Number | MFCD00063271 |
| SMILES | CC(=O)OCC1OC(S)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Synonym | 1-thio-beta-d-glucose tetraacetate,2r,3r,4s,5r,6s-2-acetoxymethyl-6-mercaptotetrahydro-2h-pyran-3,4,5-triyl triacetate,1-thio-b-d-glucose tetraacetate,1-thio-beta-d-glucose 2,3,4,6-tetraacetate,2,3,4,6-tetra-o-acetyl-1-thio-beta-d-glucopyranose,1-thio-,a-d-glucose tetraacetate,2r,3r,4s,5r,6s-3,4,5-tris acetyloxy-6-sulfanyloxan-2-yl methyl acetate,2,3,4,6-tetra-o-acetyl-1-thio-,a-d-glucopyranose,beta-d-thioglucose tetraacetate,1-thio-ss-d-glucose tetraacetate |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfanyloxan-2-yl]methyl acetate |
| InChI Key | SFOZKJGZNOBSHF-UHFFFAOYNA-N |
| Molecular Formula | C14H20O9S |
alpha,alpha-Difluorophenylacetic acid, 97%
CAS: 360-03-2 Molecular Formula: C8H6F2O2 Molecular Weight (g/mol): 172.131 MDL Number: MFCD00498146 InChI Key: PFKSLFZFBCIJOI-UHFFFAOYSA-N PubChem CID: 726153 IUPAC Name: 2,2-difluoro-2-phenylacetic acid SMILES: C1=CC=C(C=C1)C(C(=O)O)(F)F
| PubChem CID | 726153 |
|---|---|
| CAS | 360-03-2 |
| Molecular Weight (g/mol) | 172.131 |
| MDL Number | MFCD00498146 |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)(F)F |
| IUPAC Name | 2,2-difluoro-2-phenylacetic acid |
| InChI Key | PFKSLFZFBCIJOI-UHFFFAOYSA-N |
| Molecular Formula | C8H6F2O2 |
2,2,2-Trifluoroethyl trifluoroacetate, 97+%, Thermo Scientific Chemicals
CAS: 407-38-5 Molecular Formula: C4H2F6O2 Molecular Weight (g/mol): 196.05 MDL Number: MFCD00000418 InChI Key: ZKUJOCJJXCPCFS-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl trifluoroacetate,acetic acid, trifluoro-, 2,2,2-trifluoroethyl ester,trifluoroacetic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyltrifluoroacetate,pubchem12623,acmc-1ake7,cf3co2ch2cf3,cf3c o och2cf3,ksc496e0r,trifluoroethyl trifluoroacetate PubChem CID: 67888 IUPAC Name: 2,2,2-trifluoroethyl 2,2,2-trifluoroacetate SMILES: FC(F)(F)COC(=O)C(F)(F)F
| PubChem CID | 67888 |
|---|---|
| CAS | 407-38-5 |
| Molecular Weight (g/mol) | 196.05 |
| MDL Number | MFCD00000418 |
| SMILES | FC(F)(F)COC(=O)C(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl trifluoroacetate,acetic acid, trifluoro-, 2,2,2-trifluoroethyl ester,trifluoroacetic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyltrifluoroacetate,pubchem12623,acmc-1ake7,cf3co2ch2cf3,cf3c o och2cf3,ksc496e0r,trifluoroethyl trifluoroacetate |
| IUPAC Name | 2,2,2-trifluoroethyl 2,2,2-trifluoroacetate |
| InChI Key | ZKUJOCJJXCPCFS-UHFFFAOYSA-N |
| Molecular Formula | C4H2F6O2 |
Ethyl bromoacetate, 98%
CAS: 105-36-2 MDL Number: MFCD00000191 InChI Key: PQJJJMRNHATNKG-UHFFFAOYSA-N Synonym: ethyl bromoacetate,antol,ethyl bromacetate,bromoacetic acid ethyl ester,ethyl monobromoacetate,acetic acid, bromo-, ethyl ester,ethoxycarbonylmethyl bromide,bromoacetic acid, ethyl ester,ethyl alpha-bromoacetate,ethyl bromo acetate PubChem CID: 7748 IUPAC Name: ethyl 2-bromoacetate SMILES: CCOC(=O)CBr
| PubChem CID | 7748 |
|---|---|
| CAS | 105-36-2 |
| MDL Number | MFCD00000191 |
| SMILES | CCOC(=O)CBr |
| Synonym | ethyl bromoacetate,antol,ethyl bromacetate,bromoacetic acid ethyl ester,ethyl monobromoacetate,acetic acid, bromo-, ethyl ester,ethoxycarbonylmethyl bromide,bromoacetic acid, ethyl ester,ethyl alpha-bromoacetate,ethyl bromo acetate |
| IUPAC Name | ethyl 2-bromoacetate |
| InChI Key | PQJJJMRNHATNKG-UHFFFAOYSA-N |
Benzyl chloroacetate, 98%
CAS: 140-18-1 Molecular Formula: C9H9ClO2 Molecular Weight (g/mol): 184.62 MDL Number: MFCD00157062 InChI Key: SOGXBRHOWDEKQB-UHFFFAOYSA-N Synonym: benzyl chloroacetate,benzyl monochloracetate,acetic acid, chloro-, phenylmethyl ester,chloroacetic acid, benzyl ester,monochloroacetate,chloroacetic acid benzyl ester,benzyl-alpha-chloroacetate,phenylmethyl chloroacetate,acetic acid, chloro-, benzyl ester,phenylmethyl 2-chloroacetate PubChem CID: 8786 IUPAC Name: benzyl 2-chloroacetate SMILES: C1=CC=C(C=C1)COC(=O)CCl
| PubChem CID | 8786 |
|---|---|
| CAS | 140-18-1 |
| Molecular Weight (g/mol) | 184.62 |
| MDL Number | MFCD00157062 |
| SMILES | C1=CC=C(C=C1)COC(=O)CCl |
| Synonym | benzyl chloroacetate,benzyl monochloracetate,acetic acid, chloro-, phenylmethyl ester,chloroacetic acid, benzyl ester,monochloroacetate,chloroacetic acid benzyl ester,benzyl-alpha-chloroacetate,phenylmethyl chloroacetate,acetic acid, chloro-, benzyl ester,phenylmethyl 2-chloroacetate |
| IUPAC Name | benzyl 2-chloroacetate |
| InChI Key | SOGXBRHOWDEKQB-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO2 |
tert-Butyl bromoacetate, 99%
CAS: 5292-43-3 Molecular Formula: C6H11BrO2 Molecular Weight (g/mol): 195.06 MDL Number: MFCD00000188 InChI Key: BNWCETAHAJSBFG-UHFFFAOYSA-N Synonym: tert-butyl bromoacetate,t-butyl bromoacetate,acetic acid, bromo-, 1,1-dimethylethyl ester,bromoacetic acid tert-butyl ester,tert-butylbromoacetate,acetic acid, bromo-, tert-butyl ester,brch2c o oc ch3 3,acetic acid, 2-bromo-, 1,1-dimethylethyl ester,bromo-acetic acid tert-butyl ester,tert-butylbromacetat PubChem CID: 79177 IUPAC Name: tert-butyl 2-bromoacetate SMILES: CC(C)(C)OC(=O)CBr
| PubChem CID | 79177 |
|---|---|
| CAS | 5292-43-3 |
| Molecular Weight (g/mol) | 195.06 |
| MDL Number | MFCD00000188 |
| SMILES | CC(C)(C)OC(=O)CBr |
| Synonym | tert-butyl bromoacetate,t-butyl bromoacetate,acetic acid, bromo-, 1,1-dimethylethyl ester,bromoacetic acid tert-butyl ester,tert-butylbromoacetate,acetic acid, bromo-, tert-butyl ester,brch2c o oc ch3 3,acetic acid, 2-bromo-, 1,1-dimethylethyl ester,bromo-acetic acid tert-butyl ester,tert-butylbromacetat |
| IUPAC Name | tert-butyl 2-bromoacetate |
| InChI Key | BNWCETAHAJSBFG-UHFFFAOYSA-N |
| Molecular Formula | C6H11BrO2 |
(S)-(-)-2-Chloropropionic acid, 98%
CAS: 29617-66-1 Molecular Formula: C3H4ClO2 Molecular Weight (g/mol): 107.51 MDL Number: MFCD00064205 InChI Key: GAWAYYRQGQZKCR-REOHCLBHSA-M Synonym: s---2-chloropropionic acid,s-2-chloropropanoic acid,s-2-chloropropionic acid,2s-2-chloropropanoic acid,l-2-chloropropanoic acid,l-2-chloropropionic acid,alpha-l-chloropropionic acid,unii-pcc7j322cm,2s-chloropropanoic acid,2 s-chloropropionic acid PubChem CID: 107915 ChEBI: CHEBI:73956 IUPAC Name: (2S)-2-chloropropanoic acid SMILES: C[C@H](Cl)C([O-])=O
| PubChem CID | 107915 |
|---|---|
| CAS | 29617-66-1 |
| Molecular Weight (g/mol) | 107.51 |
| ChEBI | CHEBI:73956 |
| MDL Number | MFCD00064205 |
| SMILES | C[C@H](Cl)C([O-])=O |
| Synonym | s---2-chloropropionic acid,s-2-chloropropanoic acid,s-2-chloropropionic acid,2s-2-chloropropanoic acid,l-2-chloropropanoic acid,l-2-chloropropionic acid,alpha-l-chloropropionic acid,unii-pcc7j322cm,2s-chloropropanoic acid,2 s-chloropropionic acid |
| IUPAC Name | (2S)-2-chloropropanoic acid |
| InChI Key | GAWAYYRQGQZKCR-REOHCLBHSA-M |
| Molecular Formula | C3H4ClO2 |
Triprolidine Hydrochloride, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
Allyl chloroacetate, 98%
CAS: 2916-14-5 Molecular Formula: C5H7ClO2 Molecular Weight (g/mol): 134.559 MDL Number: MFCD00058936 InChI Key: VMBJJCDVORDOCF-UHFFFAOYSA-N Synonym: allyl chloroacetate,allyl 2-chloroacetate,chloroacetic acid allyl ester,acetic acid, chloro-, 2-propenyl ester,prop-2-en-1-yl 2-chloroacetate,acetic acid, chloro-, allyl ester,allyl monochloroacetate,acmc-1cffa,chloroacetic acid,2-propenyl ester PubChem CID: 76206 IUPAC Name: prop-2-enyl 2-chloroacetate SMILES: C=CCOC(=O)CCl
| PubChem CID | 76206 |
|---|---|
| CAS | 2916-14-5 |
| Molecular Weight (g/mol) | 134.559 |
| MDL Number | MFCD00058936 |
| SMILES | C=CCOC(=O)CCl |
| Synonym | allyl chloroacetate,allyl 2-chloroacetate,chloroacetic acid allyl ester,acetic acid, chloro-, 2-propenyl ester,prop-2-en-1-yl 2-chloroacetate,acetic acid, chloro-, allyl ester,allyl monochloroacetate,acmc-1cffa,chloroacetic acid,2-propenyl ester |
| IUPAC Name | prop-2-enyl 2-chloroacetate |
| InChI Key | VMBJJCDVORDOCF-UHFFFAOYSA-N |
| Molecular Formula | C5H7ClO2 |
Isopropyl trifluoroacetate, 97%
CAS: 400-38-4 Molecular Formula: C5H7F3O2 Molecular Weight (g/mol): 156.10 MDL Number: MFCD00013566 InChI Key: ASAXRKSDVDALDT-UHFFFAOYSA-N Synonym: isopropyl trifluoroacetate,isopropyltrifluoroacetate,isopropyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, 1-methylethyl ester,iso-propyl trifluoroacetate,trifluoroacetic acid isopropyl ester,pubchem12590,acmc-1ctsh,methylethyl 2,2,2-trifluoroacetate PubChem CID: 78998 IUPAC Name: propan-2-yl 2,2,2-trifluoroacetate SMILES: CC(C)OC(=O)C(F)(F)F
| PubChem CID | 78998 |
|---|---|
| CAS | 400-38-4 |
| Molecular Weight (g/mol) | 156.10 |
| MDL Number | MFCD00013566 |
| SMILES | CC(C)OC(=O)C(F)(F)F |
| Synonym | isopropyl trifluoroacetate,isopropyltrifluoroacetate,isopropyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, 1-methylethyl ester,iso-propyl trifluoroacetate,trifluoroacetic acid isopropyl ester,pubchem12590,acmc-1ctsh,methylethyl 2,2,2-trifluoroacetate |
| IUPAC Name | propan-2-yl 2,2,2-trifluoroacetate |
| InChI Key | ASAXRKSDVDALDT-UHFFFAOYSA-N |
| Molecular Formula | C5H7F3O2 |